Project import
diff --git a/Makefile b/Makefile
new file mode 100644
index 0000000..1242917
--- /dev/null
+++ b/Makefile
@@ -0,0 +1,124 @@
+#
+#    Copyright (c) 2012 Nest Labs, Inc.
+#    All rights reserved.
+#
+#    This document is the property of Nest. It is considered
+#    confidential and proprietary information.
+#
+#    This document may not be reproduced or transmitted in any form,
+#    in whole or in part, without the express written permission of
+#    Nest.
+#
+#    Description:
+#      This file is the make file for popt, a library for parsing
+#      command-line arguments.
+#
+
+BuildConfigSpecialized	:= No
+BuildProductSpecialized	:= No
+
+include pre.mak
+
+PackageName		:= popt
+
+PackageExtension	:= tar.gz
+PackageSeparator	:= -
+
+PackagePatchArgs	:= -p1
+
+PackageArchive		:= $(PackageName).$(PackageExtension)
+PackageSourceDir	:= $(PackageName)$(PackageSeparator)$(PackageVersion)
+
+PackageBuildMakefile	= $(call GenerateBuildPaths,Makefile)
+
+LicenseSourceFile	:= $(PackageSourceDir)/COPYING
+
+CleanPaths		+= $(PackageLicenseFile)
+
+all: $(PackageDefaultGoal)
+
+# Generate the package license contents.
+
+$(LicenseSourceFile): source
+
+$(PackageLicenseFile): $(LicenseSourceFile)
+	$(copy-result)
+
+# Extract the source from the archive and apply patches, if any.
+
+$(PackageSourceDir): $(PackageArchive) $(PackagePatchPaths)
+	$(expand-and-patch-package)
+
+# Prepare the sources.
+
+.PHONY: source
+source: | $(PackageSourceDir)
+
+# Patch the sources, if necessary.
+
+.PHONY: patch
+patch: source
+
+# Generate the package build makefile.
+
+$(PackageBuildMakefile): | $(PackageSourceDir) $(BuildDirectory) $(ResultDirectory)
+	$(Verbose)cd $(BuildDirectory) && \
+	$(CURDIR)/$(PackageSourceDir)/configure \
+	CC="$(CC)" CXX="$(CXX)" AR=$(AR) NM=$(NM) RANLIB=$(RANLIB) STRIP=$(STRIP) \
+	INSTALL="$(INSTALL) $(INSTALLFLAGS)" \
+	--build=$(HostTuple) \
+	--host=$(TargetTuple) \
+	--prefix=/usr \
+	--sysconfdir=/etc \
+	--localstatedir=/var \
+	--disable-static
+
+# Configure the source for building.
+
+.PHONY: configure
+configure: source $(PackageBuildMakefile)
+
+# Build the source.
+#
+# We have to unset MAKEFLAGS since they confuse the package build otherwise.
+
+.PHONY: build
+build: configure
+	$(Verbose)unset MAKEFLAGS && \
+	$(MAKE) $(JOBSFLAG) -C $(BuildDirectory) \
+	all
+
+# Stage the build to a temporary installation area.
+#
+# We have to unset MAKEFLAGS since they confuse the package build otherwise.
+#
+# We explictly remove 'libpopt.la' because some packages that depend
+# on expat use libtool. If libtool finds a '*.la' file for a library,
+# it uses the value of 'libdir=<dir>' it finds. In our case, since
+# '--prefix=/usr' this value is '/usr/lib'. It then resolves '-lexpat'
+# to '/usr/lib/libpopt.so'. In a cross-compilation environment, this
+# is likely to be neither the right architecture nor the right
+# version to link against. In short, we lose.
+#
+# We could also handle this by removing DESTDIR and setting the prefix
+# to $(ResultDirectory); however, that results in libtool hard-coding
+# $(ResultDirectory) as the RPATH in the linked executables which is
+# NOT what we want either. We lose again.
+#
+# By removing the '*.la' file, we win by ensuring neither a
+# misdirected link nor an RPATH.
+
+.PHONY: stage
+stage: build | $(ResultDirectory)
+	$(Verbose)unset MAKEFLAGS && \
+	$(MAKE) $(JOBSFLAG) -C $(BuildDirectory) \
+	DESTDIR=$(ResultDirectory) \
+	install
+	$(Verbose)$(RM) $(RMFLAGS) $(call GenerateResultPaths,,usr/lib/libpopt.la)
+
+clean:
+	$(Verbose)$(RM) $(RMFLAGS) -r $(PackageSourceDir)
+	$(Verbose)$(RM) $(RMFLAGS) -r $(BuildDirectory)
+	$(Verbose)$(RM) $(RMFLAGS) -r $(ResultDirectory)
+
+include post.mak
diff --git a/popt-1.16/ABOUT-NLS b/popt-1.16/ABOUT-NLS
new file mode 100644
index 0000000..83bc72e
--- /dev/null
+++ b/popt-1.16/ABOUT-NLS
@@ -0,0 +1,1068 @@
+1 Notes on the Free Translation Project
+***************************************
+
+Free software is going international!  The Free Translation Project is
+a way to get maintainers of free software, translators, and users all
+together, so that free software will gradually become able to speak many
+languages.  A few packages already provide translations for their
+messages.
+
+   If you found this `ABOUT-NLS' file inside a distribution, you may
+assume that the distributed package does use GNU `gettext' internally,
+itself available at your nearest GNU archive site.  But you do _not_
+need to install GNU `gettext' prior to configuring, installing or using
+this package with messages translated.
+
+   Installers will find here some useful hints.  These notes also
+explain how users should proceed for getting the programs to use the
+available translations.  They tell how people wanting to contribute and
+work on translations can contact the appropriate team.
+
+   When reporting bugs in the `intl/' directory or bugs which may be
+related to internationalization, you should tell about the version of
+`gettext' which is used.  The information can be found in the
+`intl/VERSION' file, in internationalized packages.
+
+1.1 Quick configuration advice
+==============================
+
+If you want to exploit the full power of internationalization, you
+should configure it using
+
+     ./configure --with-included-gettext
+
+to force usage of internationalizing routines provided within this
+package, despite the existence of internationalizing capabilities in the
+operating system where this package is being installed.  So far, only
+the `gettext' implementation in the GNU C library version 2 provides as
+many features (such as locale alias, message inheritance, automatic
+charset conversion or plural form handling) as the implementation here.
+It is also not possible to offer this additional functionality on top
+of a `catgets' implementation.  Future versions of GNU `gettext' will
+very likely convey even more functionality.  So it might be a good idea
+to change to GNU `gettext' as soon as possible.
+
+   So you need _not_ provide this option if you are using GNU libc 2 or
+you have installed a recent copy of the GNU gettext package with the
+included `libintl'.
+
+1.2 INSTALL Matters
+===================
+
+Some packages are "localizable" when properly installed; the programs
+they contain can be made to speak your own native language.  Most such
+packages use GNU `gettext'.  Other packages have their own ways to
+internationalization, predating GNU `gettext'.
+
+   By default, this package will be installed to allow translation of
+messages.  It will automatically detect whether the system already
+provides the GNU `gettext' functions.  If not, the included GNU
+`gettext' library will be used.  This library is wholly contained
+within this package, usually in the `intl/' subdirectory, so prior
+installation of the GNU `gettext' package is _not_ required.
+Installers may use special options at configuration time for changing
+the default behaviour.  The commands:
+
+     ./configure --with-included-gettext
+     ./configure --disable-nls
+
+will, respectively, bypass any pre-existing `gettext' to use the
+internationalizing routines provided within this package, or else,
+_totally_ disable translation of messages.
+
+   When you already have GNU `gettext' installed on your system and run
+configure without an option for your new package, `configure' will
+probably detect the previously built and installed `libintl.a' file and
+will decide to use this.  This might not be desirable.  You should use
+the more recent version of the GNU `gettext' library.  I.e. if the file
+`intl/VERSION' shows that the library which comes with this package is
+more recent, you should use
+
+     ./configure --with-included-gettext
+
+to prevent auto-detection.
+
+   The configuration process will not test for the `catgets' function
+and therefore it will not be used.  The reason is that even an
+emulation of `gettext' on top of `catgets' could not provide all the
+extensions of the GNU `gettext' library.
+
+   Internationalized packages usually have many `po/LL.po' files, where
+LL gives an ISO 639 two-letter code identifying the language.  Unless
+translations have been forbidden at `configure' time by using the
+`--disable-nls' switch, all available translations are installed
+together with the package.  However, the environment variable `LINGUAS'
+may be set, prior to configuration, to limit the installed set.
+`LINGUAS' should then contain a space separated list of two-letter
+codes, stating which languages are allowed.
+
+1.3 Using This Package
+======================
+
+As a user, if your language has been installed for this package, you
+only have to set the `LANG' environment variable to the appropriate
+`LL_CC' combination.  If you happen to have the `LC_ALL' or some other
+`LC_xxx' environment variables set, you should unset them before
+setting `LANG', otherwise the setting of `LANG' will not have the
+desired effect.  Here `LL' is an ISO 639 two-letter language code, and
+`CC' is an ISO 3166 two-letter country code.  For example, let's
+suppose that you speak German and live in Germany.  At the shell
+prompt, merely execute `setenv LANG de_DE' (in `csh'),
+`export LANG; LANG=de_DE' (in `sh') or `export LANG=de_DE' (in `bash').
+This can be done from your `.login' or `.profile' file, once and for
+all.
+
+   You might think that the country code specification is redundant.
+But in fact, some languages have dialects in different countries.  For
+example, `de_AT' is used for Austria, and `pt_BR' for Brazil.  The
+country code serves to distinguish the dialects.
+
+   The locale naming convention of `LL_CC', with `LL' denoting the
+language and `CC' denoting the country, is the one use on systems based
+on GNU libc.  On other systems, some variations of this scheme are
+used, such as `LL' or `LL_CC.ENCODING'.  You can get the list of
+locales supported by your system for your language by running the
+command `locale -a | grep '^LL''.
+
+   Not all programs have translations for all languages.  By default, an
+English message is shown in place of a nonexistent translation.  If you
+understand other languages, you can set up a priority list of languages.
+This is done through a different environment variable, called
+`LANGUAGE'.  GNU `gettext' gives preference to `LANGUAGE' over `LANG'
+for the purpose of message handling, but you still need to have `LANG'
+set to the primary language; this is required by other parts of the
+system libraries.  For example, some Swedish users who would rather
+read translations in German than English for when Swedish is not
+available, set `LANGUAGE' to `sv:de' while leaving `LANG' to `sv_SE'.
+
+   Special advice for Norwegian users: The language code for Norwegian
+bokma*l changed from `no' to `nb' recently (in 2003).  During the
+transition period, while some message catalogs for this language are
+installed under `nb' and some older ones under `no', it's recommended
+for Norwegian users to set `LANGUAGE' to `nb:no' so that both newer and
+older translations are used.
+
+   In the `LANGUAGE' environment variable, but not in the `LANG'
+environment variable, `LL_CC' combinations can be abbreviated as `LL'
+to denote the language's main dialect.  For example, `de' is equivalent
+to `de_DE' (German as spoken in Germany), and `pt' to `pt_PT'
+(Portuguese as spoken in Portugal) in this context.
+
+1.4 Translating Teams
+=====================
+
+For the Free Translation Project to be a success, we need interested
+people who like their own language and write it well, and who are also
+able to synergize with other translators speaking the same language.
+Each translation team has its own mailing list.  The up-to-date list of
+teams can be found at the Free Translation Project's homepage,
+`http://translationproject.org/', in the "Teams" area.
+
+   If you'd like to volunteer to _work_ at translating messages, you
+should become a member of the translating team for your own language.
+The subscribing address is _not_ the same as the list itself, it has
+`-request' appended.  For example, speakers of Swedish can send a
+message to `sv-request@li.org', having this message body:
+
+     subscribe
+
+   Keep in mind that team members are expected to participate
+_actively_ in translations, or at solving translational difficulties,
+rather than merely lurking around.  If your team does not exist yet and
+you want to start one, or if you are unsure about what to do or how to
+get started, please write to `coordinator@translationproject.org' to
+reach the coordinator for all translator teams.
+
+   The English team is special.  It works at improving and uniformizing
+the terminology in use.  Proven linguistic skills are praised more than
+programming skills, here.
+
+1.5 Available Packages
+======================
+
+Languages are not equally supported in all packages.  The following
+matrix shows the current state of internationalization, as of November
+2007.  The matrix shows, in regard of each package, for which languages
+PO files have been submitted to translation coordination, with a
+translation percentage of at least 50%.
+
+     Ready PO files       af am ar az be bg bs ca cs cy da de el en en_GB eo
+                        +----------------------------------------------------+
+     Compendium         |                      []       [] []        []      |
+     a2ps               |             []                [] [] []     []      |
+     aegis              |                                  ()                |
+     ant-phone          |                                  ()                |
+     anubis             |                                  []                |
+     ap-utils           |                                                    |
+     aspell             |                      [] []    [] []        []      |
+     bash               |                                                 [] |
+     bfd                |                                                    |
+     bibshelf           |                                  []                |
+     binutils           |                                                    |
+     bison              |                               [] []                |
+     bison-runtime      |                                  []                |
+     bluez-pin          | []                      []       [] []          [] |
+     cflow              |                               []                   |
+     clisp              |                               [] []    []          |
+     console-tools      |                         []       []                |
+     coreutils          |                []    [] []       []                |
+     cpio               |                                                    |
+     cpplib             |                      []       [] []                |
+     cryptonit          |                                  []                |
+     dialog             |                                                    |
+     diffutils          |                      [] []    [] [] []          [] |
+     doodle             |                                  []                |
+     e2fsprogs          |                         []       []                |
+     enscript           |                      []       [] []        []      |
+     fetchmail          |                      []       [] () []     []      |
+     findutils          |                []                                  |
+     findutils_stable   |                []    []       []                   |
+     flex               |                      []       [] []                |
+     fslint             |                                                    |
+     gas                |                                                    |
+     gawk               |                      []       [] []                |
+     gcal               |                      []                            |
+     gcc                |                                  []                |
+     gettext-examples   | []                   []          [] []          [] |
+     gettext-runtime    |             []       []       [] []             [] |
+     gettext-tools      |                      []          []                |
+     gip                |                []                                  |
+     gliv               |                []                []                |
+     glunarclock        |                []                                  |
+     gmult              | []                               []                |
+     gnubiff            |                                  ()                |
+     gnucash            |                      [] []       () ()     []      |
+     gnuedu             |                                                    |
+     gnulib             |                []                                  |
+     gnunet             |                                                    |
+     gnunet-gtk         |                                                    |
+     gnutls             |                                  []                |
+     gpe-aerial         |                         []       []                |
+     gpe-beam           |                         []       []                |
+     gpe-calendar       |                                                    |
+     gpe-clock          |                         []       []                |
+     gpe-conf           |                         []       []                |
+     gpe-contacts       |                                                    |
+     gpe-edit           |                         []                         |
+     gpe-filemanager    |                                                    |
+     gpe-go             |                         []                         |
+     gpe-login          |                         []       []                |
+     gpe-ownerinfo      |                         []       []                |
+     gpe-package        |                                                    |
+     gpe-sketchbook     |                         []       []                |
+     gpe-su             |                         []       []                |
+     gpe-taskmanager    |                         []       []                |
+     gpe-timesheet      |                         []                         |
+     gpe-today          |                         []       []                |
+     gpe-todo           |                                                    |
+     gphoto2            |                         []    [] []        []      |
+     gprof              |                               [] []                |
+     gpsdrive           |                                                    |
+     gramadoir          | []                               []                |
+     grep               |                         []                      [] |
+     gretl              |                                  ()                |
+     gsasl              |                                                    |
+     gss                |                                                    |
+     gst-plugins-bad    |                []             []                   |
+     gst-plugins-base   |                []             []                   |
+     gst-plugins-good   |                []    []       []                   |
+     gst-plugins-ugly   |                []             []                   |
+     gstreamer          | []             []    [] []    [] []        []      |
+     gtick              |                                  ()                |
+     gtkam              |             []          []    [] []                |
+     gtkorphan          |                []                []                |
+     gtkspell           |             []                   [] []          [] |
+     gutenprint         |                               []                   |
+     hello              |                []    []       [] []             [] |
+     herrie             |                                  []                |
+     hylafax            |                                                    |
+     idutils            |                               [] []                |
+     indent             |                      [] []       []             [] |
+     iso_15924          |                                                    |
+     iso_3166           |       []    [] [] [] [] [] [] [] [] []          [] |
+     iso_3166_2         |                                                    |
+     iso_4217           |                         []    [] []                |
+     iso_639            |                         []    [] []             [] |
+     jpilot             |                         []                         |
+     jtag               |                                                    |
+     jwhois             |                                                    |
+     kbd                |                         []    [] [] []             |
+     keytouch           |                      []          []                |
+     keytouch-editor    |                                  []                |
+     keytouch-keyboa... |                      []                            |
+     latrine            |                                  ()                |
+     ld                 |                               []                   |
+     leafpad            |                []    [] []       [] []             |
+     libc               |                      [] []    [] []                |
+     libexif            |                                  []                |
+     libextractor       |                                  []                |
+     libgpewidget       |                         []    [] []                |
+     libgpg-error       |                                  []                |
+     libgphoto2         |                               [] []                |
+     libgphoto2_port    |                               [] []                |
+     libgsasl           |                                                    |
+     libiconv           |                                  []             [] |
+     libidn             |                         []    []                [] |
+     lifelines          |                               [] ()                |
+     lilypond           |                                  []                |
+     lingoteach         |                                                    |
+     lprng              |                                                    |
+     lynx               |                      [] []    [] []                |
+     m4                 |                         []    [] [] []             |
+     mailfromd          |                                                    |
+     mailutils          |                      []                            |
+     make               |                               [] []                |
+     man-db             |                      []       [] []                |
+     minicom            |                         []    [] []                |
+     nano               |                []    []          []                |
+     opcodes            |                                  []                |
+     parted             |                         []       []                |
+     pilot-qof          |                                                    |
+     popt               |                         []    [] []                |
+     psmisc             |                []                                  |
+     pwdutils           |                                                    |
+     qof                |                                                    |
+     radius             |                      []                            |
+     recode             |             []       []       [] [] []          [] |
+     rpm                |                               []                   |
+     screem             |                                                    |
+     scrollkeeper       |          [] []       [] [] [] [] []        []      |
+     sed                |                      []          []             [] |
+     shared-mime-info   |                []    [] []    [] () []     []   [] |
+     sharutils          |                []    [] []    [] [] []             |
+     shishi             |                                                    |
+     skencil            |                               [] ()                |
+     solfege            |                                                    |
+     soundtracker       |                               [] []                |
+     sp                 |                                  []                |
+     system-tools-ba... |       []       [] [] [] []    [] [] []     []      |
+     tar                |                []                []                |
+     texinfo            |                               [] []             [] |
+     tin                |                                  ()        ()      |
+     tuxpaint           | []             []             [] []        []   [] |
+     unicode-han-tra... |                                                    |
+     unicode-transla... |                                                    |
+     util-linux         |                      [] []    [] []                |
+     util-linux-ng      |                      [] []    [] []                |
+     vorbis-tools       |                         []                         |
+     wastesedge         |                                  ()                |
+     wdiff              |                      []       [] []        []      |
+     wget               |                      [] []       []                |
+     xchat              |             [] []    [] []       [] []     []      |
+     xkeyboard-config   |                []                                  |
+     xpad               |                []             []           []      |
+                        +----------------------------------------------------+
+                          af am ar az be bg bs ca cs cy da de el en en_GB eo
+                           6  0  2  1  8 26  2 40 48  2 56 88 15  1  15   18
+
+                          es et eu fa fi fr  ga gl gu he hi hr hu id is it
+                        +--------------------------------------------------+
+     Compendium         | []          [] []  []                []          |
+     a2ps               |    []       [] []                             () |
+     aegis              |                                                  |
+     ant-phone          |                []                                |
+     anubis             |                []                                |
+     ap-utils           |             [] []                                |
+     aspell             |                []  []                         [] |
+     bash               | []                                               |
+     bfd                | []          []                                   |
+     bibshelf           | []                 []                         [] |
+     binutils           | []          [] []                                |
+     bison              | [] []          []  []                   []    [] |
+     bison-runtime      |    []          []  []                   []    [] |
+     bluez-pin          |             [] []  []                [] []       |
+     cflow              |                    []                            |
+     clisp              | []             []                                |
+     console-tools      |                                                  |
+     coreutils          | [] []       [] []  []                []          |
+     cpio               | []             []  []                            |
+     cpplib             | []             []                                |
+     cryptonit          |                []                                |
+     dialog             |       []           []                         [] |
+     diffutils          | []          [] []  [] []    []       [] []    [] |
+     doodle             |                    []                         [] |
+     e2fsprogs          | []             []                             [] |
+     enscript           |                []  []             []             |
+     fetchmail          | []                                               |
+     findutils          |    []              []                []          |
+     findutils_stable   |    []          []  []                []          |
+     flex               | []             []  []                            |
+     fslint             |                                                  |
+     gas                | []             []                                |
+     gawk               | []             []  []       []                () |
+     gcal               | []             []                                |
+     gcc                | []                                               |
+     gettext-examples   | []          [] []  []                [] []    [] |
+     gettext-runtime    | []          [] []  []                   []    [] |
+     gettext-tools      | []    []       []                             [] |
+     gip                | []    []       []  []                            |
+     gliv               |                ()                                |
+     glunarclock        |             []     []                []          |
+     gmult              |       []       []                             [] |
+     gnubiff            |                ()                             () |
+     gnucash            | ()             ()                    ()          |
+     gnuedu             | []                                               |
+     gnulib             | [] []              []                            |
+     gnunet             |                                                  |
+     gnunet-gtk         |                                                  |
+     gnutls             |                                                  |
+     gpe-aerial         | []             []                                |
+     gpe-beam           | []             []                                |
+     gpe-calendar       |                                                  |
+     gpe-clock          | []          [] []                    []          |
+     gpe-conf           |                []                                |
+     gpe-contacts       | []             []                                |
+     gpe-edit           | []             []                    [] []       |
+     gpe-filemanager    | []                                               |
+     gpe-go             | []             []                    []          |
+     gpe-login          | []             []                    []          |
+     gpe-ownerinfo      | []          [] []                    [] []       |
+     gpe-package        | []                                               |
+     gpe-sketchbook     | []             []                                |
+     gpe-su             | []          [] []                    []          |
+     gpe-taskmanager    | []          [] []                                |
+     gpe-timesheet      | []             []  []                   []       |
+     gpe-today          | []          [] []  []                            |
+     gpe-todo           | []                                               |
+     gphoto2            | []          [] []                    []       [] |
+     gprof              | []          [] []  []                   []       |
+     gpsdrive           |    []                                            |
+     gramadoir          |                []  []                            |
+     grep               | []          []     []                            |
+     gretl              | []    []       []                             () |
+     gsasl              |                    []                   []       |
+     gss                |                []  []                            |
+     gst-plugins-bad    | []          []                       []       [] |
+     gst-plugins-base   | []          []                       []       [] |
+     gst-plugins-good   | []    []    []                       []       [] |
+     gst-plugins-ugly   | []          []                       []       [] |
+     gstreamer          |             []                       []       [] |
+     gtick              |             []     []                         [] |
+     gtkam              | []             []                    []       [] |
+     gtkorphan          |                []                             [] |
+     gtkspell           | []    []    [] []  []                []       [] |
+     gutenprint         |                                      []          |
+     hello              | [] [] [] [] [] []  [] []    []    [] [] []    [] |
+     herrie             |                    []                            |
+     hylafax            |                                                  |
+     idutils            |                []  []                [] []    [] |
+     indent             | [] [] []    [] []  [] []             [] []    [] |
+     iso_15924          |                []                                |
+     iso_3166           | [] [] []    [] []     [] [] [] [] [] [] []    [] |
+     iso_3166_2         |                []                                |
+     iso_4217           | [] []       [] []                    []       [] |
+     iso_639            | []       [] [] []  []                []          |
+     jpilot             | []             []                                |
+     jtag               |                []                                |
+     jwhois             | []             []                    [] []    [] |
+     kbd                | []             []                                |
+     keytouch           |                []  []                         [] |
+     keytouch-editor    |                    []                            |
+     keytouch-keyboa... |                    []                         [] |
+     latrine            |                    []                         [] |
+     ld                 | []          [] []  []                            |
+     leafpad            | []             []  []       []       []       [] |
+     libc               | []          [] []     []             []          |
+     libexif            | []                                               |
+     libextractor       |                    []                            |
+     libgpewidget       | []             []  []                [] []       |
+     libgpg-error       |                []                                |
+     libgphoto2         | []             []                             [] |
+     libgphoto2_port    |                []                             [] |
+     libgsasl           |                []  []                            |
+     libiconv           |    []       []     []                            |
+     libidn             |                []                             [] |
+     lifelines          |                ()                                |
+     lilypond           | []          [] []                                |
+     lingoteach         |                []                       []    [] |
+     lprng              |                                                  |
+     lynx               |    []                                []       [] |
+     m4                 |                []  [] []                []       |
+     mailfromd          |                                                  |
+     mailutils          | []             []                                |
+     make               | []          [] []  [] []    []    []    []       |
+     man-db             |                                               [] |
+     minicom            | []          [] []                    []          |
+     nano               | []    []       []  [] []             []       [] |
+     opcodes            | []          [] []  []                            |
+     parted             |                []                       []    [] |
+     pilot-qof          |                                                  |
+     popt               |                []  [] []                   []    |
+     psmisc             |                                      []       [] |
+     pwdutils           |                                                  |
+     qof                |                                         []       |
+     radius             | []             []                                |
+     recode             | []             []  [] []    []       [] []    [] |
+     rpm                |                []                       []       |
+     screem             |                                                  |
+     scrollkeeper       | []          []                       []          |
+     sed                | [] []          []  []                []          |
+     shared-mime-info   | []    []    [] []                    []       [] |
+     sharutils          | [] []       [] []  [] []             []       [] |
+     shishi             |                []                                |
+     skencil            | []             []                                |
+     solfege            |                                               [] |
+     soundtracker       | []             []                             [] |
+     sp                 |                []                                |
+     system-tools-ba... | []    []    [] []  []             [] [] []    [] |
+     tar                |    [] []    []     []                []          |
+     texinfo            |                []           []       []          |
+     tin                |    []          ()                                |
+     tuxpaint           |                    []                []          |
+     unicode-han-tra... |                                                  |
+     unicode-transla... |                []  []                            |
+     util-linux         | [] []       [] []                    [] []    [] |
+     util-linux-ng      | [] []       [] []                    [] []    [] |
+     vorbis-tools       |                                                  |
+     wastesedge         |                ()                                |
+     wdiff              | [] []          []  [] []             [] []    [] |
+     wget               |    []       [] []  []             [] [] []    [] |
+     xchat              | []          [] []        []    []    []       [] |
+     xkeyboard-config   | []          [] []                    []          |
+     xpad               | []                 []                []          |
+                        +--------------------------------------------------+
+                          es et eu fa fi fr  ga gl gu he hi hr hu id is it
+                          85 22 14  2 48 101 61 12  2  8  2  6 53 29  1 52
+
+                          ja ka ko ku ky lg lt lv mk mn ms mt nb ne nl  nn
+                        +--------------------------------------------------+
+     Compendium         |                                           []     |
+     a2ps               |       ()                      []          []     |
+     aegis              |                                           ()     |
+     ant-phone          |                                           []     |
+     anubis             |                               []    []    []     |
+     ap-utils           |                               []                 |
+     aspell             |                            []             []     |
+     bash               |                                           []     |
+     bfd                |                                                  |
+     bibshelf           |                               []                 |
+     binutils           |                                                  |
+     bison              |                               []    []    []     |
+     bison-runtime      |                               []    []    []     |
+     bluez-pin          |          []                   []          []     |
+     cflow              |                                                  |
+     clisp              |                                           []     |
+     console-tools      |                                                  |
+     coreutils          |                                           []     |
+     cpio               |                                           []     |
+     cpplib             |                                           []     |
+     cryptonit          |                                           []     |
+     dialog             |                               []          []     |
+     diffutils          | []                            []          []     |
+     doodle             |                                                  |
+     e2fsprogs          |                                           []     |
+     enscript           |                                           []     |
+     fetchmail          | []                                        []     |
+     findutils          |                                           []     |
+     findutils_stable   |                                           []     |
+     flex               |       []                                  []     |
+     fslint             |                                                  |
+     gas                |                                                  |
+     gawk               | []                                        []     |
+     gcal               |                                                  |
+     gcc                |                                                  |
+     gettext-examples   | []                            []          []     |
+     gettext-runtime    | []    []                                  []     |
+     gettext-tools      | []    []                                         |
+     gip                |                               []          []     |
+     gliv               |                                           []     |
+     glunarclock        |                               []          []     |
+     gmult              | []                            []          []     |
+     gnubiff            |                                                  |
+     gnucash            | ()                                  () ()        |
+     gnuedu             |                                                  |
+     gnulib             | []                                        []     |
+     gnunet             |                                                  |
+     gnunet-gtk         |                                                  |
+     gnutls             |                               []                 |
+     gpe-aerial         |                                           []     |
+     gpe-beam           |                                           []     |
+     gpe-calendar       | []                                               |
+     gpe-clock          | []    []                                  []     |
+     gpe-conf           | []    []                                  []     |
+     gpe-contacts       |       []                                         |
+     gpe-edit           | []    []                                  []     |
+     gpe-filemanager    | []    []                                         |
+     gpe-go             | []    []                                  []     |
+     gpe-login          | []    []                                  []     |
+     gpe-ownerinfo      | []                                        []     |
+     gpe-package        | []    []                                         |
+     gpe-sketchbook     |       []                                  []     |
+     gpe-su             | []    []                                  []     |
+     gpe-taskmanager    | []    [] []                               []     |
+     gpe-timesheet      |                                           []     |
+     gpe-today          | []                                        []     |
+     gpe-todo           | []                                               |
+     gphoto2            | []                                        []     |
+     gprof              |                               []                 |
+     gpsdrive           |                                           []     |
+     gramadoir          |                                           ()     |
+     grep               |             []                            []     |
+     gretl              |                                                  |
+     gsasl              |                                           []     |
+     gss                |                                                  |
+     gst-plugins-bad    |                                           []     |
+     gst-plugins-base   |                                           []     |
+     gst-plugins-good   |                                           []     |
+     gst-plugins-ugly   |                                           []     |
+     gstreamer          |                                           []     |
+     gtick              |                                           []     |
+     gtkam              | []                                        []     |
+     gtkorphan          |                                           []     |
+     gtkspell           |                            []             []     |
+     gutenprint         |                                           []     |
+     hello              | [] [] []                      []    []    []  [] |
+     herrie             |                                           []     |
+     hylafax            |                                                  |
+     idutils            |                                           []     |
+     indent             | []                                        []     |
+     iso_15924          |                                           []     |
+     iso_3166           | []    [] []       []    []          []    []  [] |
+     iso_3166_2         |                                           []     |
+     iso_4217           | []                []                      []     |
+     iso_639            | []                []                      []  [] |
+     jpilot             | ()                                        ()     |
+     jtag               |                                                  |
+     jwhois             |                                           []     |
+     kbd                |                                           []     |
+     keytouch           |                                           []     |
+     keytouch-editor    |                                           []     |
+     keytouch-keyboa... |                                                  |
+     latrine            |                                           []     |
+     ld                 |                                                  |
+     leafpad            | []                []                             |
+     libc               | []    []                                  []     |
+     libexif            |                                                  |
+     libextractor       |                                                  |
+     libgpewidget       |                                           []     |
+     libgpg-error       |                                                  |
+     libgphoto2         | []                                               |
+     libgphoto2_port    | []                                               |
+     libgsasl           |                                           []     |
+     libiconv           |                                           []     |
+     libidn             | []                                        []     |
+     lifelines          |                                           []     |
+     lilypond           |                                           []     |
+     lingoteach         |                                           []     |
+     lprng              |                                                  |
+     lynx               | []                                        []     |
+     m4                 | []                                        []     |
+     mailfromd          |                                                  |
+     mailutils          |                                                  |
+     make               | []    []                                  []     |
+     man-db             |                                                  |
+     minicom            | []                                               |
+     nano               |                               []    []    []     |
+     opcodes            |                                           []     |
+     parted             | []                                        []     |
+     pilot-qof          |                                                  |
+     popt               | []    []                                  []     |
+     psmisc             | []                                  []    []     |
+     pwdutils           |                                                  |
+     qof                |                                                  |
+     radius             |                                                  |
+     recode             |                                           []     |
+     rpm                | []    []                                         |
+     screem             | []                                               |
+     scrollkeeper       |                                     [] [] []  [] |
+     sed                | []                                        []     |
+     shared-mime-info   | []    []          []          []    []    []  [] |
+     sharutils          | []                                        []     |
+     shishi             |                                                  |
+     skencil            |                                                  |
+     solfege            |                                     ()        () |
+     soundtracker       |                                                  |
+     sp                 | ()                                               |
+     system-tools-ba... | []    []          []                      []     |
+     tar                | []          []                            []     |
+     texinfo            |                                     []    []     |
+     tin                |                                                  |
+     tuxpaint           |                                     ()    []  [] |
+     unicode-han-tra... |                                                  |
+     unicode-transla... |                                                  |
+     util-linux         | []                                        []     |
+     util-linux-ng      | []                                        []     |
+     vorbis-tools       |                                                  |
+     wastesedge         |                                           []     |
+     wdiff              |                               []    []           |
+     wget               | []                                        []     |
+     xchat              | []    []                []                []     |
+     xkeyboard-config   |    [] []                                  []     |
+     xpad               |       []                      []          []     |
+                        +--------------------------------------------------+
+                          ja ka ko ku ky lg lt lv mk mn ms mt nb ne nl  nn
+                          51  2 25  3  2  0  6  0  2  2 20  0 11  1 103  6
+
+                          or pa pl pt pt_BR rm ro ru rw sk sl sq sr sv  ta
+                        +--------------------------------------------------+
+     Compendium         |          []  []      []       []          []     |
+     a2ps               |       ()     []      [] []       []    [] []     |
+     aegis              |                      () ()                       |
+     ant-phone          |                      []                   []     |
+     anubis             |       []             [] []                       |
+     ap-utils           |       ()                                         |
+     aspell             |                      [] []    []                 |
+     bash               |       []                      []                 |
+     bfd                |                                                  |
+     bibshelf           |                                           []     |
+     binutils           |                         []    []                 |
+     bison              |       []     []      [] []                []     |
+     bison-runtime      |       []     []      []          []       []     |
+     bluez-pin          |       []     []   [] [] []    [] []    [] []     |
+     cflow              |       []                                         |
+     clisp              |                         []                       |
+     console-tools      |                         []                       |
+     coreutils          |       []                []       []       []     |
+     cpio               |       []                []                []     |
+     cpplib             |                                           []     |
+     cryptonit          |              []                           []     |
+     dialog             |                                           []     |
+     diffutils          |       []     []      [] []             [] []     |
+     doodle             |                                     []    []     |
+     e2fsprogs          |       []                                  []     |
+     enscript           |              []      [] []       []       []     |
+     fetchmail          |       []                []          []           |
+     findutils          |       [] []                               []     |
+     findutils_stable   |       [] []          []       [] []       []     |
+     flex               |       []     []      [] []                []     |
+     fslint             |                                           []     |
+     gas                |                                                  |
+     gawk               |       []     []      []                   []     |
+     gcal               |                                           []     |
+     gcc                |                                        [] []     |
+     gettext-examples   |       [] []          [] []    [] []    [] []     |
+     gettext-runtime    |       [] []          [] []    [] []    [] []     |
+     gettext-tools      |       []             [] []    [] []    [] []     |
+     gip                |                   []          []       [] []     |
+     gliv               |       []     []      [] []    []          []     |
+     glunarclock        |              []      [] []    []       [] []     |
+     gmult              |                   [] []                [] []     |
+     gnubiff            |                      ()                   []     |
+     gnucash            |       ()                                  []     |
+     gnuedu             |                                                  |
+     gnulib             |       []                         []       []     |
+     gnunet             |                                                  |
+     gnunet-gtk         |                                           []     |
+     gnutls             |       []                                  []     |
+     gpe-aerial         |          []  []      [] []       []    [] []     |
+     gpe-beam           |          []  []      [] []       []    [] []     |
+     gpe-calendar       |                         []       []    [] []     |
+     gpe-clock          |          []  []      [] []    [] []    [] []     |
+     gpe-conf           |          []  []      [] []    [] []       []     |
+     gpe-contacts       |                      [] []       []    [] []     |
+     gpe-edit           |       [] []  []      [] []    [] []    [] []     |
+     gpe-filemanager    |                                  []       []     |
+     gpe-go             |       []     []      [] []    [] []    [] []     |
+     gpe-login          |          []  []      [] []    [] []    [] []     |
+     gpe-ownerinfo      |          []  []      [] []    [] []    [] []     |
+     gpe-package        |                                  []       []     |
+     gpe-sketchbook     |          []  []      [] []    [] []    [] []     |
+     gpe-su             |          []  []      [] []    [] []    [] []     |
+     gpe-taskmanager    |          []  []      [] []    [] []    [] []     |
+     gpe-timesheet      |          []  []      [] []    [] []    [] []     |
+     gpe-today          |          []  []      [] []    [] []    [] []     |
+     gpe-todo           |                         []       []    [] []     |
+     gphoto2            |    [] []             []       []       [] []     |
+     gprof              |              []      []                   []     |
+     gpsdrive           |                         []                []     |
+     gramadoir          |                               []          []     |
+     grep               |       []                      [] []       []     |
+     gretl              |       [] []  []                                  |
+     gsasl              |       []                               [] []     |
+     gss                |       []             []       []          []     |
+     gst-plugins-bad    |       []     []                           []     |
+     gst-plugins-base   |       []                                  []     |
+     gst-plugins-good   |       []                                  []     |
+     gst-plugins-ugly   |       []     []                           []     |
+     gstreamer          |       []                            [] [] []     |
+     gtick              |                         []                       |
+     gtkam              |    [] []     []         []                []     |
+     gtkorphan          |                                           []     |
+     gtkspell           |              []   [] [] []    [] []    [] []     |
+     gutenprint         |                                           []     |
+     hello              |       []     []      [] []    [] []    [] []     |
+     herrie             |       []                []                []     |
+     hylafax            |                                                  |
+     idutils            |       []     []      [] []                []     |
+     indent             |       []     []      [] []    []       [] []     |
+     iso_15924          |                                                  |
+     iso_3166           |    [] [] []  []      [] [] [] [] [] [] [] []  [] |
+     iso_3166_2         |                                                  |
+     iso_4217           |       [] []             [] []    []    [] []     |
+     iso_639            |       []                [] [] [] []    [] []     |
+     jpilot             |                                                  |
+     jtag               |                               []                 |
+     jwhois             |       []     []      []                   []     |
+     kbd                |       []             []                   []     |
+     keytouch           |                                           []     |
+     keytouch-editor    |                                           []     |
+     keytouch-keyboa... |                                           []     |
+     latrine            |                                                  |
+     ld                 |                                           []     |
+     leafpad            |       [] []             []    []          []  [] |
+     libc               |       []                []    []          []     |
+     libexif            |       []                      []                 |
+     libextractor       |                      []                   []     |
+     libgpewidget       |       [] []  []      []       [] []    [] []     |
+     libgpg-error       |       []             []                   []     |
+     libgphoto2         |       []                                         |
+     libgphoto2_port    |       []                []                []     |
+     libgsasl           |       []             []                [] []     |
+     libiconv           |                                  []    [] []     |
+     libidn             |       []                               [] ()     |
+     lifelines          |       []                                  []     |
+     lilypond           |                                                  |
+     lingoteach         |              []                                  |
+     lprng              |       []                                         |
+     lynx               |              []         []                []     |
+     m4                 |       []     []      [] []                []     |
+     mailfromd          |       []                                         |
+     mailutils          |       []                []                []     |
+     make               |       []     []         []                []     |
+     man-db             |       []             [] []                []     |
+     minicom            |       []     []      [] []                []     |
+     nano               |              []      [] []                []     |
+     opcodes            |                      []                   []     |
+     parted             |       []                                         |
+     pilot-qof          |                                                  |
+     popt               |       [] []             []                []     |
+     psmisc             |       []                                  []     |
+     pwdutils           |       []                                  []     |
+     qof                |              []                           []     |
+     radius             |       []                []                       |
+     recode             |       [] []  []      [] []       []       []     |
+     rpm                |       [] []             []                []     |
+     screem             |                                                  |
+     scrollkeeper       |       []             [] []    []    [] [] []     |
+     sed                |       [] []  []      [] []    [] []    [] []     |
+     shared-mime-info   |       [] []  []                     [] [] []     |
+     sharutils          |       []                []             [] []     |
+     shishi             |       []                                         |
+     skencil            |          []  []                           []     |
+     solfege            |              []                                  |
+     soundtracker       |                               []          []     |
+     sp                 |                                                  |
+     system-tools-ba... |    [] [] []  []      []             [] [] []  [] |
+     tar                |       []                []       []       []     |
+     texinfo            |       []             [] []                []     |
+     tin                |                         ()                       |
+     tuxpaint           |       [] []                      [] [] [] []     |
+     unicode-han-tra... |                                                  |
+     unicode-transla... |                                                  |
+     util-linux         |              []         []       []       []     |
+     util-linux-ng      |              []         []       []       []     |
+     vorbis-tools       |                         []                       |
+     wastesedge         |                                                  |
+     wdiff              |       []     []      [] []    [] []       []     |
+     wget               |          []             []    []          []     |
+     xchat              |    []                   []    [] [] [] [] []     |
+     xkeyboard-config   |                               [] []       []     |
+     xpad               |                               [] []       []     |
+                        +--------------------------------------------------+
+                          or pa pl pt pt_BR rm ro ru rw sk sl sq sr sv  ta
+                           0  5 77 31  53    4 58 72  3 45 46  9 45 122  3
+
+                          tg th tk tr uk ven vi  wa xh zh_CN zh_HK zh_TW zu
+                        +---------------------------------------------------+
+     Compendium         |          []        []         []          []      | 19
+     a2ps               |          [] []     []                             | 19
+     aegis              |                    []                             |  1
+     ant-phone          |          []        []                             |  6
+     anubis             |          [] []     []                             | 11
+     ap-utils           |             ()     []                             |  4
+     aspell             |             []     []  []                         | 16
+     bash               |          []                                       |  6
+     bfd                |                                                   |  2
+     bibshelf           |                    []                             |  7
+     binutils           |          [] []     []                     []      |  9
+     bison              |          [] []     []                     []      | 20
+     bison-runtime      |             []     []         []          []      | 18
+     bluez-pin          |          [] []     []  []     []          []      | 28
+     cflow              |             []     []                             |  5
+     clisp              |                                                   |  9
+     console-tools      |          []        []                             |  5
+     coreutils          |          [] []     []                             | 18
+     cpio               |          [] []     []         []                  | 11
+     cpplib             |          [] []     []         []          []      | 12
+     cryptonit          |                    []                             |  6
+     dialog             |                    []  []     []                  |  9
+     diffutils          |          [] []     []         []          []      | 29
+     doodle             |                    []                             |  6
+     e2fsprogs          |          []        []                             | 10
+     enscript           |          [] []     []                             | 16
+     fetchmail          |          []        []                             | 12
+     findutils          |          [] []     []                             | 11
+     findutils_stable   |          [] []     []                     []      | 18
+     flex               |          []        []                             | 15
+     fslint             |                    []                             |  2
+     gas                |          []                                       |  3
+     gawk               |          []        []         []                  | 16
+     gcal               |          []                                       |  5
+     gcc                |          []                   []          []      |  7
+     gettext-examples   |          [] []     []         []    []    []      | 29
+     gettext-runtime    |          [] []     []         []    []    []      | 28
+     gettext-tools      |          [] []     []         []          []      | 20
+     gip                |                    []                     []      | 13
+     gliv               |          []        []                             | 11
+     glunarclock        |                    []  []                 []      | 15
+     gmult              |          []        []         []          []      | 16
+     gnubiff            |                    []                             |  2
+     gnucash            |          () []                                    |  5
+     gnuedu             |                    []                             |  2
+     gnulib             |                    []                             | 10
+     gnunet             |                                                   |  0
+     gnunet-gtk         |          []        []                             |  3
+     gnutls             |                                                   |  4
+     gpe-aerial         |                    []         []                  | 14
+     gpe-beam           |                    []         []                  | 14
+     gpe-calendar       |                    []  []                         |  7
+     gpe-clock          |          []        []  []     []                  | 21
+     gpe-conf           |                    []  []     []                  | 16
+     gpe-contacts       |                    []         []                  | 10
+     gpe-edit           |          []        []  []     []          []      | 22
+     gpe-filemanager    |                    []  []                         |  7
+     gpe-go             |          []        []  []     []                  | 19
+     gpe-login          |          []        []  []     []          []      | 21
+     gpe-ownerinfo      |          []        []         []          []      | 21
+     gpe-package        |                    []                             |  6
+     gpe-sketchbook     |          []        []                             | 16
+     gpe-su             |          []        []  []     []                  | 21
+     gpe-taskmanager    |          []        []  []     []                  | 21
+     gpe-timesheet      |          []        []         []          []      | 18
+     gpe-today          |          []        []  []     []          []      | 21
+     gpe-todo           |                    []  []                         |  8
+     gphoto2            |             []     []         []          []      | 21
+     gprof              |          []        []                             | 13
+     gpsdrive           |                    []                             |  5
+     gramadoir          |                    []                             |  7
+     grep               |                    []                             | 12
+     gretl              |                                                   |  6
+     gsasl              |                    []         []          []      |  9
+     gss                |                    []                             |  7
+     gst-plugins-bad    |             []     []         []                  | 13
+     gst-plugins-base   |             []     []                             | 11
+     gst-plugins-good   |             []     []         []    []    []      | 16
+     gst-plugins-ugly   |             []     []         []                  | 13
+     gstreamer          |          [] []     []                             | 18
+     gtick              |             []     []                             |  7
+     gtkam              |                    []                             | 16
+     gtkorphan          |                    []                             |  7
+     gtkspell           |             []     []  []     []    []    []      | 27
+     gutenprint         |                                                   |  4
+     hello              |          [] []     []         []          []      | 38
+     herrie             |          []        []                             |  8
+     hylafax            |                                                   |  0
+     idutils            |          []        []                             | 15
+     indent             |          [] []     []         []          []      | 28
+     iso_15924          |                    []         []                  |  4
+     iso_3166           |    [] [] [] []     []  []     []    []    []      | 54
+     iso_3166_2         |                    []         []                  |  4
+     iso_4217           |    []    []        []         []    []            | 24
+     iso_639            |             []     []  []     []    []            | 26
+     jpilot             |          [] []     []         []                  |  7
+     jtag               |                    []                             |  3
+     jwhois             |          []        []                     []      | 13
+     kbd                |          [] []     []                             | 13
+     keytouch           |                    []                             |  8
+     keytouch-editor    |                    []                             |  5
+     keytouch-keyboa... |                    []                             |  5
+     latrine            |          []        []                             |  5
+     ld                 |          []        []         []          []      | 10
+     leafpad            |          [] []     []         []          []      | 24
+     libc               |          []                   []          []      | 19
+     libexif            |                    []                             |  5
+     libextractor       |                    []                             |  5
+     libgpewidget       |                    []  []     []                  | 20
+     libgpg-error       |                    []                             |  6
+     libgphoto2         |             []     []                             |  9
+     libgphoto2_port    |             []     []                     []      | 11
+     libgsasl           |                    []                             |  8
+     libiconv           |                    []  []                         | 11
+     libidn             |                    []         []                  | 11
+     lifelines          |                                                   |  4
+     lilypond           |                    []                             |  6
+     lingoteach         |                    []                             |  6
+     lprng              |                    []                             |  2
+     lynx               |          [] []     []                             | 15
+     m4                 |                    []         []          []      | 18
+     mailfromd          |             []     []                             |  3
+     mailutils          |             []     []                             |  8
+     make               |          []        []         []                  | 20
+     man-db             |                    []                             |  9
+     minicom            |                    []                             | 14
+     nano               |                    []         []          []      | 20
+     opcodes            |          []        []                             | 10
+     parted             |          [] []                            []      | 11
+     pilot-qof          |                    []                             |  1
+     popt               |          []        []         []          []      | 18
+     psmisc             |                    []         []                  | 10
+     pwdutils           |                    []                             |  3
+     qof                |                    []                             |  4
+     radius             |             []     []                             |  7
+     recode             |          []        []         []                  | 25
+     rpm                |          [] []     []                     []      | 13
+     screem             |                    []                             |  2
+     scrollkeeper       |          [] []     []                     []      | 26
+     sed                |          []        []         []          []      | 23
+     shared-mime-info   |             []     []         []                  | 29
+     sharutils          |          []        []                     []      | 23
+     shishi             |                    []                             |  3
+     skencil            |                    []                             |  7
+     solfege            |                    []                             |  3
+     soundtracker       |          []        []                             |  9
+     sp                 |          []                                       |  3
+     system-tools-ba... |    []    [] []     []     []  []          []      | 38
+     tar                |          [] []     []                             | 17
+     texinfo            |          []        []         []                  | 15
+     tin                |                                                   |  1
+     tuxpaint           |                    []  []                 []      | 19
+     unicode-han-tra... |                                                   |  0
+     unicode-transla... |                                                   |  2
+     util-linux         |          [] []     []                             | 20
+     util-linux-ng      |          [] []     []                             | 20
+     vorbis-tools       |             []     []                             |  4
+     wastesedge         |                                                   |  1
+     wdiff              |          []        []                             | 23
+     wget               |          []        []                     []      | 20
+     xchat              |             []     []         []          []      | 29
+     xkeyboard-config   |          [] []     []                             | 14
+     xpad               |                    []         []          []      | 15
+                        +---------------------------------------------------+
+       76 teams           tg th tk tr uk ven vi  wa xh zh_CN zh_HK zh_TW zu
+      163 domains          0  3  1 74 51  0  143 21  1  57     7    45    0  2036
+
+   Some counters in the preceding matrix are higher than the number of
+visible blocks let us expect.  This is because a few extra PO files are
+used for implementing regional variants of languages, or language
+dialects.
+
+   For a PO file in the matrix above to be effective, the package to
+which it applies should also have been internationalized and
+distributed as such by its maintainer.  There might be an observable
+lag between the mere existence a PO file and its wide availability in a
+distribution.
+
+   If November 2007 seems to be old, you may fetch a more recent copy
+of this `ABOUT-NLS' file on most GNU archive sites.  The most
+up-to-date matrix with full percentage details can be found at
+`http://translationproject.org/extra/matrix.html'.
+
+1.6 Using `gettext' in new packages
+===================================
+
+If you are writing a freely available program and want to
+internationalize it you are welcome to use GNU `gettext' in your
+package.  Of course you have to respect the GNU Library General Public
+License which covers the use of the GNU `gettext' library.  This means
+in particular that even non-free programs can use `libintl' as a shared
+library, whereas only free software can use `libintl' as a static
+library or use modified versions of `libintl'.
+
+   Once the sources are changed appropriately and the setup can handle
+the use of `gettext' the only thing missing are the translations.  The
+Free Translation Project is also available for packages which are not
+developed inside the GNU project.  Therefore the information given above
+applies also for every other Free Software Project.  Contact
+`coordinator@translationproject.org' to make the `.pot' files available
+to the translation teams.
+
diff --git a/popt-1.16/CHANGES b/popt-1.16/CHANGES
new file mode 100644
index 0000000..0062af2
--- /dev/null
+++ b/popt-1.16/CHANGES
@@ -0,0 +1,204 @@
+1.15 -> 1.16:
+    - add lv.po, update translations (Translation Project).
+    - include xcode project files in distributed popt tar ball.
+    - make distcheck is now squeaky clean.
+    - permit VPATH builds.
+    - add shallow tests using ISP/RAS api-sanity-autotest.pl.
+    - prefix bit set routines with popt to avoid symbol coolisions w rpm.
+    - add tdict.c to exercise popt bit sets against /usr/dict/words.
+    - add poptBitsArgs() method to generate args bit set.
+    - add methods for bit set union and intersection.
+    - permit comma separated attribute lists, handle negated attributes.
+    - better test for POPT_ARG_BITSET.
+    - add POPT_ARG_BITSET handling.
+    - add POPT_ARG_SHORT handling.
+    - handle all callback traversals within a C switch (for extendability ease).
+    - add popt.pc.
+    - devzero2000: add AC_CONFIG_AUX_DIR, AC_CONFIG_MACRO_DIR to configure. Create build-aux 
+    - devzero2000: del acinclude.m4 : AC_CHECK_VA_COPY is not used
+1.14 -> 1.15:
+    - release popt-1.15.
+    - rse: fix building under --disable-nls
+    - rse: fix building under non GLIBC platforms where glob_pattern_p fallback has to be used
+    - rse: fix building under platforms where FNM_EXTMATCH is not available
+    - jbj: poptReadFile: permit NULL if return values are not desired.
+    - jbj: poptReadFile: add routine.
+    - jbj: trim out escaped newline(s) from file content, other fixes.
+    - jbj: permit popt alias/exec to include content from a file.
+    - jbj: permit glob(3) patterns in appName field of popt alias/exec config.
+    - jbj: add test cases for bit operations and toggles.
+    - jbj: avoid displaying --[no]nofoo with POPT_ARGFLAG_TOGGLE.
+    - jbj: add poptArgInfo() to get argInfo, implementing POPT_ARGFLAG_TOGGLE.
+    - jbj: add longOptionStrcmp() to match w POPT_ARGFLAG_TOGGLE.
+    - jbj: change singleDash arg to a bit enum, use LF_ISSET(ONEDASH) instead.
+    - jbj: rework the glob wrappers into something more useful. portability todo++.
+    - jbj: stub in glob(3) wrappers for popt. more useful poptGlob() API next.
+    - jbj: add poptInit/poptFini/poptReadConfigFiles/poptSaneFile routines.
+    - jbj: rewrite poptReadConfigFile(), styling for (i.e. my) readbility.
+    - jbj: reserve a bit for --[no]opt prefix toggling.
+    - jbj: fix: check/print argv[0] in --help for NULL.
+    - jbj: permit type/group bitmasks to be changed (if needed somewhen).
+    - jbj: snip out 8 unused bits for argument groups.
+    - jbj: fix: eliminate dead code (CID#5).
+    - jbj: fix: rearrange code to better hint to coverity scan (CID#9).
+    - jbj: fix: rewrite (and simplify) strdup_locale_from_utf8() (CID#7, CID#8, CID#11, CID#12).
+    - jbj: test/use HAVE_SRANDOM to avoid portability issues.
+    - jbj: fix: remove AC_CHECK_VA_COPY check, va_copy is no longer used.
+    - jbj: add eo.po and id.po (Translation Project).
+    - jbj: updated da.po (Translation Project).
+    - jbj: extend coverage to several additional setup routines.
+    - jbj: add tests for --usage/--help coverage.
+    - jbj: add lconv/gcov targets to Makefile.am.
+    - jbj: refactor automagic (*opt->arg) option arg store to poptSaveArg().
+    - ldv: update INPUT tag in Doxyfile.in, fix doxygen warnings in popthelp.c.
+    - start popt-1.15 development.
+
+1.13 -> 1.14:
+    - release popt-1.14.
+    - jbj: remove findme.c, add poptint.c, to po/POTFILES.in.
+    - jbj: use stpcpy 2 more places (Wayne Davison<wayned@samba.org>).
+    - jbj: add @LTLIBICONV@ when needed (Stanislav Brabec<sbrabec@suse.cz>).
+    - jbj: fix: remove the "echo --" Fedorable hack-a-round.
+    - rsc: updated de.po (not from the Translation Project).
+    - jbj: study the mess with splint. Sigh, splint is so easily confused ...
+    - jbj: rewrite findProgramPath & move to popt.c. Nuke the findme.{c,h} toys.
+    - jbj: use stpcpy several more places (Wayne Davison<wayned@samba.org>).
+    - jbj: enable equal after short option (Wayne Davison<wayned@samba.org>).
+    - jbj: permit "#define POPT_fprintf fprintf" to lose the malloc'ing fprintf.
+    - jbj: use vasprintf(3) when available (Wayne Davison<wayned@samba.org>).
+    - jbj: study the mess with splint, remove annotations where possible.
+    - jbj: add -D_GNU_SOURCE for gcc to use __builtin_stpcpy when available.
+    - jbj: add static inline stpcpy for the deprived.
+    - jbj: use stpcpy to eliminate sprintf calls everywhere but popthelp.c
+    - jbj: remove (now unneeded afaik) va_copy() from POPT_fprintf().
+    - jbj: inline strdup_fprintf() => POPT_fprintf keeping (unneeded?) va_copy.
+    - rse: fix memcpy(3) based va_copy(3) fallbacks
+    - jbj: fix: short option with "foo=bar" argument was mishandled.
+	(Wayne Davison<wayned@samba.org>).
+    - jbj: rename _ABS to avoid collisions, define DBL_EPSILON if not present
+	(Wayne Davison<wayned@samba.org>).
+    - jbj: test for <glob.h>, disable reading directory poptrc files if not.
+    - jbj: add __attribute__(__unused__) (Wayne Davison<wayned@samba.org>).
+    - jbj: permit equal after short option (Wayne Davison<wayned@samba.org>).
+    - jbj: make sure that short options are printed only once with --usage.
+    - jbj: don't display hidden short options with --usage.
+    - jbj: updated sv.po (Translation Project).
+    - jbj: updated {fi,nl}.po (Translation Project).
+    - jbj: updated th.po (Translation Project).
+    - rsc: avoid multilib file conflicts in generated doxygen.
+    - jbj: updated vi.po and zh_CN.po (Translation Project).
+    - jbj: fix: keep the poptHelpOptions array exactly the same size.
+    - jbj: updated pl.po (Translation Project).
+    - jbj: add new fi, th, zh_TW translations (Translation Project).
+    - jbj: add "make updatepo" to simplify PO file maintenance.
+    - jbj: display POPT_ARG_ARGV options in --help just like other options.
+    - jbj: add test for POPT_ARG_ARGV handling.
+    - jbj: fix: permit "--foo bar" and "--foo=bar" equivalent forms for aliases.
+    - jbj: fix: tests 20 -> 23 require an explicit '--' arg separator now.
+    - jbj: popt.3: add POPT_ARG_ARGV description.
+    - jbj: use NUL terminator to align help with (possible) multibyte chars.
+    - jbj: add utf8_skip_data table[] to keep track of utf8 character widths.
+    - jbj: refactor the POPT_WCHAR_HACK into stringDisplayWidth().
+    - jbj: add POPT_dgettext() prototype.
+    - jbj: add POPT_dgettext() for popt internal UTF-8 codeset (Takao Fujiwara).
+    - jbj: add POPT_next_char(), backout POPT_fprintf() usage (for the moment).
+    - jbj: finish POPT_ARG_ARGV implementation.
+    - jbj: free aliases/execs with common code.
+    - jbj: rewrite the callback logic using a switch for simplicity.
+    - jbj: hide bit field structure behind F_ISSET/LF_ISSET/CBF_ISSET macros.
+    - jbj: expose poptSaveLongLong and poptSaveString in the loader map.
+    - jbj: add POPT_ARG_ARGV, starting with the poptSaveString() method.
+    - jbj: add help for POPT_ARG_LONGLONG.
+    - jbj: hmmm, POSIXly correct --echo-args needs fixing, disable for now.
+    - jbj: poptint.h: typedef's for string and string arrays.
+    - jbj: add POPT_ARG_LONGLONG, and poptSaveLongLong().
+    - jbj: poptint.h: add poptSubstituteHelpI18N() to bury the ABI hack.
+    - jbj: start using poptArg and poptArgType() where useful.
+    - jbj: poptint.h: add a poptArgType define for bitfield type abstraction.
+    - jbj: poptint.h: add a poptArg union for opt->arg access without casts.
+    - jbj: include "-- Terminate options" end-of-options msg in poptHelpOptions.
+    - jbj: opt->argDescrip[0] determines "--foo=bar" or "--foo bar".
+    - jbj: --long always padded for alignment with/without "-X, ".
+    - jbj: Display shortName iff printable non-space.
+    - jbj: POPT_AUTOALIAS: if no popt aliases/execs, don't display the sub-head.
+    - jbj: add --libdir=/%{_lib} to popt.spec.
+    - jbj: add .cvsignore to m4 subdirectory.
+    - jbj: remove duplicate nb locale from ALL_LINGUAS.
+    - jbj: autogen.sh: on linux, add --libdir=/lib (no /lib64 autodetect yet).
+
+1.12 -> 1.13:
+    - release popt-1.13.
+    - jbj: add a %track section (as in rpm-5.0) to popt.spec.
+    - jbj: chg poptGetOptArg() to "char *", document application needs to free.
+    - jbj: re-add it.po (from Sandro Bonazzola <sandro.bonazzola@gmail.com>).
+    - jbj: rescuscitate the splint annotations.
+    - jbj: change sizeof to use the type implicitly, rather than explicitly.
+    - jbj: remove incorrect casts, changing to size_t where needed.
+    - jbj: remove unused STD_VFPRINTF macro.
+    - jbj: reindent (and otherwise diddle) recent patch for popt coding style.
+    - jbj: remove splint bounds/branch annotations, little gain, much pain.
+    - jbj: revert alloca usage again again.
+    - jbj: handle Solaris signed character isspace(3) issues consistently.
+    - bero: read /etc/popt.d/* files.
+    - jbj: don't read /etc/popt twice (#290531).
+    - jbj: isspace(3) has i18n encoding signednesss issues on Solaris (#172393).
+    - jbj: refactor column cursor to a structure, carry maxcols as well.
+    - jbj: use TIOCGWINSZ to determine --help column wrapping.
+    - jbj: help formatting for POPT_ARG_MAINCALL.
+    - jbj: remove N_(...) markings from popt.h, markers in popthelp.c instead.
+    - jbj: add zh_CN.po (Translation Project).
+    - jbj: use PACKAGE_BUGREPORT.
+    - jbj: hotwire POPT_AUTOHELP/POPT_AUTOALIAS lookup in popt i18n domain.
+
+1.11 -> 1.12
+    - jbj: plug a memory leak.
+    - jbj: fix index thinko.
+    - jbj: add vi.po (Translation Project).
+    - jbj: add nl.po (Translation Project).
+    
+1.5 -> 1.6
+	- add ability to perform callbacks for every, not just first, match.
+
+1.3 -> 1.5
+	- heavy dose of const's
+	- poptParseArgvString() now NULL terminates the list
+
+1.2.3 -> 1.3
+	- added support for single -
+	- misc bug fixes
+	- portability improvements
+
+1.2.2 -> 1.2.3
+	- fixed memset() in help message generation (Dale Hawkins)
+	- added extern "C" stuff to popt.h for C++ compilers (Dale Hawkins)
+	- const'ified poptParseArgvString (Jeff Garzik)
+
+1.2.1 -> 1.2.2
+	- fixed bug in chaind alias happens which seems to have only
+	  affected --triggers in rpm
+	- added POPT_ARG_VAL
+	- popt.3 installed by default
+
+1.2 -> 1.2.1
+	- added POPT_ARG_INTL_DOMAIN (Elliot Lee)
+	- updated Makefile's to be more GNUish (Elliot Lee)
+
+1.1 -> 1.2
+	- added popt.3 man page (Robert Lynch)
+	- don't use mmap anymore (its lack of portability isn't worth the
+	  trouble)
+	- added test script
+	- added support for exec
+	- removed support for *_POPT_ALIASES env variable -- it was a bad
+	  idea
+	- reorganized into multiple source files
+	- added automatic help generation, POPT_AUTOHELP
+	- added table callbacks
+	- added table inclusion
+	- updated man page for new features
+	- added test scripts
+
+1.0 -> 1.1
+	- moved to autoconf (Fred Fish)
+	- added STRERROR replacement (Norbert Warmuth)
+	- added const keywords (Bruce Perens)
diff --git a/popt-1.16/COPYING b/popt-1.16/COPYING
new file mode 100644
index 0000000..b4c7ca8
--- /dev/null
+++ b/popt-1.16/COPYING
@@ -0,0 +1,22 @@
+Copyright (c) 1998  Red Hat Software
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.  IN NO EVENT SHALL THE
+X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN
+AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+Except as contained in this notice, the name of the X Consortium shall not be
+used in advertising or otherwise to promote the sale, use or other dealings
+in this Software without prior written authorization from the X Consortium.
diff --git a/popt-1.16/Doxyfile.in b/popt-1.16/Doxyfile.in
new file mode 100644
index 0000000..737a73e
--- /dev/null
+++ b/popt-1.16/Doxyfile.in
@@ -0,0 +1,1246 @@
+# Doxyfile 1.4.6
+
+# This file describes the settings to be used by the documentation system
+# doxygen (www.doxygen.org) for a project
+#
+# All text after a hash (#) is considered a comment and will be ignored
+# The format is:
+#       TAG = value [value, ...]
+# For lists items can also be appended using:
+#       TAG += value [value, ...]
+# Values that contain spaces should be placed between quotes (" ")
+
+#---------------------------------------------------------------------------
+# Project related configuration options
+#---------------------------------------------------------------------------
+
+# The PROJECT_NAME tag is a single word (or a sequence of words surrounded 
+# by quotes) that should identify the project.
+
+PROJECT_NAME           = @PACKAGE@
+
+# The PROJECT_NUMBER tag can be used to enter a project or revision number. 
+# This could be handy for archiving the generated documentation or 
+# if some version control system is used.
+
+PROJECT_NUMBER         = @VERSION@
+
+# The OUTPUT_DIRECTORY tag is used to specify the (relative or absolute) 
+# base path where the generated documentation will be put. 
+# If a relative path is entered, it will be relative to the location 
+# where doxygen was started. If left blank the current directory will be used.
+
+OUTPUT_DIRECTORY       = doxygen
+
+# If the CREATE_SUBDIRS tag is set to YES, then doxygen will create 
+# 4096 sub-directories (in 2 levels) under the output directory of each output 
+# format and will distribute the generated files over these directories. 
+# Enabling this option can be useful when feeding doxygen a huge amount of 
+# source files, where putting all generated files in the same directory would 
+# otherwise cause performance problems for the file system.
+
+CREATE_SUBDIRS         = NO
+
+# The OUTPUT_LANGUAGE tag is used to specify the language in which all 
+# documentation generated by doxygen is written. Doxygen will use this 
+# information to generate all constant output in the proper language. 
+# The default language is English, other supported languages are: 
+# Brazilian, Catalan, Chinese, Chinese-Traditional, Croatian, Czech, Danish, 
+# Dutch, Finnish, French, German, Greek, Hungarian, Italian, Japanese, 
+# Japanese-en (Japanese with English messages), Korean, Korean-en, Norwegian, 
+# Polish, Portuguese, Romanian, Russian, Serbian, Slovak, Slovene, Spanish, 
+# Swedish, and Ukrainian.
+
+OUTPUT_LANGUAGE        = English
+
+# This tag can be used to specify the encoding used in the generated output. 
+# The encoding is not always determined by the language that is chosen, 
+# but also whether or not the output is meant for Windows or non-Windows users. 
+# In case there is a difference, setting the USE_WINDOWS_ENCODING tag to YES 
+# forces the Windows encoding (this is the default for the Windows binary), 
+# whereas setting the tag to NO uses a Unix-style encoding (the default for 
+# all platforms other than Windows).
+
+USE_WINDOWS_ENCODING   = NO
+
+# If the BRIEF_MEMBER_DESC tag is set to YES (the default) Doxygen will 
+# include brief member descriptions after the members that are listed in 
+# the file and class documentation (similar to JavaDoc). 
+# Set to NO to disable this.
+
+BRIEF_MEMBER_DESC      = YES
+
+# If the REPEAT_BRIEF tag is set to YES (the default) Doxygen will prepend 
+# the brief description of a member or function before the detailed description. 
+# Note: if both HIDE_UNDOC_MEMBERS and BRIEF_MEMBER_DESC are set to NO, the 
+# brief descriptions will be completely suppressed.
+
+REPEAT_BRIEF           = YES
+
+# This tag implements a quasi-intelligent brief description abbreviator 
+# that is used to form the text in various listings. Each string 
+# in this list, if found as the leading text of the brief description, will be 
+# stripped from the text and the result after processing the whole list, is 
+# used as the annotated text. Otherwise, the brief description is used as-is. 
+# If left blank, the following values are used ("$name" is automatically 
+# replaced with the name of the entity): "The $name class" "The $name widget" 
+# "The $name file" "is" "provides" "specifies" "contains" 
+# "represents" "a" "an" "the"
+
+ABBREVIATE_BRIEF       = 
+
+# If the ALWAYS_DETAILED_SEC and REPEAT_BRIEF tags are both set to YES then 
+# Doxygen will generate a detailed section even if there is only a brief 
+# description.
+
+ALWAYS_DETAILED_SEC    = NO
+
+# If the INLINE_INHERITED_MEMB tag is set to YES, doxygen will show all 
+# inherited members of a class in the documentation of that class as if those 
+# members were ordinary class members. Constructors, destructors and assignment 
+# operators of the base classes will not be shown.
+
+INLINE_INHERITED_MEMB  = NO
+
+# If the FULL_PATH_NAMES tag is set to YES then Doxygen will prepend the full 
+# path before files name in the file list and in the header files. If set 
+# to NO the shortest path that makes the file name unique will be used.
+
+FULL_PATH_NAMES        = YES
+
+# If the FULL_PATH_NAMES tag is set to YES then the STRIP_FROM_PATH tag 
+# can be used to strip a user-defined part of the path. Stripping is 
+# only done if one of the specified strings matches the left-hand part of 
+# the path. The tag can be used to show relative paths in the file list. 
+# If left blank the directory from which doxygen is run is used as the 
+# path to strip.
+
+STRIP_FROM_PATH        = @top_srcdir@/
+
+# The STRIP_FROM_INC_PATH tag can be used to strip a user-defined part of 
+# the path mentioned in the documentation of a class, which tells 
+# the reader which header file to include in order to use a class. 
+# If left blank only the name of the header file containing the class 
+# definition is used. Otherwise one should specify the include paths that 
+# are normally passed to the compiler using the -I flag.
+ 
+STRIP_FROM_INC_PATH    = @top_srcdir@/
+
+# If the SHORT_NAMES tag is set to YES, doxygen will generate much shorter 
+# (but less readable) file names. This can be useful is your file systems 
+# doesn't support long names like on DOS, Mac, or CD-ROM.
+
+SHORT_NAMES            = NO
+
+# If the JAVADOC_AUTOBRIEF tag is set to YES then Doxygen 
+# will interpret the first line (until the first dot) of a JavaDoc-style 
+# comment as the brief description. If set to NO, the JavaDoc 
+# comments will behave just like the Qt-style comments (thus requiring an 
+# explicit @brief command for a brief description.
+
+JAVADOC_AUTOBRIEF      = YES
+
+# The MULTILINE_CPP_IS_BRIEF tag can be set to YES to make Doxygen 
+# treat a multi-line C++ special comment block (i.e. a block of //! or /// 
+# comments) as a brief description. This used to be the default behaviour. 
+# The new default is to treat a multi-line C++ comment block as a detailed 
+# description. Set this tag to YES if you prefer the old behaviour instead.
+
+MULTILINE_CPP_IS_BRIEF = NO
+
+# If the DETAILS_AT_TOP tag is set to YES then Doxygen 
+# will output the detailed description near the top, like JavaDoc.
+# If set to NO, the detailed description appears after the member 
+# documentation.
+
+DETAILS_AT_TOP         = NO
+
+# If the INHERIT_DOCS tag is set to YES (the default) then an undocumented 
+# member inherits the documentation from any documented member that it 
+# re-implements.
+
+INHERIT_DOCS           = YES
+
+# If the SEPARATE_MEMBER_PAGES tag is set to YES, then doxygen will produce 
+# a new page for each member. If set to NO, the documentation of a member will 
+# be part of the file/class/namespace that contains it.
+
+SEPARATE_MEMBER_PAGES  = NO
+
+# The TAB_SIZE tag can be used to set the number of spaces in a tab. 
+# Doxygen uses this value to replace tabs by spaces in code fragments.
+
+TAB_SIZE               = 8
+
+# This tag can be used to specify a number of aliases that acts 
+# as commands in the documentation. An alias has the form "name=value". 
+# For example adding "sideeffect=\par Side Effects:\n" will allow you to 
+# put the command \sideeffect (or @sideeffect) in the documentation, which 
+# will result in a user-defined paragraph with heading "Side Effects:". 
+# You can put \n's in the value part of an alias to insert newlines.
+
+ALIASES                = 
+
+# Set the OPTIMIZE_OUTPUT_FOR_C tag to YES if your project consists of C 
+# sources only. Doxygen will then generate output that is more tailored for C. 
+# For instance, some of the names that are used will be different. The list 
+# of all members will be omitted, etc.
+
+OPTIMIZE_OUTPUT_FOR_C  = YES
+
+# Set the OPTIMIZE_OUTPUT_JAVA tag to YES if your project consists of Java 
+# sources only. Doxygen will then generate output that is more tailored for Java. 
+# For instance, namespaces will be presented as packages, qualified scopes 
+# will look different, etc.
+
+OPTIMIZE_OUTPUT_JAVA   = NO
+
+# If you use STL classes (i.e. std::string, std::vector, etc.) but do not want to 
+# include (a tag file for) the STL sources as input, then you should 
+# set this tag to YES in order to let doxygen match functions declarations and 
+# definitions whose arguments contain STL classes (e.g. func(std::string); v.s. 
+# func(std::string) {}). This also make the inheritance and collaboration 
+# diagrams that involve STL classes more complete and accurate.
+
+BUILTIN_STL_SUPPORT    = NO
+
+# If member grouping is used in the documentation and the DISTRIBUTE_GROUP_DOC 
+# tag is set to YES, then doxygen will reuse the documentation of the first 
+# member in the group (if any) for the other members of the group. By default 
+# all members of a group must be documented explicitly.
+
+DISTRIBUTE_GROUP_DOC   = NO
+
+# Set the SUBGROUPING tag to YES (the default) to allow class member groups of 
+# the same type (for instance a group of public functions) to be put as a 
+# subgroup of that type (e.g. under the Public Functions section). Set it to 
+# NO to prevent subgrouping. Alternatively, this can be done per class using 
+# the \nosubgrouping command.
+
+SUBGROUPING            = YES
+
+#---------------------------------------------------------------------------
+# Build related configuration options
+#---------------------------------------------------------------------------
+
+# If the EXTRACT_ALL tag is set to YES doxygen will assume all entities in 
+# documentation are documented, even if no documentation was available. 
+# Private class members and static file members will be hidden unless 
+# the EXTRACT_PRIVATE and EXTRACT_STATIC tags are set to YES
+
+EXTRACT_ALL            = YES
+
+# If the EXTRACT_PRIVATE tag is set to YES all private members of a class 
+# will be included in the documentation.
+
+EXTRACT_PRIVATE        = NO
+
+# If the EXTRACT_STATIC tag is set to YES all static members of a file 
+# will be included in the documentation.
+
+EXTRACT_STATIC         = YES
+
+# If the EXTRACT_LOCAL_CLASSES tag is set to YES classes (and structs) 
+# defined locally in source files will be included in the documentation. 
+# If set to NO only classes defined in header files are included.
+
+EXTRACT_LOCAL_CLASSES  = YES
+
+# This flag is only useful for Objective-C code. When set to YES local 
+# methods, which are defined in the implementation section but not in 
+# the interface are included in the documentation. 
+# If set to NO (the default) only methods in the interface are included.
+
+EXTRACT_LOCAL_METHODS  = NO
+
+# If the HIDE_UNDOC_MEMBERS tag is set to YES, Doxygen will hide all 
+# undocumented members of documented classes, files or namespaces. 
+# If set to NO (the default) these members will be included in the 
+# various overviews, but no documentation section is generated. 
+# This option has no effect if EXTRACT_ALL is enabled.
+
+HIDE_UNDOC_MEMBERS     = NO
+
+# If the HIDE_UNDOC_CLASSES tag is set to YES, Doxygen will hide all 
+# undocumented classes that are normally visible in the class hierarchy. 
+# If set to NO (the default) these classes will be included in the various 
+# overviews. This option has no effect if EXTRACT_ALL is enabled.
+
+HIDE_UNDOC_CLASSES     = NO
+
+# If the HIDE_FRIEND_COMPOUNDS tag is set to YES, Doxygen will hide all 
+# friend (class|struct|union) declarations. 
+# If set to NO (the default) these declarations will be included in the 
+# documentation.
+
+HIDE_FRIEND_COMPOUNDS  = NO
+
+# If the HIDE_IN_BODY_DOCS tag is set to YES, Doxygen will hide any 
+# documentation blocks found inside the body of a function. 
+# If set to NO (the default) these blocks will be appended to the 
+# function's detailed documentation block.
+
+HIDE_IN_BODY_DOCS      = NO
+
+# The INTERNAL_DOCS tag determines if documentation 
+# that is typed after a \internal command is included. If the tag is set 
+# to NO (the default) then the documentation will be excluded. 
+# Set it to YES to include the internal documentation.
+
+INTERNAL_DOCS          = YES
+
+# If the CASE_SENSE_NAMES tag is set to NO then Doxygen will only generate 
+# file names in lower-case letters. If set to YES upper-case letters are also 
+# allowed. This is useful if you have classes or files whose names only differ 
+# in case and if your file system supports case sensitive file names. Windows 
+# and Mac users are advised to set this option to NO.
+
+CASE_SENSE_NAMES       = YES
+
+# If the HIDE_SCOPE_NAMES tag is set to NO (the default) then Doxygen 
+# will show members with their full class and namespace scopes in the 
+# documentation. If set to YES the scope will be hidden.
+
+HIDE_SCOPE_NAMES       = NO
+
+# If the SHOW_INCLUDE_FILES tag is set to YES (the default) then Doxygen 
+# will put a list of the files that are included by a file in the documentation 
+# of that file.
+
+SHOW_INCLUDE_FILES     = YES
+
+# If the INLINE_INFO tag is set to YES (the default) then a tag [inline] 
+# is inserted in the documentation for inline members.
+
+INLINE_INFO            = YES
+
+# If the SORT_MEMBER_DOCS tag is set to YES (the default) then doxygen 
+# will sort the (detailed) documentation of file and class members 
+# alphabetically by member name. If set to NO the members will appear in 
+# declaration order.
+
+SORT_MEMBER_DOCS       = YES
+
+# If the SORT_BRIEF_DOCS tag is set to YES then doxygen will sort the 
+# brief documentation of file, namespace and class members alphabetically 
+# by member name. If set to NO (the default) the members will appear in 
+# declaration order.
+
+SORT_BRIEF_DOCS        = NO
+
+# If the SORT_BY_SCOPE_NAME tag is set to YES, the class list will be 
+# sorted by fully-qualified names, including namespaces. If set to 
+# NO (the default), the class list will be sorted only by class name, 
+# not including the namespace part. 
+# Note: This option is not very useful if HIDE_SCOPE_NAMES is set to YES.
+# Note: This option applies only to the class list, not to the 
+# alphabetical list.
+
+SORT_BY_SCOPE_NAME     = NO
+
+# The GENERATE_TODOLIST tag can be used to enable (YES) or 
+# disable (NO) the todo list. This list is created by putting \todo 
+# commands in the documentation.
+
+GENERATE_TODOLIST      = YES
+
+# The GENERATE_TESTLIST tag can be used to enable (YES) or 
+# disable (NO) the test list. This list is created by putting \test 
+# commands in the documentation.
+
+GENERATE_TESTLIST      = YES
+
+# The GENERATE_BUGLIST tag can be used to enable (YES) or 
+# disable (NO) the bug list. This list is created by putting \bug 
+# commands in the documentation.
+
+GENERATE_BUGLIST       = YES
+
+# The GENERATE_DEPRECATEDLIST tag can be used to enable (YES) or 
+# disable (NO) the deprecated list. This list is created by putting 
+# \deprecated commands in the documentation.
+
+GENERATE_DEPRECATEDLIST= YES
+
+# The ENABLED_SECTIONS tag can be used to enable conditional 
+# documentation sections, marked by \if sectionname ... \endif.
+
+ENABLED_SECTIONS       = 
+
+# The MAX_INITIALIZER_LINES tag determines the maximum number of lines 
+# the initial value of a variable or define consists of for it to appear in 
+# the documentation. If the initializer consists of more lines than specified 
+# here it will be hidden. Use a value of 0 to hide initializers completely. 
+# The appearance of the initializer of individual variables and defines in the 
+# documentation can be controlled using \showinitializer or \hideinitializer 
+# command in the documentation regardless of this setting.
+
+MAX_INITIALIZER_LINES  = 30
+
+# Set the SHOW_USED_FILES tag to NO to disable the list of files generated 
+# at the bottom of the documentation of classes and structs. If set to YES the 
+# list will mention the files that were used to generate the documentation.
+
+SHOW_USED_FILES        = YES
+
+# If the sources in your project are distributed over multiple directories 
+# then setting the SHOW_DIRECTORIES tag to YES will show the directory hierarchy 
+# in the documentation. The default is NO.
+
+SHOW_DIRECTORIES       = NO
+
+# The FILE_VERSION_FILTER tag can be used to specify a program or script that 
+# doxygen should invoke to get the current version for each file (typically from the 
+# version control system). Doxygen will invoke the program by executing (via 
+# popen()) the command <command> <input-file>, where <command> is the value of 
+# the FILE_VERSION_FILTER tag, and <input-file> is the name of an input file 
+# provided by doxygen. Whatever the program writes to standard output 
+# is used as the file version. See the manual for examples.
+
+FILE_VERSION_FILTER    = 
+
+#---------------------------------------------------------------------------
+# configuration options related to warning and progress messages
+#---------------------------------------------------------------------------
+
+# The QUIET tag can be used to turn on/off the messages that are generated 
+# by doxygen. Possible values are YES and NO. If left blank NO is used.
+
+QUIET                  = NO
+
+# The WARNINGS tag can be used to turn on/off the warning messages that are 
+# generated by doxygen. Possible values are YES and NO. If left blank 
+# NO is used.
+
+WARNINGS               = YES
+
+# If WARN_IF_UNDOCUMENTED is set to YES, then doxygen will generate warnings 
+# for undocumented members. If EXTRACT_ALL is set to YES then this flag will 
+# automatically be disabled.
+
+WARN_IF_UNDOCUMENTED   = YES
+
+# If WARN_IF_DOC_ERROR is set to YES, doxygen will generate warnings for 
+# potential errors in the documentation, such as not documenting some 
+# parameters in a documented function, or documenting parameters that 
+# don't exist or using markup commands wrongly.
+
+WARN_IF_DOC_ERROR      = YES
+
+# This WARN_NO_PARAMDOC option can be abled to get warnings for 
+# functions that are documented, but have no documentation for their parameters 
+# or return value. If set to NO (the default) doxygen will only warn about 
+# wrong or incomplete parameter documentation, but not about the absence of 
+# documentation.
+
+WARN_NO_PARAMDOC       = NO
+
+# The WARN_FORMAT tag determines the format of the warning messages that 
+# doxygen can produce. The string should contain the $file, $line, and $text 
+# tags, which will be replaced by the file and line number from which the 
+# warning originated and the warning text. Optionally the format may contain 
+# $version, which will be replaced by the version of the file (if it could 
+# be obtained via FILE_VERSION_FILTER)
+
+WARN_FORMAT            = "$file:$line: $text"
+
+# The WARN_LOGFILE tag can be used to specify a file to which warning 
+# and error messages should be written. If left blank the output is written 
+# to stderr.
+
+WARN_LOGFILE           = 
+
+#---------------------------------------------------------------------------
+# configuration options related to the input files
+#---------------------------------------------------------------------------
+
+# The INPUT tag can be used to specify the files and/or directories that contain 
+# documented source files. You may enter file names like "myfile.cpp" or 
+# directories like "/usr/src/myproject". Separate the files or directories 
+# with spaces.
+
+INPUT                  = \
+                        ./popt.c \
+                        ./popt.h \
+                        ./poptconfig.c \
+                        ./popthelp.c \
+                        ./poptint.c \
+                        ./poptint.h \
+                        ./poptparse.c \
+			./system.h
+
+# If the value of the INPUT tag contains directories, you can use the 
+# FILE_PATTERNS tag to specify one or more wildcard pattern (like *.cpp 
+# and *.h) to filter out the source-files in the directories. If left 
+# blank the following patterns are tested: 
+# *.c *.cc *.cxx *.cpp *.c++ *.java *.ii *.ixx *.ipp *.i++ *.inl *.h *.hh *.hxx 
+# *.hpp *.h++ *.idl *.odl *.cs *.php *.php3 *.inc *.m *.mm *.py
+
+FILE_PATTERNS          = *.c \
+                         *.h
+
+# The RECURSIVE tag can be used to turn specify whether or not subdirectories 
+# should be searched for input files as well. Possible values are YES and NO. 
+# If left blank NO is used.
+
+RECURSIVE              = NO
+
+# The EXCLUDE tag can be used to specify files and/or directories that should 
+# excluded from the INPUT source files. This way you can easily exclude a 
+# subdirectory from a directory tree whose root is specified with the INPUT tag.
+
+EXCLUDE                = 
+
+# The EXCLUDE_SYMLINKS tag can be used select whether or not files or 
+# directories that are symbolic links (a Unix filesystem feature) are excluded 
+# from the input.
+
+EXCLUDE_SYMLINKS       = NO
+
+# If the value of the INPUT tag contains directories, you can use the 
+# EXCLUDE_PATTERNS tag to specify one or more wildcard patterns to exclude 
+# certain files from those directories. Note that the wildcards are matched 
+# against the file with absolute path, so to exclude all test directories 
+# for example use the pattern */test/*
+
+EXCLUDE_PATTERNS       = 
+
+# The EXAMPLE_PATH tag can be used to specify one or more files or 
+# directories that contain example code fragments that are included (see 
+# the \include command).
+
+EXAMPLE_PATH           = 
+
+# If the value of the EXAMPLE_PATH tag contains directories, you can use the 
+# EXAMPLE_PATTERNS tag to specify one or more wildcard pattern (like *.cpp 
+# and *.h) to filter out the source-files in the directories. If left 
+# blank all files are included.
+
+EXAMPLE_PATTERNS       = 
+
+# If the EXAMPLE_RECURSIVE tag is set to YES then subdirectories will be 
+# searched for input files to be used with the \include or \dontinclude 
+# commands irrespective of the value of the RECURSIVE tag. 
+# Possible values are YES and NO. If left blank NO is used.
+
+EXAMPLE_RECURSIVE      = NO
+
+# The IMAGE_PATH tag can be used to specify one or more files or 
+# directories that contain image that are included in the documentation (see 
+# the \image command).
+
+IMAGE_PATH             = 
+
+# The INPUT_FILTER tag can be used to specify a program that doxygen should 
+# invoke to filter for each input file. Doxygen will invoke the filter program 
+# by executing (via popen()) the command <filter> <input-file>, where <filter> 
+# is the value of the INPUT_FILTER tag, and <input-file> is the name of an 
+# input file. Doxygen will then use the output that the filter program writes 
+# to standard output.  If FILTER_PATTERNS is specified, this tag will be 
+# ignored.
+
+INPUT_FILTER           = 
+
+# The FILTER_PATTERNS tag can be used to specify filters on a per file pattern 
+# basis.  Doxygen will compare the file name with each pattern and apply the 
+# filter if there is a match.  The filters are a list of the form: 
+# pattern=filter (like *.cpp=my_cpp_filter). See INPUT_FILTER for further 
+# info on how filters are used. If FILTER_PATTERNS is empty, INPUT_FILTER 
+# is applied to all files.
+
+FILTER_PATTERNS        = 
+
+# If the FILTER_SOURCE_FILES tag is set to YES, the input filter (if set using 
+# INPUT_FILTER) will be used to filter the input files when producing source 
+# files to browse (i.e. when SOURCE_BROWSER is set to YES).
+
+FILTER_SOURCE_FILES    = NO
+
+#---------------------------------------------------------------------------
+# configuration options related to source browsing
+#---------------------------------------------------------------------------
+
+# If the SOURCE_BROWSER tag is set to YES then a list of source files will 
+# be generated. Documented entities will be cross-referenced with these sources. 
+# Note: To get rid of all source code in the generated output, make sure also 
+# VERBATIM_HEADERS is set to NO.
+
+SOURCE_BROWSER         = YES
+
+# Setting the INLINE_SOURCES tag to YES will include the body 
+# of functions and classes directly in the documentation.
+
+INLINE_SOURCES         = NO
+
+# Setting the STRIP_CODE_COMMENTS tag to YES (the default) will instruct 
+# doxygen to hide any special comment blocks from generated source code 
+# fragments. Normal C and C++ comments will always remain visible.
+
+STRIP_CODE_COMMENTS    = YES
+
+# If the REFERENCED_BY_RELATION tag is set to YES (the default) 
+# then for each documented function all documented 
+# functions referencing it will be listed.
+
+REFERENCED_BY_RELATION = YES
+
+# If the REFERENCES_RELATION tag is set to YES (the default) 
+# then for each documented function all documented entities 
+# called/used by that function will be listed.
+
+REFERENCES_RELATION    = YES
+
+# If the USE_HTAGS tag is set to YES then the references to source code 
+# will point to the HTML generated by the htags(1) tool instead of doxygen 
+# built-in source browser. The htags tool is part of GNU's global source 
+# tagging system (see http://www.gnu.org/software/global/global.html). You 
+# will need version 4.8.6 or higher.
+
+USE_HTAGS              = NO
+
+# If the VERBATIM_HEADERS tag is set to YES (the default) then Doxygen 
+# will generate a verbatim copy of the header file for each class for 
+# which an include is specified. Set to NO to disable this.
+
+VERBATIM_HEADERS       = YES
+
+#---------------------------------------------------------------------------
+# configuration options related to the alphabetical class index
+#---------------------------------------------------------------------------
+
+# If the ALPHABETICAL_INDEX tag is set to YES, an alphabetical index 
+# of all compounds will be generated. Enable this if the project 
+# contains a lot of classes, structs, unions or interfaces.
+
+ALPHABETICAL_INDEX     = NO
+
+# If the alphabetical index is enabled (see ALPHABETICAL_INDEX) then 
+# the COLS_IN_ALPHA_INDEX tag can be used to specify the number of columns 
+# in which this list will be split (can be a number in the range [1..20])
+
+COLS_IN_ALPHA_INDEX    = 5
+
+# In case all classes in a project start with a common prefix, all 
+# classes will be put under the same header in the alphabetical index. 
+# The IGNORE_PREFIX tag can be used to specify one or more prefixes that 
+# should be ignored while generating the index headers.
+
+IGNORE_PREFIX          = 
+
+#---------------------------------------------------------------------------
+# configuration options related to the HTML output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_HTML tag is set to YES (the default) Doxygen will 
+# generate HTML output.
+
+GENERATE_HTML          = YES
+
+# The HTML_OUTPUT tag is used to specify where the HTML docs will be put. 
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be 
+# put in front of it. If left blank `html' will be used as the default path.
+
+HTML_OUTPUT            = html
+
+# The HTML_FILE_EXTENSION tag can be used to specify the file extension for 
+# each generated HTML page (for example: .htm,.php,.asp). If it is left blank 
+# doxygen will generate files with .html extension.
+
+HTML_FILE_EXTENSION    = .html
+
+# The HTML_HEADER tag can be used to specify a personal HTML header for 
+# each generated HTML page. If it is left blank doxygen will generate a 
+# standard header.
+
+HTML_HEADER            = 
+
+# The HTML_FOOTER tag can be used to specify a personal HTML footer for 
+# each generated HTML page. If it is left blank doxygen will generate a 
+# standard footer.
+
+HTML_FOOTER            = footer_no_timestamp.html
+
+# The HTML_STYLESHEET tag can be used to specify a user-defined cascading 
+# style sheet that is used by each HTML page. It can be used to 
+# fine-tune the look of the HTML output. If the tag is left blank doxygen 
+# will generate a default style sheet. Note that doxygen will try to copy 
+# the style sheet file to the HTML output directory, so don't put your own 
+# stylesheet in the HTML output directory as well, or it will be erased!
+
+HTML_STYLESHEET        = 
+
+# If the HTML_ALIGN_MEMBERS tag is set to YES, the members of classes, 
+# files or namespaces will be aligned in HTML using tables. If set to 
+# NO a bullet list will be used.
+
+HTML_ALIGN_MEMBERS     = YES
+
+# If the GENERATE_HTMLHELP tag is set to YES, additional index files 
+# will be generated that can be used as input for tools like the 
+# Microsoft HTML help workshop to generate a compressed HTML help file (.chm) 
+# of the generated HTML documentation.
+
+GENERATE_HTMLHELP      = NO
+
+# If the GENERATE_HTMLHELP tag is set to YES, the CHM_FILE tag can 
+# be used to specify the file name of the resulting .chm file. You 
+# can add a path in front of the file if the result should not be 
+# written to the html output directory.
+
+CHM_FILE               = 
+
+# If the GENERATE_HTMLHELP tag is set to YES, the HHC_LOCATION tag can 
+# be used to specify the location (absolute path including file name) of 
+# the HTML help compiler (hhc.exe). If non-empty doxygen will try to run 
+# the HTML help compiler on the generated index.hhp.
+
+HHC_LOCATION           = 
+
+# If the GENERATE_HTMLHELP tag is set to YES, the GENERATE_CHI flag 
+# controls if a separate .chi index file is generated (YES) or that 
+# it should be included in the master .chm file (NO).
+
+GENERATE_CHI           = NO
+
+# If the GENERATE_HTMLHELP tag is set to YES, the BINARY_TOC flag 
+# controls whether a binary table of contents is generated (YES) or a 
+# normal table of contents (NO) in the .chm file.
+
+BINARY_TOC             = NO
+
+# The TOC_EXPAND flag can be set to YES to add extra items for group members 
+# to the contents of the HTML help documentation and to the tree view.
+
+TOC_EXPAND             = NO
+
+# The DISABLE_INDEX tag can be used to turn on/off the condensed index at 
+# top of each HTML page. The value NO (the default) enables the index and 
+# the value YES disables it.
+
+DISABLE_INDEX          = NO
+
+# This tag can be used to set the number of enum values (range [1..20]) 
+# that doxygen will group on one line in the generated HTML documentation.
+
+ENUM_VALUES_PER_LINE   = 4
+
+# If the GENERATE_TREEVIEW tag is set to YES, a side panel will be
+# generated containing a tree-like index structure (just like the one that 
+# is generated for HTML Help). For this to work a browser that supports 
+# JavaScript, DHTML, CSS and frames is required (for instance Mozilla 1.0+, 
+# Netscape 6.0+, Internet explorer 5.0+, or Konqueror). Windows users are 
+# probably better off using the HTML help feature.
+
+GENERATE_TREEVIEW      = NO
+
+# If the treeview is enabled (see GENERATE_TREEVIEW) then this tag can be 
+# used to set the initial width (in pixels) of the frame in which the tree 
+# is shown.
+
+TREEVIEW_WIDTH         = 250
+
+#---------------------------------------------------------------------------
+# configuration options related to the LaTeX output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_LATEX tag is set to YES (the default) Doxygen will 
+# generate Latex output.
+
+GENERATE_LATEX         = NO
+
+# The LATEX_OUTPUT tag is used to specify where the LaTeX docs will be put. 
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be 
+# put in front of it. If left blank `latex' will be used as the default path.
+
+LATEX_OUTPUT           = latex
+
+# The LATEX_CMD_NAME tag can be used to specify the LaTeX command name to be 
+# invoked. If left blank `latex' will be used as the default command name.
+
+LATEX_CMD_NAME         = latex
+
+# The MAKEINDEX_CMD_NAME tag can be used to specify the command name to 
+# generate index for LaTeX. If left blank `makeindex' will be used as the 
+# default command name.
+
+MAKEINDEX_CMD_NAME     = makeindex
+
+# If the COMPACT_LATEX tag is set to YES Doxygen generates more compact 
+# LaTeX documents. This may be useful for small projects and may help to 
+# save some trees in general.
+
+COMPACT_LATEX          = NO
+
+# The PAPER_TYPE tag can be used to set the paper type that is used 
+# by the printer. Possible values are: a4, a4wide, letter, legal and 
+# executive. If left blank a4wide will be used.
+
+PAPER_TYPE             = letter
+
+# The EXTRA_PACKAGES tag can be to specify one or more names of LaTeX 
+# packages that should be included in the LaTeX output.
+
+EXTRA_PACKAGES         = 
+
+# The LATEX_HEADER tag can be used to specify a personal LaTeX header for 
+# the generated latex document. The header should contain everything until 
+# the first chapter. If it is left blank doxygen will generate a 
+# standard header. Notice: only use this tag if you know what you are doing!
+
+LATEX_HEADER           = 
+
+# If the PDF_HYPERLINKS tag is set to YES, the LaTeX that is generated 
+# is prepared for conversion to pdf (using ps2pdf). The pdf file will 
+# contain links (just like the HTML output) instead of page references 
+# This makes the output suitable for online browsing using a pdf viewer.
+
+PDF_HYPERLINKS         = YES
+
+# If the USE_PDFLATEX tag is set to YES, pdflatex will be used instead of 
+# plain latex in the generated Makefile. Set this option to YES to get a 
+# higher quality PDF documentation.
+
+USE_PDFLATEX           = YES
+
+# If the LATEX_BATCHMODE tag is set to YES, doxygen will add the \\batchmode. 
+# command to the generated LaTeX files. This will instruct LaTeX to keep 
+# running if errors occur, instead of asking the user for help. 
+# This option is also used when generating formulas in HTML.
+
+LATEX_BATCHMODE        = NO
+
+# If LATEX_HIDE_INDICES is set to YES then doxygen will not 
+# include the index chapters (such as File Index, Compound Index, etc.) 
+# in the output.
+
+LATEX_HIDE_INDICES     = NO
+
+#---------------------------------------------------------------------------
+# configuration options related to the RTF output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_RTF tag is set to YES Doxygen will generate RTF output 
+# The RTF output is optimized for Word 97 and may not look very pretty with 
+# other RTF readers or editors.
+
+GENERATE_RTF           = NO
+
+# The RTF_OUTPUT tag is used to specify where the RTF docs will be put. 
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be 
+# put in front of it. If left blank `rtf' will be used as the default path.
+
+RTF_OUTPUT             = rtf
+
+# If the COMPACT_RTF tag is set to YES Doxygen generates more compact 
+# RTF documents. This may be useful for small projects and may help to 
+# save some trees in general.
+
+COMPACT_RTF            = NO
+
+# If the RTF_HYPERLINKS tag is set to YES, the RTF that is generated 
+# will contain hyperlink fields. The RTF file will 
+# contain links (just like the HTML output) instead of page references. 
+# This makes the output suitable for online browsing using WORD or other 
+# programs which support those fields. 
+# Note: wordpad (write) and others do not support links.
+
+RTF_HYPERLINKS         = NO
+
+# Load stylesheet definitions from file. Syntax is similar to doxygen's 
+# config file, i.e. a series of assignments. You only have to provide 
+# replacements, missing definitions are set to their default value.
+
+RTF_STYLESHEET_FILE    = 
+
+# Set optional variables used in the generation of an rtf document. 
+# Syntax is similar to doxygen's config file.
+
+RTF_EXTENSIONS_FILE    = 
+
+#---------------------------------------------------------------------------
+# configuration options related to the man page output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_MAN tag is set to YES (the default) Doxygen will 
+# generate man pages
+
+GENERATE_MAN           = YES
+
+# The MAN_OUTPUT tag is used to specify where the man pages will be put. 
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be 
+# put in front of it. If left blank `man' will be used as the default path.
+
+MAN_OUTPUT             = man
+
+# The MAN_EXTENSION tag determines the extension that is added to 
+# the generated man pages (default is the subroutine's section .3)
+
+MAN_EXTENSION          = .3
+
+# If the MAN_LINKS tag is set to YES and Doxygen generates man output, 
+# then it will generate one additional man file for each entity 
+# documented in the real man page(s). These additional files 
+# only source the real man page, but without them the man command 
+# would be unable to find the correct page. The default is NO.
+
+MAN_LINKS              = NO
+
+#---------------------------------------------------------------------------
+# configuration options related to the XML output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_XML tag is set to YES Doxygen will 
+# generate an XML file that captures the structure of 
+# the code including all documentation.
+
+GENERATE_XML           = NO
+
+# The XML_OUTPUT tag is used to specify where the XML pages will be put. 
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be 
+# put in front of it. If left blank `xml' will be used as the default path.
+
+XML_OUTPUT             = xml
+
+# The XML_SCHEMA tag can be used to specify an XML schema, 
+# which can be used by a validating XML parser to check the 
+# syntax of the XML files.
+
+XML_SCHEMA             = 
+
+# The XML_DTD tag can be used to specify an XML DTD, 
+# which can be used by a validating XML parser to check the 
+# syntax of the XML files.
+
+XML_DTD                = 
+
+# If the XML_PROGRAMLISTING tag is set to YES Doxygen will 
+# dump the program listings (including syntax highlighting 
+# and cross-referencing information) to the XML output. Note that 
+# enabling this will significantly increase the size of the XML output.
+
+XML_PROGRAMLISTING     = YES
+
+#---------------------------------------------------------------------------
+# configuration options for the AutoGen Definitions output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_AUTOGEN_DEF tag is set to YES Doxygen will 
+# generate an AutoGen Definitions (see autogen.sf.net) file 
+# that captures the structure of the code including all 
+# documentation. Note that this feature is still experimental 
+# and incomplete at the moment.
+
+GENERATE_AUTOGEN_DEF   = NO
+
+#---------------------------------------------------------------------------
+# configuration options related to the Perl module output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_PERLMOD tag is set to YES Doxygen will 
+# generate a Perl module file that captures the structure of 
+# the code including all documentation. Note that this 
+# feature is still experimental and incomplete at the 
+# moment.
+
+GENERATE_PERLMOD       = NO
+
+# If the PERLMOD_LATEX tag is set to YES Doxygen will generate 
+# the necessary Makefile rules, Perl scripts and LaTeX code to be able 
+# to generate PDF and DVI output from the Perl module output.
+
+PERLMOD_LATEX          = NO
+
+# If the PERLMOD_PRETTY tag is set to YES the Perl module output will be 
+# nicely formatted so it can be parsed by a human reader.  This is useful 
+# if you want to understand what is going on.  On the other hand, if this 
+# tag is set to NO the size of the Perl module output will be much smaller 
+# and Perl will parse it just the same.
+
+PERLMOD_PRETTY         = YES
+
+# The names of the make variables in the generated doxyrules.make file 
+# are prefixed with the string contained in PERLMOD_MAKEVAR_PREFIX. 
+# This is useful so different doxyrules.make files included by the same 
+# Makefile don't overwrite each other's variables.
+
+PERLMOD_MAKEVAR_PREFIX = 
+
+#---------------------------------------------------------------------------
+# Configuration options related to the preprocessor   
+#---------------------------------------------------------------------------
+
+# If the ENABLE_PREPROCESSING tag is set to YES (the default) Doxygen will 
+# evaluate all C-preprocessor directives found in the sources and include 
+# files.
+
+ENABLE_PREPROCESSING   = YES
+
+# If the MACRO_EXPANSION tag is set to YES Doxygen will expand all macro 
+# names in the source code. If set to NO (the default) only conditional 
+# compilation will be performed. Macro expansion can be done in a controlled 
+# way by setting EXPAND_ONLY_PREDEF to YES.
+
+MACRO_EXPANSION        = YES
+
+# If the EXPAND_ONLY_PREDEF and MACRO_EXPANSION tags are both set to YES 
+# then the macro expansion is limited to the macros specified with the 
+# PREDEFINED and EXPAND_AS_DEFINED tags.
+
+EXPAND_ONLY_PREDEF     = NO
+
+# If the SEARCH_INCLUDES tag is set to YES (the default) the includes files 
+# in the INCLUDE_PATH (see below) will be search if a #include is found.
+
+SEARCH_INCLUDES        = YES
+
+# The INCLUDE_PATH tag can be used to specify one or more directories that 
+# contain include files that are not input files but should be processed by 
+# the preprocessor.
+
+INCLUDE_PATH           = 
+
+# You can use the INCLUDE_FILE_PATTERNS tag to specify one or more wildcard 
+# patterns (like *.h and *.hpp) to filter out the header-files in the 
+# directories. If left blank, the patterns specified with FILE_PATTERNS will 
+# be used.
+
+INCLUDE_FILE_PATTERNS  = 
+
+# The PREDEFINED tag can be used to specify one or more macro names that 
+# are defined before the preprocessor is started (similar to the -D option of 
+# gcc). The argument of the tag is a list of macros of the form: name 
+# or name=definition (no spaces). If the definition and the = are 
+# omitted =1 is assumed. To prevent a macro definition from being 
+# undefined via #undef or recursively expanded use the := operator 
+# instead of the = operator.
+
+PREDEFINED             = 
+
+# If the MACRO_EXPANSION and EXPAND_ONLY_PREDEF tags are set to YES then 
+# this tag can be used to specify a list of macro names that should be expanded. 
+# The macro definition that is found in the sources will be used. 
+# Use the PREDEFINED tag if you want to use a different macro definition.
+
+EXPAND_AS_DEFINED      = 
+
+# If the SKIP_FUNCTION_MACROS tag is set to YES (the default) then 
+# doxygen's preprocessor will remove all function-like macros that are alone 
+# on a line, have an all uppercase name, and do not end with a semicolon. Such 
+# function macros are typically used for boiler-plate code, and will confuse 
+# the parser if not removed.
+
+SKIP_FUNCTION_MACROS   = YES
+
+#---------------------------------------------------------------------------
+# Configuration::additions related to external references   
+#---------------------------------------------------------------------------
+
+# The TAGFILES option can be used to specify one or more tagfiles. 
+# Optionally an initial location of the external documentation 
+# can be added for each tagfile. The format of a tag file without 
+# this location is as follows: 
+#   TAGFILES = file1 file2 ... 
+# Adding location for the tag files is done as follows: 
+#   TAGFILES = file1=loc1 "file2 = loc2" ... 
+# where "loc1" and "loc2" can be relative or absolute paths or 
+# URLs. If a location is present for each tag, the installdox tool 
+# does not have to be run to correct the links.
+# Note that each tag file must have a unique name
+# (where the name does NOT include the path)
+# If a tag file is not located in the directory in which doxygen 
+# is run, you must also specify the path to the tagfile here.
+
+TAGFILES               = 
+
+# When a file name is specified after GENERATE_TAGFILE, doxygen will create 
+# a tag file that is based on the input files it reads.
+
+GENERATE_TAGFILE       = Doxytags
+
+# If the ALLEXTERNALS tag is set to YES all external classes will be listed 
+# in the class index. If set to NO only the inherited external classes 
+# will be listed.
+
+ALLEXTERNALS           = NO
+
+# If the EXTERNAL_GROUPS tag is set to YES all external groups will be listed 
+# in the modules index. If set to NO, only the current project's groups will 
+# be listed.
+
+EXTERNAL_GROUPS        = YES
+
+# The PERL_PATH should be the absolute path and name of the perl script 
+# interpreter (i.e. the result of `which perl').
+
+PERL_PATH              = /usr/bin/perl
+
+#---------------------------------------------------------------------------
+# Configuration options related to the dot tool   
+#---------------------------------------------------------------------------
+
+# If the CLASS_DIAGRAMS tag is set to YES (the default) Doxygen will 
+# generate a inheritance diagram (in HTML, RTF and LaTeX) for classes with base 
+# or super classes. Setting the tag to NO turns the diagrams off. Note that 
+# this option is superseded by the HAVE_DOT option below. This is only a 
+# fallback. It is recommended to install and use dot, since it yields more 
+# powerful graphs.
+
+CLASS_DIAGRAMS         = YES
+
+# If set to YES, the inheritance and collaboration graphs will hide 
+# inheritance and usage relations if the target is undocumented 
+# or is not a class.
+
+HIDE_UNDOC_RELATIONS   = YES
+
+# If you set the HAVE_DOT tag to YES then doxygen will assume the dot tool is 
+# available from the path. This tool is part of Graphviz, a graph visualization 
+# toolkit from AT&T and Lucent Bell Labs. The other options in this section 
+# have no effect if this option is set to NO (the default)
+
+HAVE_DOT               = YES
+
+# If the CLASS_GRAPH and HAVE_DOT tags are set to YES then doxygen 
+# will generate a graph for each documented class showing the direct and 
+# indirect inheritance relations. Setting this tag to YES will force the 
+# the CLASS_DIAGRAMS tag to NO.
+
+CLASS_GRAPH            = YES
+
+# If the COLLABORATION_GRAPH and HAVE_DOT tags are set to YES then doxygen 
+# will generate a graph for each documented class showing the direct and 
+# indirect implementation dependencies (inheritance, containment, and 
+# class references variables) of the class with other documented classes.
+
+COLLABORATION_GRAPH    = YES
+
+# If the GROUP_GRAPHS and HAVE_DOT tags are set to YES then doxygen 
+# will generate a graph for groups, showing the direct groups dependencies
+
+GROUP_GRAPHS           = YES
+
+# If the UML_LOOK tag is set to YES doxygen will generate inheritance and 
+# collaboration diagrams in a style similar to the OMG's Unified Modeling 
+# Language.
+
+UML_LOOK               = NO
+
+# If set to YES, the inheritance and collaboration graphs will show the 
+# relations between templates and their instances.
+
+TEMPLATE_RELATIONS     = YES
+
+# If the ENABLE_PREPROCESSING, SEARCH_INCLUDES, INCLUDE_GRAPH, and HAVE_DOT 
+# tags are set to YES then doxygen will generate a graph for each documented 
+# file showing the direct and indirect include dependencies of the file with 
+# other documented files.
+
+INCLUDE_GRAPH          = YES
+
+# If the ENABLE_PREPROCESSING, SEARCH_INCLUDES, INCLUDED_BY_GRAPH, and 
+# HAVE_DOT tags are set to YES then doxygen will generate a graph for each 
+# documented header file showing the documented files that directly or 
+# indirectly include this file.
+
+INCLUDED_BY_GRAPH      = YES
+
+# If the CALL_GRAPH and HAVE_DOT tags are set to YES then doxygen will 
+# generate a call dependency graph for every global function or class method. 
+# Note that enabling this option will significantly increase the time of a run. 
+# So in most cases it will be better to enable call graphs for selected 
+# functions only using the \callgraph command.
+
+CALL_GRAPH             = NO
+
+# If the GRAPHICAL_HIERARCHY and HAVE_DOT tags are set to YES then doxygen 
+# will graphical hierarchy of all classes instead of a textual one.
+
+GRAPHICAL_HIERARCHY    = YES
+
+# If the DIRECTORY_GRAPH, SHOW_DIRECTORIES and HAVE_DOT tags are set to YES 
+# then doxygen will show the dependencies a directory has on other directories 
+# in a graphical way. The dependency relations are determined by the #include
+# relations between the files in the directories.
+
+DIRECTORY_GRAPH        = YES
+
+# The DOT_IMAGE_FORMAT tag can be used to set the image format of the images 
+# generated by dot. Possible values are png, jpg, or gif
+# If left blank png will be used.
+
+DOT_IMAGE_FORMAT       = png
+
+# The tag DOT_PATH can be used to specify the path where the dot tool can be 
+# found. If left blank, it is assumed the dot tool can be found in the path.
+
+DOT_PATH               = 
+
+# The DOTFILE_DIRS tag can be used to specify one or more directories that 
+# contain dot files that are included in the documentation (see the 
+# \dotfile command).
+
+DOTFILE_DIRS           = 
+
+# The MAX_DOT_GRAPH_WIDTH tag can be used to set the maximum allowed width 
+# (in pixels) of the graphs generated by dot. If a graph becomes larger than 
+# this value, doxygen will try to truncate the graph, so that it fits within 
+# the specified constraint. Beware that most browsers cannot cope with very 
+# large images.
+
+MAX_DOT_GRAPH_WIDTH    = 1024
+
+# The MAX_DOT_GRAPH_HEIGHT tag can be used to set the maximum allows height 
+# (in pixels) of the graphs generated by dot. If a graph becomes larger than 
+# this value, doxygen will try to truncate the graph, so that it fits within 
+# the specified constraint. Beware that most browsers cannot cope with very 
+# large images.
+
+MAX_DOT_GRAPH_HEIGHT   = 1024
+
+# The MAX_DOT_GRAPH_DEPTH tag can be used to set the maximum depth of the 
+# graphs generated by dot. A depth value of 3 means that only nodes reachable 
+# from the root by following a path via at most 3 edges will be shown. Nodes 
+# that lay further from the root node will be omitted. Note that setting this 
+# option to 1 or 2 may greatly reduce the computation time needed for large 
+# code bases. Also note that a graph may be further truncated if the graph's 
+# image dimensions are not sufficient to fit the graph (see MAX_DOT_GRAPH_WIDTH 
+# and MAX_DOT_GRAPH_HEIGHT). If 0 is used for the depth value (the default), 
+# the graph is not depth-constrained.
+
+MAX_DOT_GRAPH_DEPTH    = 0
+
+# Set the DOT_TRANSPARENT tag to YES to generate images with a transparent 
+# background. This is disabled by default, which results in a white background. 
+# Warning: Depending on the platform used, enabling this option may lead to 
+# badly anti-aliased labels on the edges of a graph (i.e. they become hard to 
+# read).
+
+DOT_TRANSPARENT        = NO
+
+# Set the DOT_MULTI_TARGETS tag to YES allow dot to generate multiple output 
+# files in one run (i.e. multiple -o and -T options on the command line). This 
+# makes dot run faster, but since only newer versions of dot (>1.8.10) 
+# support this, this feature is disabled by default.
+
+DOT_MULTI_TARGETS      = NO
+
+# If the GENERATE_LEGEND tag is set to YES (the default) Doxygen will 
+# generate a legend page explaining the meaning of the various boxes and 
+# arrows in the dot generated graphs.
+
+GENERATE_LEGEND        = YES
+
+# If the DOT_CLEANUP tag is set to YES (the default) Doxygen will 
+# remove the intermediate dot files that are used to generate 
+# the various graphs.
+
+DOT_CLEANUP            = YES
+
+#---------------------------------------------------------------------------
+# Configuration::additions related to the search engine   
+#---------------------------------------------------------------------------
+
+# The SEARCHENGINE tag specifies whether or not a search engine should be 
+# used. If set to NO the values of all tags below this one will be ignored.
+
+SEARCHENGINE           = NO
diff --git a/popt-1.16/Makefile.am b/popt-1.16/Makefile.am
new file mode 100644
index 0000000..d7aec9e
--- /dev/null
+++ b/popt-1.16/Makefile.am
@@ -0,0 +1,118 @@
+# Makefile for popt library.
+
+AUTOMAKE_OPTIONS = 1.4 foreign
+
+LINT =		splint
+MCCABE =	pmccabe
+
+EXTRA_DIST = config.rpath lookup3.c autogen.sh CHANGES $(man_MANS) \
+	m4/Makefile.in \
+	footer_no_timestamp.html libpopt.vers \
+	testit.sh test-poptrc \
+	popt.xcodeproj/project.pbxproj \
+	popt.ps
+
+SUBDIRS = po . auto
+
+AM_CPPFLAGS = -I. -I$(top_srcdir)
+
+noinst_HEADERS = poptint.h system.h
+
+noinst_PROGRAMS = test1 test2 tdict # test3
+test1_SOURCES = test1.c
+test1_LDFLAGS = 
+test1_LDADD = $(usrlib_LTLIBRARIES)
+test2_SOURCES = test2.c
+test2_LDFLAGS = 
+test2_LDADD = $(usrlib_LTLIBRARIES)
+#test3_SOURCES = test3.c
+#test3_LDFLAGS = 
+#test3_LDADD = $(usrlib_LTLIBRARIES)
+tdict_SOURCES = tdict.c
+tdict_LDFLAGS = 
+tdict_LDADD = $(usrlib_LTLIBRARIES)
+
+noinst_SCRIPTS = testit.sh
+
+TESTS_ENVIRONMENT = \
+test1="$(top_builddir)/test1"
+
+TESTS = $(top_srcdir)/testit.sh
+
+include_HEADERS = popt.h
+
+usrlibdir = $(libdir)
+usrlib_LTLIBRARIES = libpopt.la
+
+libpopt_la_SOURCES = popt.c poptparse.c poptconfig.c popthelp.c poptint.c
+libpopt_la_LDFLAGS = -no-undefined @LTLIBINTL@ @LTLIBICONV@
+
+pkgconfigdir = $(prefix)/lib/pkgconfig
+pkgconfig_DATA = popt.pc
+
+if HAVE_LD_VERSION_SCRIPT
+libpopt_la_LDFLAGS += -Wl,--version-script=$(top_srcdir)/libpopt.vers
+endif
+
+man_MANS = popt.3
+
+BUILT_SOURCES = popt.pc # popt.lcd
+
+distclean-local:
+	rm -rf .ccache
+
+.PHONY:	updatepo
+updatepo:
+	rsync -Lrtvz  translationproject.org::tp/latest/popt/  po
+
+popt.lcd: Makefile.am ${libpopt_la_SOURCES} ${include_HEADERS} ${noinst_HEADERS}
+	lclint -dump $@ ${libpopt_la_SOURCES}
+
+.PHONY:	sources
+sources:
+	@echo $(libpopt_la_SOURCES:%=popt/%)
+
+.PHONY: lint
+lint:
+	$(LINT) ${DEFS} ${INCLUDES} test1.c ${libpopt_la_SOURCES}
+
+.PHONY:	mccabe
+mccabe:
+	$(MCCABE) $(libpopt_la_SOURCES) | sort -n -r | head -n 10
+
+.PHONY: doxygen
+doxygen: Doxyfile
+	rm -rf doxygen
+	mkdir -p doxygen
+	doxygen
+
+.PHONY:	lcov-reset	# run lcov from scratch, always
+lcov-reset:
+	make lcov-run
+	make lcov-report
+
+.PHONY:	lcov		# run lcov from scratch if the dir is not there
+lcov:
+	make lcov-reset
+
+.PHONY:	lcov-run	# reset run coverage tests
+lcov-run:
+	@-rm -rf lcov
+	find . -name "*.gcda" -exec rm {} \;
+	make check
+
+.PHONY:	lcov-report	# generate report based on current coverage data
+lcov-report:
+	mkdir lcov
+	lcov --directory . --capture --output-file lcov/lcov.info
+	lcov -l lcov/lcov.info | grep -v "`cd $(top_srcdir) && pwd`" | cut -d: -f1 > lcov/remove
+	lcov -r lcov/lcov.info `cat lcov/remove` > lcov/lcov.cleaned.info
+	rm lcov/remove
+	mv lcov/lcov.cleaned.info lcov/lcov.info
+	genhtml -t "$(PACKAGE_STRING)" -o lcov lcov/lcov.info
+
+#.PHONY:	lcov-upload
+#lcov-upload: lcov
+#	rsync -rvz -e ssh --delete lcov/* ???
+
+ACLOCAL_AMFLAGS = -I m4
diff --git a/popt-1.16/Makefile.in b/popt-1.16/Makefile.in
new file mode 100644
index 0000000..2e6890d
--- /dev/null
+++ b/popt-1.16/Makefile.in
@@ -0,0 +1,1234 @@
+# Makefile.in generated by automake 1.11.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002,
+# 2003, 2004, 2005, 2006, 2007, 2008, 2009  Free Software Foundation,
+# Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+# Makefile for popt library.
+
+
+
+
+
+VPATH = @srcdir@
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+target_triplet = @target@
+noinst_PROGRAMS = test1$(EXEEXT) test2$(EXEEXT) tdict$(EXEEXT)
+@HAVE_LD_VERSION_SCRIPT_TRUE@am__append_1 = -Wl,--version-script=$(top_srcdir)/libpopt.vers
+subdir = .
+DIST_COMMON = README $(am__configure_deps) $(include_HEADERS) \
+	$(noinst_HEADERS) $(srcdir)/Doxyfile.in $(srcdir)/Makefile.am \
+	$(srcdir)/Makefile.in $(srcdir)/config.h.in \
+	$(srcdir)/popt.pc.in $(srcdir)/popt.spec.in \
+	$(srcdir)/test-poptrc.in $(top_srcdir)/configure ABOUT-NLS \
+	COPYING config.guess config.rpath config.sub depcomp \
+	install-sh ltmain.sh missing
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/gettext.m4 \
+	$(top_srcdir)/m4/iconv.m4 $(top_srcdir)/m4/lib-ld.m4 \
+	$(top_srcdir)/m4/lib-link.m4 $(top_srcdir)/m4/lib-prefix.m4 \
+	$(top_srcdir)/m4/libtool.m4 $(top_srcdir)/m4/ltoptions.m4 \
+	$(top_srcdir)/m4/ltsugar.m4 $(top_srcdir)/m4/ltversion.m4 \
+	$(top_srcdir)/m4/lt~obsolete.m4 $(top_srcdir)/m4/nls.m4 \
+	$(top_srcdir)/m4/po.m4 $(top_srcdir)/m4/progtest.m4 \
+	$(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+	$(ACLOCAL_M4)
+am__CONFIG_DISTCLEAN_FILES = config.status config.cache config.log \
+ configure.lineno config.status.lineno
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = config.h
+CONFIG_CLEAN_FILES = Doxyfile popt.pc popt.spec test-poptrc
+CONFIG_CLEAN_VPATH_FILES =
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+    $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+    *) f=$$p;; \
+  esac;
+am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`;
+am__install_max = 40
+am__nobase_strip_setup = \
+  srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'`
+am__nobase_strip = \
+  for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||"
+am__nobase_list = $(am__nobase_strip_setup); \
+  for p in $$list; do echo "$$p $$p"; done | \
+  sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \
+  $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \
+    if (++n[$$2] == $(am__install_max)) \
+      { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \
+    END { for (dir in files) print dir, files[dir] }'
+am__base_list = \
+  sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
+  sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__installdirs = "$(DESTDIR)$(usrlibdir)" "$(DESTDIR)$(man3dir)" \
+	"$(DESTDIR)$(pkgconfigdir)" "$(DESTDIR)$(includedir)"
+LTLIBRARIES = $(usrlib_LTLIBRARIES)
+libpopt_la_LIBADD =
+am_libpopt_la_OBJECTS = popt.lo poptparse.lo poptconfig.lo popthelp.lo \
+	poptint.lo
+libpopt_la_OBJECTS = $(am_libpopt_la_OBJECTS)
+libpopt_la_LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) \
+	$(LIBTOOLFLAGS) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \
+	$(libpopt_la_LDFLAGS) $(LDFLAGS) -o $@
+PROGRAMS = $(noinst_PROGRAMS)
+am_tdict_OBJECTS = tdict.$(OBJEXT)
+tdict_OBJECTS = $(am_tdict_OBJECTS)
+tdict_DEPENDENCIES = $(usrlib_LTLIBRARIES)
+tdict_LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \
+	--mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) $(tdict_LDFLAGS) \
+	$(LDFLAGS) -o $@
+am_test1_OBJECTS = test1.$(OBJEXT)
+test1_OBJECTS = $(am_test1_OBJECTS)
+test1_DEPENDENCIES = $(usrlib_LTLIBRARIES)
+test1_LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \
+	--mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) $(test1_LDFLAGS) \
+	$(LDFLAGS) -o $@
+am_test2_OBJECTS = test2.$(OBJEXT)
+test2_OBJECTS = $(am_test2_OBJECTS)
+test2_DEPENDENCIES = $(usrlib_LTLIBRARIES)
+test2_LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \
+	--mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) $(test2_LDFLAGS) \
+	$(LDFLAGS) -o $@
+SCRIPTS = $(noinst_SCRIPTS)
+DEFAULT_INCLUDES = -I.@am__isrc@
+depcomp = $(SHELL) $(top_srcdir)/depcomp
+am__depfiles_maybe = depfiles
+am__mv = mv -f
+COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
+	$(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \
+	--mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) \
+	$(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+CCLD = $(CC)
+LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \
+	--mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) $(AM_LDFLAGS) \
+	$(LDFLAGS) -o $@
+SOURCES = $(libpopt_la_SOURCES) $(tdict_SOURCES) $(test1_SOURCES) \
+	$(test2_SOURCES)
+DIST_SOURCES = $(libpopt_la_SOURCES) $(tdict_SOURCES) $(test1_SOURCES) \
+	$(test2_SOURCES)
+RECURSIVE_TARGETS = all-recursive check-recursive dvi-recursive \
+	html-recursive info-recursive install-data-recursive \
+	install-dvi-recursive install-exec-recursive \
+	install-html-recursive install-info-recursive \
+	install-pdf-recursive install-ps-recursive install-recursive \
+	installcheck-recursive installdirs-recursive pdf-recursive \
+	ps-recursive uninstall-recursive
+man3dir = $(mandir)/man3
+NROFF = nroff
+MANS = $(man_MANS)
+DATA = $(pkgconfig_DATA)
+HEADERS = $(include_HEADERS) $(noinst_HEADERS)
+RECURSIVE_CLEAN_TARGETS = mostlyclean-recursive clean-recursive	\
+  distclean-recursive maintainer-clean-recursive
+AM_RECURSIVE_TARGETS = $(RECURSIVE_TARGETS:-recursive=) \
+	$(RECURSIVE_CLEAN_TARGETS:-recursive=) tags TAGS ctags CTAGS \
+	distdir dist dist-all distcheck
+ETAGS = etags
+CTAGS = ctags
+am__tty_colors = \
+red=; grn=; lgn=; blu=; std=
+DIST_SUBDIRS = $(SUBDIRS)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+distdir = $(PACKAGE)-$(VERSION)
+top_distdir = $(distdir)
+am__remove_distdir = \
+  { test ! -d "$(distdir)" \
+    || { find "$(distdir)" -type d ! -perm -200 -exec chmod u+w {} ';' \
+         && rm -fr "$(distdir)"; }; }
+am__relativize = \
+  dir0=`pwd`; \
+  sed_first='s,^\([^/]*\)/.*$$,\1,'; \
+  sed_rest='s,^[^/]*/*,,'; \
+  sed_last='s,^.*/\([^/]*\)$$,\1,'; \
+  sed_butlast='s,/*[^/]*$$,,'; \
+  while test -n "$$dir1"; do \
+    first=`echo "$$dir1" | sed -e "$$sed_first"`; \
+    if test "$$first" != "."; then \
+      if test "$$first" = ".."; then \
+        dir2=`echo "$$dir0" | sed -e "$$sed_last"`/"$$dir2"; \
+        dir0=`echo "$$dir0" | sed -e "$$sed_butlast"`; \
+      else \
+        first2=`echo "$$dir2" | sed -e "$$sed_first"`; \
+        if test "$$first2" = "$$first"; then \
+          dir2=`echo "$$dir2" | sed -e "$$sed_rest"`; \
+        else \
+          dir2="../$$dir2"; \
+        fi; \
+        dir0="$$dir0"/"$$first"; \
+      fi; \
+    fi; \
+    dir1=`echo "$$dir1" | sed -e "$$sed_rest"`; \
+  done; \
+  reldir="$$dir2"
+DIST_ARCHIVES = $(distdir).tar.gz
+GZIP_ENV = --best
+distuninstallcheck_listfiles = find . -type f -print
+distcleancheck_listfiles = find . -type f -print
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GETTEXT_MACRO_VERSION = @GETTEXT_MACRO_VERSION@
+GMSGFMT = @GMSGFMT@
+GMSGFMT_015 = @GMSGFMT_015@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+INTLLIBS = @INTLLIBS@
+INTL_MACOSX_LIBS = @INTL_MACOSX_LIBS@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBICONV = @LIBICONV@
+LIBINTL = @LIBINTL@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBICONV = @LTLIBICONV@
+LTLIBINTL = @LTLIBINTL@
+LTLIBOBJS = @LTLIBOBJS@
+LT_AGE = @LT_AGE@
+LT_CURRENT = @LT_CURRENT@
+LT_REVISION = @LT_REVISION@
+MAINT = @MAINT@
+MAKEINFO = @MAKEINFO@
+MKDIR_P = @MKDIR_P@
+MSGFMT = @MSGFMT@
+MSGFMT_015 = @MSGFMT_015@
+MSGMERGE = @MSGMERGE@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+POPT_PKGCONFIG_LIBS = @POPT_PKGCONFIG_LIBS@
+POPT_SOURCE_PATH = @POPT_SOURCE_PATH@
+POSUB = @POSUB@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+TARGET = @TARGET@
+U = @U@
+USE_NLS = @USE_NLS@
+VERSION = @VERSION@
+XGETTEXT = @XGETTEXT@
+XGETTEXT_015 = @XGETTEXT_015@
+XGETTEXT_EXTRA_OPTIONS = @XGETTEXT_EXTRA_OPTIONS@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+lt_ECHO = @lt_ECHO@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+subdirs = @subdirs@
+sysconfdir = @sysconfdir@
+target = @target@
+target_alias = @target_alias@
+target_cpu = @target_cpu@
+target_os = @target_os@
+target_vendor = @target_vendor@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+AUTOMAKE_OPTIONS = 1.4 foreign
+LINT = splint
+MCCABE = pmccabe
+EXTRA_DIST = config.rpath lookup3.c autogen.sh CHANGES $(man_MANS) \
+	m4/Makefile.in \
+	footer_no_timestamp.html libpopt.vers \
+	testit.sh test-poptrc \
+	popt.xcodeproj/project.pbxproj \
+	popt.ps
+
+SUBDIRS = po . auto
+AM_CPPFLAGS = -I. -I$(top_srcdir)
+noinst_HEADERS = poptint.h system.h
+test1_SOURCES = test1.c
+test1_LDFLAGS = 
+test1_LDADD = $(usrlib_LTLIBRARIES)
+test2_SOURCES = test2.c
+test2_LDFLAGS = 
+test2_LDADD = $(usrlib_LTLIBRARIES)
+#test3_SOURCES = test3.c
+#test3_LDFLAGS = 
+#test3_LDADD = $(usrlib_LTLIBRARIES)
+tdict_SOURCES = tdict.c
+tdict_LDFLAGS = 
+tdict_LDADD = $(usrlib_LTLIBRARIES)
+noinst_SCRIPTS = testit.sh
+TESTS_ENVIRONMENT = \
+test1="$(top_builddir)/test1"
+
+TESTS = $(top_srcdir)/testit.sh
+include_HEADERS = popt.h
+usrlibdir = $(libdir)
+usrlib_LTLIBRARIES = libpopt.la
+libpopt_la_SOURCES = popt.c poptparse.c poptconfig.c popthelp.c poptint.c
+libpopt_la_LDFLAGS = -no-undefined @LTLIBINTL@ @LTLIBICONV@ \
+	$(am__append_1)
+pkgconfigdir = $(prefix)/lib/pkgconfig
+pkgconfig_DATA = popt.pc
+man_MANS = popt.3
+BUILT_SOURCES = popt.pc # popt.lcd
+
+#.PHONY:	lcov-upload
+#lcov-upload: lcov
+#	rsync -rvz -e ssh --delete lcov/* ???
+ACLOCAL_AMFLAGS = -I m4
+all: $(BUILT_SOURCES) config.h
+	$(MAKE) $(AM_MAKEFLAGS) all-recursive
+
+.SUFFIXES:
+.SUFFIXES: .c .lo .o .obj
+am--refresh:
+	@:
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am  $(am__configure_deps)
+	@for dep in $?; do \
+	  case '$(am__configure_deps)' in \
+	    *$$dep*) \
+	      echo ' cd $(srcdir) && $(AUTOMAKE) --foreign'; \
+	      $(am__cd) $(srcdir) && $(AUTOMAKE) --foreign \
+		&& exit 0; \
+	      exit 1;; \
+	  esac; \
+	done; \
+	echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign Makefile'; \
+	$(am__cd) $(top_srcdir) && \
+	  $(AUTOMAKE) --foreign Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+	@case '$?' in \
+	  *config.status*) \
+	    echo ' $(SHELL) ./config.status'; \
+	    $(SHELL) ./config.status;; \
+	  *) \
+	    echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe)'; \
+	    cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe);; \
+	esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+	$(SHELL) ./config.status --recheck
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+	$(am__cd) $(srcdir) && $(AUTOCONF)
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+	$(am__cd) $(srcdir) && $(ACLOCAL) $(ACLOCAL_AMFLAGS)
+$(am__aclocal_m4_deps):
+
+config.h: stamp-h1
+	@if test ! -f $@; then \
+	  rm -f stamp-h1; \
+	  $(MAKE) $(AM_MAKEFLAGS) stamp-h1; \
+	else :; fi
+
+stamp-h1: $(srcdir)/config.h.in $(top_builddir)/config.status
+	@rm -f stamp-h1
+	cd $(top_builddir) && $(SHELL) ./config.status config.h
+$(srcdir)/config.h.in: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) 
+	($(am__cd) $(top_srcdir) && $(AUTOHEADER))
+	rm -f stamp-h1
+	touch $@
+
+distclean-hdr:
+	-rm -f config.h stamp-h1
+Doxyfile: $(top_builddir)/config.status $(srcdir)/Doxyfile.in
+	cd $(top_builddir) && $(SHELL) ./config.status $@
+popt.pc: $(top_builddir)/config.status $(srcdir)/popt.pc.in
+	cd $(top_builddir) && $(SHELL) ./config.status $@
+popt.spec: $(top_builddir)/config.status $(srcdir)/popt.spec.in
+	cd $(top_builddir) && $(SHELL) ./config.status $@
+test-poptrc: $(top_builddir)/config.status $(srcdir)/test-poptrc.in
+	cd $(top_builddir) && $(SHELL) ./config.status $@
+install-usrlibLTLIBRARIES: $(usrlib_LTLIBRARIES)
+	@$(NORMAL_INSTALL)
+	test -z "$(usrlibdir)" || $(MKDIR_P) "$(DESTDIR)$(usrlibdir)"
+	@list='$(usrlib_LTLIBRARIES)'; test -n "$(usrlibdir)" || list=; \
+	list2=; for p in $$list; do \
+	  if test -f $$p; then \
+	    list2="$$list2 $$p"; \
+	  else :; fi; \
+	done; \
+	test -z "$$list2" || { \
+	  echo " $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL) $(INSTALL_STRIP_FLAG) $$list2 '$(DESTDIR)$(usrlibdir)'"; \
+	  $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL) $(INSTALL_STRIP_FLAG) $$list2 "$(DESTDIR)$(usrlibdir)"; \
+	}
+
+uninstall-usrlibLTLIBRARIES:
+	@$(NORMAL_UNINSTALL)
+	@list='$(usrlib_LTLIBRARIES)'; test -n "$(usrlibdir)" || list=; \
+	for p in $$list; do \
+	  $(am__strip_dir) \
+	  echo " $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=uninstall rm -f '$(DESTDIR)$(usrlibdir)/$$f'"; \
+	  $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=uninstall rm -f "$(DESTDIR)$(usrlibdir)/$$f"; \
+	done
+
+clean-usrlibLTLIBRARIES:
+	-test -z "$(usrlib_LTLIBRARIES)" || rm -f $(usrlib_LTLIBRARIES)
+	@list='$(usrlib_LTLIBRARIES)'; for p in $$list; do \
+	  dir="`echo $$p | sed -e 's|/[^/]*$$||'`"; \
+	  test "$$dir" != "$$p" || dir=.; \
+	  echo "rm -f \"$${dir}/so_locations\""; \
+	  rm -f "$${dir}/so_locations"; \
+	done
+libpopt.la: $(libpopt_la_OBJECTS) $(libpopt_la_DEPENDENCIES) 
+	$(libpopt_la_LINK) -rpath $(usrlibdir) $(libpopt_la_OBJECTS) $(libpopt_la_LIBADD) $(LIBS)
+
+clean-noinstPROGRAMS:
+	@list='$(noinst_PROGRAMS)'; test -n "$$list" || exit 0; \
+	echo " rm -f" $$list; \
+	rm -f $$list || exit $$?; \
+	test -n "$(EXEEXT)" || exit 0; \
+	list=`for p in $$list; do echo "$$p"; done | sed 's/$(EXEEXT)$$//'`; \
+	echo " rm -f" $$list; \
+	rm -f $$list
+tdict$(EXEEXT): $(tdict_OBJECTS) $(tdict_DEPENDENCIES) 
+	@rm -f tdict$(EXEEXT)
+	$(tdict_LINK) $(tdict_OBJECTS) $(tdict_LDADD) $(LIBS)
+test1$(EXEEXT): $(test1_OBJECTS) $(test1_DEPENDENCIES) 
+	@rm -f test1$(EXEEXT)
+	$(test1_LINK) $(test1_OBJECTS) $(test1_LDADD) $(LIBS)
+test2$(EXEEXT): $(test2_OBJECTS) $(test2_DEPENDENCIES) 
+	@rm -f test2$(EXEEXT)
+	$(test2_LINK) $(test2_OBJECTS) $(test2_LDADD) $(LIBS)
+
+mostlyclean-compile:
+	-rm -f *.$(OBJEXT)
+
+distclean-compile:
+	-rm -f *.tab.c
+
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/popt.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/poptconfig.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/popthelp.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/poptint.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/poptparse.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdict.Po@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/test1.Po@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/test2.Po@am__quote@
+
+.c.o:
+@am__fastdepCC_TRUE@	$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+@am__fastdepCC_TRUE@	$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+@AMDEP_TRUE@@am__fastdepCC_FALSE@	source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@	$(COMPILE) -c $<
+
+.c.obj:
+@am__fastdepCC_TRUE@	$(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ `$(CYGPATH_W) '$<'`
+@am__fastdepCC_TRUE@	$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+@AMDEP_TRUE@@am__fastdepCC_FALSE@	source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@	$(COMPILE) -c `$(CYGPATH_W) '$<'`
+
+.c.lo:
+@am__fastdepCC_TRUE@	$(LTCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+@am__fastdepCC_TRUE@	$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Plo
+@AMDEP_TRUE@@am__fastdepCC_FALSE@	source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@	DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@	$(LTCOMPILE) -c -o $@ $<
+
+mostlyclean-libtool:
+	-rm -f *.lo
+
+clean-libtool:
+	-rm -rf .libs _libs
+
+distclean-libtool:
+	-rm -f libtool config.lt
+install-man3: $(man_MANS)
+	@$(NORMAL_INSTALL)
+	test -z "$(man3dir)" || $(MKDIR_P) "$(DESTDIR)$(man3dir)"
+	@list=''; test -n "$(man3dir)" || exit 0; \
+	{ for i in $$list; do echo "$$i"; done; \
+	l2='$(man_MANS)'; for i in $$l2; do echo "$$i"; done | \
+	  sed -n '/\.3[a-z]*$$/p'; \
+	} | while read p; do \
+	  if test -f $$p; then d=; else d="$(srcdir)/"; fi; \
+	  echo "$$d$$p"; echo "$$p"; \
+	done | \
+	sed -e 'n;s,.*/,,;p;h;s,.*\.,,;s,^[^3][0-9a-z]*$$,3,;x' \
+	      -e 's,\.[0-9a-z]*$$,,;$(transform);G;s,\n,.,' | \
+	sed 'N;N;s,\n, ,g' | { \
+	list=; while read file base inst; do \
+	  if test "$$base" = "$$inst"; then list="$$list $$file"; else \
+	    echo " $(INSTALL_DATA) '$$file' '$(DESTDIR)$(man3dir)/$$inst'"; \
+	    $(INSTALL_DATA) "$$file" "$(DESTDIR)$(man3dir)/$$inst" || exit $$?; \
+	  fi; \
+	done; \
+	for i in $$list; do echo "$$i"; done | $(am__base_list) | \
+	while read files; do \
+	  test -z "$$files" || { \
+	    echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(man3dir)'"; \
+	    $(INSTALL_DATA) $$files "$(DESTDIR)$(man3dir)" || exit $$?; }; \
+	done; }
+
+uninstall-man3:
+	@$(NORMAL_UNINSTALL)
+	@list=''; test -n "$(man3dir)" || exit 0; \
+	files=`{ for i in $$list; do echo "$$i"; done; \
+	l2='$(man_MANS)'; for i in $$l2; do echo "$$i"; done | \
+	  sed -n '/\.3[a-z]*$$/p'; \
+	} | sed -e 's,.*/,,;h;s,.*\.,,;s,^[^3][0-9a-z]*$$,3,;x' \
+	      -e 's,\.[0-9a-z]*$$,,;$(transform);G;s,\n,.,'`; \
+	test -z "$$files" || { \
+	  echo " ( cd '$(DESTDIR)$(man3dir)' && rm -f" $$files ")"; \
+	  cd "$(DESTDIR)$(man3dir)" && rm -f $$files; }
+install-pkgconfigDATA: $(pkgconfig_DATA)
+	@$(NORMAL_INSTALL)
+	test -z "$(pkgconfigdir)" || $(MKDIR_P) "$(DESTDIR)$(pkgconfigdir)"
+	@list='$(pkgconfig_DATA)'; test -n "$(pkgconfigdir)" || list=; \
+	for p in $$list; do \
+	  if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+	  echo "$$d$$p"; \
+	done | $(am__base_list) | \
+	while read files; do \
+	  echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(pkgconfigdir)'"; \
+	  $(INSTALL_DATA) $$files "$(DESTDIR)$(pkgconfigdir)" || exit $$?; \
+	done
+
+uninstall-pkgconfigDATA:
+	@$(NORMAL_UNINSTALL)
+	@list='$(pkgconfig_DATA)'; test -n "$(pkgconfigdir)" || list=; \
+	files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \
+	test -n "$$files" || exit 0; \
+	echo " ( cd '$(DESTDIR)$(pkgconfigdir)' && rm -f" $$files ")"; \
+	cd "$(DESTDIR)$(pkgconfigdir)" && rm -f $$files
+install-includeHEADERS: $(include_HEADERS)
+	@$(NORMAL_INSTALL)
+	test -z "$(includedir)" || $(MKDIR_P) "$(DESTDIR)$(includedir)"
+	@list='$(include_HEADERS)'; test -n "$(includedir)" || list=; \
+	for p in $$list; do \
+	  if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+	  echo "$$d$$p"; \
+	done | $(am__base_list) | \
+	while read files; do \
+	  echo " $(INSTALL_HEADER) $$files '$(DESTDIR)$(includedir)'"; \
+	  $(INSTALL_HEADER) $$files "$(DESTDIR)$(includedir)" || exit $$?; \
+	done
+
+uninstall-includeHEADERS:
+	@$(NORMAL_UNINSTALL)
+	@list='$(include_HEADERS)'; test -n "$(includedir)" || list=; \
+	files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \
+	test -n "$$files" || exit 0; \
+	echo " ( cd '$(DESTDIR)$(includedir)' && rm -f" $$files ")"; \
+	cd "$(DESTDIR)$(includedir)" && rm -f $$files
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run `make' without going through this Makefile.
+# To change the values of `make' variables: instead of editing Makefiles,
+# (1) if the variable is set in `config.status', edit `config.status'
+#     (which will cause the Makefiles to be regenerated when you run `make');
+# (2) otherwise, pass the desired values on the `make' command line.
+$(RECURSIVE_TARGETS):
+	@fail= failcom='exit 1'; \
+	for f in x $$MAKEFLAGS; do \
+	  case $$f in \
+	    *=* | --[!k]*);; \
+	    *k*) failcom='fail=yes';; \
+	  esac; \
+	done; \
+	dot_seen=no; \
+	target=`echo $@ | sed s/-recursive//`; \
+	list='$(SUBDIRS)'; for subdir in $$list; do \
+	  echo "Making $$target in $$subdir"; \
+	  if test "$$subdir" = "."; then \
+	    dot_seen=yes; \
+	    local_target="$$target-am"; \
+	  else \
+	    local_target="$$target"; \
+	  fi; \
+	  ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+	  || eval $$failcom; \
+	done; \
+	if test "$$dot_seen" = "no"; then \
+	  $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \
+	fi; test -z "$$fail"
+
+$(RECURSIVE_CLEAN_TARGETS):
+	@fail= failcom='exit 1'; \
+	for f in x $$MAKEFLAGS; do \
+	  case $$f in \
+	    *=* | --[!k]*);; \
+	    *k*) failcom='fail=yes';; \
+	  esac; \
+	done; \
+	dot_seen=no; \
+	case "$@" in \
+	  distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \
+	  *) list='$(SUBDIRS)' ;; \
+	esac; \
+	rev=''; for subdir in $$list; do \
+	  if test "$$subdir" = "."; then :; else \
+	    rev="$$subdir $$rev"; \
+	  fi; \
+	done; \
+	rev="$$rev ."; \
+	target=`echo $@ | sed s/-recursive//`; \
+	for subdir in $$rev; do \
+	  echo "Making $$target in $$subdir"; \
+	  if test "$$subdir" = "."; then \
+	    local_target="$$target-am"; \
+	  else \
+	    local_target="$$target"; \
+	  fi; \
+	  ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+	  || eval $$failcom; \
+	done && test -z "$$fail"
+tags-recursive:
+	list='$(SUBDIRS)'; for subdir in $$list; do \
+	  test "$$subdir" = . || ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \
+	done
+ctags-recursive:
+	list='$(SUBDIRS)'; for subdir in $$list; do \
+	  test "$$subdir" = . || ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) ctags); \
+	done
+
+ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES)
+	list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \
+	unique=`for i in $$list; do \
+	    if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+	  done | \
+	  $(AWK) '{ files[$$0] = 1; nonempty = 1; } \
+	      END { if (nonempty) { for (i in files) print i; }; }'`; \
+	mkid -fID $$unique
+tags: TAGS
+
+TAGS: tags-recursive $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) \
+		$(TAGS_FILES) $(LISP)
+	set x; \
+	here=`pwd`; \
+	if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \
+	  include_option=--etags-include; \
+	  empty_fix=.; \
+	else \
+	  include_option=--include; \
+	  empty_fix=; \
+	fi; \
+	list='$(SUBDIRS)'; for subdir in $$list; do \
+	  if test "$$subdir" = .; then :; else \
+	    test ! -f $$subdir/TAGS || \
+	      set "$$@" "$$include_option=$$here/$$subdir/TAGS"; \
+	  fi; \
+	done; \
+	list='$(SOURCES) $(HEADERS) config.h.in $(LISP) $(TAGS_FILES)'; \
+	unique=`for i in $$list; do \
+	    if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+	  done | \
+	  $(AWK) '{ files[$$0] = 1; nonempty = 1; } \
+	      END { if (nonempty) { for (i in files) print i; }; }'`; \
+	shift; \
+	if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+	  test -n "$$unique" || unique=$$empty_fix; \
+	  if test $$# -gt 0; then \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      "$$@" $$unique; \
+	  else \
+	    $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+	      $$unique; \
+	  fi; \
+	fi
+ctags: CTAGS
+CTAGS: ctags-recursive $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) \
+		$(TAGS_FILES) $(LISP)
+	list='$(SOURCES) $(HEADERS) config.h.in $(LISP) $(TAGS_FILES)'; \
+	unique=`for i in $$list; do \
+	    if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+	  done | \
+	  $(AWK) '{ files[$$0] = 1; nonempty = 1; } \
+	      END { if (nonempty) { for (i in files) print i; }; }'`; \
+	test -z "$(CTAGS_ARGS)$$unique" \
+	  || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+	     $$unique
+
+GTAGS:
+	here=`$(am__cd) $(top_builddir) && pwd` \
+	  && $(am__cd) $(top_srcdir) \
+	  && gtags -i $(GTAGS_ARGS) "$$here"
+
+distclean-tags:
+	-rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+check-TESTS: $(TESTS)
+	@failed=0; all=0; xfail=0; xpass=0; skip=0; \
+	srcdir=$(srcdir); export srcdir; \
+	list=' $(TESTS) '; \
+	$(am__tty_colors); \
+	if test -n "$$list"; then \
+	  for tst in $$list; do \
+	    if test -f ./$$tst; then dir=./; \
+	    elif test -f $$tst; then dir=; \
+	    else dir="$(srcdir)/"; fi; \
+	    if $(TESTS_ENVIRONMENT) $${dir}$$tst; then \
+	      all=`expr $$all + 1`; \
+	      case " $(XFAIL_TESTS) " in \
+	      *[\ \	]$$tst[\ \	]*) \
+		xpass=`expr $$xpass + 1`; \
+		failed=`expr $$failed + 1`; \
+		col=$$red; res=XPASS; \
+	      ;; \
+	      *) \
+		col=$$grn; res=PASS; \
+	      ;; \
+	      esac; \
+	    elif test $$? -ne 77; then \
+	      all=`expr $$all + 1`; \
+	      case " $(XFAIL_TESTS) " in \
+	      *[\ \	]$$tst[\ \	]*) \
+		xfail=`expr $$xfail + 1`; \
+		col=$$lgn; res=XFAIL; \
+	      ;; \
+	      *) \
+		failed=`expr $$failed + 1`; \
+		col=$$red; res=FAIL; \
+	      ;; \
+	      esac; \
+	    else \
+	      skip=`expr $$skip + 1`; \
+	      col=$$blu; res=SKIP; \
+	    fi; \
+	    echo "$${col}$$res$${std}: $$tst"; \
+	  done; \
+	  if test "$$all" -eq 1; then \
+	    tests="test"; \
+	    All=""; \
+	  else \
+	    tests="tests"; \
+	    All="All "; \
+	  fi; \
+	  if test "$$failed" -eq 0; then \
+	    if test "$$xfail" -eq 0; then \
+	      banner="$$All$$all $$tests passed"; \
+	    else \
+	      if test "$$xfail" -eq 1; then failures=failure; else failures=failures; fi; \
+	      banner="$$All$$all $$tests behaved as expected ($$xfail expected $$failures)"; \
+	    fi; \
+	  else \
+	    if test "$$xpass" -eq 0; then \
+	      banner="$$failed of $$all $$tests failed"; \
+	    else \
+	      if test "$$xpass" -eq 1; then passes=pass; else passes=passes; fi; \
+	      banner="$$failed of $$all $$tests did not behave as expected ($$xpass unexpected $$passes)"; \
+	    fi; \
+	  fi; \
+	  dashes="$$banner"; \
+	  skipped=""; \
+	  if test "$$skip" -ne 0; then \
+	    if test "$$skip" -eq 1; then \
+	      skipped="($$skip test was not run)"; \
+	    else \
+	      skipped="($$skip tests were not run)"; \
+	    fi; \
+	    test `echo "$$skipped" | wc -c` -le `echo "$$banner" | wc -c` || \
+	      dashes="$$skipped"; \
+	  fi; \
+	  report=""; \
+	  if test "$$failed" -ne 0 && test -n "$(PACKAGE_BUGREPORT)"; then \
+	    report="Please report to $(PACKAGE_BUGREPORT)"; \
+	    test `echo "$$report" | wc -c` -le `echo "$$banner" | wc -c` || \
+	      dashes="$$report"; \
+	  fi; \
+	  dashes=`echo "$$dashes" | sed s/./=/g`; \
+	  if test "$$failed" -eq 0; then \
+	    echo "$$grn$$dashes"; \
+	  else \
+	    echo "$$red$$dashes"; \
+	  fi; \
+	  echo "$$banner"; \
+	  test -z "$$skipped" || echo "$$skipped"; \
+	  test -z "$$report" || echo "$$report"; \
+	  echo "$$dashes$$std"; \
+	  test "$$failed" -eq 0; \
+	else :; fi
+
+distdir: $(DISTFILES)
+	@list='$(MANS)'; if test -n "$$list"; then \
+	  list=`for p in $$list; do \
+	    if test -f $$p; then d=; else d="$(srcdir)/"; fi; \
+	    if test -f "$$d$$p"; then echo "$$d$$p"; else :; fi; done`; \
+	  if test -n "$$list" && \
+	    grep 'ab help2man is required to generate this page' $$list >/dev/null; then \
+	    echo "error: found man pages containing the \`missing help2man' replacement text:" >&2; \
+	    grep -l 'ab help2man is required to generate this page' $$list | sed 's/^/         /' >&2; \
+	    echo "       to fix them, install help2man, remove and regenerate the man pages;" >&2; \
+	    echo "       typically \`make maintainer-clean' will remove them" >&2; \
+	    exit 1; \
+	  else :; fi; \
+	else :; fi
+	$(am__remove_distdir)
+	test -d "$(distdir)" || mkdir "$(distdir)"
+	@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	list='$(DISTFILES)'; \
+	  dist_files=`for file in $$list; do echo $$file; done | \
+	  sed -e "s|^$$srcdirstrip/||;t" \
+	      -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+	case $$dist_files in \
+	  */*) $(MKDIR_P) `echo "$$dist_files" | \
+			   sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+			   sort -u` ;; \
+	esac; \
+	for file in $$dist_files; do \
+	  if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+	  if test -d $$d/$$file; then \
+	    dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+	    if test -d "$(distdir)/$$file"; then \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+	      cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+	  else \
+	    test -f "$(distdir)/$$file" \
+	    || cp -p $$d/$$file "$(distdir)/$$file" \
+	    || exit 1; \
+	  fi; \
+	done
+	@list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+	  if test "$$subdir" = .; then :; else \
+	    test -d "$(distdir)/$$subdir" \
+	    || $(MKDIR_P) "$(distdir)/$$subdir" \
+	    || exit 1; \
+	  fi; \
+	done
+	@list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+	  if test "$$subdir" = .; then :; else \
+	    dir1=$$subdir; dir2="$(distdir)/$$subdir"; \
+	    $(am__relativize); \
+	    new_distdir=$$reldir; \
+	    dir1=$$subdir; dir2="$(top_distdir)"; \
+	    $(am__relativize); \
+	    new_top_distdir=$$reldir; \
+	    echo " (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir="$$new_top_distdir" distdir="$$new_distdir" \\"; \
+	    echo "     am__remove_distdir=: am__skip_length_check=: am__skip_mode_fix=: distdir)"; \
+	    ($(am__cd) $$subdir && \
+	      $(MAKE) $(AM_MAKEFLAGS) \
+	        top_distdir="$$new_top_distdir" \
+	        distdir="$$new_distdir" \
+		am__remove_distdir=: \
+		am__skip_length_check=: \
+		am__skip_mode_fix=: \
+	        distdir) \
+	      || exit 1; \
+	  fi; \
+	done
+	-test -n "$(am__skip_mode_fix)" \
+	|| find "$(distdir)" -type d ! -perm -755 \
+		-exec chmod u+rwx,go+rx {} \; -o \
+	  ! -type d ! -perm -444 -links 1 -exec chmod a+r {} \; -o \
+	  ! -type d ! -perm -400 -exec chmod a+r {} \; -o \
+	  ! -type d ! -perm -444 -exec $(install_sh) -c -m a+r {} {} \; \
+	|| chmod -R a+r "$(distdir)"
+dist-gzip: distdir
+	tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz
+	$(am__remove_distdir)
+
+dist-bzip2: distdir
+	tardir=$(distdir) && $(am__tar) | bzip2 -9 -c >$(distdir).tar.bz2
+	$(am__remove_distdir)
+
+dist-lzma: distdir
+	tardir=$(distdir) && $(am__tar) | lzma -9 -c >$(distdir).tar.lzma
+	$(am__remove_distdir)
+
+dist-xz: distdir
+	tardir=$(distdir) && $(am__tar) | xz -c >$(distdir).tar.xz
+	$(am__remove_distdir)
+
+dist-tarZ: distdir
+	tardir=$(distdir) && $(am__tar) | compress -c >$(distdir).tar.Z
+	$(am__remove_distdir)
+
+dist-shar: distdir
+	shar $(distdir) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).shar.gz
+	$(am__remove_distdir)
+
+dist-zip: distdir
+	-rm -f $(distdir).zip
+	zip -rq $(distdir).zip $(distdir)
+	$(am__remove_distdir)
+
+dist dist-all: distdir
+	tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz
+	$(am__remove_distdir)
+
+# This target untars the dist file and tries a VPATH configuration.  Then
+# it guarantees that the distribution is self-contained by making another
+# tarfile.
+distcheck: dist
+	case '$(DIST_ARCHIVES)' in \
+	*.tar.gz*) \
+	  GZIP=$(GZIP_ENV) gzip -dc $(distdir).tar.gz | $(am__untar) ;;\
+	*.tar.bz2*) \
+	  bzip2 -dc $(distdir).tar.bz2 | $(am__untar) ;;\
+	*.tar.lzma*) \
+	  lzma -dc $(distdir).tar.lzma | $(am__untar) ;;\
+	*.tar.xz*) \
+	  xz -dc $(distdir).tar.xz | $(am__untar) ;;\
+	*.tar.Z*) \
+	  uncompress -c $(distdir).tar.Z | $(am__untar) ;;\
+	*.shar.gz*) \
+	  GZIP=$(GZIP_ENV) gzip -dc $(distdir).shar.gz | unshar ;;\
+	*.zip*) \
+	  unzip $(distdir).zip ;;\
+	esac
+	chmod -R a-w $(distdir); chmod a+w $(distdir)
+	mkdir $(distdir)/_build
+	mkdir $(distdir)/_inst
+	chmod a-w $(distdir)
+	test -d $(distdir)/_build || exit 0; \
+	dc_install_base=`$(am__cd) $(distdir)/_inst && pwd | sed -e 's,^[^:\\/]:[\\/],/,'` \
+	  && dc_destdir="$${TMPDIR-/tmp}/am-dc-$$$$/" \
+	  && am__cwd=`pwd` \
+	  && $(am__cd) $(distdir)/_build \
+	  && ../configure --srcdir=.. --prefix="$$dc_install_base" \
+	    $(DISTCHECK_CONFIGURE_FLAGS) \
+	  && $(MAKE) $(AM_MAKEFLAGS) \
+	  && $(MAKE) $(AM_MAKEFLAGS) dvi \
+	  && $(MAKE) $(AM_MAKEFLAGS) check \
+	  && $(MAKE) $(AM_MAKEFLAGS) install \
+	  && $(MAKE) $(AM_MAKEFLAGS) installcheck \
+	  && $(MAKE) $(AM_MAKEFLAGS) uninstall \
+	  && $(MAKE) $(AM_MAKEFLAGS) distuninstallcheck_dir="$$dc_install_base" \
+	        distuninstallcheck \
+	  && chmod -R a-w "$$dc_install_base" \
+	  && ({ \
+	       (cd ../.. && umask 077 && mkdir "$$dc_destdir") \
+	       && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" install \
+	       && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" uninstall \
+	       && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" \
+	            distuninstallcheck_dir="$$dc_destdir" distuninstallcheck; \
+	      } || { rm -rf "$$dc_destdir"; exit 1; }) \
+	  && rm -rf "$$dc_destdir" \
+	  && $(MAKE) $(AM_MAKEFLAGS) dist \
+	  && rm -rf $(DIST_ARCHIVES) \
+	  && $(MAKE) $(AM_MAKEFLAGS) distcleancheck \
+	  && cd "$$am__cwd" \
+	  || exit 1
+	$(am__remove_distdir)
+	@(echo "$(distdir) archives ready for distribution: "; \
+	  list='$(DIST_ARCHIVES)'; for i in $$list; do echo $$i; done) | \
+	  sed -e 1h -e 1s/./=/g -e 1p -e 1x -e '$$p' -e '$$x'
+distuninstallcheck:
+	@$(am__cd) '$(distuninstallcheck_dir)' \
+	&& test `$(distuninstallcheck_listfiles) | wc -l` -le 1 \
+	   || { echo "ERROR: files left after uninstall:" ; \
+	        if test -n "$(DESTDIR)"; then \
+	          echo "  (check DESTDIR support)"; \
+	        fi ; \
+	        $(distuninstallcheck_listfiles) ; \
+	        exit 1; } >&2
+distcleancheck: distclean
+	@if test '$(srcdir)' = . ; then \
+	  echo "ERROR: distcleancheck can only run from a VPATH build" ; \
+	  exit 1 ; \
+	fi
+	@test `$(distcleancheck_listfiles) | wc -l` -eq 0 \
+	  || { echo "ERROR: files left in build directory after distclean:" ; \
+	       $(distcleancheck_listfiles) ; \
+	       exit 1; } >&2
+check-am: all-am
+	$(MAKE) $(AM_MAKEFLAGS) check-TESTS
+check: $(BUILT_SOURCES)
+	$(MAKE) $(AM_MAKEFLAGS) check-recursive
+all-am: Makefile $(LTLIBRARIES) $(PROGRAMS) $(SCRIPTS) $(MANS) $(DATA) \
+		$(HEADERS) config.h
+installdirs: installdirs-recursive
+installdirs-am:
+	for dir in "$(DESTDIR)$(usrlibdir)" "$(DESTDIR)$(man3dir)" "$(DESTDIR)$(pkgconfigdir)" "$(DESTDIR)$(includedir)"; do \
+	  test -z "$$dir" || $(MKDIR_P) "$$dir"; \
+	done
+install: $(BUILT_SOURCES)
+	$(MAKE) $(AM_MAKEFLAGS) install-recursive
+install-exec: install-exec-recursive
+install-data: install-data-recursive
+uninstall: uninstall-recursive
+
+install-am: all-am
+	@$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-recursive
+install-strip:
+	$(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	  install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	  `test -z '$(STRIP)' || \
+	    echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+	-test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+	-test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+	@echo "This command is intended for maintainers to use"
+	@echo "it deletes files that may require special tools to rebuild."
+	-test -z "$(BUILT_SOURCES)" || rm -f $(BUILT_SOURCES)
+clean: clean-recursive
+
+clean-am: clean-generic clean-libtool clean-noinstPROGRAMS \
+	clean-usrlibLTLIBRARIES mostlyclean-am
+
+distclean: distclean-recursive
+	-rm -f $(am__CONFIG_DISTCLEAN_FILES)
+	-rm -rf ./$(DEPDIR)
+	-rm -f Makefile
+distclean-am: clean-am distclean-compile distclean-generic \
+	distclean-hdr distclean-libtool distclean-local distclean-tags
+
+dvi: dvi-recursive
+
+dvi-am:
+
+html: html-recursive
+
+html-am:
+
+info: info-recursive
+
+info-am:
+
+install-data-am: install-includeHEADERS install-man \
+	install-pkgconfigDATA install-usrlibLTLIBRARIES
+
+install-dvi: install-dvi-recursive
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-recursive
+
+install-html-am:
+
+install-info: install-info-recursive
+
+install-info-am:
+
+install-man: install-man3
+
+install-pdf: install-pdf-recursive
+
+install-pdf-am:
+
+install-ps: install-ps-recursive
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-recursive
+	-rm -f $(am__CONFIG_DISTCLEAN_FILES)
+	-rm -rf $(top_srcdir)/autom4te.cache
+	-rm -rf ./$(DEPDIR)
+	-rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-recursive
+
+mostlyclean-am: mostlyclean-compile mostlyclean-generic \
+	mostlyclean-libtool
+
+pdf: pdf-recursive
+
+pdf-am:
+
+ps: ps-recursive
+
+ps-am:
+
+uninstall-am: uninstall-includeHEADERS uninstall-man \
+	uninstall-pkgconfigDATA uninstall-usrlibLTLIBRARIES
+
+uninstall-man: uninstall-man3
+
+.MAKE: $(RECURSIVE_CLEAN_TARGETS) $(RECURSIVE_TARGETS) all check \
+	check-am ctags-recursive install install-am install-strip \
+	tags-recursive
+
+.PHONY: $(RECURSIVE_CLEAN_TARGETS) $(RECURSIVE_TARGETS) CTAGS GTAGS \
+	all all-am am--refresh check check-TESTS check-am clean \
+	clean-generic clean-libtool clean-noinstPROGRAMS \
+	clean-usrlibLTLIBRARIES ctags ctags-recursive dist dist-all \
+	dist-bzip2 dist-gzip dist-lzma dist-shar dist-tarZ dist-xz \
+	dist-zip distcheck distclean distclean-compile \
+	distclean-generic distclean-hdr distclean-libtool \
+	distclean-local distclean-tags distcleancheck distdir \
+	distuninstallcheck dvi dvi-am html html-am info info-am \
+	install install-am install-data install-data-am install-dvi \
+	install-dvi-am install-exec install-exec-am install-html \
+	install-html-am install-includeHEADERS install-info \
+	install-info-am install-man install-man3 install-pdf \
+	install-pdf-am install-pkgconfigDATA install-ps install-ps-am \
+	install-strip install-usrlibLTLIBRARIES installcheck \
+	installcheck-am installdirs installdirs-am maintainer-clean \
+	maintainer-clean-generic mostlyclean mostlyclean-compile \
+	mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+	tags tags-recursive uninstall uninstall-am \
+	uninstall-includeHEADERS uninstall-man uninstall-man3 \
+	uninstall-pkgconfigDATA uninstall-usrlibLTLIBRARIES
+
+
+distclean-local:
+	rm -rf .ccache
+
+.PHONY:	updatepo
+updatepo:
+	rsync -Lrtvz  translationproject.org::tp/latest/popt/  po
+
+popt.lcd: Makefile.am ${libpopt_la_SOURCES} ${include_HEADERS} ${noinst_HEADERS}
+	lclint -dump $@ ${libpopt_la_SOURCES}
+
+.PHONY:	sources
+sources:
+	@echo $(libpopt_la_SOURCES:%=popt/%)
+
+.PHONY: lint
+lint:
+	$(LINT) ${DEFS} ${INCLUDES} test1.c ${libpopt_la_SOURCES}
+
+.PHONY:	mccabe
+mccabe:
+	$(MCCABE) $(libpopt_la_SOURCES) | sort -n -r | head -n 10
+
+.PHONY: doxygen
+doxygen: Doxyfile
+	rm -rf doxygen
+	mkdir -p doxygen
+	doxygen
+
+.PHONY:	lcov-reset	# run lcov from scratch, always
+lcov-reset:
+	make lcov-run
+	make lcov-report
+
+.PHONY:	lcov		# run lcov from scratch if the dir is not there
+lcov:
+	make lcov-reset
+
+.PHONY:	lcov-run	# reset run coverage tests
+lcov-run:
+	@-rm -rf lcov
+	find . -name "*.gcda" -exec rm {} \;
+	make check
+
+.PHONY:	lcov-report	# generate report based on current coverage data
+lcov-report:
+	mkdir lcov
+	lcov --directory . --capture --output-file lcov/lcov.info
+	lcov -l lcov/lcov.info | grep -v "`cd $(top_srcdir) && pwd`" | cut -d: -f1 > lcov/remove
+	lcov -r lcov/lcov.info `cat lcov/remove` > lcov/lcov.cleaned.info
+	rm lcov/remove
+	mv lcov/lcov.cleaned.info lcov/lcov.info
+	genhtml -t "$(PACKAGE_STRING)" -o lcov lcov/lcov.info
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/popt-1.16/README b/popt-1.16/README
new file mode 100644
index 0000000..c66432d
--- /dev/null
+++ b/popt-1.16/README
@@ -0,0 +1,16 @@
+This is the popt(3) command line option parsing library. While it is similiar
+to getopt(3), it contains a number of enhancements, including:
+
+	1) popt is fully reentrant
+	2) popt can parse arbitrary argv[] style arrays while 
+	   getopt(3) makes this quite difficult
+	3) popt allows users to alias command line arguments
+	4) popt provides convience functions for parsing strings
+	   into argv[] style arrays
+
+Complete documentation on popt(3) is available in popt.ps (included in this
+tarball), which is excerpted with permission from the book "Linux
+Application Development" by Michael K. Johnson and Erik Troan (available
+from Addison Wesley in May, 1998).
+
+Comments on popt should be addressed to popt-devel@rpm5.org.
diff --git a/popt-1.16/aclocal.m4 b/popt-1.16/aclocal.m4
new file mode 100644
index 0000000..185a208
--- /dev/null
+++ b/popt-1.16/aclocal.m4
@@ -0,0 +1,1082 @@
+# generated automatically by aclocal 1.11.1 -*- Autoconf -*-
+
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004,
+# 2005, 2006, 2007, 2008, 2009  Free Software Foundation, Inc.
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+m4_ifndef([AC_AUTOCONF_VERSION],
+  [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
+m4_if(m4_defn([AC_AUTOCONF_VERSION]), [2.63],,
+[m4_warning([this file was generated for autoconf 2.63.
+You have another version of autoconf.  It may work, but is not guaranteed to.
+If you have problems, you may need to regenerate the build system entirely.
+To do so, use the procedure documented by the package, typically `autoreconf'.])])
+
+# intlmacosx.m4 serial 1 (gettext-0.17)
+dnl Copyright (C) 2004-2007 Free Software Foundation, Inc.
+dnl This file is free software; the Free Software Foundation
+dnl gives unlimited permission to copy and/or distribute it,
+dnl with or without modifications, as long as this notice is preserved.
+dnl
+dnl This file can can be used in projects which are not available under
+dnl the GNU General Public License or the GNU Library General Public
+dnl License but which still want to provide support for the GNU gettext
+dnl functionality.
+dnl Please note that the actual code of the GNU gettext library is covered
+dnl by the GNU Library General Public License, and the rest of the GNU
+dnl gettext package package is covered by the GNU General Public License.
+dnl They are *not* in the public domain.
+
+dnl Checks for special options needed on MacOS X.
+dnl Defines INTL_MACOSX_LIBS.
+AC_DEFUN([gt_INTL_MACOSX],
+[
+  dnl Check for API introduced in MacOS X 10.2.
+  AC_CACHE_CHECK([for CFPreferencesCopyAppValue],
+    gt_cv_func_CFPreferencesCopyAppValue,
+    [gt_save_LIBS="$LIBS"
+     LIBS="$LIBS -Wl,-framework -Wl,CoreFoundation"
+     AC_TRY_LINK([#include <CoreFoundation/CFPreferences.h>],
+       [CFPreferencesCopyAppValue(NULL, NULL)],
+       [gt_cv_func_CFPreferencesCopyAppValue=yes],
+       [gt_cv_func_CFPreferencesCopyAppValue=no])
+     LIBS="$gt_save_LIBS"])
+  if test $gt_cv_func_CFPreferencesCopyAppValue = yes; then
+    AC_DEFINE([HAVE_CFPREFERENCESCOPYAPPVALUE], 1,
+      [Define to 1 if you have the MacOS X function CFPreferencesCopyAppValue in the CoreFoundation framework.])
+  fi
+  dnl Check for API introduced in MacOS X 10.3.
+  AC_CACHE_CHECK([for CFLocaleCopyCurrent], gt_cv_func_CFLocaleCopyCurrent,
+    [gt_save_LIBS="$LIBS"
+     LIBS="$LIBS -Wl,-framework -Wl,CoreFoundation"
+     AC_TRY_LINK([#include <CoreFoundation/CFLocale.h>], [CFLocaleCopyCurrent();],
+       [gt_cv_func_CFLocaleCopyCurrent=yes],
+       [gt_cv_func_CFLocaleCopyCurrent=no])
+     LIBS="$gt_save_LIBS"])
+  if test $gt_cv_func_CFLocaleCopyCurrent = yes; then
+    AC_DEFINE([HAVE_CFLOCALECOPYCURRENT], 1,
+      [Define to 1 if you have the MacOS X function CFLocaleCopyCurrent in the CoreFoundation framework.])
+  fi
+  INTL_MACOSX_LIBS=
+  if test $gt_cv_func_CFPreferencesCopyAppValue = yes || test $gt_cv_func_CFLocaleCopyCurrent = yes; then
+    INTL_MACOSX_LIBS="-Wl,-framework -Wl,CoreFoundation"
+  fi
+  AC_SUBST([INTL_MACOSX_LIBS])
+])
+
+# Copyright (C) 2002, 2003, 2005, 2006, 2007, 2008  Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_AUTOMAKE_VERSION(VERSION)
+# ----------------------------
+# Automake X.Y traces this macro to ensure aclocal.m4 has been
+# generated from the m4 files accompanying Automake X.Y.
+# (This private macro should not be called outside this file.)
+AC_DEFUN([AM_AUTOMAKE_VERSION],
+[am__api_version='1.11'
+dnl Some users find AM_AUTOMAKE_VERSION and mistake it for a way to
+dnl require some minimum version.  Point them to the right macro.
+m4_if([$1], [1.11.1], [],
+      [AC_FATAL([Do not call $0, use AM_INIT_AUTOMAKE([$1]).])])dnl
+])
+
+# _AM_AUTOCONF_VERSION(VERSION)
+# -----------------------------
+# aclocal traces this macro to find the Autoconf version.
+# This is a private macro too.  Using m4_define simplifies
+# the logic in aclocal, which can simply ignore this definition.
+m4_define([_AM_AUTOCONF_VERSION], [])
+
+# AM_SET_CURRENT_AUTOMAKE_VERSION
+# -------------------------------
+# Call AM_AUTOMAKE_VERSION and AM_AUTOMAKE_VERSION so they can be traced.
+# This function is AC_REQUIREd by AM_INIT_AUTOMAKE.
+AC_DEFUN([AM_SET_CURRENT_AUTOMAKE_VERSION],
+[AM_AUTOMAKE_VERSION([1.11.1])dnl
+m4_ifndef([AC_AUTOCONF_VERSION],
+  [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
+_AM_AUTOCONF_VERSION(m4_defn([AC_AUTOCONF_VERSION]))])
+
+# AM_AUX_DIR_EXPAND                                         -*- Autoconf -*-
+
+# Copyright (C) 2001, 2003, 2005  Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# For projects using AC_CONFIG_AUX_DIR([foo]), Autoconf sets
+# $ac_aux_dir to `$srcdir/foo'.  In other projects, it is set to
+# `$srcdir', `$srcdir/..', or `$srcdir/../..'.
+#
+# Of course, Automake must honor this variable whenever it calls a
+# tool from the auxiliary directory.  The problem is that $srcdir (and
+# therefore $ac_aux_dir as well) can be either absolute or relative,
+# depending on how configure is run.  This is pretty annoying, since
+# it makes $ac_aux_dir quite unusable in subdirectories: in the top
+# source directory, any form will work fine, but in subdirectories a
+# relative path needs to be adjusted first.
+#
+# $ac_aux_dir/missing
+#    fails when called from a subdirectory if $ac_aux_dir is relative
+# $top_srcdir/$ac_aux_dir/missing
+#    fails if $ac_aux_dir is absolute,
+#    fails when called from a subdirectory in a VPATH build with
+#          a relative $ac_aux_dir
+#
+# The reason of the latter failure is that $top_srcdir and $ac_aux_dir
+# are both prefixed by $srcdir.  In an in-source build this is usually
+# harmless because $srcdir is `.', but things will broke when you
+# start a VPATH build or use an absolute $srcdir.
+#
+# So we could use something similar to $top_srcdir/$ac_aux_dir/missing,
+# iff we strip the leading $srcdir from $ac_aux_dir.  That would be:
+#   am_aux_dir='\$(top_srcdir)/'`expr "$ac_aux_dir" : "$srcdir//*\(.*\)"`
+# and then we would define $MISSING as
+#   MISSING="\${SHELL} $am_aux_dir/missing"
+# This will work as long as MISSING is not called from configure, because
+# unfortunately $(top_srcdir) has no meaning in configure.
+# However there are other variables, like CC, which are often used in
+# configure, and could therefore not use this "fixed" $ac_aux_dir.
+#
+# Another solution, used here, is to always expand $ac_aux_dir to an
+# absolute PATH.  The drawback is that using absolute paths prevent a
+# configured tree to be moved without reconfiguration.
+
+AC_DEFUN([AM_AUX_DIR_EXPAND],
+[dnl Rely on autoconf to set up CDPATH properly.
+AC_PREREQ([2.50])dnl
+# expand $ac_aux_dir to an absolute path
+am_aux_dir=`cd $ac_aux_dir && pwd`
+])
+
+# AM_CONDITIONAL                                            -*- Autoconf -*-
+
+# Copyright (C) 1997, 2000, 2001, 2003, 2004, 2005, 2006, 2008
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 9
+
+# AM_CONDITIONAL(NAME, SHELL-CONDITION)
+# -------------------------------------
+# Define a conditional.
+AC_DEFUN([AM_CONDITIONAL],
+[AC_PREREQ(2.52)dnl
+ ifelse([$1], [TRUE],  [AC_FATAL([$0: invalid condition: $1])],
+	[$1], [FALSE], [AC_FATAL([$0: invalid condition: $1])])dnl
+AC_SUBST([$1_TRUE])dnl
+AC_SUBST([$1_FALSE])dnl
+_AM_SUBST_NOTMAKE([$1_TRUE])dnl
+_AM_SUBST_NOTMAKE([$1_FALSE])dnl
+m4_define([_AM_COND_VALUE_$1], [$2])dnl
+if $2; then
+  $1_TRUE=
+  $1_FALSE='#'
+else
+  $1_TRUE='#'
+  $1_FALSE=
+fi
+AC_CONFIG_COMMANDS_PRE(
+[if test -z "${$1_TRUE}" && test -z "${$1_FALSE}"; then
+  AC_MSG_ERROR([[conditional "$1" was never defined.
+Usually this means the macro was only invoked conditionally.]])
+fi])])
+
+# Copyright (C) 1999, 2000, 2001, 2002, 2003, 2004, 2005, 2006, 2009
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 10
+
+# There are a few dirty hacks below to avoid letting `AC_PROG_CC' be
+# written in clear, in which case automake, when reading aclocal.m4,
+# will think it sees a *use*, and therefore will trigger all it's
+# C support machinery.  Also note that it means that autoscan, seeing
+# CC etc. in the Makefile, will ask for an AC_PROG_CC use...
+
+
+# _AM_DEPENDENCIES(NAME)
+# ----------------------
+# See how the compiler implements dependency checking.
+# NAME is "CC", "CXX", "GCJ", or "OBJC".
+# We try a few techniques and use that to set a single cache variable.
+#
+# We don't AC_REQUIRE the corresponding AC_PROG_CC since the latter was
+# modified to invoke _AM_DEPENDENCIES(CC); we would have a circular
+# dependency, and given that the user is not expected to run this macro,
+# just rely on AC_PROG_CC.
+AC_DEFUN([_AM_DEPENDENCIES],
+[AC_REQUIRE([AM_SET_DEPDIR])dnl
+AC_REQUIRE([AM_OUTPUT_DEPENDENCY_COMMANDS])dnl
+AC_REQUIRE([AM_MAKE_INCLUDE])dnl
+AC_REQUIRE([AM_DEP_TRACK])dnl
+
+ifelse([$1], CC,   [depcc="$CC"   am_compiler_list=],
+       [$1], CXX,  [depcc="$CXX"  am_compiler_list=],
+       [$1], OBJC, [depcc="$OBJC" am_compiler_list='gcc3 gcc'],
+       [$1], UPC,  [depcc="$UPC"  am_compiler_list=],
+       [$1], GCJ,  [depcc="$GCJ"  am_compiler_list='gcc3 gcc'],
+                   [depcc="$$1"   am_compiler_list=])
+
+AC_CACHE_CHECK([dependency style of $depcc],
+               [am_cv_$1_dependencies_compiler_type],
+[if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+  # We make a subdir and do the tests there.  Otherwise we can end up
+  # making bogus files that we don't know about and never remove.  For
+  # instance it was reported that on HP-UX the gcc test will end up
+  # making a dummy file named `D' -- because `-MD' means `put the output
+  # in D'.
+  mkdir conftest.dir
+  # Copy depcomp to subdir because otherwise we won't find it if we're
+  # using a relative directory.
+  cp "$am_depcomp" conftest.dir
+  cd conftest.dir
+  # We will build objects and dependencies in a subdirectory because
+  # it helps to detect inapplicable dependency modes.  For instance
+  # both Tru64's cc and ICC support -MD to output dependencies as a
+  # side effect of compilation, but ICC will put the dependencies in
+  # the current directory while Tru64 will put them in the object
+  # directory.
+  mkdir sub
+
+  am_cv_$1_dependencies_compiler_type=none
+  if test "$am_compiler_list" = ""; then
+     am_compiler_list=`sed -n ['s/^#*\([a-zA-Z0-9]*\))$/\1/p'] < ./depcomp`
+  fi
+  am__universal=false
+  m4_case([$1], [CC],
+    [case " $depcc " in #(
+     *\ -arch\ *\ -arch\ *) am__universal=true ;;
+     esac],
+    [CXX],
+    [case " $depcc " in #(
+     *\ -arch\ *\ -arch\ *) am__universal=true ;;
+     esac])
+
+  for depmode in $am_compiler_list; do
+    # Setup a source with many dependencies, because some compilers
+    # like to wrap large dependency lists on column 80 (with \), and
+    # we should not choose a depcomp mode which is confused by this.
+    #
+    # We need to recreate these files for each test, as the compiler may
+    # overwrite some of them when testing with obscure command lines.
+    # This happens at least with the AIX C compiler.
+    : > sub/conftest.c
+    for i in 1 2 3 4 5 6; do
+      echo '#include "conftst'$i'.h"' >> sub/conftest.c
+      # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with
+      # Solaris 8's {/usr,}/bin/sh.
+      touch sub/conftst$i.h
+    done
+    echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+    # We check with `-c' and `-o' for the sake of the "dashmstdout"
+    # mode.  It turns out that the SunPro C++ compiler does not properly
+    # handle `-M -o', and we need to detect this.  Also, some Intel
+    # versions had trouble with output in subdirs
+    am__obj=sub/conftest.${OBJEXT-o}
+    am__minus_obj="-o $am__obj"
+    case $depmode in
+    gcc)
+      # This depmode causes a compiler race in universal mode.
+      test "$am__universal" = false || continue
+      ;;
+    nosideeffect)
+      # after this tag, mechanisms are not by side-effect, so they'll
+      # only be used when explicitly requested
+      if test "x$enable_dependency_tracking" = xyes; then
+	continue
+      else
+	break
+      fi
+      ;;
+    msvisualcpp | msvcmsys)
+      # This compiler won't grok `-c -o', but also, the minuso test has
+      # not run yet.  These depmodes are late enough in the game, and
+      # so weak that their functioning should not be impacted.
+      am__obj=conftest.${OBJEXT-o}
+      am__minus_obj=
+      ;;
+    none) break ;;
+    esac
+    if depmode=$depmode \
+       source=sub/conftest.c object=$am__obj \
+       depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+       $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \
+         >/dev/null 2>conftest.err &&
+       grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 &&
+       grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+       grep $am__obj sub/conftest.Po > /dev/null 2>&1 &&
+       ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+      # icc doesn't choke on unknown options, it will just issue warnings
+      # or remarks (even with -Werror).  So we grep stderr for any message
+      # that says an option was ignored or not supported.
+      # When given -MP, icc 7.0 and 7.1 complain thusly:
+      #   icc: Command line warning: ignoring option '-M'; no argument required
+      # The diagnosis changed in icc 8.0:
+      #   icc: Command line remark: option '-MP' not supported
+      if (grep 'ignoring option' conftest.err ||
+          grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+        am_cv_$1_dependencies_compiler_type=$depmode
+        break
+      fi
+    fi
+  done
+
+  cd ..
+  rm -rf conftest.dir
+else
+  am_cv_$1_dependencies_compiler_type=none
+fi
+])
+AC_SUBST([$1DEPMODE], [depmode=$am_cv_$1_dependencies_compiler_type])
+AM_CONDITIONAL([am__fastdep$1], [
+  test "x$enable_dependency_tracking" != xno \
+  && test "$am_cv_$1_dependencies_compiler_type" = gcc3])
+])
+
+
+# AM_SET_DEPDIR
+# -------------
+# Choose a directory name for dependency files.
+# This macro is AC_REQUIREd in _AM_DEPENDENCIES
+AC_DEFUN([AM_SET_DEPDIR],
+[AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+AC_SUBST([DEPDIR], ["${am__leading_dot}deps"])dnl
+])
+
+
+# AM_DEP_TRACK
+# ------------
+AC_DEFUN([AM_DEP_TRACK],
+[AC_ARG_ENABLE(dependency-tracking,
+[  --disable-dependency-tracking  speeds up one-time build
+  --enable-dependency-tracking   do not reject slow dependency extractors])
+if test "x$enable_dependency_tracking" != xno; then
+  am_depcomp="$ac_aux_dir/depcomp"
+  AMDEPBACKSLASH='\'
+fi
+AM_CONDITIONAL([AMDEP], [test "x$enable_dependency_tracking" != xno])
+AC_SUBST([AMDEPBACKSLASH])dnl
+_AM_SUBST_NOTMAKE([AMDEPBACKSLASH])dnl
+])
+
+# Generate code to set up dependency tracking.              -*- Autoconf -*-
+
+# Copyright (C) 1999, 2000, 2001, 2002, 2003, 2004, 2005, 2008
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+#serial 5
+
+# _AM_OUTPUT_DEPENDENCY_COMMANDS
+# ------------------------------
+AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS],
+[{
+  # Autoconf 2.62 quotes --file arguments for eval, but not when files
+  # are listed without --file.  Let's play safe and only enable the eval
+  # if we detect the quoting.
+  case $CONFIG_FILES in
+  *\'*) eval set x "$CONFIG_FILES" ;;
+  *)   set x $CONFIG_FILES ;;
+  esac
+  shift
+  for mf
+  do
+    # Strip MF so we end up with the name of the file.
+    mf=`echo "$mf" | sed -e 's/:.*$//'`
+    # Check whether this is an Automake generated Makefile or not.
+    # We used to match only the files named `Makefile.in', but
+    # some people rename them; so instead we look at the file content.
+    # Grep'ing the first line is not enough: some people post-process
+    # each Makefile.in and add a new line on top of each file to say so.
+    # Grep'ing the whole file is not good either: AIX grep has a line
+    # limit of 2048, but all sed's we know have understand at least 4000.
+    if sed -n 's,^#.*generated by automake.*,X,p' "$mf" | grep X >/dev/null 2>&1; then
+      dirpart=`AS_DIRNAME("$mf")`
+    else
+      continue
+    fi
+    # Extract the definition of DEPDIR, am__include, and am__quote
+    # from the Makefile without running `make'.
+    DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"`
+    test -z "$DEPDIR" && continue
+    am__include=`sed -n 's/^am__include = //p' < "$mf"`
+    test -z "am__include" && continue
+    am__quote=`sed -n 's/^am__quote = //p' < "$mf"`
+    # When using ansi2knr, U may be empty or an underscore; expand it
+    U=`sed -n 's/^U = //p' < "$mf"`
+    # Find all dependency output files, they are included files with
+    # $(DEPDIR) in their names.  We invoke sed twice because it is the
+    # simplest approach to changing $(DEPDIR) to its actual value in the
+    # expansion.
+    for file in `sed -n "
+      s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \
+	 sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g' -e 's/\$U/'"$U"'/g'`; do
+      # Make sure the directory exists.
+      test -f "$dirpart/$file" && continue
+      fdir=`AS_DIRNAME(["$file"])`
+      AS_MKDIR_P([$dirpart/$fdir])
+      # echo "creating $dirpart/$file"
+      echo '# dummy' > "$dirpart/$file"
+    done
+  done
+}
+])# _AM_OUTPUT_DEPENDENCY_COMMANDS
+
+
+# AM_OUTPUT_DEPENDENCY_COMMANDS
+# -----------------------------
+# This macro should only be invoked once -- use via AC_REQUIRE.
+#
+# This code is only required when automatic dependency tracking
+# is enabled.  FIXME.  This creates each `.P' file that we will
+# need in order to bootstrap the dependency handling code.
+AC_DEFUN([AM_OUTPUT_DEPENDENCY_COMMANDS],
+[AC_CONFIG_COMMANDS([depfiles],
+     [test x"$AMDEP_TRUE" != x"" || _AM_OUTPUT_DEPENDENCY_COMMANDS],
+     [AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"])
+])
+
+# Do all the work for Automake.                             -*- Autoconf -*-
+
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004,
+# 2005, 2006, 2008, 2009 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 16
+
+# This macro actually does too much.  Some checks are only needed if
+# your package does certain things.  But this isn't really a big deal.
+
+# AM_INIT_AUTOMAKE(PACKAGE, VERSION, [NO-DEFINE])
+# AM_INIT_AUTOMAKE([OPTIONS])
+# -----------------------------------------------
+# The call with PACKAGE and VERSION arguments is the old style
+# call (pre autoconf-2.50), which is being phased out.  PACKAGE
+# and VERSION should now be passed to AC_INIT and removed from
+# the call to AM_INIT_AUTOMAKE.
+# We support both call styles for the transition.  After
+# the next Automake release, Autoconf can make the AC_INIT
+# arguments mandatory, and then we can depend on a new Autoconf
+# release and drop the old call support.
+AC_DEFUN([AM_INIT_AUTOMAKE],
+[AC_PREREQ([2.62])dnl
+dnl Autoconf wants to disallow AM_ names.  We explicitly allow
+dnl the ones we care about.
+m4_pattern_allow([^AM_[A-Z]+FLAGS$])dnl
+AC_REQUIRE([AM_SET_CURRENT_AUTOMAKE_VERSION])dnl
+AC_REQUIRE([AC_PROG_INSTALL])dnl
+if test "`cd $srcdir && pwd`" != "`pwd`"; then
+  # Use -I$(srcdir) only when $(srcdir) != ., so that make's output
+  # is not polluted with repeated "-I."
+  AC_SUBST([am__isrc], [' -I$(srcdir)'])_AM_SUBST_NOTMAKE([am__isrc])dnl
+  # test to see if srcdir already configured
+  if test -f $srcdir/config.status; then
+    AC_MSG_ERROR([source directory already configured; run "make distclean" there first])
+  fi
+fi
+
+# test whether we have cygpath
+if test -z "$CYGPATH_W"; then
+  if (cygpath --version) >/dev/null 2>/dev/null; then
+    CYGPATH_W='cygpath -w'
+  else
+    CYGPATH_W=echo
+  fi
+fi
+AC_SUBST([CYGPATH_W])
+
+# Define the identity of the package.
+dnl Distinguish between old-style and new-style calls.
+m4_ifval([$2],
+[m4_ifval([$3], [_AM_SET_OPTION([no-define])])dnl
+ AC_SUBST([PACKAGE], [$1])dnl
+ AC_SUBST([VERSION], [$2])],
+[_AM_SET_OPTIONS([$1])dnl
+dnl Diagnose old-style AC_INIT with new-style AM_AUTOMAKE_INIT.
+m4_if(m4_ifdef([AC_PACKAGE_NAME], 1)m4_ifdef([AC_PACKAGE_VERSION], 1), 11,,
+  [m4_fatal([AC_INIT should be called with package and version arguments])])dnl
+ AC_SUBST([PACKAGE], ['AC_PACKAGE_TARNAME'])dnl
+ AC_SUBST([VERSION], ['AC_PACKAGE_VERSION'])])dnl
+
+_AM_IF_OPTION([no-define],,
+[AC_DEFINE_UNQUOTED(PACKAGE, "$PACKAGE", [Name of package])
+ AC_DEFINE_UNQUOTED(VERSION, "$VERSION", [Version number of package])])dnl
+
+# Some tools Automake needs.
+AC_REQUIRE([AM_SANITY_CHECK])dnl
+AC_REQUIRE([AC_ARG_PROGRAM])dnl
+AM_MISSING_PROG(ACLOCAL, aclocal-${am__api_version})
+AM_MISSING_PROG(AUTOCONF, autoconf)
+AM_MISSING_PROG(AUTOMAKE, automake-${am__api_version})
+AM_MISSING_PROG(AUTOHEADER, autoheader)
+AM_MISSING_PROG(MAKEINFO, makeinfo)
+AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+AC_REQUIRE([AM_PROG_INSTALL_STRIP])dnl
+AC_REQUIRE([AM_PROG_MKDIR_P])dnl
+# We need awk for the "check" target.  The system "awk" is bad on
+# some platforms.
+AC_REQUIRE([AC_PROG_AWK])dnl
+AC_REQUIRE([AC_PROG_MAKE_SET])dnl
+AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+_AM_IF_OPTION([tar-ustar], [_AM_PROG_TAR([ustar])],
+	      [_AM_IF_OPTION([tar-pax], [_AM_PROG_TAR([pax])],
+			     [_AM_PROG_TAR([v7])])])
+_AM_IF_OPTION([no-dependencies],,
+[AC_PROVIDE_IFELSE([AC_PROG_CC],
+		  [_AM_DEPENDENCIES(CC)],
+		  [define([AC_PROG_CC],
+			  defn([AC_PROG_CC])[_AM_DEPENDENCIES(CC)])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_CXX],
+		  [_AM_DEPENDENCIES(CXX)],
+		  [define([AC_PROG_CXX],
+			  defn([AC_PROG_CXX])[_AM_DEPENDENCIES(CXX)])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_OBJC],
+		  [_AM_DEPENDENCIES(OBJC)],
+		  [define([AC_PROG_OBJC],
+			  defn([AC_PROG_OBJC])[_AM_DEPENDENCIES(OBJC)])])dnl
+])
+_AM_IF_OPTION([silent-rules], [AC_REQUIRE([AM_SILENT_RULES])])dnl
+dnl The `parallel-tests' driver may need to know about EXEEXT, so add the
+dnl `am__EXEEXT' conditional if _AM_COMPILER_EXEEXT was seen.  This macro
+dnl is hooked onto _AC_COMPILER_EXEEXT early, see below.
+AC_CONFIG_COMMANDS_PRE(dnl
+[m4_provide_if([_AM_COMPILER_EXEEXT],
+  [AM_CONDITIONAL([am__EXEEXT], [test -n "$EXEEXT"])])])dnl
+])
+
+dnl Hook into `_AC_COMPILER_EXEEXT' early to learn its expansion.  Do not
+dnl add the conditional right here, as _AC_COMPILER_EXEEXT may be further
+dnl mangled by Autoconf and run in a shell conditional statement.
+m4_define([_AC_COMPILER_EXEEXT],
+m4_defn([_AC_COMPILER_EXEEXT])[m4_provide([_AM_COMPILER_EXEEXT])])
+
+
+# When config.status generates a header, we must update the stamp-h file.
+# This file resides in the same directory as the config header
+# that is generated.  The stamp files are numbered to have different names.
+
+# Autoconf calls _AC_AM_CONFIG_HEADER_HOOK (when defined) in the
+# loop where config.status creates the headers, so we can generate
+# our stamp files there.
+AC_DEFUN([_AC_AM_CONFIG_HEADER_HOOK],
+[# Compute $1's index in $config_headers.
+_am_arg=$1
+_am_stamp_count=1
+for _am_header in $config_headers :; do
+  case $_am_header in
+    $_am_arg | $_am_arg:* )
+      break ;;
+    * )
+      _am_stamp_count=`expr $_am_stamp_count + 1` ;;
+  esac
+done
+echo "timestamp for $_am_arg" >`AS_DIRNAME(["$_am_arg"])`/stamp-h[]$_am_stamp_count])
+
+# Copyright (C) 2001, 2003, 2005, 2008  Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_SH
+# ------------------
+# Define $install_sh.
+AC_DEFUN([AM_PROG_INSTALL_SH],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+if test x"${install_sh}" != xset; then
+  case $am_aux_dir in
+  *\ * | *\	*)
+    install_sh="\${SHELL} '$am_aux_dir/install-sh'" ;;
+  *)
+    install_sh="\${SHELL} $am_aux_dir/install-sh"
+  esac
+fi
+AC_SUBST(install_sh)])
+
+# Copyright (C) 2003, 2005  Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 2
+
+# Check whether the underlying file-system supports filenames
+# with a leading dot.  For instance MS-DOS doesn't.
+AC_DEFUN([AM_SET_LEADING_DOT],
+[rm -rf .tst 2>/dev/null
+mkdir .tst 2>/dev/null
+if test -d .tst; then
+  am__leading_dot=.
+else
+  am__leading_dot=_
+fi
+rmdir .tst 2>/dev/null
+AC_SUBST([am__leading_dot])])
+
+# Add --enable-maintainer-mode option to configure.         -*- Autoconf -*-
+# From Jim Meyering
+
+# Copyright (C) 1996, 1998, 2000, 2001, 2002, 2003, 2004, 2005, 2008
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 5
+
+# AM_MAINTAINER_MODE([DEFAULT-MODE])
+# ----------------------------------
+# Control maintainer-specific portions of Makefiles.
+# Default is to disable them, unless `enable' is passed literally.
+# For symmetry, `disable' may be passed as well.  Anyway, the user
+# can override the default with the --enable/--disable switch.
+AC_DEFUN([AM_MAINTAINER_MODE],
+[m4_case(m4_default([$1], [disable]),
+       [enable], [m4_define([am_maintainer_other], [disable])],
+       [disable], [m4_define([am_maintainer_other], [enable])],
+       [m4_define([am_maintainer_other], [enable])
+        m4_warn([syntax], [unexpected argument to AM@&t@_MAINTAINER_MODE: $1])])
+AC_MSG_CHECKING([whether to am_maintainer_other maintainer-specific portions of Makefiles])
+  dnl maintainer-mode's default is 'disable' unless 'enable' is passed
+  AC_ARG_ENABLE([maintainer-mode],
+[  --][am_maintainer_other][-maintainer-mode  am_maintainer_other make rules and dependencies not useful
+			  (and sometimes confusing) to the casual installer],
+      [USE_MAINTAINER_MODE=$enableval],
+      [USE_MAINTAINER_MODE=]m4_if(am_maintainer_other, [enable], [no], [yes]))
+  AC_MSG_RESULT([$USE_MAINTAINER_MODE])
+  AM_CONDITIONAL([MAINTAINER_MODE], [test $USE_MAINTAINER_MODE = yes])
+  MAINT=$MAINTAINER_MODE_TRUE
+  AC_SUBST([MAINT])dnl
+]
+)
+
+AU_DEFUN([jm_MAINTAINER_MODE], [AM_MAINTAINER_MODE])
+
+# Check to see how 'make' treats includes.	            -*- Autoconf -*-
+
+# Copyright (C) 2001, 2002, 2003, 2005, 2009  Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 4
+
+# AM_MAKE_INCLUDE()
+# -----------------
+# Check to see how make treats includes.
+AC_DEFUN([AM_MAKE_INCLUDE],
+[am_make=${MAKE-make}
+cat > confinc << 'END'
+am__doit:
+	@echo this is the am__doit target
+.PHONY: am__doit
+END
+# If we don't find an include directive, just comment out the code.
+AC_MSG_CHECKING([for style of include used by $am_make])
+am__include="#"
+am__quote=
+_am_result=none
+# First try GNU make style include.
+echo "include confinc" > confmf
+# Ignore all kinds of additional output from `make'.
+case `$am_make -s -f confmf 2> /dev/null` in #(
+*the\ am__doit\ target*)
+  am__include=include
+  am__quote=
+  _am_result=GNU
+  ;;
+esac
+# Now try BSD make style include.
+if test "$am__include" = "#"; then
+   echo '.include "confinc"' > confmf
+   case `$am_make -s -f confmf 2> /dev/null` in #(
+   *the\ am__doit\ target*)
+     am__include=.include
+     am__quote="\""
+     _am_result=BSD
+     ;;
+   esac
+fi
+AC_SUBST([am__include])
+AC_SUBST([am__quote])
+AC_MSG_RESULT([$_am_result])
+rm -f confinc confmf
+])
+
+# Fake the existence of programs that GNU maintainers use.  -*- Autoconf -*-
+
+# Copyright (C) 1997, 1999, 2000, 2001, 2003, 2004, 2005, 2008
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 6
+
+# AM_MISSING_PROG(NAME, PROGRAM)
+# ------------------------------
+AC_DEFUN([AM_MISSING_PROG],
+[AC_REQUIRE([AM_MISSING_HAS_RUN])
+$1=${$1-"${am_missing_run}$2"}
+AC_SUBST($1)])
+
+
+# AM_MISSING_HAS_RUN
+# ------------------
+# Define MISSING if not defined so far and test if it supports --run.
+# If it does, set am_missing_run to use it, otherwise, to nothing.
+AC_DEFUN([AM_MISSING_HAS_RUN],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+AC_REQUIRE_AUX_FILE([missing])dnl
+if test x"${MISSING+set}" != xset; then
+  case $am_aux_dir in
+  *\ * | *\	*)
+    MISSING="\${SHELL} \"$am_aux_dir/missing\"" ;;
+  *)
+    MISSING="\${SHELL} $am_aux_dir/missing" ;;
+  esac
+fi
+# Use eval to expand $SHELL
+if eval "$MISSING --run true"; then
+  am_missing_run="$MISSING --run "
+else
+  am_missing_run=
+  AC_MSG_WARN([`missing' script is too old or missing])
+fi
+])
+
+# Copyright (C) 2003, 2004, 2005, 2006  Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_MKDIR_P
+# ---------------
+# Check for `mkdir -p'.
+AC_DEFUN([AM_PROG_MKDIR_P],
+[AC_PREREQ([2.60])dnl
+AC_REQUIRE([AC_PROG_MKDIR_P])dnl
+dnl Automake 1.8 to 1.9.6 used to define mkdir_p.  We now use MKDIR_P,
+dnl while keeping a definition of mkdir_p for backward compatibility.
+dnl @MKDIR_P@ is magic: AC_OUTPUT adjusts its value for each Makefile.
+dnl However we cannot define mkdir_p as $(MKDIR_P) for the sake of
+dnl Makefile.ins that do not define MKDIR_P, so we do our own
+dnl adjustment using top_builddir (which is defined more often than
+dnl MKDIR_P).
+AC_SUBST([mkdir_p], ["$MKDIR_P"])dnl
+case $mkdir_p in
+  [[\\/$]]* | ?:[[\\/]]*) ;;
+  */*) mkdir_p="\$(top_builddir)/$mkdir_p" ;;
+esac
+])
+
+# Helper functions for option handling.                     -*- Autoconf -*-
+
+# Copyright (C) 2001, 2002, 2003, 2005, 2008  Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 4
+
+# _AM_MANGLE_OPTION(NAME)
+# -----------------------
+AC_DEFUN([_AM_MANGLE_OPTION],
+[[_AM_OPTION_]m4_bpatsubst($1, [[^a-zA-Z0-9_]], [_])])
+
+# _AM_SET_OPTION(NAME)
+# ------------------------------
+# Set option NAME.  Presently that only means defining a flag for this option.
+AC_DEFUN([_AM_SET_OPTION],
+[m4_define(_AM_MANGLE_OPTION([$1]), 1)])
+
+# _AM_SET_OPTIONS(OPTIONS)
+# ----------------------------------
+# OPTIONS is a space-separated list of Automake options.
+AC_DEFUN([_AM_SET_OPTIONS],
+[m4_foreach_w([_AM_Option], [$1], [_AM_SET_OPTION(_AM_Option)])])
+
+# _AM_IF_OPTION(OPTION, IF-SET, [IF-NOT-SET])
+# -------------------------------------------
+# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise.
+AC_DEFUN([_AM_IF_OPTION],
+[m4_ifset(_AM_MANGLE_OPTION([$1]), [$2], [$3])])
+
+# Copyright (C) 1996, 1997, 1998, 2000, 2001, 2002, 2003, 2005, 2006
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 5
+
+AC_DEFUN([AM_C_PROTOTYPES],
+[AC_REQUIRE([AC_C_PROTOTYPES])
+if test "$ac_cv_prog_cc_stdc" != no; then
+  U= ANSI2KNR=
+else
+  U=_ ANSI2KNR=./ansi2knr
+fi
+# Ensure some checks needed by ansi2knr itself.
+AC_REQUIRE([AC_HEADER_STDC])
+AC_CHECK_HEADERS([string.h])
+AC_SUBST([U])dnl
+AC_SUBST([ANSI2KNR])dnl
+_AM_SUBST_NOTMAKE([ANSI2KNR])dnl
+])
+
+AU_DEFUN([fp_C_PROTOTYPES], [AM_C_PROTOTYPES])
+
+# Check to make sure that the build environment is sane.    -*- Autoconf -*-
+
+# Copyright (C) 1996, 1997, 2000, 2001, 2003, 2005, 2008
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 5
+
+# AM_SANITY_CHECK
+# ---------------
+AC_DEFUN([AM_SANITY_CHECK],
+[AC_MSG_CHECKING([whether build environment is sane])
+# Just in case
+sleep 1
+echo timestamp > conftest.file
+# Reject unsafe characters in $srcdir or the absolute working directory
+# name.  Accept space and tab only in the latter.
+am_lf='
+'
+case `pwd` in
+  *[[\\\"\#\$\&\'\`$am_lf]]*)
+    AC_MSG_ERROR([unsafe absolute working directory name]);;
+esac
+case $srcdir in
+  *[[\\\"\#\$\&\'\`$am_lf\ \	]]*)
+    AC_MSG_ERROR([unsafe srcdir value: `$srcdir']);;
+esac
+
+# Do `set' in a subshell so we don't clobber the current shell's
+# arguments.  Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+   set X `ls -Lt "$srcdir/configure" conftest.file 2> /dev/null`
+   if test "$[*]" = "X"; then
+      # -L didn't work.
+      set X `ls -t "$srcdir/configure" conftest.file`
+   fi
+   rm -f conftest.file
+   if test "$[*]" != "X $srcdir/configure conftest.file" \
+      && test "$[*]" != "X conftest.file $srcdir/configure"; then
+
+      # If neither matched, then we have a broken ls.  This can happen
+      # if, for instance, CONFIG_SHELL is bash and it inherits a
+      # broken ls alias from the environment.  This has actually
+      # happened.  Such a system could not be considered "sane".
+      AC_MSG_ERROR([ls -t appears to fail.  Make sure there is not a broken
+alias in your environment])
+   fi
+
+   test "$[2]" = conftest.file
+   )
+then
+   # Ok.
+   :
+else
+   AC_MSG_ERROR([newly created file is older than distributed files!
+Check your system clock])
+fi
+AC_MSG_RESULT(yes)])
+
+# Copyright (C) 2001, 2003, 2005  Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_STRIP
+# ---------------------
+# One issue with vendor `install' (even GNU) is that you can't
+# specify the program used to strip binaries.  This is especially
+# annoying in cross-compiling environments, where the build's strip
+# is unlikely to handle the host's binaries.
+# Fortunately install-sh will honor a STRIPPROG variable, so we
+# always use install-sh in `make install-strip', and initialize
+# STRIPPROG with the value of the STRIP variable (set by the user).
+AC_DEFUN([AM_PROG_INSTALL_STRIP],
+[AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+# Installed binaries are usually stripped using `strip' when the user
+# run `make install-strip'.  However `strip' might not be the right
+# tool to use in cross-compilation environments, therefore Automake
+# will honor the `STRIP' environment variable to overrule this program.
+dnl Don't test for $cross_compiling = yes, because it might be `maybe'.
+if test "$cross_compiling" != no; then
+  AC_CHECK_TOOL([STRIP], [strip], :)
+fi
+INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s"
+AC_SUBST([INSTALL_STRIP_PROGRAM])])
+
+# Copyright (C) 2006, 2008  Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 2
+
+# _AM_SUBST_NOTMAKE(VARIABLE)
+# ---------------------------
+# Prevent Automake from outputting VARIABLE = @VARIABLE@ in Makefile.in.
+# This macro is traced by Automake.
+AC_DEFUN([_AM_SUBST_NOTMAKE])
+
+# AM_SUBST_NOTMAKE(VARIABLE)
+# ---------------------------
+# Public sister of _AM_SUBST_NOTMAKE.
+AC_DEFUN([AM_SUBST_NOTMAKE], [_AM_SUBST_NOTMAKE($@)])
+
+# Check how to create a tarball.                            -*- Autoconf -*-
+
+# Copyright (C) 2004, 2005  Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 2
+
+# _AM_PROG_TAR(FORMAT)
+# --------------------
+# Check how to create a tarball in format FORMAT.
+# FORMAT should be one of `v7', `ustar', or `pax'.
+#
+# Substitute a variable $(am__tar) that is a command
+# writing to stdout a FORMAT-tarball containing the directory
+# $tardir.
+#     tardir=directory && $(am__tar) > result.tar
+#
+# Substitute a variable $(am__untar) that extract such
+# a tarball read from stdin.
+#     $(am__untar) < result.tar
+AC_DEFUN([_AM_PROG_TAR],
+[# Always define AMTAR for backward compatibility.
+AM_MISSING_PROG([AMTAR], [tar])
+m4_if([$1], [v7],
+     [am__tar='${AMTAR} chof - "$$tardir"'; am__untar='${AMTAR} xf -'],
+     [m4_case([$1], [ustar],, [pax],,
+              [m4_fatal([Unknown tar format])])
+AC_MSG_CHECKING([how to create a $1 tar archive])
+# Loop over all known methods to create a tar archive until one works.
+_am_tools='gnutar m4_if([$1], [ustar], [plaintar]) pax cpio none'
+_am_tools=${am_cv_prog_tar_$1-$_am_tools}
+# Do not fold the above two line into one, because Tru64 sh and
+# Solaris sh will not grok spaces in the rhs of `-'.
+for _am_tool in $_am_tools
+do
+  case $_am_tool in
+  gnutar)
+    for _am_tar in tar gnutar gtar;
+    do
+      AM_RUN_LOG([$_am_tar --version]) && break
+    done
+    am__tar="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$$tardir"'
+    am__tar_="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$tardir"'
+    am__untar="$_am_tar -xf -"
+    ;;
+  plaintar)
+    # Must skip GNU tar: if it does not support --format= it doesn't create
+    # ustar tarball either.
+    (tar --version) >/dev/null 2>&1 && continue
+    am__tar='tar chf - "$$tardir"'
+    am__tar_='tar chf - "$tardir"'
+    am__untar='tar xf -'
+    ;;
+  pax)
+    am__tar='pax -L -x $1 -w "$$tardir"'
+    am__tar_='pax -L -x $1 -w "$tardir"'
+    am__untar='pax -r'
+    ;;
+  cpio)
+    am__tar='find "$$tardir" -print | cpio -o -H $1 -L'
+    am__tar_='find "$tardir" -print | cpio -o -H $1 -L'
+    am__untar='cpio -i -H $1 -d'
+    ;;
+  none)
+    am__tar=false
+    am__tar_=false
+    am__untar=false
+    ;;
+  esac
+
+  # If the value was cached, stop now.  We just wanted to have am__tar
+  # and am__untar set.
+  test -n "${am_cv_prog_tar_$1}" && break
+
+  # tar/untar a dummy directory, and stop if the command works
+  rm -rf conftest.dir
+  mkdir conftest.dir
+  echo GrepMe > conftest.dir/file
+  AM_RUN_LOG([tardir=conftest.dir && eval $am__tar_ >conftest.tar])
+  rm -rf conftest.dir
+  if test -s conftest.tar; then
+    AM_RUN_LOG([$am__untar <conftest.tar])
+    grep GrepMe conftest.dir/file >/dev/null 2>&1 && break
+  fi
+done
+rm -rf conftest.dir
+
+AC_CACHE_VAL([am_cv_prog_tar_$1], [am_cv_prog_tar_$1=$_am_tool])
+AC_MSG_RESULT([$am_cv_prog_tar_$1])])
+AC_SUBST([am__tar])
+AC_SUBST([am__untar])
+]) # _AM_PROG_TAR
+
+m4_include([m4/gettext.m4])
+m4_include([m4/iconv.m4])
+m4_include([m4/lib-ld.m4])
+m4_include([m4/lib-link.m4])
+m4_include([m4/lib-prefix.m4])
+m4_include([m4/libtool.m4])
+m4_include([m4/ltoptions.m4])
+m4_include([m4/ltsugar.m4])
+m4_include([m4/ltversion.m4])
+m4_include([m4/lt~obsolete.m4])
+m4_include([m4/nls.m4])
+m4_include([m4/po.m4])
+m4_include([m4/progtest.m4])
diff --git a/popt-1.16/auto/Makefile.am b/popt-1.16/auto/Makefile.am
new file mode 100644
index 0000000..56bb292
--- /dev/null
+++ b/popt-1.16/auto/Makefile.am
@@ -0,0 +1,12 @@
+AUTOMAKE_OPTIONS = 1.4 foreign
+
+AUTOTEST =      api-sanity-autotest.pl
+
+TDIRS =		descriptors_storage header_compile_errors test_results tests
+
+clean-local:
+	rm -rf $(TDIRS)
+
+check-local:
+	-[ -d tests ] && ${AUTOTEST} -l popt -d desc -clean
+	-${AUTOTEST} -l popt -d desc -st types -gen -build -run
diff --git a/popt-1.16/auto/Makefile.in b/popt-1.16/auto/Makefile.in
new file mode 100644
index 0000000..193fc56
--- /dev/null
+++ b/popt-1.16/auto/Makefile.in
@@ -0,0 +1,401 @@
+# Makefile.in generated by automake 1.11.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002,
+# 2003, 2004, 2005, 2006, 2007, 2008, 2009  Free Software Foundation,
+# Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+VPATH = @srcdir@
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+target_triplet = @target@
+subdir = auto
+DIST_COMMON = $(srcdir)/Makefile.am $(srcdir)/Makefile.in \
+	$(srcdir)/desc.in $(srcdir)/types.in
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/gettext.m4 \
+	$(top_srcdir)/m4/iconv.m4 $(top_srcdir)/m4/lib-ld.m4 \
+	$(top_srcdir)/m4/lib-link.m4 $(top_srcdir)/m4/lib-prefix.m4 \
+	$(top_srcdir)/m4/libtool.m4 $(top_srcdir)/m4/ltoptions.m4 \
+	$(top_srcdir)/m4/ltsugar.m4 $(top_srcdir)/m4/ltversion.m4 \
+	$(top_srcdir)/m4/lt~obsolete.m4 $(top_srcdir)/m4/nls.m4 \
+	$(top_srcdir)/m4/po.m4 $(top_srcdir)/m4/progtest.m4 \
+	$(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+	$(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/config.h
+CONFIG_CLEAN_FILES = desc types
+CONFIG_CLEAN_VPATH_FILES =
+SOURCES =
+DIST_SOURCES =
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GETTEXT_MACRO_VERSION = @GETTEXT_MACRO_VERSION@
+GMSGFMT = @GMSGFMT@
+GMSGFMT_015 = @GMSGFMT_015@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+INTLLIBS = @INTLLIBS@
+INTL_MACOSX_LIBS = @INTL_MACOSX_LIBS@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBICONV = @LIBICONV@
+LIBINTL = @LIBINTL@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBICONV = @LTLIBICONV@
+LTLIBINTL = @LTLIBINTL@
+LTLIBOBJS = @LTLIBOBJS@
+LT_AGE = @LT_AGE@
+LT_CURRENT = @LT_CURRENT@
+LT_REVISION = @LT_REVISION@
+MAINT = @MAINT@
+MAKEINFO = @MAKEINFO@
+MKDIR_P = @MKDIR_P@
+MSGFMT = @MSGFMT@
+MSGFMT_015 = @MSGFMT_015@
+MSGMERGE = @MSGMERGE@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+POPT_PKGCONFIG_LIBS = @POPT_PKGCONFIG_LIBS@
+POPT_SOURCE_PATH = @POPT_SOURCE_PATH@
+POSUB = @POSUB@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+TARGET = @TARGET@
+U = @U@
+USE_NLS = @USE_NLS@
+VERSION = @VERSION@
+XGETTEXT = @XGETTEXT@
+XGETTEXT_015 = @XGETTEXT_015@
+XGETTEXT_EXTRA_OPTIONS = @XGETTEXT_EXTRA_OPTIONS@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+lt_ECHO = @lt_ECHO@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+subdirs = @subdirs@
+sysconfdir = @sysconfdir@
+target = @target@
+target_alias = @target_alias@
+target_cpu = @target_cpu@
+target_os = @target_os@
+target_vendor = @target_vendor@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+AUTOMAKE_OPTIONS = 1.4 foreign
+AUTOTEST = api-sanity-autotest.pl
+TDIRS = descriptors_storage header_compile_errors test_results tests
+all: all-am
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am  $(am__configure_deps)
+	@for dep in $?; do \
+	  case '$(am__configure_deps)' in \
+	    *$$dep*) \
+	      ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+	        && { if test -f $@; then exit 0; else break; fi; }; \
+	      exit 1;; \
+	  esac; \
+	done; \
+	echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign auto/Makefile'; \
+	$(am__cd) $(top_srcdir) && \
+	  $(AUTOMAKE) --foreign auto/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+	@case '$?' in \
+	  *config.status*) \
+	    cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+	  *) \
+	    echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+	    cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+	esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+	cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+desc: $(top_builddir)/config.status $(srcdir)/desc.in
+	cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@
+types: $(top_builddir)/config.status $(srcdir)/types.in
+	cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@
+
+mostlyclean-libtool:
+	-rm -f *.lo
+
+clean-libtool:
+	-rm -rf .libs _libs
+tags: TAGS
+TAGS:
+
+ctags: CTAGS
+CTAGS:
+
+
+distdir: $(DISTFILES)
+	@srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+	list='$(DISTFILES)'; \
+	  dist_files=`for file in $$list; do echo $$file; done | \
+	  sed -e "s|^$$srcdirstrip/||;t" \
+	      -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+	case $$dist_files in \
+	  */*) $(MKDIR_P) `echo "$$dist_files" | \
+			   sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+			   sort -u` ;; \
+	esac; \
+	for file in $$dist_files; do \
+	  if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+	  if test -d $$d/$$file; then \
+	    dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+	    if test -d "$(distdir)/$$file"; then \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+	      cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+	      find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+	    fi; \
+	    cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+	  else \
+	    test -f "$(distdir)/$$file" \
+	    || cp -p $$d/$$file "$(distdir)/$$file" \
+	    || exit 1; \
+	  fi; \
+	done
+check-am: all-am
+	$(MAKE) $(AM_MAKEFLAGS) check-local
+check: check-am
+all-am: Makefile
+installdirs:
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+	@$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+	$(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+	  install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+	  `test -z '$(STRIP)' || \
+	    echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+	-test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+	-test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+	@echo "This command is intended for maintainers to use"
+	@echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-generic clean-libtool clean-local mostlyclean-am
+
+distclean: distclean-am
+	-rm -f Makefile
+distclean-am: clean-am distclean-generic
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+html-am:
+
+info: info-am
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-am
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-am
+
+install-html-am:
+
+install-info: install-info-am
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-am
+
+install-pdf-am:
+
+install-ps: install-ps-am
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+	-rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am:
+
+.MAKE: check-am install-am install-strip
+
+.PHONY: all all-am check check-am check-local clean clean-generic \
+	clean-libtool clean-local distclean distclean-generic \
+	distclean-libtool distdir dvi dvi-am html html-am info info-am \
+	install install-am install-data install-data-am install-dvi \
+	install-dvi-am install-exec install-exec-am install-html \
+	install-html-am install-info install-info-am install-man \
+	install-pdf install-pdf-am install-ps install-ps-am \
+	install-strip installcheck installcheck-am installdirs \
+	maintainer-clean maintainer-clean-generic mostlyclean \
+	mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+	uninstall uninstall-am
+
+
+clean-local:
+	rm -rf $(TDIRS)
+
+check-local:
+	-[ -d tests ] && ${AUTOTEST} -l popt -d desc -clean
+	-${AUTOTEST} -l popt -d desc -st types -gen -build -run
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/popt-1.16/auto/desc.in b/popt-1.16/auto/desc.in
new file mode 100644
index 0000000..32bdc3b
--- /dev/null
+++ b/popt-1.16/auto/desc.in
@@ -0,0 +1,28 @@
+<version>
+  1.15
+</version>
+ 
+<headers>
+  popt.h
+</headers>
+ 
+<libs>
+  @abs_top_builddir@/.libs/libpopt.so
+</libs>
+
+<include_paths>
+  @abs_top_srcdir@
+</include_paths>
+
+<gcc_options>
+  @CFLAGS@
+</gcc_options>
+
+<opaque_types>
+</opaque_types>
+<skip_interfaces>
+</skip_interfaces>
+<include_preamble>
+</include_preamble>
+<libs_depend>
+</libs_depend>
diff --git a/popt-1.16/auto/types.in b/popt-1.16/auto/types.in
new file mode 100644
index 0000000..74a6c33
--- /dev/null
+++ b/popt-1.16/auto/types.in
@@ -0,0 +1,147 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<collection>
+
+<spec_type>
+  <kind> common_env </kind>
+  <global_code>
+    static int aVal = 141421;
+    static unsigned int aFlag = 0x8aceU;
+
+    static short aShort = (short)4523;
+    static int aInt = 271828;
+    static long aLong = 738905609L;
+    static long long aLongLong = 738905609LL;
+    static float aFloat = 3.1415926535;
+    static double aDouble = 9.86960440108935861883;
+    static const char ** aArgv = NULL;
+
+    static struct poptOption optionsTable[] = {
+      { "val", '\0', POPT_ARG_VAL | POPT_ARGFLAG_SHOW_DEFAULT, &aVal, 125992,
+    	"POPT_ARG_VAL: 125992 141421", 0},
+      { "int", 'i', POPT_ARG_INT | POPT_ARGFLAG_SHOW_DEFAULT, &aInt, 0,
+    	"POPT_ARG_INT: 271828", NULL },
+      { "short", 's', POPT_ARG_SHORT | POPT_ARGFLAG_SHOW_DEFAULT, &aShort, 0,
+    	"POPT_ARG_SHORT: 4523", NULL },
+      { "long", 'l', POPT_ARG_LONG | POPT_ARGFLAG_SHOW_DEFAULT, &aLong, 0,
+    	"POPT_ARG_LONG: 738905609", NULL },
+      { "longlong", 'L', POPT_ARG_LONGLONG | POPT_ARGFLAG_SHOW_DEFAULT, &aLongLong, 0,
+    	"POPT_ARG_LONGLONG: 738905609", NULL },
+      { "float", 'f', POPT_ARG_FLOAT | POPT_ARGFLAG_SHOW_DEFAULT, &aFloat, 0,
+    	"POPT_ARG_FLOAT: 3.14159", NULL },
+      { "double", 'd', POPT_ARG_DOUBLE | POPT_ARGFLAG_SHOW_DEFAULT, &aDouble, 0,
+    	"POPT_ARG_DOUBLE: 9.8696", NULL },
+      { "argv", '\0', POPT_ARG_ARGV, &aArgv, 0,
+    	"POPT_ARG_ARGV: append string to argv array (can be used multiple times)","STRING"},
+      POPT_AUTOALIAS
+      POPT_AUTOHELP
+      POPT_TABLEEND
+    };
+  </global_code>
+</spec_type>
+
+<spec_type>
+  <kind> common_param </kind>
+  <data_type> poptContext </data_type>
+  <value> poptGetContext(argv[0], argc, argv, optionsTable, 0) </value>
+  <final_code>
+    $0 = poptFreeContext($0);
+  </final_code>
+  <associating>
+    <except>
+      poptAddItem	<!-- FIXME -->
+    </except>
+  </associating>
+</spec_type>
+<spec_type>
+  <kind> normal </kind>
+  <data_type> poptContext </data_type>
+  <value> poptGetContext(argv[0], argc, argv, optionsTable, 0) </value>
+  <associating>
+    <interfaces>
+      poptFreeContext
+      poptFini
+    </interfaces>
+    <links> param1 </links>
+  </associating>
+</spec_type>
+<spec_type>
+  <kind> normal </kind>
+  <data_type> poptItem </data_type>
+  <value> NULL </value>
+  <global_code>
+    #include <malloc.h>
+  </global_code>
+  <init_code>
+    $0 = calloc(1, sizeof(*$0));
+    $0->option = *poptHelpOptionsI18N;
+    $0->argc = 1;
+    $0->argv = calloc(2, sizeof(*$0->argv));
+    $0->argv[0] = strdup("arg1");
+  </init_code>
+  <associating>
+    <interfaces> poptAddItem </interfaces>
+    <links> param2 </links>
+  </associating>
+</spec_type>
+
+<spec_type>
+  <kind> common_param </kind>
+  <data_type> struct poptAlias </data_type>
+  <value> _alias </value>
+  <global_code>
+    #include <malloc.h>
+    static struct poptAlias _alias = {
+      .longName = "longName",
+      .shortName = 'l',
+      .argc = 0,
+      .argv = NULL
+    };
+  </global_code>
+  <init_code>
+    $0.argc = 1;
+    $0.argv = calloc($0.argc + 1, sizeof(*$0.argv));
+    $0.argv[0] = strdup("arg1");
+  </init_code>
+</spec_type>
+
+<spec_type>
+  <kind> common_param </kind>
+  <name> poptBits </name>
+  <data_type> poptBits </data_type>
+  <value>
+    create_poptBits()
+  </value>
+  <global_code>
+    poptBits create_poptBits()
+    {
+	poptBits a = NULL;
+	(void) poptSaveBits(&a, 0, "foo");
+	(void) poptSaveBits(&a, 0, "bar");
+	(void) poptSaveBits(&a, 0, "baz");
+	return a;
+    }
+  </global_code>
+</spec_type>
+
+<spec_type>
+  <kind> normal </kind>
+  <data_type> const char *** </data_type>
+  <value> &av </value>
+  <global_code>
+    #include <malloc.h>
+  </global_code>
+  <init_code>
+    const char ** av = NULL;
+  </init_code>
+  <final_code>
+    free(av[0]);
+    free(av);
+  </final_code>
+  <associating>
+    <interfaces> poptSaveString </interfaces>
+    <links> param1 </links>
+  </associating>
+</spec_type>
+
+</collection>
+
diff --git a/popt-1.16/autogen.sh b/popt-1.16/autogen.sh
new file mode 100755
index 0000000..63d786c
--- /dev/null
+++ b/popt-1.16/autogen.sh
@@ -0,0 +1,38 @@
+#!/bin/sh
+
+srcdir="`dirname $0`"
+test -z "$srcdir" && srcdir=.
+
+THEDIR="`pwd`"
+
+libtoolize=`which glibtoolize 2>/dev/null`
+case $libtoolize in
+/*) ;;
+*)  libtoolize=`which libtoolize 2>/dev/null`
+    case $libtoolize in
+    /*) ;;
+    *)  libtoolize=libtoolize
+    esac
+esac
+
+cd "$srcdir"
+$libtoolize --copy --force
+gettextize --copy --force --no-changelog
+perl -p -i~ -e 's/(po\/Makefile\.in)\s+po\/Makefile\.in/$1/' configure.ac
+perl -p -i~ -e 's/(SUBDIRS\s+=\s+po)\s+po/$1/' Makefile.am
+aclocal -I m4
+autoheader
+automake -Wall -Wno-override -a -c
+autoconf
+
+if [ "$1" = "--noconfigure" ]; then 
+    exit 0;
+fi
+
+cd "$THEDIR"
+
+if [ X"$@" = X  -a "X`uname -s`" = "XLinux" ]; then
+    $srcdir/configure --prefix=/usr --libdir=/lib "$@"
+else
+    $srcdir/configure "$@"
+fi
diff --git a/popt-1.16/config.guess b/popt-1.16/config.guess
new file mode 100755
index 0000000..dc84c68
--- /dev/null
+++ b/popt-1.16/config.guess
@@ -0,0 +1,1501 @@
+#! /bin/sh
+# Attempt to guess a canonical system name.
+#   Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999,
+#   2000, 2001, 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009
+#   Free Software Foundation, Inc.
+
+timestamp='2009-11-20'
+
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin Street - Fifth Floor, Boston, MA
+# 02110-1301, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+
+# Originally written by Per Bothner.  Please send patches (context
+# diff format) to <config-patches@gnu.org> and include a ChangeLog
+# entry.
+#
+# This script attempts to guess a canonical system name similar to
+# config.sub.  If it succeeds, it prints the system name on stdout, and
+# exits with 0.  Otherwise, it exits with 1.
+#
+# You can get the latest version of this script from:
+# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess;hb=HEAD
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION]
+
+Output the configuration name of the system \`$me' is run on.
+
+Operation modes:
+  -h, --help         print this help, then exit
+  -t, --time-stamp   print date of last modification, then exit
+  -v, --version      print version number, then exit
+
+Report bugs and patches to <config-patches@gnu.org>."
+
+version="\
+GNU config.guess ($timestamp)
+
+Originally written by Per Bothner.
+Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001,
+2002, 2003, 2004, 2005, 2006, 2007, 2008 Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions.  There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+  case $1 in
+    --time-stamp | --time* | -t )
+       echo "$timestamp" ; exit ;;
+    --version | -v )
+       echo "$version" ; exit ;;
+    --help | --h* | -h )
+       echo "$usage"; exit ;;
+    -- )     # Stop option processing
+       shift; break ;;
+    - )	# Use stdin as input.
+       break ;;
+    -* )
+       echo "$me: invalid option $1$help" >&2
+       exit 1 ;;
+    * )
+       break ;;
+  esac
+done
+
+if test $# != 0; then
+  echo "$me: too many arguments$help" >&2
+  exit 1
+fi
+
+trap 'exit 1' 1 2 15
+
+# CC_FOR_BUILD -- compiler used by this script. Note that the use of a
+# compiler to aid in system detection is discouraged as it requires
+# temporary files to be created and, as you can see below, it is a
+# headache to deal with in a portable fashion.
+
+# Historically, `CC_FOR_BUILD' used to be named `HOST_CC'. We still
+# use `HOST_CC' if defined, but it is deprecated.
+
+# Portable tmp directory creation inspired by the Autoconf team.
+
+set_cc_for_build='
+trap "exitcode=\$?; (rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null) && exit \$exitcode" 0 ;
+trap "rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null; exit 1" 1 2 13 15 ;
+: ${TMPDIR=/tmp} ;
+ { tmp=`(umask 077 && mktemp -d "$TMPDIR/cgXXXXXX") 2>/dev/null` && test -n "$tmp" && test -d "$tmp" ; } ||
+ { test -n "$RANDOM" && tmp=$TMPDIR/cg$$-$RANDOM && (umask 077 && mkdir $tmp) ; } ||
+ { tmp=$TMPDIR/cg-$$ && (umask 077 && mkdir $tmp) && echo "Warning: creating insecure temp directory" >&2 ; } ||
+ { echo "$me: cannot create a temporary directory in $TMPDIR" >&2 ; exit 1 ; } ;
+dummy=$tmp/dummy ;
+tmpfiles="$dummy.c $dummy.o $dummy.rel $dummy" ;
+case $CC_FOR_BUILD,$HOST_CC,$CC in
+ ,,)    echo "int x;" > $dummy.c ;
+	for c in cc gcc c89 c99 ; do
+	  if ($c -c -o $dummy.o $dummy.c) >/dev/null 2>&1 ; then
+	     CC_FOR_BUILD="$c"; break ;
+	  fi ;
+	done ;
+	if test x"$CC_FOR_BUILD" = x ; then
+	  CC_FOR_BUILD=no_compiler_found ;
+	fi
+	;;
+ ,,*)   CC_FOR_BUILD=$CC ;;
+ ,*,*)  CC_FOR_BUILD=$HOST_CC ;;
+esac ; set_cc_for_build= ;'
+
+# This is needed to find uname on a Pyramid OSx when run in the BSD universe.
+# (ghazi@noc.rutgers.edu 1994-08-24)
+if (test -f /.attbin/uname) >/dev/null 2>&1 ; then
+	PATH=$PATH:/.attbin ; export PATH
+fi
+
+UNAME_MACHINE=`(uname -m) 2>/dev/null` || UNAME_MACHINE=unknown
+UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown
+UNAME_SYSTEM=`(uname -s) 2>/dev/null`  || UNAME_SYSTEM=unknown
+UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown
+
+# Note: order is significant - the case branches are not exclusive.
+
+case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
+    *:NetBSD:*:*)
+	# NetBSD (nbsd) targets should (where applicable) match one or
+	# more of the tupples: *-*-netbsdelf*, *-*-netbsdaout*,
+	# *-*-netbsdecoff* and *-*-netbsd*.  For targets that recently
+	# switched to ELF, *-*-netbsd* would select the old
+	# object file format.  This provides both forward
+	# compatibility and a consistent mechanism for selecting the
+	# object file format.
+	#
+	# Note: NetBSD doesn't particularly care about the vendor
+	# portion of the name.  We always set it to "unknown".
+	sysctl="sysctl -n hw.machine_arch"
+	UNAME_MACHINE_ARCH=`(/sbin/$sysctl 2>/dev/null || \
+	    /usr/sbin/$sysctl 2>/dev/null || echo unknown)`
+	case "${UNAME_MACHINE_ARCH}" in
+	    armeb) machine=armeb-unknown ;;
+	    arm*) machine=arm-unknown ;;
+	    sh3el) machine=shl-unknown ;;
+	    sh3eb) machine=sh-unknown ;;
+	    sh5el) machine=sh5le-unknown ;;
+	    *) machine=${UNAME_MACHINE_ARCH}-unknown ;;
+	esac
+	# The Operating System including object format, if it has switched
+	# to ELF recently, or will in the future.
+	case "${UNAME_MACHINE_ARCH}" in
+	    arm*|i386|m68k|ns32k|sh3*|sparc|vax)
+		eval $set_cc_for_build
+		if echo __ELF__ | $CC_FOR_BUILD -E - 2>/dev/null \
+			| grep -q __ELF__
+		then
+		    # Once all utilities can be ECOFF (netbsdecoff) or a.out (netbsdaout).
+		    # Return netbsd for either.  FIX?
+		    os=netbsd
+		else
+		    os=netbsdelf
+		fi
+		;;
+	    *)
+	        os=netbsd
+		;;
+	esac
+	# The OS release
+	# Debian GNU/NetBSD machines have a different userland, and
+	# thus, need a distinct triplet. However, they do not need
+	# kernel version information, so it can be replaced with a
+	# suitable tag, in the style of linux-gnu.
+	case "${UNAME_VERSION}" in
+	    Debian*)
+		release='-gnu'
+		;;
+	    *)
+		release=`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+		;;
+	esac
+	# Since CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM:
+	# contains redundant information, the shorter form:
+	# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM is used.
+	echo "${machine}-${os}${release}"
+	exit ;;
+    *:OpenBSD:*:*)
+	UNAME_MACHINE_ARCH=`arch | sed 's/OpenBSD.//'`
+	echo ${UNAME_MACHINE_ARCH}-unknown-openbsd${UNAME_RELEASE}
+	exit ;;
+    *:ekkoBSD:*:*)
+	echo ${UNAME_MACHINE}-unknown-ekkobsd${UNAME_RELEASE}
+	exit ;;
+    *:SolidBSD:*:*)
+	echo ${UNAME_MACHINE}-unknown-solidbsd${UNAME_RELEASE}
+	exit ;;
+    macppc:MirBSD:*:*)
+	echo powerpc-unknown-mirbsd${UNAME_RELEASE}
+	exit ;;
+    *:MirBSD:*:*)
+	echo ${UNAME_MACHINE}-unknown-mirbsd${UNAME_RELEASE}
+	exit ;;
+    alpha:OSF1:*:*)
+	case $UNAME_RELEASE in
+	*4.0)
+		UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'`
+		;;
+	*5.*)
+	        UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $4}'`
+		;;
+	esac
+	# According to Compaq, /usr/sbin/psrinfo has been available on
+	# OSF/1 and Tru64 systems produced since 1995.  I hope that
+	# covers most systems running today.  This code pipes the CPU
+	# types through head -n 1, so we only detect the type of CPU 0.
+	ALPHA_CPU_TYPE=`/usr/sbin/psrinfo -v | sed -n -e 's/^  The alpha \(.*\) processor.*$/\1/p' | head -n 1`
+	case "$ALPHA_CPU_TYPE" in
+	    "EV4 (21064)")
+		UNAME_MACHINE="alpha" ;;
+	    "EV4.5 (21064)")
+		UNAME_MACHINE="alpha" ;;
+	    "LCA4 (21066/21068)")
+		UNAME_MACHINE="alpha" ;;
+	    "EV5 (21164)")
+		UNAME_MACHINE="alphaev5" ;;
+	    "EV5.6 (21164A)")
+		UNAME_MACHINE="alphaev56" ;;
+	    "EV5.6 (21164PC)")
+		UNAME_MACHINE="alphapca56" ;;
+	    "EV5.7 (21164PC)")
+		UNAME_MACHINE="alphapca57" ;;
+	    "EV6 (21264)")
+		UNAME_MACHINE="alphaev6" ;;
+	    "EV6.7 (21264A)")
+		UNAME_MACHINE="alphaev67" ;;
+	    "EV6.8CB (21264C)")
+		UNAME_MACHINE="alphaev68" ;;
+	    "EV6.8AL (21264B)")
+		UNAME_MACHINE="alphaev68" ;;
+	    "EV6.8CX (21264D)")
+		UNAME_MACHINE="alphaev68" ;;
+	    "EV6.9A (21264/EV69A)")
+		UNAME_MACHINE="alphaev69" ;;
+	    "EV7 (21364)")
+		UNAME_MACHINE="alphaev7" ;;
+	    "EV7.9 (21364A)")
+		UNAME_MACHINE="alphaev79" ;;
+	esac
+	# A Pn.n version is a patched version.
+	# A Vn.n version is a released version.
+	# A Tn.n version is a released field test version.
+	# A Xn.n version is an unreleased experimental baselevel.
+	# 1.2 uses "1.2" for uname -r.
+	echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[PVTX]//' | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+	exit ;;
+    Alpha\ *:Windows_NT*:*)
+	# How do we know it's Interix rather than the generic POSIX subsystem?
+	# Should we change UNAME_MACHINE based on the output of uname instead
+	# of the specific Alpha model?
+	echo alpha-pc-interix
+	exit ;;
+    21064:Windows_NT:50:3)
+	echo alpha-dec-winnt3.5
+	exit ;;
+    Amiga*:UNIX_System_V:4.0:*)
+	echo m68k-unknown-sysv4
+	exit ;;
+    *:[Aa]miga[Oo][Ss]:*:*)
+	echo ${UNAME_MACHINE}-unknown-amigaos
+	exit ;;
+    *:[Mm]orph[Oo][Ss]:*:*)
+	echo ${UNAME_MACHINE}-unknown-morphos
+	exit ;;
+    *:OS/390:*:*)
+	echo i370-ibm-openedition
+	exit ;;
+    *:z/VM:*:*)
+	echo s390-ibm-zvmoe
+	exit ;;
+    *:OS400:*:*)
+        echo powerpc-ibm-os400
+	exit ;;
+    arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*)
+	echo arm-acorn-riscix${UNAME_RELEASE}
+	exit ;;
+    arm:riscos:*:*|arm:RISCOS:*:*)
+	echo arm-unknown-riscos
+	exit ;;
+    SR2?01:HI-UX/MPP:*:* | SR8000:HI-UX/MPP:*:*)
+	echo hppa1.1-hitachi-hiuxmpp
+	exit ;;
+    Pyramid*:OSx*:*:* | MIS*:OSx*:*:* | MIS*:SMP_DC-OSx*:*:*)
+	# akee@wpdis03.wpafb.af.mil (Earle F. Ake) contributed MIS and NILE.
+	if test "`(/bin/universe) 2>/dev/null`" = att ; then
+		echo pyramid-pyramid-sysv3
+	else
+		echo pyramid-pyramid-bsd
+	fi
+	exit ;;
+    NILE*:*:*:dcosx)
+	echo pyramid-pyramid-svr4
+	exit ;;
+    DRS?6000:unix:4.0:6*)
+	echo sparc-icl-nx6
+	exit ;;
+    DRS?6000:UNIX_SV:4.2*:7* | DRS?6000:isis:4.2*:7*)
+	case `/usr/bin/uname -p` in
+	    sparc) echo sparc-icl-nx7; exit ;;
+	esac ;;
+    s390x:SunOS:*:*)
+	echo ${UNAME_MACHINE}-ibm-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    sun4H:SunOS:5.*:*)
+	echo sparc-hal-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*)
+	echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    i86pc:AuroraUX:5.*:* | i86xen:AuroraUX:5.*:*)
+	echo i386-pc-auroraux${UNAME_RELEASE}
+	exit ;;
+    i86pc:SunOS:5.*:* | i86xen:SunOS:5.*:*)
+	eval $set_cc_for_build
+	SUN_ARCH="i386"
+	# If there is a compiler, see if it is configured for 64-bit objects.
+	# Note that the Sun cc does not turn __LP64__ into 1 like gcc does.
+	# This test works for both compilers.
+	if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then
+	    if (echo '#ifdef __amd64'; echo IS_64BIT_ARCH; echo '#endif') | \
+		(CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \
+		grep IS_64BIT_ARCH >/dev/null
+	    then
+		SUN_ARCH="x86_64"
+	    fi
+	fi
+	echo ${SUN_ARCH}-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    sun4*:SunOS:6*:*)
+	# According to config.sub, this is the proper way to canonicalize
+	# SunOS6.  Hard to guess exactly what SunOS6 will be like, but
+	# it's likely to be more like Solaris than SunOS4.
+	echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    sun4*:SunOS:*:*)
+	case "`/usr/bin/arch -k`" in
+	    Series*|S4*)
+		UNAME_RELEASE=`uname -v`
+		;;
+	esac
+	# Japanese Language versions have a version number like `4.1.3-JL'.
+	echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'`
+	exit ;;
+    sun3*:SunOS:*:*)
+	echo m68k-sun-sunos${UNAME_RELEASE}
+	exit ;;
+    sun*:*:4.2BSD:*)
+	UNAME_RELEASE=`(sed 1q /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null`
+	test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3
+	case "`/bin/arch`" in
+	    sun3)
+		echo m68k-sun-sunos${UNAME_RELEASE}
+		;;
+	    sun4)
+		echo sparc-sun-sunos${UNAME_RELEASE}
+		;;
+	esac
+	exit ;;
+    aushp:SunOS:*:*)
+	echo sparc-auspex-sunos${UNAME_RELEASE}
+	exit ;;
+    # The situation for MiNT is a little confusing.  The machine name
+    # can be virtually everything (everything which is not
+    # "atarist" or "atariste" at least should have a processor
+    # > m68000).  The system name ranges from "MiNT" over "FreeMiNT"
+    # to the lowercase version "mint" (or "freemint").  Finally
+    # the system name "TOS" denotes a system which is actually not
+    # MiNT.  But MiNT is downward compatible to TOS, so this should
+    # be no problem.
+    atarist[e]:*MiNT:*:* | atarist[e]:*mint:*:* | atarist[e]:*TOS:*:*)
+        echo m68k-atari-mint${UNAME_RELEASE}
+	exit ;;
+    atari*:*MiNT:*:* | atari*:*mint:*:* | atarist[e]:*TOS:*:*)
+	echo m68k-atari-mint${UNAME_RELEASE}
+        exit ;;
+    *falcon*:*MiNT:*:* | *falcon*:*mint:*:* | *falcon*:*TOS:*:*)
+        echo m68k-atari-mint${UNAME_RELEASE}
+	exit ;;
+    milan*:*MiNT:*:* | milan*:*mint:*:* | *milan*:*TOS:*:*)
+        echo m68k-milan-mint${UNAME_RELEASE}
+        exit ;;
+    hades*:*MiNT:*:* | hades*:*mint:*:* | *hades*:*TOS:*:*)
+        echo m68k-hades-mint${UNAME_RELEASE}
+        exit ;;
+    *:*MiNT:*:* | *:*mint:*:* | *:*TOS:*:*)
+        echo m68k-unknown-mint${UNAME_RELEASE}
+        exit ;;
+    m68k:machten:*:*)
+	echo m68k-apple-machten${UNAME_RELEASE}
+	exit ;;
+    powerpc:machten:*:*)
+	echo powerpc-apple-machten${UNAME_RELEASE}
+	exit ;;
+    RISC*:Mach:*:*)
+	echo mips-dec-mach_bsd4.3
+	exit ;;
+    RISC*:ULTRIX:*:*)
+	echo mips-dec-ultrix${UNAME_RELEASE}
+	exit ;;
+    VAX*:ULTRIX*:*:*)
+	echo vax-dec-ultrix${UNAME_RELEASE}
+	exit ;;
+    2020:CLIX:*:* | 2430:CLIX:*:*)
+	echo clipper-intergraph-clix${UNAME_RELEASE}
+	exit ;;
+    mips:*:*:UMIPS | mips:*:*:RISCos)
+	eval $set_cc_for_build
+	sed 's/^	//' << EOF >$dummy.c
+#ifdef __cplusplus
+#include <stdio.h>  /* for printf() prototype */
+	int main (int argc, char *argv[]) {
+#else
+	int main (argc, argv) int argc; char *argv[]; {
+#endif
+	#if defined (host_mips) && defined (MIPSEB)
+	#if defined (SYSTYPE_SYSV)
+	  printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0);
+	#endif
+	#if defined (SYSTYPE_SVR4)
+	  printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0);
+	#endif
+	#if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD)
+	  printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0);
+	#endif
+	#endif
+	  exit (-1);
+	}
+EOF
+	$CC_FOR_BUILD -o $dummy $dummy.c &&
+	  dummyarg=`echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` &&
+	  SYSTEM_NAME=`$dummy $dummyarg` &&
+	    { echo "$SYSTEM_NAME"; exit; }
+	echo mips-mips-riscos${UNAME_RELEASE}
+	exit ;;
+    Motorola:PowerMAX_OS:*:*)
+	echo powerpc-motorola-powermax
+	exit ;;
+    Motorola:*:4.3:PL8-*)
+	echo powerpc-harris-powermax
+	exit ;;
+    Night_Hawk:*:*:PowerMAX_OS | Synergy:PowerMAX_OS:*:*)
+	echo powerpc-harris-powermax
+	exit ;;
+    Night_Hawk:Power_UNIX:*:*)
+	echo powerpc-harris-powerunix
+	exit ;;
+    m88k:CX/UX:7*:*)
+	echo m88k-harris-cxux7
+	exit ;;
+    m88k:*:4*:R4*)
+	echo m88k-motorola-sysv4
+	exit ;;
+    m88k:*:3*:R3*)
+	echo m88k-motorola-sysv3
+	exit ;;
+    AViiON:dgux:*:*)
+        # DG/UX returns AViiON for all architectures
+        UNAME_PROCESSOR=`/usr/bin/uname -p`
+	if [ $UNAME_PROCESSOR = mc88100 ] || [ $UNAME_PROCESSOR = mc88110 ]
+	then
+	    if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx ] || \
+	       [ ${TARGET_BINARY_INTERFACE}x = x ]
+	    then
+		echo m88k-dg-dgux${UNAME_RELEASE}
+	    else
+		echo m88k-dg-dguxbcs${UNAME_RELEASE}
+	    fi
+	else
+	    echo i586-dg-dgux${UNAME_RELEASE}
+	fi
+ 	exit ;;
+    M88*:DolphinOS:*:*)	# DolphinOS (SVR3)
+	echo m88k-dolphin-sysv3
+	exit ;;
+    M88*:*:R3*:*)
+	# Delta 88k system running SVR3
+	echo m88k-motorola-sysv3
+	exit ;;
+    XD88*:*:*:*) # Tektronix XD88 system running UTekV (SVR3)
+	echo m88k-tektronix-sysv3
+	exit ;;
+    Tek43[0-9][0-9]:UTek:*:*) # Tektronix 4300 system running UTek (BSD)
+	echo m68k-tektronix-bsd
+	exit ;;
+    *:IRIX*:*:*)
+	echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'`
+	exit ;;
+    ????????:AIX?:[12].1:2)   # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX.
+	echo romp-ibm-aix     # uname -m gives an 8 hex-code CPU id
+	exit ;;               # Note that: echo "'`uname -s`'" gives 'AIX '
+    i*86:AIX:*:*)
+	echo i386-ibm-aix
+	exit ;;
+    ia64:AIX:*:*)
+	if [ -x /usr/bin/oslevel ] ; then
+		IBM_REV=`/usr/bin/oslevel`
+	else
+		IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+	fi
+	echo ${UNAME_MACHINE}-ibm-aix${IBM_REV}
+	exit ;;
+    *:AIX:2:3)
+	if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then
+		eval $set_cc_for_build
+		sed 's/^		//' << EOF >$dummy.c
+		#include <sys/systemcfg.h>
+
+		main()
+			{
+			if (!__power_pc())
+				exit(1);
+			puts("powerpc-ibm-aix3.2.5");
+			exit(0);
+			}
+EOF
+		if $CC_FOR_BUILD -o $dummy $dummy.c && SYSTEM_NAME=`$dummy`
+		then
+			echo "$SYSTEM_NAME"
+		else
+			echo rs6000-ibm-aix3.2.5
+		fi
+	elif grep bos324 /usr/include/stdio.h >/dev/null 2>&1; then
+		echo rs6000-ibm-aix3.2.4
+	else
+		echo rs6000-ibm-aix3.2
+	fi
+	exit ;;
+    *:AIX:*:[456])
+	IBM_CPU_ID=`/usr/sbin/lsdev -C -c processor -S available | sed 1q | awk '{ print $1 }'`
+	if /usr/sbin/lsattr -El ${IBM_CPU_ID} | grep ' POWER' >/dev/null 2>&1; then
+		IBM_ARCH=rs6000
+	else
+		IBM_ARCH=powerpc
+	fi
+	if [ -x /usr/bin/oslevel ] ; then
+		IBM_REV=`/usr/bin/oslevel`
+	else
+		IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+	fi
+	echo ${IBM_ARCH}-ibm-aix${IBM_REV}
+	exit ;;
+    *:AIX:*:*)
+	echo rs6000-ibm-aix
+	exit ;;
+    ibmrt:4.4BSD:*|romp-ibm:BSD:*)
+	echo romp-ibm-bsd4.4
+	exit ;;
+    ibmrt:*BSD:*|romp-ibm:BSD:*)            # covers RT/PC BSD and
+	echo romp-ibm-bsd${UNAME_RELEASE}   # 4.3 with uname added to
+	exit ;;                             # report: romp-ibm BSD 4.3
+    *:BOSX:*:*)
+	echo rs6000-bull-bosx
+	exit ;;
+    DPX/2?00:B.O.S.:*:*)
+	echo m68k-bull-sysv3
+	exit ;;
+    9000/[34]??:4.3bsd:1.*:*)
+	echo m68k-hp-bsd
+	exit ;;
+    hp300:4.4BSD:*:* | 9000/[34]??:4.3bsd:2.*:*)
+	echo m68k-hp-bsd4.4
+	exit ;;
+    9000/[34678]??:HP-UX:*:*)
+	HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+	case "${UNAME_MACHINE}" in
+	    9000/31? )            HP_ARCH=m68000 ;;
+	    9000/[34]?? )         HP_ARCH=m68k ;;
+	    9000/[678][0-9][0-9])
+		if [ -x /usr/bin/getconf ]; then
+		    sc_cpu_version=`/usr/bin/getconf SC_CPU_VERSION 2>/dev/null`
+                    sc_kernel_bits=`/usr/bin/getconf SC_KERNEL_BITS 2>/dev/null`
+                    case "${sc_cpu_version}" in
+                      523) HP_ARCH="hppa1.0" ;; # CPU_PA_RISC1_0
+                      528) HP_ARCH="hppa1.1" ;; # CPU_PA_RISC1_1
+                      532)                      # CPU_PA_RISC2_0
+                        case "${sc_kernel_bits}" in
+                          32) HP_ARCH="hppa2.0n" ;;
+                          64) HP_ARCH="hppa2.0w" ;;
+			  '') HP_ARCH="hppa2.0" ;;   # HP-UX 10.20
+                        esac ;;
+                    esac
+		fi
+		if [ "${HP_ARCH}" = "" ]; then
+		    eval $set_cc_for_build
+		    sed 's/^              //' << EOF >$dummy.c
+
+              #define _HPUX_SOURCE
+              #include <stdlib.h>
+              #include <unistd.h>
+
+              int main ()
+              {
+              #if defined(_SC_KERNEL_BITS)
+                  long bits = sysconf(_SC_KERNEL_BITS);
+              #endif
+                  long cpu  = sysconf (_SC_CPU_VERSION);
+
+                  switch (cpu)
+              	{
+              	case CPU_PA_RISC1_0: puts ("hppa1.0"); break;
+              	case CPU_PA_RISC1_1: puts ("hppa1.1"); break;
+              	case CPU_PA_RISC2_0:
+              #if defined(_SC_KERNEL_BITS)
+              	    switch (bits)
+              		{
+              		case 64: puts ("hppa2.0w"); break;
+              		case 32: puts ("hppa2.0n"); break;
+              		default: puts ("hppa2.0"); break;
+              		} break;
+              #else  /* !defined(_SC_KERNEL_BITS) */
+              	    puts ("hppa2.0"); break;
+              #endif
+              	default: puts ("hppa1.0"); break;
+              	}
+                  exit (0);
+              }
+EOF
+		    (CCOPTS= $CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null) && HP_ARCH=`$dummy`
+		    test -z "$HP_ARCH" && HP_ARCH=hppa
+		fi ;;
+	esac
+	if [ ${HP_ARCH} = "hppa2.0w" ]
+	then
+	    eval $set_cc_for_build
+
+	    # hppa2.0w-hp-hpux* has a 64-bit kernel and a compiler generating
+	    # 32-bit code.  hppa64-hp-hpux* has the same kernel and a compiler
+	    # generating 64-bit code.  GNU and HP use different nomenclature:
+	    #
+	    # $ CC_FOR_BUILD=cc ./config.guess
+	    # => hppa2.0w-hp-hpux11.23
+	    # $ CC_FOR_BUILD="cc +DA2.0w" ./config.guess
+	    # => hppa64-hp-hpux11.23
+
+	    if echo __LP64__ | (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) |
+		grep -q __LP64__
+	    then
+		HP_ARCH="hppa2.0w"
+	    else
+		HP_ARCH="hppa64"
+	    fi
+	fi
+	echo ${HP_ARCH}-hp-hpux${HPUX_REV}
+	exit ;;
+    ia64:HP-UX:*:*)
+	HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+	echo ia64-hp-hpux${HPUX_REV}
+	exit ;;
+    3050*:HI-UX:*:*)
+	eval $set_cc_for_build
+	sed 's/^	//' << EOF >$dummy.c
+	#include <unistd.h>
+	int
+	main ()
+	{
+	  long cpu = sysconf (_SC_CPU_VERSION);
+	  /* The order matters, because CPU_IS_HP_MC68K erroneously returns
+	     true for CPU_PA_RISC1_0.  CPU_IS_PA_RISC returns correct
+	     results, however.  */
+	  if (CPU_IS_PA_RISC (cpu))
+	    {
+	      switch (cpu)
+		{
+		  case CPU_PA_RISC1_0: puts ("hppa1.0-hitachi-hiuxwe2"); break;
+		  case CPU_PA_RISC1_1: puts ("hppa1.1-hitachi-hiuxwe2"); break;
+		  case CPU_PA_RISC2_0: puts ("hppa2.0-hitachi-hiuxwe2"); break;
+		  default: puts ("hppa-hitachi-hiuxwe2"); break;
+		}
+	    }
+	  else if (CPU_IS_HP_MC68K (cpu))
+	    puts ("m68k-hitachi-hiuxwe2");
+	  else puts ("unknown-hitachi-hiuxwe2");
+	  exit (0);
+	}
+EOF
+	$CC_FOR_BUILD -o $dummy $dummy.c && SYSTEM_NAME=`$dummy` &&
+		{ echo "$SYSTEM_NAME"; exit; }
+	echo unknown-hitachi-hiuxwe2
+	exit ;;
+    9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* )
+	echo hppa1.1-hp-bsd
+	exit ;;
+    9000/8??:4.3bsd:*:*)
+	echo hppa1.0-hp-bsd
+	exit ;;
+    *9??*:MPE/iX:*:* | *3000*:MPE/iX:*:*)
+	echo hppa1.0-hp-mpeix
+	exit ;;
+    hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* )
+	echo hppa1.1-hp-osf
+	exit ;;
+    hp8??:OSF1:*:*)
+	echo hppa1.0-hp-osf
+	exit ;;
+    i*86:OSF1:*:*)
+	if [ -x /usr/sbin/sysversion ] ; then
+	    echo ${UNAME_MACHINE}-unknown-osf1mk
+	else
+	    echo ${UNAME_MACHINE}-unknown-osf1
+	fi
+	exit ;;
+    parisc*:Lites*:*:*)
+	echo hppa1.1-hp-lites
+	exit ;;
+    C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*)
+	echo c1-convex-bsd
+        exit ;;
+    C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*)
+	if getsysinfo -f scalar_acc
+	then echo c32-convex-bsd
+	else echo c2-convex-bsd
+	fi
+        exit ;;
+    C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*)
+	echo c34-convex-bsd
+        exit ;;
+    C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*)
+	echo c38-convex-bsd
+        exit ;;
+    C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*)
+	echo c4-convex-bsd
+        exit ;;
+    CRAY*Y-MP:*:*:*)
+	echo ymp-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+	exit ;;
+    CRAY*[A-Z]90:*:*:*)
+	echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \
+	| sed -e 's/CRAY.*\([A-Z]90\)/\1/' \
+	      -e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/ \
+	      -e 's/\.[^.]*$/.X/'
+	exit ;;
+    CRAY*TS:*:*:*)
+	echo t90-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+	exit ;;
+    CRAY*T3E:*:*:*)
+	echo alphaev5-cray-unicosmk${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+	exit ;;
+    CRAY*SV1:*:*:*)
+	echo sv1-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+	exit ;;
+    *:UNICOS/mp:*:*)
+	echo craynv-cray-unicosmp${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+	exit ;;
+    F30[01]:UNIX_System_V:*:* | F700:UNIX_System_V:*:*)
+	FUJITSU_PROC=`uname -m | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+        FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
+        FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'`
+        echo "${FUJITSU_PROC}-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+        exit ;;
+    5000:UNIX_System_V:4.*:*)
+        FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
+        FUJITSU_REL=`echo ${UNAME_RELEASE} | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/ /_/'`
+        echo "sparc-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+	exit ;;
+    i*86:BSD/386:*:* | i*86:BSD/OS:*:* | *:Ascend\ Embedded/OS:*:*)
+	echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE}
+	exit ;;
+    sparc*:BSD/OS:*:*)
+	echo sparc-unknown-bsdi${UNAME_RELEASE}
+	exit ;;
+    *:BSD/OS:*:*)
+	echo ${UNAME_MACHINE}-unknown-bsdi${UNAME_RELEASE}
+	exit ;;
+    *:FreeBSD:*:*)
+	case ${UNAME_MACHINE} in
+	    pc98)
+		echo i386-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+	    amd64)
+		echo x86_64-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+	    *)
+		echo ${UNAME_MACHINE}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+	esac
+	exit ;;
+    i*:CYGWIN*:*)
+	echo ${UNAME_MACHINE}-pc-cygwin
+	exit ;;
+    *:MINGW*:*)
+	echo ${UNAME_MACHINE}-pc-mingw32
+	exit ;;
+    i*:windows32*:*)
+    	# uname -m includes "-pc" on this system.
+    	echo ${UNAME_MACHINE}-mingw32
+	exit ;;
+    i*:PW*:*)
+	echo ${UNAME_MACHINE}-pc-pw32
+	exit ;;
+    *:Interix*:*)
+    	case ${UNAME_MACHINE} in
+	    x86)
+		echo i586-pc-interix${UNAME_RELEASE}
+		exit ;;
+	    authenticamd | genuineintel | EM64T)
+		echo x86_64-unknown-interix${UNAME_RELEASE}
+		exit ;;
+	    IA64)
+		echo ia64-unknown-interix${UNAME_RELEASE}
+		exit ;;
+	esac ;;
+    [345]86:Windows_95:* | [345]86:Windows_98:* | [345]86:Windows_NT:*)
+	echo i${UNAME_MACHINE}-pc-mks
+	exit ;;
+    8664:Windows_NT:*)
+	echo x86_64-pc-mks
+	exit ;;
+    i*:Windows_NT*:* | Pentium*:Windows_NT*:*)
+	# How do we know it's Interix rather than the generic POSIX subsystem?
+	# It also conflicts with pre-2.0 versions of AT&T UWIN. Should we
+	# UNAME_MACHINE based on the output of uname instead of i386?
+	echo i586-pc-interix
+	exit ;;
+    i*:UWIN*:*)
+	echo ${UNAME_MACHINE}-pc-uwin
+	exit ;;
+    amd64:CYGWIN*:*:* | x86_64:CYGWIN*:*:*)
+	echo x86_64-unknown-cygwin
+	exit ;;
+    p*:CYGWIN*:*)
+	echo powerpcle-unknown-cygwin
+	exit ;;
+    prep*:SunOS:5.*:*)
+	echo powerpcle-unknown-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+	exit ;;
+    *:GNU:*:*)
+	# the GNU system
+	echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-unknown-gnu`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'`
+	exit ;;
+    *:GNU/*:*:*)
+	# other systems with GNU libc and userland
+	echo ${UNAME_MACHINE}-unknown-`echo ${UNAME_SYSTEM} | sed 's,^[^/]*/,,' | tr '[A-Z]' '[a-z]'``echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`-gnu
+	exit ;;
+    i*86:Minix:*:*)
+	echo ${UNAME_MACHINE}-pc-minix
+	exit ;;
+    alpha:Linux:*:*)
+	case `sed -n '/^cpu model/s/^.*: \(.*\)/\1/p' < /proc/cpuinfo` in
+	  EV5)   UNAME_MACHINE=alphaev5 ;;
+	  EV56)  UNAME_MACHINE=alphaev56 ;;
+	  PCA56) UNAME_MACHINE=alphapca56 ;;
+	  PCA57) UNAME_MACHINE=alphapca56 ;;
+	  EV6)   UNAME_MACHINE=alphaev6 ;;
+	  EV67)  UNAME_MACHINE=alphaev67 ;;
+	  EV68*) UNAME_MACHINE=alphaev68 ;;
+        esac
+	objdump --private-headers /bin/sh | grep -q ld.so.1
+	if test "$?" = 0 ; then LIBC="libc1" ; else LIBC="" ; fi
+	echo ${UNAME_MACHINE}-unknown-linux-gnu${LIBC}
+	exit ;;
+    arm*:Linux:*:*)
+	eval $set_cc_for_build
+	if echo __ARM_EABI__ | $CC_FOR_BUILD -E - 2>/dev/null \
+	    | grep -q __ARM_EABI__
+	then
+	    echo ${UNAME_MACHINE}-unknown-linux-gnu
+	else
+	    echo ${UNAME_MACHINE}-unknown-linux-gnueabi
+	fi
+	exit ;;
+    avr32*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-gnu
+	exit ;;
+    cris:Linux:*:*)
+	echo cris-axis-linux-gnu
+	exit ;;
+    crisv32:Linux:*:*)
+	echo crisv32-axis-linux-gnu
+	exit ;;
+    frv:Linux:*:*)
+    	echo frv-unknown-linux-gnu
+	exit ;;
+    i*86:Linux:*:*)
+	LIBC=gnu
+	eval $set_cc_for_build
+	sed 's/^	//' << EOF >$dummy.c
+	#ifdef __dietlibc__
+	LIBC=dietlibc
+	#endif
+EOF
+	eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^LIBC'`
+	echo "${UNAME_MACHINE}-pc-linux-${LIBC}"
+	exit ;;
+    ia64:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-gnu
+	exit ;;
+    m32r*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-gnu
+	exit ;;
+    m68*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-gnu
+	exit ;;
+    mips:Linux:*:* | mips64:Linux:*:*)
+	eval $set_cc_for_build
+	sed 's/^	//' << EOF >$dummy.c
+	#undef CPU
+	#undef ${UNAME_MACHINE}
+	#undef ${UNAME_MACHINE}el
+	#if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL)
+	CPU=${UNAME_MACHINE}el
+	#else
+	#if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB)
+	CPU=${UNAME_MACHINE}
+	#else
+	CPU=
+	#endif
+	#endif
+EOF
+	eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^CPU'`
+	test x"${CPU}" != x && { echo "${CPU}-unknown-linux-gnu"; exit; }
+	;;
+    or32:Linux:*:*)
+	echo or32-unknown-linux-gnu
+	exit ;;
+    padre:Linux:*:*)
+	echo sparc-unknown-linux-gnu
+	exit ;;
+    parisc64:Linux:*:* | hppa64:Linux:*:*)
+	echo hppa64-unknown-linux-gnu
+	exit ;;
+    parisc:Linux:*:* | hppa:Linux:*:*)
+	# Look for CPU level
+	case `grep '^cpu[^a-z]*:' /proc/cpuinfo 2>/dev/null | cut -d' ' -f2` in
+	  PA7*) echo hppa1.1-unknown-linux-gnu ;;
+	  PA8*) echo hppa2.0-unknown-linux-gnu ;;
+	  *)    echo hppa-unknown-linux-gnu ;;
+	esac
+	exit ;;
+    ppc64:Linux:*:*)
+	echo powerpc64-unknown-linux-gnu
+	exit ;;
+    ppc:Linux:*:*)
+	echo powerpc-unknown-linux-gnu
+	exit ;;
+    s390:Linux:*:* | s390x:Linux:*:*)
+	echo ${UNAME_MACHINE}-ibm-linux
+	exit ;;
+    sh64*:Linux:*:*)
+    	echo ${UNAME_MACHINE}-unknown-linux-gnu
+	exit ;;
+    sh*:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-gnu
+	exit ;;
+    sparc:Linux:*:* | sparc64:Linux:*:*)
+	echo ${UNAME_MACHINE}-unknown-linux-gnu
+	exit ;;
+    vax:Linux:*:*)
+	echo ${UNAME_MACHINE}-dec-linux-gnu
+	exit ;;
+    x86_64:Linux:*:*)
+	echo x86_64-unknown-linux-gnu
+	exit ;;
+    xtensa*:Linux:*:*)
+    	echo ${UNAME_MACHINE}-unknown-linux-gnu
+	exit ;;
+    i*86:DYNIX/ptx:4*:*)
+	# ptx 4.0 does uname -s correctly, with DYNIX/ptx in there.
+	# earlier versions are messed up and put the nodename in both
+	# sysname and nodename.
+	echo i386-sequent-sysv4
+	exit ;;
+    i*86:UNIX_SV:4.2MP:2.*)
+        # Unixware is an offshoot of SVR4, but it has its own version
+        # number series starting with 2...
+        # I am not positive that other SVR4 systems won't match this,
+	# I just have to hope.  -- rms.
+        # Use sysv4.2uw... so that sysv4* matches it.
+	echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION}
+	exit ;;
+    i*86:OS/2:*:*)
+	# If we were able to find `uname', then EMX Unix compatibility
+	# is probably installed.
+	echo ${UNAME_MACHINE}-pc-os2-emx
+	exit ;;
+    i*86:XTS-300:*:STOP)
+	echo ${UNAME_MACHINE}-unknown-stop
+	exit ;;
+    i*86:atheos:*:*)
+	echo ${UNAME_MACHINE}-unknown-atheos
+	exit ;;
+    i*86:syllable:*:*)
+	echo ${UNAME_MACHINE}-pc-syllable
+	exit ;;
+    i*86:LynxOS:2.*:* | i*86:LynxOS:3.[01]*:* | i*86:LynxOS:4.[02]*:*)
+	echo i386-unknown-lynxos${UNAME_RELEASE}
+	exit ;;
+    i*86:*DOS:*:*)
+	echo ${UNAME_MACHINE}-pc-msdosdjgpp
+	exit ;;
+    i*86:*:4.*:* | i*86:SYSTEM_V:4.*:*)
+	UNAME_REL=`echo ${UNAME_RELEASE} | sed 's/\/MP$//'`
+	if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then
+		echo ${UNAME_MACHINE}-univel-sysv${UNAME_REL}
+	else
+		echo ${UNAME_MACHINE}-pc-sysv${UNAME_REL}
+	fi
+	exit ;;
+    i*86:*:5:[678]*)
+    	# UnixWare 7.x, OpenUNIX and OpenServer 6.
+	case `/bin/uname -X | grep "^Machine"` in
+	    *486*)	     UNAME_MACHINE=i486 ;;
+	    *Pentium)	     UNAME_MACHINE=i586 ;;
+	    *Pent*|*Celeron) UNAME_MACHINE=i686 ;;
+	esac
+	echo ${UNAME_MACHINE}-unknown-sysv${UNAME_RELEASE}${UNAME_SYSTEM}${UNAME_VERSION}
+	exit ;;
+    i*86:*:3.2:*)
+	if test -f /usr/options/cb.name; then
+		UNAME_REL=`sed -n 's/.*Version //p' </usr/options/cb.name`
+		echo ${UNAME_MACHINE}-pc-isc$UNAME_REL
+	elif /bin/uname -X 2>/dev/null >/dev/null ; then
+		UNAME_REL=`(/bin/uname -X|grep Release|sed -e 's/.*= //')`
+		(/bin/uname -X|grep i80486 >/dev/null) && UNAME_MACHINE=i486
+		(/bin/uname -X|grep '^Machine.*Pentium' >/dev/null) \
+			&& UNAME_MACHINE=i586
+		(/bin/uname -X|grep '^Machine.*Pent *II' >/dev/null) \
+			&& UNAME_MACHINE=i686
+		(/bin/uname -X|grep '^Machine.*Pentium Pro' >/dev/null) \
+			&& UNAME_MACHINE=i686
+		echo ${UNAME_MACHINE}-pc-sco$UNAME_REL
+	else
+		echo ${UNAME_MACHINE}-pc-sysv32
+	fi
+	exit ;;
+    pc:*:*:*)
+	# Left here for compatibility:
+        # uname -m prints for DJGPP always 'pc', but it prints nothing about
+        # the processor, so we play safe by assuming i586.
+	# Note: whatever this is, it MUST be the same as what config.sub
+	# prints for the "djgpp" host, or else GDB configury will decide that
+	# this is a cross-build.
+	echo i586-pc-msdosdjgpp
+        exit ;;
+    Intel:Mach:3*:*)
+	echo i386-pc-mach3
+	exit ;;
+    paragon:*:*:*)
+	echo i860-intel-osf1
+	exit ;;
+    i860:*:4.*:*) # i860-SVR4
+	if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then
+	  echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4
+	else # Add other i860-SVR4 vendors below as they are discovered.
+	  echo i860-unknown-sysv${UNAME_RELEASE}  # Unknown i860-SVR4
+	fi
+	exit ;;
+    mini*:CTIX:SYS*5:*)
+	# "miniframe"
+	echo m68010-convergent-sysv
+	exit ;;
+    mc68k:UNIX:SYSTEM5:3.51m)
+	echo m68k-convergent-sysv
+	exit ;;
+    M680?0:D-NIX:5.3:*)
+	echo m68k-diab-dnix
+	exit ;;
+    M68*:*:R3V[5678]*:*)
+	test -r /sysV68 && { echo 'm68k-motorola-sysv'; exit; } ;;
+    3[345]??:*:4.0:3.0 | 3[34]??A:*:4.0:3.0 | 3[34]??,*:*:4.0:3.0 | 3[34]??/*:*:4.0:3.0 | 4400:*:4.0:3.0 | 4850:*:4.0:3.0 | SKA40:*:4.0:3.0 | SDS2:*:4.0:3.0 | SHG2:*:4.0:3.0 | S7501*:*:4.0:3.0)
+	OS_REL=''
+	test -r /etc/.relid \
+	&& OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+	/bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+	  && { echo i486-ncr-sysv4.3${OS_REL}; exit; }
+	/bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+	  && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;;
+    3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*)
+        /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+          && { echo i486-ncr-sysv4; exit; } ;;
+    NCR*:*:4.2:* | MPRAS*:*:4.2:*)
+	OS_REL='.3'
+	test -r /etc/.relid \
+	    && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+	/bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+	    && { echo i486-ncr-sysv4.3${OS_REL}; exit; }
+	/bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+	    && { echo i586-ncr-sysv4.3${OS_REL}; exit; }
+	/bin/uname -p 2>/dev/null | /bin/grep pteron >/dev/null \
+	    && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;;
+    m68*:LynxOS:2.*:* | m68*:LynxOS:3.0*:*)
+	echo m68k-unknown-lynxos${UNAME_RELEASE}
+	exit ;;
+    mc68030:UNIX_System_V:4.*:*)
+	echo m68k-atari-sysv4
+	exit ;;
+    TSUNAMI:LynxOS:2.*:*)
+	echo sparc-unknown-lynxos${UNAME_RELEASE}
+	exit ;;
+    rs6000:LynxOS:2.*:*)
+	echo rs6000-unknown-lynxos${UNAME_RELEASE}
+	exit ;;
+    PowerPC:LynxOS:2.*:* | PowerPC:LynxOS:3.[01]*:* | PowerPC:LynxOS:4.[02]*:*)
+	echo powerpc-unknown-lynxos${UNAME_RELEASE}
+	exit ;;
+    SM[BE]S:UNIX_SV:*:*)
+	echo mips-dde-sysv${UNAME_RELEASE}
+	exit ;;
+    RM*:ReliantUNIX-*:*:*)
+	echo mips-sni-sysv4
+	exit ;;
+    RM*:SINIX-*:*:*)
+	echo mips-sni-sysv4
+	exit ;;
+    *:SINIX-*:*:*)
+	if uname -p 2>/dev/null >/dev/null ; then
+		UNAME_MACHINE=`(uname -p) 2>/dev/null`
+		echo ${UNAME_MACHINE}-sni-sysv4
+	else
+		echo ns32k-sni-sysv
+	fi
+	exit ;;
+    PENTIUM:*:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort
+                      # says <Richard.M.Bartel@ccMail.Census.GOV>
+        echo i586-unisys-sysv4
+        exit ;;
+    *:UNIX_System_V:4*:FTX*)
+	# From Gerald Hewes <hewes@openmarket.com>.
+	# How about differentiating between stratus architectures? -djm
+	echo hppa1.1-stratus-sysv4
+	exit ;;
+    *:*:*:FTX*)
+	# From seanf@swdc.stratus.com.
+	echo i860-stratus-sysv4
+	exit ;;
+    i*86:VOS:*:*)
+	# From Paul.Green@stratus.com.
+	echo ${UNAME_MACHINE}-stratus-vos
+	exit ;;
+    *:VOS:*:*)
+	# From Paul.Green@stratus.com.
+	echo hppa1.1-stratus-vos
+	exit ;;
+    mc68*:A/UX:*:*)
+	echo m68k-apple-aux${UNAME_RELEASE}
+	exit ;;
+    news*:NEWS-OS:6*:*)
+	echo mips-sony-newsos6
+	exit ;;
+    R[34]000:*System_V*:*:* | R4000:UNIX_SYSV:*:* | R*000:UNIX_SV:*:*)
+	if [ -d /usr/nec ]; then
+	        echo mips-nec-sysv${UNAME_RELEASE}
+	else
+	        echo mips-unknown-sysv${UNAME_RELEASE}
+	fi
+        exit ;;
+    BeBox:BeOS:*:*)	# BeOS running on hardware made by Be, PPC only.
+	echo powerpc-be-beos
+	exit ;;
+    BeMac:BeOS:*:*)	# BeOS running on Mac or Mac clone, PPC only.
+	echo powerpc-apple-beos
+	exit ;;
+    BePC:BeOS:*:*)	# BeOS running on Intel PC compatible.
+	echo i586-pc-beos
+	exit ;;
+    BePC:Haiku:*:*)	# Haiku running on Intel PC compatible.
+	echo i586-pc-haiku
+	exit ;;
+    SX-4:SUPER-UX:*:*)
+	echo sx4-nec-superux${UNAME_RELEASE}
+	exit ;;
+    SX-5:SUPER-UX:*:*)
+	echo sx5-nec-superux${UNAME_RELEASE}
+	exit ;;
+    SX-6:SUPER-UX:*:*)
+	echo sx6-nec-superux${UNAME_RELEASE}
+	exit ;;
+    SX-7:SUPER-UX:*:*)
+	echo sx7-nec-superux${UNAME_RELEASE}
+	exit ;;
+    SX-8:SUPER-UX:*:*)
+	echo sx8-nec-superux${UNAME_RELEASE}
+	exit ;;
+    SX-8R:SUPER-UX:*:*)
+	echo sx8r-nec-superux${UNAME_RELEASE}
+	exit ;;
+    Power*:Rhapsody:*:*)
+	echo powerpc-apple-rhapsody${UNAME_RELEASE}
+	exit ;;
+    *:Rhapsody:*:*)
+	echo ${UNAME_MACHINE}-apple-rhapsody${UNAME_RELEASE}
+	exit ;;
+    *:Darwin:*:*)
+	UNAME_PROCESSOR=`uname -p` || UNAME_PROCESSOR=unknown
+	case $UNAME_PROCESSOR in
+	    i386)
+		eval $set_cc_for_build
+		if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then
+		  if (echo '#ifdef __LP64__'; echo IS_64BIT_ARCH; echo '#endif') | \
+		      (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \
+		      grep IS_64BIT_ARCH >/dev/null
+		  then
+		      UNAME_PROCESSOR="x86_64"
+		  fi
+		fi ;;
+	    unknown) UNAME_PROCESSOR=powerpc ;;
+	esac
+	echo ${UNAME_PROCESSOR}-apple-darwin${UNAME_RELEASE}
+	exit ;;
+    *:procnto*:*:* | *:QNX:[0123456789]*:*)
+	UNAME_PROCESSOR=`uname -p`
+	if test "$UNAME_PROCESSOR" = "x86"; then
+		UNAME_PROCESSOR=i386
+		UNAME_MACHINE=pc
+	fi
+	echo ${UNAME_PROCESSOR}-${UNAME_MACHINE}-nto-qnx${UNAME_RELEASE}
+	exit ;;
+    *:QNX:*:4*)
+	echo i386-pc-qnx
+	exit ;;
+    NSE-?:NONSTOP_KERNEL:*:*)
+	echo nse-tandem-nsk${UNAME_RELEASE}
+	exit ;;
+    NSR-?:NONSTOP_KERNEL:*:*)
+	echo nsr-tandem-nsk${UNAME_RELEASE}
+	exit ;;
+    *:NonStop-UX:*:*)
+	echo mips-compaq-nonstopux
+	exit ;;
+    BS2000:POSIX*:*:*)
+	echo bs2000-siemens-sysv
+	exit ;;
+    DS/*:UNIX_System_V:*:*)
+	echo ${UNAME_MACHINE}-${UNAME_SYSTEM}-${UNAME_RELEASE}
+	exit ;;
+    *:Plan9:*:*)
+	# "uname -m" is not consistent, so use $cputype instead. 386
+	# is converted to i386 for consistency with other x86
+	# operating systems.
+	if test "$cputype" = "386"; then
+	    UNAME_MACHINE=i386
+	else
+	    UNAME_MACHINE="$cputype"
+	fi
+	echo ${UNAME_MACHINE}-unknown-plan9
+	exit ;;
+    *:TOPS-10:*:*)
+	echo pdp10-unknown-tops10
+	exit ;;
+    *:TENEX:*:*)
+	echo pdp10-unknown-tenex
+	exit ;;
+    KS10:TOPS-20:*:* | KL10:TOPS-20:*:* | TYPE4:TOPS-20:*:*)
+	echo pdp10-dec-tops20
+	exit ;;
+    XKL-1:TOPS-20:*:* | TYPE5:TOPS-20:*:*)
+	echo pdp10-xkl-tops20
+	exit ;;
+    *:TOPS-20:*:*)
+	echo pdp10-unknown-tops20
+	exit ;;
+    *:ITS:*:*)
+	echo pdp10-unknown-its
+	exit ;;
+    SEI:*:*:SEIUX)
+        echo mips-sei-seiux${UNAME_RELEASE}
+	exit ;;
+    *:DragonFly:*:*)
+	echo ${UNAME_MACHINE}-unknown-dragonfly`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`
+	exit ;;
+    *:*VMS:*:*)
+    	UNAME_MACHINE=`(uname -p) 2>/dev/null`
+	case "${UNAME_MACHINE}" in
+	    A*) echo alpha-dec-vms ; exit ;;
+	    I*) echo ia64-dec-vms ; exit ;;
+	    V*) echo vax-dec-vms ; exit ;;
+	esac ;;
+    *:XENIX:*:SysV)
+	echo i386-pc-xenix
+	exit ;;
+    i*86:skyos:*:*)
+	echo ${UNAME_MACHINE}-pc-skyos`echo ${UNAME_RELEASE}` | sed -e 's/ .*$//'
+	exit ;;
+    i*86:rdos:*:*)
+	echo ${UNAME_MACHINE}-pc-rdos
+	exit ;;
+    i*86:AROS:*:*)
+	echo ${UNAME_MACHINE}-pc-aros
+	exit ;;
+esac
+
+#echo '(No uname command or uname output not recognized.)' 1>&2
+#echo "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" 1>&2
+
+eval $set_cc_for_build
+cat >$dummy.c <<EOF
+#ifdef _SEQUENT_
+# include <sys/types.h>
+# include <sys/utsname.h>
+#endif
+main ()
+{
+#if defined (sony)
+#if defined (MIPSEB)
+  /* BFD wants "bsd" instead of "newsos".  Perhaps BFD should be changed,
+     I don't know....  */
+  printf ("mips-sony-bsd\n"); exit (0);
+#else
+#include <sys/param.h>
+  printf ("m68k-sony-newsos%s\n",
+#ifdef NEWSOS4
+          "4"
+#else
+	  ""
+#endif
+         ); exit (0);
+#endif
+#endif
+
+#if defined (__arm) && defined (__acorn) && defined (__unix)
+  printf ("arm-acorn-riscix\n"); exit (0);
+#endif
+
+#if defined (hp300) && !defined (hpux)
+  printf ("m68k-hp-bsd\n"); exit (0);
+#endif
+
+#if defined (NeXT)
+#if !defined (__ARCHITECTURE__)
+#define __ARCHITECTURE__ "m68k"
+#endif
+  int version;
+  version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`;
+  if (version < 4)
+    printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version);
+  else
+    printf ("%s-next-openstep%d\n", __ARCHITECTURE__, version);
+  exit (0);
+#endif
+
+#if defined (MULTIMAX) || defined (n16)
+#if defined (UMAXV)
+  printf ("ns32k-encore-sysv\n"); exit (0);
+#else
+#if defined (CMU)
+  printf ("ns32k-encore-mach\n"); exit (0);
+#else
+  printf ("ns32k-encore-bsd\n"); exit (0);
+#endif
+#endif
+#endif
+
+#if defined (__386BSD__)
+  printf ("i386-pc-bsd\n"); exit (0);
+#endif
+
+#if defined (sequent)
+#if defined (i386)
+  printf ("i386-sequent-dynix\n"); exit (0);
+#endif
+#if defined (ns32000)
+  printf ("ns32k-sequent-dynix\n"); exit (0);
+#endif
+#endif
+
+#if defined (_SEQUENT_)
+    struct utsname un;
+
+    uname(&un);
+
+    if (strncmp(un.version, "V2", 2) == 0) {
+	printf ("i386-sequent-ptx2\n"); exit (0);
+    }
+    if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */
+	printf ("i386-sequent-ptx1\n"); exit (0);
+    }
+    printf ("i386-sequent-ptx\n"); exit (0);
+
+#endif
+
+#if defined (vax)
+# if !defined (ultrix)
+#  include <sys/param.h>
+#  if defined (BSD)
+#   if BSD == 43
+      printf ("vax-dec-bsd4.3\n"); exit (0);
+#   else
+#    if BSD == 199006
+      printf ("vax-dec-bsd4.3reno\n"); exit (0);
+#    else
+      printf ("vax-dec-bsd\n"); exit (0);
+#    endif
+#   endif
+#  else
+    printf ("vax-dec-bsd\n"); exit (0);
+#  endif
+# else
+    printf ("vax-dec-ultrix\n"); exit (0);
+# endif
+#endif
+
+#if defined (alliant) && defined (i860)
+  printf ("i860-alliant-bsd\n"); exit (0);
+#endif
+
+  exit (1);
+}
+EOF
+
+$CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null && SYSTEM_NAME=`$dummy` &&
+	{ echo "$SYSTEM_NAME"; exit; }
+
+# Apollos put the system type in the environment.
+
+test -d /usr/apollo && { echo ${ISP}-apollo-${SYSTYPE}; exit; }
+
+# Convex versions that predate uname can use getsysinfo(1)
+
+if [ -x /usr/convex/getsysinfo ]
+then
+    case `getsysinfo -f cpu_type` in
+    c1*)
+	echo c1-convex-bsd
+	exit ;;
+    c2*)
+	if getsysinfo -f scalar_acc
+	then echo c32-convex-bsd
+	else echo c2-convex-bsd
+	fi
+	exit ;;
+    c34*)
+	echo c34-convex-bsd
+	exit ;;
+    c38*)
+	echo c38-convex-bsd
+	exit ;;
+    c4*)
+	echo c4-convex-bsd
+	exit ;;
+    esac
+fi
+
+cat >&2 <<EOF
+$0: unable to guess system type
+
+This script, last modified $timestamp, has failed to recognize
+the operating system you are using. It is advised that you
+download the most up to date version of the config scripts from
+
+  http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess;hb=HEAD
+and
+  http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub;hb=HEAD
+
+If the version you run ($0) is already up to date, please
+send the following data and any information you think might be
+pertinent to <config-patches@gnu.org> in order to provide the needed
+information to handle your system.
+
+config.guess timestamp = $timestamp
+
+uname -m = `(uname -m) 2>/dev/null || echo unknown`
+uname -r = `(uname -r) 2>/dev/null || echo unknown`
+uname -s = `(uname -s) 2>/dev/null || echo unknown`
+uname -v = `(uname -v) 2>/dev/null || echo unknown`
+
+/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null`
+/bin/uname -X     = `(/bin/uname -X) 2>/dev/null`
+
+hostinfo               = `(hostinfo) 2>/dev/null`
+/bin/universe          = `(/bin/universe) 2>/dev/null`
+/usr/bin/arch -k       = `(/usr/bin/arch -k) 2>/dev/null`
+/bin/arch              = `(/bin/arch) 2>/dev/null`
+/usr/bin/oslevel       = `(/usr/bin/oslevel) 2>/dev/null`
+/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null`
+
+UNAME_MACHINE = ${UNAME_MACHINE}
+UNAME_RELEASE = ${UNAME_RELEASE}
+UNAME_SYSTEM  = ${UNAME_SYSTEM}
+UNAME_VERSION = ${UNAME_VERSION}
+EOF
+
+exit 1
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:
diff --git a/popt-1.16/config.h.in b/popt-1.16/config.h.in
new file mode 100644
index 0000000..d77075d
--- /dev/null
+++ b/popt-1.16/config.h.in
@@ -0,0 +1,144 @@
+/* config.h.in.  Generated from configure.ac by autoheader.  */
+
+/* Define to 1 if translation of program messages to the user's native
+   language is requested. */
+#undef ENABLE_NLS
+
+/* Define to 1 if you have the MacOS X function CFLocaleCopyCurrent in the
+   CoreFoundation framework. */
+#undef HAVE_CFLOCALECOPYCURRENT
+
+/* Define to 1 if you have the MacOS X function CFPreferencesCopyAppValue in
+   the CoreFoundation framework. */
+#undef HAVE_CFPREFERENCESCOPYAPPVALUE
+
+/* Define if the GNU dcgettext() function is already present or preinstalled.
+   */
+#undef HAVE_DCGETTEXT
+
+/* Define to 1 if you have the <dlfcn.h> header file. */
+#undef HAVE_DLFCN_H
+
+/* Define to 1 if you have the <float.h> header file. */
+#undef HAVE_FLOAT_H
+
+/* Define to 1 if you have the <fnmatch.h> header file. */
+#undef HAVE_FNMATCH_H
+
+/* Define to 1 if you have the `geteuid' function. */
+#undef HAVE_GETEUID
+
+/* Define if the GNU gettext() function is already present or preinstalled. */
+#undef HAVE_GETTEXT
+
+/* Define to 1 if you have the `getuid' function. */
+#undef HAVE_GETUID
+
+/* Define to 1 if you have the <glob.h> header file. */
+#undef HAVE_GLOB_H
+
+/* Define if you have the iconv() function and it works. */
+#undef HAVE_ICONV
+
+/* Define to 1 if you have the <inttypes.h> header file. */
+#undef HAVE_INTTYPES_H
+
+/* Define to 1 if you have the <langinfo.h> header file. */
+#undef HAVE_LANGINFO_H
+
+/* Define to 1 if you have the <libintl.h> header file. */
+#undef HAVE_LIBINTL_H
+
+/* Define to 1 if you have the <mcheck.h> header file. */
+#undef HAVE_MCHECK_H
+
+/* Define to 1 if you have the <memory.h> header file. */
+#undef HAVE_MEMORY_H
+
+/* Define to 1 if you have the `mtrace' function. */
+#undef HAVE_MTRACE
+
+/* Define to 1 if you have the `setregid' function. */
+#undef HAVE_SETREGID
+
+/* Define to 1 if you have the `srandom' function. */
+#undef HAVE_SRANDOM
+
+/* Define to 1 if you have the <stdint.h> header file. */
+#undef HAVE_STDINT_H
+
+/* Define to 1 if you have the <stdlib.h> header file. */
+#undef HAVE_STDLIB_H
+
+/* Define to 1 if you have the `stpcpy' function. */
+#undef HAVE_STPCPY
+
+/* Define to 1 if you have the `strerror' function. */
+#undef HAVE_STRERROR
+
+/* Define to 1 if you have the <strings.h> header file. */
+#undef HAVE_STRINGS_H
+
+/* Define to 1 if you have the <string.h> header file. */
+#undef HAVE_STRING_H
+
+/* Define to 1 if you have the <sys/stat.h> header file. */
+#undef HAVE_SYS_STAT_H
+
+/* Define to 1 if you have the <sys/types.h> header file. */
+#undef HAVE_SYS_TYPES_H
+
+/* Define to 1 if you have the <unistd.h> header file. */
+#undef HAVE_UNISTD_H
+
+/* Define to 1 if you have the `vasprintf' function. */
+#undef HAVE_VASPRINTF
+
+/* Define to 1 if you have the `__secure_getenv' function. */
+#undef HAVE___SECURE_GETENV
+
+/* Define to the sub-directory in which libtool stores uninstalled libraries.
+   */
+#undef LT_OBJDIR
+
+/* Name of package */
+#undef PACKAGE
+
+/* Define to the address where bug reports for this package should be sent. */
+#undef PACKAGE_BUGREPORT
+
+/* Define to the full name of this package. */
+#undef PACKAGE_NAME
+
+/* Define to the full name and version of this package. */
+#undef PACKAGE_STRING
+
+/* Define to the one symbol short name of this package. */
+#undef PACKAGE_TARNAME
+
+/* Define to the version of this package. */
+#undef PACKAGE_VERSION
+
+/* Full path to popt top_srcdir. */
+#undef POPT_SOURCE_PATH
+
+/* Full path to default POPT configuration directory */
+#undef POPT_SYSCONFDIR
+
+/* Define to 1 if the C compiler supports function prototypes. */
+#undef PROTOTYPES
+
+/* Define to 1 if you have the ANSI C header files. */
+#undef STDC_HEADERS
+
+/* Version number of package */
+#undef VERSION
+
+/* Number of bits in a file offset, on hosts where this is settable. */
+#undef _FILE_OFFSET_BITS
+
+/* Define for large files, on AIX-style hosts. */
+#undef _LARGE_FILES
+
+/* Define like PROTOTYPES; this can be used by system headers. */
+#undef __PROTOTYPES
diff --git a/popt-1.16/config.rpath b/popt-1.16/config.rpath
new file mode 100755
index 0000000..c547c68
--- /dev/null
+++ b/popt-1.16/config.rpath
@@ -0,0 +1,666 @@
+#! /bin/sh
+# Output a system dependent set of variables, describing how to set the
+# run time search path of shared libraries in an executable.
+#
+#   Copyright 1996-2007 Free Software Foundation, Inc.
+#   Taken from GNU libtool, 2001
+#   Originally by Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+#   This file is free software; the Free Software Foundation gives
+#   unlimited permission to copy and/or distribute it, with or without
+#   modifications, as long as this notice is preserved.
+#
+# The first argument passed to this file is the canonical host specification,
+#    CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
+# or
+#    CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
+# The environment variables CC, GCC, LDFLAGS, LD, with_gnu_ld
+# should be set by the caller.
+#
+# The set of defined variables is at the end of this script.
+
+# Known limitations:
+# - On IRIX 6.5 with CC="cc", the run time search patch must not be longer
+#   than 256 bytes, otherwise the compiler driver will dump core. The only
+#   known workaround is to choose shorter directory names for the build
+#   directory and/or the installation directory.
+
+# All known linkers require a `.a' archive for static linking (except MSVC,
+# which needs '.lib').
+libext=a
+shrext=.so
+
+host="$1"
+host_cpu=`echo "$host" | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'`
+host_vendor=`echo "$host" | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'`
+host_os=`echo "$host" | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'`
+
+# Code taken from libtool.m4's _LT_CC_BASENAME.
+
+for cc_temp in $CC""; do
+  case $cc_temp in
+    compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+    distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+    \-*) ;;
+    *) break;;
+  esac
+done
+cc_basename=`echo "$cc_temp" | sed -e 's%^.*/%%'`
+
+# Code taken from libtool.m4's AC_LIBTOOL_PROG_COMPILER_PIC.
+
+wl=
+if test "$GCC" = yes; then
+  wl='-Wl,'
+else
+  case "$host_os" in
+    aix*)
+      wl='-Wl,'
+      ;;
+    darwin*)
+      case $cc_basename in
+        xlc*)
+          wl='-Wl,'
+          ;;
+      esac
+      ;;
+    mingw* | cygwin* | pw32* | os2*)
+      ;;
+    hpux9* | hpux10* | hpux11*)
+      wl='-Wl,'
+      ;;
+    irix5* | irix6* | nonstopux*)
+      wl='-Wl,'
+      ;;
+    newsos6)
+      ;;
+    linux* | k*bsd*-gnu)
+      case $cc_basename in
+        icc* | ecc*)
+          wl='-Wl,'
+          ;;
+        pgcc | pgf77 | pgf90)
+          wl='-Wl,'
+          ;;
+        ccc*)
+          wl='-Wl,'
+          ;;
+        como)
+          wl='-lopt='
+          ;;
+        *)
+          case `$CC -V 2>&1 | sed 5q` in
+            *Sun\ C*)
+              wl='-Wl,'
+              ;;
+          esac
+          ;;
+      esac
+      ;;
+    osf3* | osf4* | osf5*)
+      wl='-Wl,'
+      ;;
+    rdos*)
+      ;;
+    solaris*)
+      wl='-Wl,'
+      ;;
+    sunos4*)
+      wl='-Qoption ld '
+      ;;
+    sysv4 | sysv4.2uw2* | sysv4.3*)
+      wl='-Wl,'
+      ;;
+    sysv4*MP*)
+      ;;
+    sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+      wl='-Wl,'
+      ;;
+    unicos*)
+      wl='-Wl,'
+      ;;
+    uts4*)
+      ;;
+  esac
+fi
+
+# Code taken from libtool.m4's AC_LIBTOOL_PROG_LD_SHLIBS.
+
+hardcode_libdir_flag_spec=
+hardcode_libdir_separator=
+hardcode_direct=no
+hardcode_minus_L=no
+
+case "$host_os" in
+  cygwin* | mingw* | pw32*)
+    # FIXME: the MSVC++ port hasn't been tested in a loooong time
+    # When not using gcc, we currently assume that we are using
+    # Microsoft Visual C++.
+    if test "$GCC" != yes; then
+      with_gnu_ld=no
+    fi
+    ;;
+  interix*)
+    # we just hope/assume this is gcc and not c89 (= MSVC++)
+    with_gnu_ld=yes
+    ;;
+  openbsd*)
+    with_gnu_ld=no
+    ;;
+esac
+
+ld_shlibs=yes
+if test "$with_gnu_ld" = yes; then
+  # Set some defaults for GNU ld with shared library support. These
+  # are reset later if shared libraries are not supported. Putting them
+  # here allows them to be overridden if necessary.
+  # Unlike libtool, we use -rpath here, not --rpath, since the documented
+  # option of GNU ld is called -rpath, not --rpath.
+  hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+  case "$host_os" in
+    aix3* | aix4* | aix5*)
+      # On AIX/PPC, the GNU linker is very broken
+      if test "$host_cpu" != ia64; then
+        ld_shlibs=no
+      fi
+      ;;
+    amigaos*)
+      hardcode_libdir_flag_spec='-L$libdir'
+      hardcode_minus_L=yes
+      # Samuel A. Falvo II <kc5tja@dolphin.openprojects.net> reports
+      # that the semantics of dynamic libraries on AmigaOS, at least up
+      # to version 4, is to share data among multiple programs linked
+      # with the same dynamic library.  Since this doesn't match the
+      # behavior of shared libraries on other platforms, we cannot use
+      # them.
+      ld_shlibs=no
+      ;;
+    beos*)
+      if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+        :
+      else
+        ld_shlibs=no
+      fi
+      ;;
+    cygwin* | mingw* | pw32*)
+      # hardcode_libdir_flag_spec is actually meaningless, as there is
+      # no search path for DLLs.
+      hardcode_libdir_flag_spec='-L$libdir'
+      if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then
+        :
+      else
+        ld_shlibs=no
+      fi
+      ;;
+    interix[3-9]*)
+      hardcode_direct=no
+      hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+      ;;
+    gnu* | linux* | k*bsd*-gnu)
+      if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+        :
+      else
+        ld_shlibs=no
+      fi
+      ;;
+    netbsd*)
+      ;;
+    solaris*)
+      if $LD -v 2>&1 | grep 'BFD 2\.8' > /dev/null; then
+        ld_shlibs=no
+      elif $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+        :
+      else
+        ld_shlibs=no
+      fi
+      ;;
+    sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+      case `$LD -v 2>&1` in
+        *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*)
+          ld_shlibs=no
+          ;;
+        *)
+          if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+            hardcode_libdir_flag_spec='`test -z "$SCOABSPATH" && echo ${wl}-rpath,$libdir`'
+          else
+            ld_shlibs=no
+          fi
+          ;;
+      esac
+      ;;
+    sunos4*)
+      hardcode_direct=yes
+      ;;
+    *)
+      if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+        :
+      else
+        ld_shlibs=no
+      fi
+      ;;
+  esac
+  if test "$ld_shlibs" = no; then
+    hardcode_libdir_flag_spec=
+  fi
+else
+  case "$host_os" in
+    aix3*)
+      # Note: this linker hardcodes the directories in LIBPATH if there
+      # are no directories specified by -L.
+      hardcode_minus_L=yes
+      if test "$GCC" = yes; then
+        # Neither direct hardcoding nor static linking is supported with a
+        # broken collect2.
+        hardcode_direct=unsupported
+      fi
+      ;;
+    aix4* | aix5*)
+      if test "$host_cpu" = ia64; then
+        # On IA64, the linker does run time linking by default, so we don't
+        # have to do anything special.
+        aix_use_runtimelinking=no
+      else
+        aix_use_runtimelinking=no
+        # Test if we are trying to use run time linking or normal
+        # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+        # need to do runtime linking.
+        case $host_os in aix4.[23]|aix4.[23].*|aix5*)
+          for ld_flag in $LDFLAGS; do
+            if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then
+              aix_use_runtimelinking=yes
+              break
+            fi
+          done
+          ;;
+        esac
+      fi
+      hardcode_direct=yes
+      hardcode_libdir_separator=':'
+      if test "$GCC" = yes; then
+        case $host_os in aix4.[012]|aix4.[012].*)
+          collect2name=`${CC} -print-prog-name=collect2`
+          if test -f "$collect2name" && \
+            strings "$collect2name" | grep resolve_lib_name >/dev/null
+          then
+            # We have reworked collect2
+            :
+          else
+            # We have old collect2
+            hardcode_direct=unsupported
+            hardcode_minus_L=yes
+            hardcode_libdir_flag_spec='-L$libdir'
+            hardcode_libdir_separator=
+          fi
+          ;;
+        esac
+      fi
+      # Begin _LT_AC_SYS_LIBPATH_AIX.
+      echo 'int main () { return 0; }' > conftest.c
+      ${CC} ${LDFLAGS} conftest.c -o conftest
+      aix_libpath=`dump -H conftest 2>/dev/null | sed -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0  *\(.*\)$/\1/; p; }
+}'`
+      if test -z "$aix_libpath"; then
+        aix_libpath=`dump -HX64 conftest 2>/dev/null | sed -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0  *\(.*\)$/\1/; p; }
+}'`
+      fi
+      if test -z "$aix_libpath"; then
+        aix_libpath="/usr/lib:/lib"
+      fi
+      rm -f conftest.c conftest
+      # End _LT_AC_SYS_LIBPATH_AIX.
+      if test "$aix_use_runtimelinking" = yes; then
+        hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath"
+      else
+        if test "$host_cpu" = ia64; then
+          hardcode_libdir_flag_spec='${wl}-R $libdir:/usr/lib:/lib'
+        else
+          hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath"
+        fi
+      fi
+      ;;
+    amigaos*)
+      hardcode_libdir_flag_spec='-L$libdir'
+      hardcode_minus_L=yes
+      # see comment about different semantics on the GNU ld section
+      ld_shlibs=no
+      ;;
+    bsdi[45]*)
+      ;;
+    cygwin* | mingw* | pw32*)
+      # When not using gcc, we currently assume that we are using
+      # Microsoft Visual C++.
+      # hardcode_libdir_flag_spec is actually meaningless, as there is
+      # no search path for DLLs.
+      hardcode_libdir_flag_spec=' '
+      libext=lib
+      ;;
+    darwin* | rhapsody*)
+      hardcode_direct=no
+      if test "$GCC" = yes ; then
+        :
+      else
+        case $cc_basename in
+          xlc*)
+            ;;
+          *)
+            ld_shlibs=no
+            ;;
+        esac
+      fi
+      ;;
+    dgux*)
+      hardcode_libdir_flag_spec='-L$libdir'
+      ;;
+    freebsd1*)
+      ld_shlibs=no
+      ;;
+    freebsd2.2*)
+      hardcode_libdir_flag_spec='-R$libdir'
+      hardcode_direct=yes
+      ;;
+    freebsd2*)
+      hardcode_direct=yes
+      hardcode_minus_L=yes
+      ;;
+    freebsd* | dragonfly*)
+      hardcode_libdir_flag_spec='-R$libdir'
+      hardcode_direct=yes
+      ;;
+    hpux9*)
+      hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+      hardcode_libdir_separator=:
+      hardcode_direct=yes
+      # hardcode_minus_L: Not really in the search PATH,
+      # but as the default location of the library.
+      hardcode_minus_L=yes
+      ;;
+    hpux10*)
+      if test "$with_gnu_ld" = no; then
+        hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+        hardcode_libdir_separator=:
+        hardcode_direct=yes
+        # hardcode_minus_L: Not really in the search PATH,
+        # but as the default location of the library.
+        hardcode_minus_L=yes
+      fi
+      ;;
+    hpux11*)
+      if test "$with_gnu_ld" = no; then
+        hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+        hardcode_libdir_separator=:
+        case $host_cpu in
+          hppa*64*|ia64*)
+            hardcode_direct=no
+            ;;
+          *)
+            hardcode_direct=yes
+            # hardcode_minus_L: Not really in the search PATH,
+            # but as the default location of the library.
+            hardcode_minus_L=yes
+            ;;
+        esac
+      fi
+      ;;
+    irix5* | irix6* | nonstopux*)
+      hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+      hardcode_libdir_separator=:
+      ;;
+    netbsd*)
+      hardcode_libdir_flag_spec='-R$libdir'
+      hardcode_direct=yes
+      ;;
+    newsos6)
+      hardcode_direct=yes
+      hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+      hardcode_libdir_separator=:
+      ;;
+    openbsd*)
+      if test -f /usr/libexec/ld.so; then
+        hardcode_direct=yes
+        if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+          hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+        else
+          case "$host_os" in
+            openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*)
+              hardcode_libdir_flag_spec='-R$libdir'
+              ;;
+            *)
+              hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+              ;;
+          esac
+        fi
+      else
+        ld_shlibs=no
+      fi
+      ;;
+    os2*)
+      hardcode_libdir_flag_spec='-L$libdir'
+      hardcode_minus_L=yes
+      ;;
+    osf3*)
+      hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+      hardcode_libdir_separator=:
+      ;;
+    osf4* | osf5*)
+      if test "$GCC" = yes; then
+        hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+      else
+        # Both cc and cxx compiler support -rpath directly
+        hardcode_libdir_flag_spec='-rpath $libdir'
+      fi
+      hardcode_libdir_separator=:
+      ;;
+    solaris*)
+      hardcode_libdir_flag_spec='-R$libdir'
+      ;;
+    sunos4*)
+      hardcode_libdir_flag_spec='-L$libdir'
+      hardcode_direct=yes
+      hardcode_minus_L=yes
+      ;;
+    sysv4)
+      case $host_vendor in
+        sni)
+          hardcode_direct=yes # is this really true???
+          ;;
+        siemens)
+          hardcode_direct=no
+          ;;
+        motorola)
+          hardcode_direct=no #Motorola manual says yes, but my tests say they lie
+          ;;
+      esac
+      ;;
+    sysv4.3*)
+      ;;
+    sysv4*MP*)
+      if test -d /usr/nec; then
+        ld_shlibs=yes
+      fi
+      ;;
+    sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7* | sco3.2v5.0.[024]*)
+      ;;
+    sysv5* | sco3.2v5* | sco5v6*)
+      hardcode_libdir_flag_spec='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`'
+      hardcode_libdir_separator=':'
+      ;;
+    uts4*)
+      hardcode_libdir_flag_spec='-L$libdir'
+      ;;
+    *)
+      ld_shlibs=no
+      ;;
+  esac
+fi
+
+# Check dynamic linker characteristics
+# Code taken from libtool.m4's AC_LIBTOOL_SYS_DYNAMIC_LINKER.
+# Unlike libtool.m4, here we don't care about _all_ names of the library, but
+# only about the one the linker finds when passed -lNAME. This is the last
+# element of library_names_spec in libtool.m4, or possibly two of them if the
+# linker has special search rules.
+library_names_spec=      # the last element of library_names_spec in libtool.m4
+libname_spec='lib$name'
+case "$host_os" in
+  aix3*)
+    library_names_spec='$libname.a'
+    ;;
+  aix4* | aix5*)
+    library_names_spec='$libname$shrext'
+    ;;
+  amigaos*)
+    library_names_spec='$libname.a'
+    ;;
+  beos*)
+    library_names_spec='$libname$shrext'
+    ;;
+  bsdi[45]*)
+    library_names_spec='$libname$shrext'
+    ;;
+  cygwin* | mingw* | pw32*)
+    shrext=.dll
+    library_names_spec='$libname.dll.a $libname.lib'
+    ;;
+  darwin* | rhapsody*)
+    shrext=.dylib
+    library_names_spec='$libname$shrext'
+    ;;
+  dgux*)
+    library_names_spec='$libname$shrext'
+    ;;
+  freebsd1*)
+    ;;
+  freebsd* | dragonfly*)
+    case "$host_os" in
+      freebsd[123]*)
+        library_names_spec='$libname$shrext$versuffix' ;;
+      *)
+        library_names_spec='$libname$shrext' ;;
+    esac
+    ;;
+  gnu*)
+    library_names_spec='$libname$shrext'
+    ;;
+  hpux9* | hpux10* | hpux11*)
+    case $host_cpu in
+      ia64*)
+        shrext=.so
+        ;;
+      hppa*64*)
+        shrext=.sl
+        ;;
+      *)
+        shrext=.sl
+        ;;
+    esac
+    library_names_spec='$libname$shrext'
+    ;;
+  interix[3-9]*)
+    library_names_spec='$libname$shrext'
+    ;;
+  irix5* | irix6* | nonstopux*)
+    library_names_spec='$libname$shrext'
+    case "$host_os" in
+      irix5* | nonstopux*)
+        libsuff= shlibsuff=
+        ;;
+      *)
+        case $LD in
+          *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ") libsuff= shlibsuff= ;;
+          *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ") libsuff=32 shlibsuff=N32 ;;
+          *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ") libsuff=64 shlibsuff=64 ;;
+          *) libsuff= shlibsuff= ;;
+        esac
+        ;;
+    esac
+    ;;
+  linux*oldld* | linux*aout* | linux*coff*)
+    ;;
+  linux* | k*bsd*-gnu)
+    library_names_spec='$libname$shrext'
+    ;;
+  knetbsd*-gnu)
+    library_names_spec='$libname$shrext'
+    ;;
+  netbsd*)
+    library_names_spec='$libname$shrext'
+    ;;
+  newsos6)
+    library_names_spec='$libname$shrext'
+    ;;
+  nto-qnx*)
+    library_names_spec='$libname$shrext'
+    ;;
+  openbsd*)
+    library_names_spec='$libname$shrext$versuffix'
+    ;;
+  os2*)
+    libname_spec='$name'
+    shrext=.dll
+    library_names_spec='$libname.a'
+    ;;
+  osf3* | osf4* | osf5*)
+    library_names_spec='$libname$shrext'
+    ;;
+  rdos*)
+    ;;
+  solaris*)
+    library_names_spec='$libname$shrext'
+    ;;
+  sunos4*)
+    library_names_spec='$libname$shrext$versuffix'
+    ;;
+  sysv4 | sysv4.3*)
+    library_names_spec='$libname$shrext'
+    ;;
+  sysv4*MP*)
+    library_names_spec='$libname$shrext'
+    ;;
+  sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+    library_names_spec='$libname$shrext'
+    ;;
+  uts4*)
+    library_names_spec='$libname$shrext'
+    ;;
+esac
+
+sed_quote_subst='s/\(["`$\\]\)/\\\1/g'
+escaped_wl=`echo "X$wl" | sed -e 's/^X//' -e "$sed_quote_subst"`
+shlibext=`echo "$shrext" | sed -e 's,^\.,,'`
+escaped_libname_spec=`echo "X$libname_spec" | sed -e 's/^X//' -e "$sed_quote_subst"`
+escaped_library_names_spec=`echo "X$library_names_spec" | sed -e 's/^X//' -e "$sed_quote_subst"`
+escaped_hardcode_libdir_flag_spec=`echo "X$hardcode_libdir_flag_spec" | sed -e 's/^X//' -e "$sed_quote_subst"`
+
+LC_ALL=C sed -e 's/^\([a-zA-Z0-9_]*\)=/acl_cv_\1=/' <<EOF
+
+# How to pass a linker flag through the compiler.
+wl="$escaped_wl"
+
+# Static library suffix (normally "a").
+libext="$libext"
+
+# Shared library suffix (normally "so").
+shlibext="$shlibext"
+
+# Format of library name prefix.
+libname_spec="$escaped_libname_spec"
+
+# Library names that the linker finds when passed -lNAME.
+library_names_spec="$escaped_library_names_spec"
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist.
+hardcode_libdir_flag_spec="$escaped_hardcode_libdir_flag_spec"
+
+# Whether we need a single -rpath flag with a separated argument.
+hardcode_libdir_separator="$hardcode_libdir_separator"
+
+# Set to yes if using DIR/libNAME.so during linking hardcodes DIR into the
+# resulting binary.
+hardcode_direct="$hardcode_direct"
+
+# Set to yes if using the -LDIR flag during linking hardcodes DIR into the
+# resulting binary.
+hardcode_minus_L="$hardcode_minus_L"
+
+EOF
diff --git a/popt-1.16/config.sub b/popt-1.16/config.sub
new file mode 100755
index 0000000..2a55a50
--- /dev/null
+++ b/popt-1.16/config.sub
@@ -0,0 +1,1705 @@
+#! /bin/sh
+# Configuration validation subroutine script.
+#   Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999,
+#   2000, 2001, 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009
+#   Free Software Foundation, Inc.
+
+timestamp='2009-11-20'
+
+# This file is (in principle) common to ALL GNU software.
+# The presence of a machine in this file suggests that SOME GNU software
+# can handle that machine.  It does not imply ALL GNU software can.
+#
+# This file is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin Street - Fifth Floor, Boston, MA
+# 02110-1301, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+
+# Please send patches to <config-patches@gnu.org>.  Submit a context
+# diff and a properly formatted GNU ChangeLog entry.
+#
+# Configuration subroutine to validate and canonicalize a configuration type.
+# Supply the specified configuration type as an argument.
+# If it is invalid, we print an error message on stderr and exit with code 1.
+# Otherwise, we print the canonical config type on stdout and succeed.
+
+# You can get the latest version of this script from:
+# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub;hb=HEAD
+
+# This file is supposed to be the same for all GNU packages
+# and recognize all the CPU types, system types and aliases
+# that are meaningful with *any* GNU software.
+# Each package is responsible for reporting which valid configurations
+# it does not support.  The user should be able to distinguish
+# a failure to support a valid configuration from a meaningless
+# configuration.
+
+# The goal of this file is to map all the various variations of a given
+# machine specification into a single specification in the form:
+#	CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
+# or in some cases, the newer four-part form:
+#	CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
+# It is wrong to echo any other type of specification.
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION] CPU-MFR-OPSYS
+       $0 [OPTION] ALIAS
+
+Canonicalize a configuration name.
+
+Operation modes:
+  -h, --help         print this help, then exit
+  -t, --time-stamp   print date of last modification, then exit
+  -v, --version      print version number, then exit
+
+Report bugs and patches to <config-patches@gnu.org>."
+
+version="\
+GNU config.sub ($timestamp)
+
+Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001,
+2002, 2003, 2004, 2005, 2006, 2007, 2008 Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions.  There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+  case $1 in
+    --time-stamp | --time* | -t )
+       echo "$timestamp" ; exit ;;
+    --version | -v )
+       echo "$version" ; exit ;;
+    --help | --h* | -h )
+       echo "$usage"; exit ;;
+    -- )     # Stop option processing
+       shift; break ;;
+    - )	# Use stdin as input.
+       break ;;
+    -* )
+       echo "$me: invalid option $1$help"
+       exit 1 ;;
+
+    *local*)
+       # First pass through any local machine types.
+       echo $1
+       exit ;;
+
+    * )
+       break ;;
+  esac
+done
+
+case $# in
+ 0) echo "$me: missing argument$help" >&2
+    exit 1;;
+ 1) ;;
+ *) echo "$me: too many arguments$help" >&2
+    exit 1;;
+esac
+
+# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any).
+# Here we must recognize all the valid KERNEL-OS combinations.
+maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'`
+case $maybe_os in
+  nto-qnx* | linux-gnu* | linux-dietlibc | linux-newlib* | linux-uclibc* | \
+  uclinux-uclibc* | uclinux-gnu* | kfreebsd*-gnu* | knetbsd*-gnu* | netbsd*-gnu* | \
+  kopensolaris*-gnu* | \
+  storm-chaos* | os2-emx* | rtmk-nova*)
+    os=-$maybe_os
+    basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`
+    ;;
+  *)
+    basic_machine=`echo $1 | sed 's/-[^-]*$//'`
+    if [ $basic_machine != $1 ]
+    then os=`echo $1 | sed 's/.*-/-/'`
+    else os=; fi
+    ;;
+esac
+
+### Let's recognize common machines as not being operating systems so
+### that things like config.sub decstation-3100 work.  We also
+### recognize some manufacturers as not being operating systems, so we
+### can provide default operating systems below.
+case $os in
+	-sun*os*)
+		# Prevent following clause from handling this invalid input.
+		;;
+	-dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \
+	-att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \
+	-unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \
+	-convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\
+	-c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \
+	-harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \
+	-apple | -axis | -knuth | -cray | -microblaze)
+		os=
+		basic_machine=$1
+		;;
+        -bluegene*)
+	        os=-cnk
+		;;
+	-sim | -cisco | -oki | -wec | -winbond)
+		os=
+		basic_machine=$1
+		;;
+	-scout)
+		;;
+	-wrs)
+		os=-vxworks
+		basic_machine=$1
+		;;
+	-chorusos*)
+		os=-chorusos
+		basic_machine=$1
+		;;
+ 	-chorusrdb)
+ 		os=-chorusrdb
+		basic_machine=$1
+ 		;;
+	-hiux*)
+		os=-hiuxwe2
+		;;
+	-sco6)
+		os=-sco5v6
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco5)
+		os=-sco3.2v5
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco4)
+		os=-sco3.2v4
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco3.2.[4-9]*)
+		os=`echo $os | sed -e 's/sco3.2./sco3.2v/'`
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco3.2v[4-9]*)
+		# Don't forget version if it is 3.2v4 or newer.
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco5v6*)
+		# Don't forget version if it is 3.2v4 or newer.
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-sco*)
+		os=-sco3.2v2
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-udk*)
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-isc)
+		os=-isc2.2
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-clix*)
+		basic_machine=clipper-intergraph
+		;;
+	-isc*)
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+		;;
+	-lynx*)
+		os=-lynxos
+		;;
+	-ptx*)
+		basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'`
+		;;
+	-windowsnt*)
+		os=`echo $os | sed -e 's/windowsnt/winnt/'`
+		;;
+	-psos*)
+		os=-psos
+		;;
+	-mint | -mint[0-9]*)
+		basic_machine=m68k-atari
+		os=-mint
+		;;
+esac
+
+# Decode aliases for certain CPU-COMPANY combinations.
+case $basic_machine in
+	# Recognize the basic CPU types without company name.
+	# Some are omitted here because they have special meanings below.
+	1750a | 580 \
+	| a29k \
+	| alpha | alphaev[4-8] | alphaev56 | alphaev6[78] | alphapca5[67] \
+	| alpha64 | alpha64ev[4-8] | alpha64ev56 | alpha64ev6[78] | alpha64pca5[67] \
+	| am33_2.0 \
+	| arc | arm | arm[bl]e | arme[lb] | armv[2345] | armv[345][lb] | avr | avr32 \
+	| bfin \
+	| c4x | clipper \
+	| d10v | d30v | dlx | dsp16xx \
+	| fido | fr30 | frv \
+	| h8300 | h8500 | hppa | hppa1.[01] | hppa2.0 | hppa2.0[nw] | hppa64 \
+	| i370 | i860 | i960 | ia64 \
+	| ip2k | iq2000 \
+	| lm32 \
+	| m32c | m32r | m32rle | m68000 | m68k | m88k \
+	| maxq | mb | microblaze | mcore | mep | metag \
+	| mips | mipsbe | mipseb | mipsel | mipsle \
+	| mips16 \
+	| mips64 | mips64el \
+	| mips64octeon | mips64octeonel \
+	| mips64orion | mips64orionel \
+	| mips64r5900 | mips64r5900el \
+	| mips64vr | mips64vrel \
+	| mips64vr4100 | mips64vr4100el \
+	| mips64vr4300 | mips64vr4300el \
+	| mips64vr5000 | mips64vr5000el \
+	| mips64vr5900 | mips64vr5900el \
+	| mipsisa32 | mipsisa32el \
+	| mipsisa32r2 | mipsisa32r2el \
+	| mipsisa64 | mipsisa64el \
+	| mipsisa64r2 | mipsisa64r2el \
+	| mipsisa64sb1 | mipsisa64sb1el \
+	| mipsisa64sr71k | mipsisa64sr71kel \
+	| mipstx39 | mipstx39el \
+	| mn10200 | mn10300 \
+	| moxie \
+	| mt \
+	| msp430 \
+	| nios | nios2 \
+	| ns16k | ns32k \
+	| or32 \
+	| pdp10 | pdp11 | pj | pjl \
+	| powerpc | powerpc64 | powerpc64le | powerpcle | ppcbe \
+	| pyramid \
+	| rx \
+	| score \
+	| sh | sh[1234] | sh[24]a | sh[24]aeb | sh[23]e | sh[34]eb | sheb | shbe | shle | sh[1234]le | sh3ele \
+	| sh64 | sh64le \
+	| sparc | sparc64 | sparc64b | sparc64v | sparc86x | sparclet | sparclite \
+	| sparcv8 | sparcv9 | sparcv9b | sparcv9v \
+	| spu | strongarm \
+	| tahoe | thumb | tic4x | tic80 | tron \
+	| ubicom32 \
+	| v850 | v850e \
+	| we32k \
+	| x86 | xc16x | xscale | xscalee[bl] | xstormy16 | xtensa \
+	| z8k | z80)
+		basic_machine=$basic_machine-unknown
+		;;
+	m6811 | m68hc11 | m6812 | m68hc12 | picochip)
+		# Motorola 68HC11/12.
+		basic_machine=$basic_machine-unknown
+		os=-none
+		;;
+	m88110 | m680[12346]0 | m683?2 | m68360 | m5200 | v70 | w65 | z8k)
+		;;
+	ms1)
+		basic_machine=mt-unknown
+		;;
+
+	# We use `pc' rather than `unknown'
+	# because (1) that's what they normally are, and
+	# (2) the word "unknown" tends to confuse beginning users.
+	i*86 | x86_64)
+	  basic_machine=$basic_machine-pc
+	  ;;
+	# Object if more than one company name word.
+	*-*-*)
+		echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+		exit 1
+		;;
+	# Recognize the basic CPU types with company name.
+	580-* \
+	| a29k-* \
+	| alpha-* | alphaev[4-8]-* | alphaev56-* | alphaev6[78]-* \
+	| alpha64-* | alpha64ev[4-8]-* | alpha64ev56-* | alpha64ev6[78]-* \
+	| alphapca5[67]-* | alpha64pca5[67]-* | arc-* \
+	| arm-*  | armbe-* | armle-* | armeb-* | armv*-* \
+	| avr-* | avr32-* \
+	| bfin-* | bs2000-* \
+	| c[123]* | c30-* | [cjt]90-* | c4x-* | c54x-* | c55x-* | c6x-* \
+	| clipper-* | craynv-* | cydra-* \
+	| d10v-* | d30v-* | dlx-* \
+	| elxsi-* \
+	| f30[01]-* | f700-* | fido-* | fr30-* | frv-* | fx80-* \
+	| h8300-* | h8500-* \
+	| hppa-* | hppa1.[01]-* | hppa2.0-* | hppa2.0[nw]-* | hppa64-* \
+	| i*86-* | i860-* | i960-* | ia64-* \
+	| ip2k-* | iq2000-* \
+	| lm32-* \
+	| m32c-* | m32r-* | m32rle-* \
+	| m68000-* | m680[012346]0-* | m68360-* | m683?2-* | m68k-* \
+	| m88110-* | m88k-* | maxq-* | mcore-* | metag-* | microblaze-* \
+	| mips-* | mipsbe-* | mipseb-* | mipsel-* | mipsle-* \
+	| mips16-* \
+	| mips64-* | mips64el-* \
+	| mips64octeon-* | mips64octeonel-* \
+	| mips64orion-* | mips64orionel-* \
+	| mips64r5900-* | mips64r5900el-* \
+	| mips64vr-* | mips64vrel-* \
+	| mips64vr4100-* | mips64vr4100el-* \
+	| mips64vr4300-* | mips64vr4300el-* \
+	| mips64vr5000-* | mips64vr5000el-* \
+	| mips64vr5900-* | mips64vr5900el-* \
+	| mipsisa32-* | mipsisa32el-* \
+	| mipsisa32r2-* | mipsisa32r2el-* \
+	| mipsisa64-* | mipsisa64el-* \
+	| mipsisa64r2-* | mipsisa64r2el-* \
+	| mipsisa64sb1-* | mipsisa64sb1el-* \
+	| mipsisa64sr71k-* | mipsisa64sr71kel-* \
+	| mipstx39-* | mipstx39el-* \
+	| mmix-* \
+	| mt-* \
+	| msp430-* \
+	| nios-* | nios2-* \
+	| none-* | np1-* | ns16k-* | ns32k-* \
+	| orion-* \
+	| pdp10-* | pdp11-* | pj-* | pjl-* | pn-* | power-* \
+	| powerpc-* | powerpc64-* | powerpc64le-* | powerpcle-* | ppcbe-* \
+	| pyramid-* \
+	| romp-* | rs6000-* | rx-* \
+	| sh-* | sh[1234]-* | sh[24]a-* | sh[24]aeb-* | sh[23]e-* | sh[34]eb-* | sheb-* | shbe-* \
+	| shle-* | sh[1234]le-* | sh3ele-* | sh64-* | sh64le-* \
+	| sparc-* | sparc64-* | sparc64b-* | sparc64v-* | sparc86x-* | sparclet-* \
+	| sparclite-* \
+	| sparcv8-* | sparcv9-* | sparcv9b-* | sparcv9v-* | strongarm-* | sv1-* | sx?-* \
+	| tahoe-* | thumb-* \
+	| tic30-* | tic4x-* | tic54x-* | tic55x-* | tic6x-* | tic80-* | tile-* \
+	| tron-* \
+	| ubicom32-* \
+	| v850-* | v850e-* | vax-* \
+	| we32k-* \
+	| x86-* | x86_64-* | xc16x-* | xps100-* | xscale-* | xscalee[bl]-* \
+	| xstormy16-* | xtensa*-* \
+	| ymp-* \
+	| z8k-* | z80-*)
+		;;
+	# Recognize the basic CPU types without company name, with glob match.
+	xtensa*)
+		basic_machine=$basic_machine-unknown
+		;;
+	# Recognize the various machine names and aliases which stand
+	# for a CPU type and a company and sometimes even an OS.
+	386bsd)
+		basic_machine=i386-unknown
+		os=-bsd
+		;;
+	3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc)
+		basic_machine=m68000-att
+		;;
+	3b*)
+		basic_machine=we32k-att
+		;;
+	a29khif)
+		basic_machine=a29k-amd
+		os=-udi
+		;;
+    	abacus)
+		basic_machine=abacus-unknown
+		;;
+	adobe68k)
+		basic_machine=m68010-adobe
+		os=-scout
+		;;
+	alliant | fx80)
+		basic_machine=fx80-alliant
+		;;
+	altos | altos3068)
+		basic_machine=m68k-altos
+		;;
+	am29k)
+		basic_machine=a29k-none
+		os=-bsd
+		;;
+	amd64)
+		basic_machine=x86_64-pc
+		;;
+	amd64-*)
+		basic_machine=x86_64-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	amdahl)
+		basic_machine=580-amdahl
+		os=-sysv
+		;;
+	amiga | amiga-*)
+		basic_machine=m68k-unknown
+		;;
+	amigaos | amigados)
+		basic_machine=m68k-unknown
+		os=-amigaos
+		;;
+	amigaunix | amix)
+		basic_machine=m68k-unknown
+		os=-sysv4
+		;;
+	apollo68)
+		basic_machine=m68k-apollo
+		os=-sysv
+		;;
+	apollo68bsd)
+		basic_machine=m68k-apollo
+		os=-bsd
+		;;
+	aros)
+		basic_machine=i386-pc
+		os=-aros
+		;;
+	aux)
+		basic_machine=m68k-apple
+		os=-aux
+		;;
+	balance)
+		basic_machine=ns32k-sequent
+		os=-dynix
+		;;
+	blackfin)
+		basic_machine=bfin-unknown
+		os=-linux
+		;;
+	blackfin-*)
+		basic_machine=bfin-`echo $basic_machine | sed 's/^[^-]*-//'`
+		os=-linux
+		;;
+	bluegene*)
+		basic_machine=powerpc-ibm
+		os=-cnk
+		;;
+	c90)
+		basic_machine=c90-cray
+		os=-unicos
+		;;
+        cegcc)
+		basic_machine=arm-unknown
+		os=-cegcc
+		;;
+	convex-c1)
+		basic_machine=c1-convex
+		os=-bsd
+		;;
+	convex-c2)
+		basic_machine=c2-convex
+		os=-bsd
+		;;
+	convex-c32)
+		basic_machine=c32-convex
+		os=-bsd
+		;;
+	convex-c34)
+		basic_machine=c34-convex
+		os=-bsd
+		;;
+	convex-c38)
+		basic_machine=c38-convex
+		os=-bsd
+		;;
+	cray | j90)
+		basic_machine=j90-cray
+		os=-unicos
+		;;
+	craynv)
+		basic_machine=craynv-cray
+		os=-unicosmp
+		;;
+	cr16)
+		basic_machine=cr16-unknown
+		os=-elf
+		;;
+	crds | unos)
+		basic_machine=m68k-crds
+		;;
+	crisv32 | crisv32-* | etraxfs*)
+		basic_machine=crisv32-axis
+		;;
+	cris | cris-* | etrax*)
+		basic_machine=cris-axis
+		;;
+	crx)
+		basic_machine=crx-unknown
+		os=-elf
+		;;
+	da30 | da30-*)
+		basic_machine=m68k-da30
+		;;
+	decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn)
+		basic_machine=mips-dec
+		;;
+	decsystem10* | dec10*)
+		basic_machine=pdp10-dec
+		os=-tops10
+		;;
+	decsystem20* | dec20*)
+		basic_machine=pdp10-dec
+		os=-tops20
+		;;
+	delta | 3300 | motorola-3300 | motorola-delta \
+	      | 3300-motorola | delta-motorola)
+		basic_machine=m68k-motorola
+		;;
+	delta88)
+		basic_machine=m88k-motorola
+		os=-sysv3
+		;;
+	dicos)
+		basic_machine=i686-pc
+		os=-dicos
+		;;
+	djgpp)
+		basic_machine=i586-pc
+		os=-msdosdjgpp
+		;;
+	dpx20 | dpx20-*)
+		basic_machine=rs6000-bull
+		os=-bosx
+		;;
+	dpx2* | dpx2*-bull)
+		basic_machine=m68k-bull
+		os=-sysv3
+		;;
+	ebmon29k)
+		basic_machine=a29k-amd
+		os=-ebmon
+		;;
+	elxsi)
+		basic_machine=elxsi-elxsi
+		os=-bsd
+		;;
+	encore | umax | mmax)
+		basic_machine=ns32k-encore
+		;;
+	es1800 | OSE68k | ose68k | ose | OSE)
+		basic_machine=m68k-ericsson
+		os=-ose
+		;;
+	fx2800)
+		basic_machine=i860-alliant
+		;;
+	genix)
+		basic_machine=ns32k-ns
+		;;
+	gmicro)
+		basic_machine=tron-gmicro
+		os=-sysv
+		;;
+	go32)
+		basic_machine=i386-pc
+		os=-go32
+		;;
+	h3050r* | hiux*)
+		basic_machine=hppa1.1-hitachi
+		os=-hiuxwe2
+		;;
+	h8300hms)
+		basic_machine=h8300-hitachi
+		os=-hms
+		;;
+	h8300xray)
+		basic_machine=h8300-hitachi
+		os=-xray
+		;;
+	h8500hms)
+		basic_machine=h8500-hitachi
+		os=-hms
+		;;
+	harris)
+		basic_machine=m88k-harris
+		os=-sysv3
+		;;
+	hp300-*)
+		basic_machine=m68k-hp
+		;;
+	hp300bsd)
+		basic_machine=m68k-hp
+		os=-bsd
+		;;
+	hp300hpux)
+		basic_machine=m68k-hp
+		os=-hpux
+		;;
+	hp3k9[0-9][0-9] | hp9[0-9][0-9])
+		basic_machine=hppa1.0-hp
+		;;
+	hp9k2[0-9][0-9] | hp9k31[0-9])
+		basic_machine=m68000-hp
+		;;
+	hp9k3[2-9][0-9])
+		basic_machine=m68k-hp
+		;;
+	hp9k6[0-9][0-9] | hp6[0-9][0-9])
+		basic_machine=hppa1.0-hp
+		;;
+	hp9k7[0-79][0-9] | hp7[0-79][0-9])
+		basic_machine=hppa1.1-hp
+		;;
+	hp9k78[0-9] | hp78[0-9])
+		# FIXME: really hppa2.0-hp
+		basic_machine=hppa1.1-hp
+		;;
+	hp9k8[67]1 | hp8[67]1 | hp9k80[24] | hp80[24] | hp9k8[78]9 | hp8[78]9 | hp9k893 | hp893)
+		# FIXME: really hppa2.0-hp
+		basic_machine=hppa1.1-hp
+		;;
+	hp9k8[0-9][13679] | hp8[0-9][13679])
+		basic_machine=hppa1.1-hp
+		;;
+	hp9k8[0-9][0-9] | hp8[0-9][0-9])
+		basic_machine=hppa1.0-hp
+		;;
+	hppa-next)
+		os=-nextstep3
+		;;
+	hppaosf)
+		basic_machine=hppa1.1-hp
+		os=-osf
+		;;
+	hppro)
+		basic_machine=hppa1.1-hp
+		os=-proelf
+		;;
+	i370-ibm* | ibm*)
+		basic_machine=i370-ibm
+		;;
+# I'm not sure what "Sysv32" means.  Should this be sysv3.2?
+	i*86v32)
+		basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+		os=-sysv32
+		;;
+	i*86v4*)
+		basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+		os=-sysv4
+		;;
+	i*86v)
+		basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+		os=-sysv
+		;;
+	i*86sol2)
+		basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+		os=-solaris2
+		;;
+	i386mach)
+		basic_machine=i386-mach
+		os=-mach
+		;;
+	i386-vsta | vsta)
+		basic_machine=i386-unknown
+		os=-vsta
+		;;
+	iris | iris4d)
+		basic_machine=mips-sgi
+		case $os in
+		    -irix*)
+			;;
+		    *)
+			os=-irix4
+			;;
+		esac
+		;;
+	isi68 | isi)
+		basic_machine=m68k-isi
+		os=-sysv
+		;;
+	m68knommu)
+		basic_machine=m68k-unknown
+		os=-linux
+		;;
+	m68knommu-*)
+		basic_machine=m68k-`echo $basic_machine | sed 's/^[^-]*-//'`
+		os=-linux
+		;;
+	m88k-omron*)
+		basic_machine=m88k-omron
+		;;
+	magnum | m3230)
+		basic_machine=mips-mips
+		os=-sysv
+		;;
+	merlin)
+		basic_machine=ns32k-utek
+		os=-sysv
+		;;
+        microblaze)
+		basic_machine=microblaze-xilinx
+		;;
+	mingw32)
+		basic_machine=i386-pc
+		os=-mingw32
+		;;
+	mingw32ce)
+		basic_machine=arm-unknown
+		os=-mingw32ce
+		;;
+	miniframe)
+		basic_machine=m68000-convergent
+		;;
+	*mint | -mint[0-9]* | *MiNT | *MiNT[0-9]*)
+		basic_machine=m68k-atari
+		os=-mint
+		;;
+	mips3*-*)
+		basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`
+		;;
+	mips3*)
+		basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown
+		;;
+	monitor)
+		basic_machine=m68k-rom68k
+		os=-coff
+		;;
+	morphos)
+		basic_machine=powerpc-unknown
+		os=-morphos
+		;;
+	msdos)
+		basic_machine=i386-pc
+		os=-msdos
+		;;
+	ms1-*)
+		basic_machine=`echo $basic_machine | sed -e 's/ms1-/mt-/'`
+		;;
+	mvs)
+		basic_machine=i370-ibm
+		os=-mvs
+		;;
+	ncr3000)
+		basic_machine=i486-ncr
+		os=-sysv4
+		;;
+	netbsd386)
+		basic_machine=i386-unknown
+		os=-netbsd
+		;;
+	netwinder)
+		basic_machine=armv4l-rebel
+		os=-linux
+		;;
+	news | news700 | news800 | news900)
+		basic_machine=m68k-sony
+		os=-newsos
+		;;
+	news1000)
+		basic_machine=m68030-sony
+		os=-newsos
+		;;
+	news-3600 | risc-news)
+		basic_machine=mips-sony
+		os=-newsos
+		;;
+	necv70)
+		basic_machine=v70-nec
+		os=-sysv
+		;;
+	next | m*-next )
+		basic_machine=m68k-next
+		case $os in
+		    -nextstep* )
+			;;
+		    -ns2*)
+		      os=-nextstep2
+			;;
+		    *)
+		      os=-nextstep3
+			;;
+		esac
+		;;
+	nh3000)
+		basic_machine=m68k-harris
+		os=-cxux
+		;;
+	nh[45]000)
+		basic_machine=m88k-harris
+		os=-cxux
+		;;
+	nindy960)
+		basic_machine=i960-intel
+		os=-nindy
+		;;
+	mon960)
+		basic_machine=i960-intel
+		os=-mon960
+		;;
+	nonstopux)
+		basic_machine=mips-compaq
+		os=-nonstopux
+		;;
+	np1)
+		basic_machine=np1-gould
+		;;
+	nsr-tandem)
+		basic_machine=nsr-tandem
+		;;
+	op50n-* | op60c-*)
+		basic_machine=hppa1.1-oki
+		os=-proelf
+		;;
+	openrisc | openrisc-*)
+		basic_machine=or32-unknown
+		;;
+	os400)
+		basic_machine=powerpc-ibm
+		os=-os400
+		;;
+	OSE68000 | ose68000)
+		basic_machine=m68000-ericsson
+		os=-ose
+		;;
+	os68k)
+		basic_machine=m68k-none
+		os=-os68k
+		;;
+	pa-hitachi)
+		basic_machine=hppa1.1-hitachi
+		os=-hiuxwe2
+		;;
+	paragon)
+		basic_machine=i860-intel
+		os=-osf
+		;;
+	parisc)
+		basic_machine=hppa-unknown
+		os=-linux
+		;;
+	parisc-*)
+		basic_machine=hppa-`echo $basic_machine | sed 's/^[^-]*-//'`
+		os=-linux
+		;;
+	pbd)
+		basic_machine=sparc-tti
+		;;
+	pbb)
+		basic_machine=m68k-tti
+		;;
+	pc532 | pc532-*)
+		basic_machine=ns32k-pc532
+		;;
+	pc98)
+		basic_machine=i386-pc
+		;;
+	pc98-*)
+		basic_machine=i386-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	pentium | p5 | k5 | k6 | nexgen | viac3)
+		basic_machine=i586-pc
+		;;
+	pentiumpro | p6 | 6x86 | athlon | athlon_*)
+		basic_machine=i686-pc
+		;;
+	pentiumii | pentium2 | pentiumiii | pentium3)
+		basic_machine=i686-pc
+		;;
+	pentium4)
+		basic_machine=i786-pc
+		;;
+	pentium-* | p5-* | k5-* | k6-* | nexgen-* | viac3-*)
+		basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	pentiumpro-* | p6-* | 6x86-* | athlon-*)
+		basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	pentiumii-* | pentium2-* | pentiumiii-* | pentium3-*)
+		basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	pentium4-*)
+		basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	pn)
+		basic_machine=pn-gould
+		;;
+	power)	basic_machine=power-ibm
+		;;
+	ppc)	basic_machine=powerpc-unknown
+		;;
+	ppc-*)	basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	ppcle | powerpclittle | ppc-le | powerpc-little)
+		basic_machine=powerpcle-unknown
+		;;
+	ppcle-* | powerpclittle-*)
+		basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	ppc64)	basic_machine=powerpc64-unknown
+		;;
+	ppc64-*) basic_machine=powerpc64-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	ppc64le | powerpc64little | ppc64-le | powerpc64-little)
+		basic_machine=powerpc64le-unknown
+		;;
+	ppc64le-* | powerpc64little-*)
+		basic_machine=powerpc64le-`echo $basic_machine | sed 's/^[^-]*-//'`
+		;;
+	ps2)
+		basic_machine=i386-ibm
+		;;
+	pw32)
+		basic_machine=i586-unknown
+		os=-pw32
+		;;
+	rdos)
+		basic_machine=i386-pc
+		os=-rdos
+		;;
+	rom68k)
+		basic_machine=m68k-rom68k
+		os=-coff
+		;;
+	rm[46]00)
+		basic_machine=mips-siemens
+		;;
+	rtpc | rtpc-*)
+		basic_machine=romp-ibm
+		;;
+	s390 | s390-*)
+		basic_machine=s390-ibm
+		;;
+	s390x | s390x-*)
+		basic_machine=s390x-ibm
+		;;
+	sa29200)
+		basic_machine=a29k-amd
+		os=-udi
+		;;
+	sb1)
+		basic_machine=mipsisa64sb1-unknown
+		;;
+	sb1el)
+		basic_machine=mipsisa64sb1el-unknown
+		;;
+	sde)
+		basic_machine=mipsisa32-sde
+		os=-elf
+		;;
+	sei)
+		basic_machine=mips-sei
+		os=-seiux
+		;;
+	sequent)
+		basic_machine=i386-sequent
+		;;
+	sh)
+		basic_machine=sh-hitachi
+		os=-hms
+		;;
+	sh5el)
+		basic_machine=sh5le-unknown
+		;;
+	sh64)
+		basic_machine=sh64-unknown
+		;;
+	sparclite-wrs | simso-wrs)
+		basic_machine=sparclite-wrs
+		os=-vxworks
+		;;
+	sps7)
+		basic_machine=m68k-bull
+		os=-sysv2
+		;;
+	spur)
+		basic_machine=spur-unknown
+		;;
+	st2000)
+		basic_machine=m68k-tandem
+		;;
+	stratus)
+		basic_machine=i860-stratus
+		os=-sysv4
+		;;
+	sun2)
+		basic_machine=m68000-sun
+		;;
+	sun2os3)
+		basic_machine=m68000-sun
+		os=-sunos3
+		;;
+	sun2os4)
+		basic_machine=m68000-sun
+		os=-sunos4
+		;;
+	sun3os3)
+		basic_machine=m68k-sun
+		os=-sunos3
+		;;
+	sun3os4)
+		basic_machine=m68k-sun
+		os=-sunos4
+		;;
+	sun4os3)
+		basic_machine=sparc-sun
+		os=-sunos3
+		;;
+	sun4os4)
+		basic_machine=sparc-sun
+		os=-sunos4
+		;;
+	sun4sol2)
+		basic_machine=sparc-sun
+		os=-solaris2
+		;;
+	sun3 | sun3-*)
+		basic_machine=m68k-sun
+		;;
+	sun4)
+		basic_machine=sparc-sun
+		;;
+	sun386 | sun386i | roadrunner)
+		basic_machine=i386-sun
+		;;
+	sv1)
+		basic_machine=sv1-cray
+		os=-unicos
+		;;
+	symmetry)
+		basic_machine=i386-sequent
+		os=-dynix
+		;;
+	t3e)
+		basic_machine=alphaev5-cray
+		os=-unicos
+		;;
+	t90)
+		basic_machine=t90-cray
+		os=-unicos
+		;;
+	tic54x | c54x*)
+		basic_machine=tic54x-unknown
+		os=-coff
+		;;
+	tic55x | c55x*)
+		basic_machine=tic55x-unknown
+		os=-coff
+		;;
+	tic6x | c6x*)
+		basic_machine=tic6x-unknown
+		os=-coff
+		;;
+	tile*)
+		basic_machine=tile-unknown
+		os=-linux-gnu
+		;;
+	tx39)
+		basic_machine=mipstx39-unknown
+		;;
+	tx39el)
+		basic_machine=mipstx39el-unknown
+		;;
+	toad1)
+		basic_machine=pdp10-xkl
+		os=-tops20
+		;;
+	tower | tower-32)
+		basic_machine=m68k-ncr
+		;;
+	tpf)
+		basic_machine=s390x-ibm
+		os=-tpf
+		;;
+	udi29k)
+		basic_machine=a29k-amd
+		os=-udi
+		;;
+	ultra3)
+		basic_machine=a29k-nyu
+		os=-sym1
+		;;
+	v810 | necv810)
+		basic_machine=v810-nec
+		os=-none
+		;;
+	vaxv)
+		basic_machine=vax-dec
+		os=-sysv
+		;;
+	vms)
+		basic_machine=vax-dec
+		os=-vms
+		;;
+	vpp*|vx|vx-*)
+		basic_machine=f301-fujitsu
+		;;
+	vxworks960)
+		basic_machine=i960-wrs
+		os=-vxworks
+		;;
+	vxworks68)
+		basic_machine=m68k-wrs
+		os=-vxworks
+		;;
+	vxworks29k)
+		basic_machine=a29k-wrs
+		os=-vxworks
+		;;
+	w65*)
+		basic_machine=w65-wdc
+		os=-none
+		;;
+	w89k-*)
+		basic_machine=hppa1.1-winbond
+		os=-proelf
+		;;
+	xbox)
+		basic_machine=i686-pc
+		os=-mingw32
+		;;
+	xps | xps100)
+		basic_machine=xps100-honeywell
+		;;
+	ymp)
+		basic_machine=ymp-cray
+		os=-unicos
+		;;
+	z8k-*-coff)
+		basic_machine=z8k-unknown
+		os=-sim
+		;;
+	z80-*-coff)
+		basic_machine=z80-unknown
+		os=-sim
+		;;
+	none)
+		basic_machine=none-none
+		os=-none
+		;;
+
+# Here we handle the default manufacturer of certain CPU types.  It is in
+# some cases the only manufacturer, in others, it is the most popular.
+	w89k)
+		basic_machine=hppa1.1-winbond
+		;;
+	op50n)
+		basic_machine=hppa1.1-oki
+		;;
+	op60c)
+		basic_machine=hppa1.1-oki
+		;;
+	romp)
+		basic_machine=romp-ibm
+		;;
+	mmix)
+		basic_machine=mmix-knuth
+		;;
+	rs6000)
+		basic_machine=rs6000-ibm
+		;;
+	vax)
+		basic_machine=vax-dec
+		;;
+	pdp10)
+		# there are many clones, so DEC is not a safe bet
+		basic_machine=pdp10-unknown
+		;;
+	pdp11)
+		basic_machine=pdp11-dec
+		;;
+	we32k)
+		basic_machine=we32k-att
+		;;
+	sh[1234] | sh[24]a | sh[24]aeb | sh[34]eb | sh[1234]le | sh[23]ele)
+		basic_machine=sh-unknown
+		;;
+	sparc | sparcv8 | sparcv9 | sparcv9b | sparcv9v)
+		basic_machine=sparc-sun
+		;;
+	cydra)
+		basic_machine=cydra-cydrome
+		;;
+	orion)
+		basic_machine=orion-highlevel
+		;;
+	orion105)
+		basic_machine=clipper-highlevel
+		;;
+	mac | mpw | mac-mpw)
+		basic_machine=m68k-apple
+		;;
+	pmac | pmac-mpw)
+		basic_machine=powerpc-apple
+		;;
+	*-unknown)
+		# Make sure to match an already-canonicalized machine name.
+		;;
+	*)
+		echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+		exit 1
+		;;
+esac
+
+# Here we canonicalize certain aliases for manufacturers.
+case $basic_machine in
+	*-digital*)
+		basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'`
+		;;
+	*-commodore*)
+		basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'`
+		;;
+	*)
+		;;
+esac
+
+# Decode manufacturer-specific aliases for certain operating systems.
+
+if [ x"$os" != x"" ]
+then
+case $os in
+        # First match some system type aliases
+        # that might get confused with valid system types.
+	# -solaris* is a basic system type, with this one exception.
+        -auroraux)
+	        os=-auroraux
+		;;
+	-solaris1 | -solaris1.*)
+		os=`echo $os | sed -e 's|solaris1|sunos4|'`
+		;;
+	-solaris)
+		os=-solaris2
+		;;
+	-svr4*)
+		os=-sysv4
+		;;
+	-unixware*)
+		os=-sysv4.2uw
+		;;
+	-gnu/linux*)
+		os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'`
+		;;
+	# First accept the basic system types.
+	# The portable systems comes first.
+	# Each alternative MUST END IN A *, to match a version number.
+	# -sysv* is not here because it comes later, after sysvr4.
+	-gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \
+	      | -*vms* | -sco* | -esix* | -isc* | -aix* | -cnk* | -sunos | -sunos[34]*\
+	      | -hpux* | -unos* | -osf* | -luna* | -dgux* | -auroraux* | -solaris* \
+	      | -sym* | -kopensolaris* \
+	      | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \
+	      | -aos* | -aros* \
+	      | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \
+	      | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \
+	      | -hiux* | -386bsd* | -knetbsd* | -mirbsd* | -netbsd* \
+	      | -openbsd* | -solidbsd* \
+	      | -ekkobsd* | -kfreebsd* | -freebsd* | -riscix* | -lynxos* \
+	      | -bosx* | -nextstep* | -cxux* | -aout* | -elf* | -oabi* \
+	      | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \
+	      | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \
+	      | -chorusos* | -chorusrdb* | -cegcc* \
+	      | -cygwin* | -pe* | -psos* | -moss* | -proelf* | -rtems* \
+	      | -mingw32* | -linux-gnu* | -linux-newlib* | -linux-uclibc* \
+	      | -uxpv* | -beos* | -mpeix* | -udk* \
+	      | -interix* | -uwin* | -mks* | -rhapsody* | -darwin* | -opened* \
+	      | -openstep* | -oskit* | -conix* | -pw32* | -nonstopux* \
+	      | -storm-chaos* | -tops10* | -tenex* | -tops20* | -its* \
+	      | -os2* | -vos* | -palmos* | -uclinux* | -nucleus* \
+	      | -morphos* | -superux* | -rtmk* | -rtmk-nova* | -windiss* \
+	      | -powermax* | -dnix* | -nx6 | -nx7 | -sei* | -dragonfly* \
+	      | -skyos* | -haiku* | -rdos* | -toppers* | -drops* | -es*)
+	# Remember, each alternative MUST END IN *, to match a version number.
+		;;
+	-qnx*)
+		case $basic_machine in
+		    x86-* | i*86-*)
+			;;
+		    *)
+			os=-nto$os
+			;;
+		esac
+		;;
+	-nto-qnx*)
+		;;
+	-nto*)
+		os=`echo $os | sed -e 's|nto|nto-qnx|'`
+		;;
+	-sim | -es1800* | -hms* | -xray | -os68k* | -none* | -v88r* \
+	      | -windows* | -osx | -abug | -netware* | -os9* | -beos* | -haiku* \
+	      | -macos* | -mpw* | -magic* | -mmixware* | -mon960* | -lnews*)
+		;;
+	-mac*)
+		os=`echo $os | sed -e 's|mac|macos|'`
+		;;
+	-linux-dietlibc)
+		os=-linux-dietlibc
+		;;
+	-linux*)
+		os=`echo $os | sed -e 's|linux|linux-gnu|'`
+		;;
+	-sunos5*)
+		os=`echo $os | sed -e 's|sunos5|solaris2|'`
+		;;
+	-sunos6*)
+		os=`echo $os | sed -e 's|sunos6|solaris3|'`
+		;;
+	-opened*)
+		os=-openedition
+		;;
+        -os400*)
+		os=-os400
+		;;
+	-wince*)
+		os=-wince
+		;;
+	-osfrose*)
+		os=-osfrose
+		;;
+	-osf*)
+		os=-osf
+		;;
+	-utek*)
+		os=-bsd
+		;;
+	-dynix*)
+		os=-bsd
+		;;
+	-acis*)
+		os=-aos
+		;;
+	-atheos*)
+		os=-atheos
+		;;
+	-syllable*)
+		os=-syllable
+		;;
+	-386bsd)
+		os=-bsd
+		;;
+	-ctix* | -uts*)
+		os=-sysv
+		;;
+	-nova*)
+		os=-rtmk-nova
+		;;
+	-ns2 )
+		os=-nextstep2
+		;;
+	-nsk*)
+		os=-nsk
+		;;
+	# Preserve the version number of sinix5.
+	-sinix5.*)
+		os=`echo $os | sed -e 's|sinix|sysv|'`
+		;;
+	-sinix*)
+		os=-sysv4
+		;;
+        -tpf*)
+		os=-tpf
+		;;
+	-triton*)
+		os=-sysv3
+		;;
+	-oss*)
+		os=-sysv3
+		;;
+	-svr4)
+		os=-sysv4
+		;;
+	-svr3)
+		os=-sysv3
+		;;
+	-sysvr4)
+		os=-sysv4
+		;;
+	# This must come after -sysvr4.
+	-sysv*)
+		;;
+	-ose*)
+		os=-ose
+		;;
+	-es1800*)
+		os=-ose
+		;;
+	-xenix)
+		os=-xenix
+		;;
+	-*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
+		os=-mint
+		;;
+	-aros*)
+		os=-aros
+		;;
+	-kaos*)
+		os=-kaos
+		;;
+	-zvmoe)
+		os=-zvmoe
+		;;
+	-dicos*)
+		os=-dicos
+		;;
+	-none)
+		;;
+	*)
+		# Get rid of the `-' at the beginning of $os.
+		os=`echo $os | sed 's/[^-]*-//'`
+		echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2
+		exit 1
+		;;
+esac
+else
+
+# Here we handle the default operating systems that come with various machines.
+# The value should be what the vendor currently ships out the door with their
+# machine or put another way, the most popular os provided with the machine.
+
+# Note that if you're going to try to match "-MANUFACTURER" here (say,
+# "-sun"), then you have to tell the case statement up towards the top
+# that MANUFACTURER isn't an operating system.  Otherwise, code above
+# will signal an error saying that MANUFACTURER isn't an operating
+# system, and we'll never get to this point.
+
+case $basic_machine in
+        score-*)
+		os=-elf
+		;;
+        spu-*)
+		os=-elf
+		;;
+	*-acorn)
+		os=-riscix1.2
+		;;
+	arm*-rebel)
+		os=-linux
+		;;
+	arm*-semi)
+		os=-aout
+		;;
+        c4x-* | tic4x-*)
+        	os=-coff
+		;;
+	# This must come before the *-dec entry.
+	pdp10-*)
+		os=-tops20
+		;;
+	pdp11-*)
+		os=-none
+		;;
+	*-dec | vax-*)
+		os=-ultrix4.2
+		;;
+	m68*-apollo)
+		os=-domain
+		;;
+	i386-sun)
+		os=-sunos4.0.2
+		;;
+	m68000-sun)
+		os=-sunos3
+		# This also exists in the configure program, but was not the
+		# default.
+		# os=-sunos4
+		;;
+	m68*-cisco)
+		os=-aout
+		;;
+        mep-*)
+		os=-elf
+		;;
+	mips*-cisco)
+		os=-elf
+		;;
+	mips*-*)
+		os=-elf
+		;;
+	or32-*)
+		os=-coff
+		;;
+	*-tti)	# must be before sparc entry or we get the wrong os.
+		os=-sysv3
+		;;
+	sparc-* | *-sun)
+		os=-sunos4.1.1
+		;;
+	*-be)
+		os=-beos
+		;;
+	*-haiku)
+		os=-haiku
+		;;
+	*-ibm)
+		os=-aix
+		;;
+    	*-knuth)
+		os=-mmixware
+		;;
+	*-wec)
+		os=-proelf
+		;;
+	*-winbond)
+		os=-proelf
+		;;
+	*-oki)
+		os=-proelf
+		;;
+	*-hp)
+		os=-hpux
+		;;
+	*-hitachi)
+		os=-hiux
+		;;
+	i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent)
+		os=-sysv
+		;;
+	*-cbm)
+		os=-amigaos
+		;;
+	*-dg)
+		os=-dgux
+		;;
+	*-dolphin)
+		os=-sysv3
+		;;
+	m68k-ccur)
+		os=-rtu
+		;;
+	m88k-omron*)
+		os=-luna
+		;;
+	*-next )
+		os=-nextstep
+		;;
+	*-sequent)
+		os=-ptx
+		;;
+	*-crds)
+		os=-unos
+		;;
+	*-ns)
+		os=-genix
+		;;
+	i370-*)
+		os=-mvs
+		;;
+	*-next)
+		os=-nextstep3
+		;;
+	*-gould)
+		os=-sysv
+		;;
+	*-highlevel)
+		os=-bsd
+		;;
+	*-encore)
+		os=-bsd
+		;;
+	*-sgi)
+		os=-irix
+		;;
+	*-siemens)
+		os=-sysv4
+		;;
+	*-masscomp)
+		os=-rtu
+		;;
+	f30[01]-fujitsu | f700-fujitsu)
+		os=-uxpv
+		;;
+	*-rom68k)
+		os=-coff
+		;;
+	*-*bug)
+		os=-coff
+		;;
+	*-apple)
+		os=-macos
+		;;
+	*-atari*)
+		os=-mint
+		;;
+	*)
+		os=-none
+		;;
+esac
+fi
+
+# Here we handle the case where we know the os, and the CPU type, but not the
+# manufacturer.  We pick the logical manufacturer.
+vendor=unknown
+case $basic_machine in
+	*-unknown)
+		case $os in
+			-riscix*)
+				vendor=acorn
+				;;
+			-sunos*)
+				vendor=sun
+				;;
+			-cnk*|-aix*)
+				vendor=ibm
+				;;
+			-beos*)
+				vendor=be
+				;;
+			-hpux*)
+				vendor=hp
+				;;
+			-mpeix*)
+				vendor=hp
+				;;
+			-hiux*)
+				vendor=hitachi
+				;;
+			-unos*)
+				vendor=crds
+				;;
+			-dgux*)
+				vendor=dg
+				;;
+			-luna*)
+				vendor=omron
+				;;
+			-genix*)
+				vendor=ns
+				;;
+			-mvs* | -opened*)
+				vendor=ibm
+				;;
+			-os400*)
+				vendor=ibm
+				;;
+			-ptx*)
+				vendor=sequent
+				;;
+			-tpf*)
+				vendor=ibm
+				;;
+			-vxsim* | -vxworks* | -windiss*)
+				vendor=wrs
+				;;
+			-aux*)
+				vendor=apple
+				;;
+			-hms*)
+				vendor=hitachi
+				;;
+			-mpw* | -macos*)
+				vendor=apple
+				;;
+			-*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
+				vendor=atari
+				;;
+			-vos*)
+				vendor=stratus
+				;;
+		esac
+		basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"`
+		;;
+esac
+
+echo $basic_machine$os
+exit
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:
diff --git a/popt-1.16/configure b/popt-1.16/configure
new file mode 100755
index 0000000..ef45bd7
--- /dev/null
+++ b/popt-1.16/configure
Binary files differ
diff --git a/popt-1.16/configure.ac b/popt-1.16/configure.ac
new file mode 100644
index 0000000..22f8bfc
--- /dev/null
+++ b/popt-1.16/configure.ac
@@ -0,0 +1,135 @@
+AC_PREREQ(2.57)
+AC_INIT(popt, 1.16, popt-devel@rpm5.org)
+AC_CONFIG_SRCDIR([popt.h])
+AC_CONFIG_HEADERS([config.h])
+AC_CANONICAL_TARGET
+
+dnl Must come before AM_INIT_AUTOMAKE.
+dnl AC_CONFIG_AUX_DIR([build-aux])
+AC_CONFIG_MACRO_DIR([m4])
+AM_INIT_AUTOMAKE([foreign -Wall])
+AM_MAINTAINER_MODE
+
+# Library code modified:                              REVISION++
+# Interfaces changed/added/removed:   CURRENT++       REVISION=0
+# Interfaces added:                             AGE++
+# Interfaces removed:                           AGE=0
+AC_SUBST(LT_CURRENT, 0)
+AC_SUBST(LT_REVISION, 0)
+AC_SUBST(LT_AGE, 8)
+
+ALL_LINGUAS="cs da de eo es fi fr ga gl hu id is it ja ko lv nb nl pl pt ro ru sk sl sv th tr uk vi wa zh_TW zh_CN"
+
+AC_PROG_CC_STDC
+AC_PROG_CC
+
+AC_PROG_INSTALL
+AC_PROG_LIBTOOL
+
+dnl if CC is gcc, we can rebuild the dependencies (since the depend rule
+dnl requires gcc).  If it's not, don't rebuild dependencies -- use what was
+dnl shipped with RPM.
+if test X"$GCC" = "Xyes"; then
+    CFLAGS="$CFLAGS -Wall -W"
+    TARGET="depend allprogs"
+else
+    TARGET="everything"
+    dnl let the Makefile know that we're done with `depend', since we don't
+    dnl have gcc we're not going to rebuild our dependencies at all.
+    echo >.depend-done
+fi
+AC_SUBST(TARGET)
+
+CFLAGS="$CFLAGS -D_GNU_SOURCE -D_REENTRANT"
+
+AC_GCC_TRADITIONAL
+AC_SYS_LARGEFILE
+
+AC_ISC_POSIX
+AM_C_PROTOTYPES
+
+AC_CHECK_HEADERS(float.h fnmatch.h glob.h langinfo.h libintl.h mcheck.h unistd.h)
+
+# For some systems we know that we have ld_version scripts.
+# Use it then as default.
+have_ld_version_script=no
+case "${host}" in
+    *-*-linux*)
+        have_ld_version_script=yes
+        ;;
+    *-*-gnu*)
+        have_ld_version_script=yes
+        ;;
+esac
+AC_ARG_ENABLE([ld-version-script],
+              AC_HELP_STRING([--enable-ld-version-script],
+                             [enable/disable use of linker version script.
+                              (default is system dependent)]),
+              [have_ld_version_script=$enableval],
+              [ : ] )
+AM_CONDITIONAL(HAVE_LD_VERSION_SCRIPT, test "$have_ld_version_script" = "yes")
+
+AC_ARG_ENABLE(build-gcov,
+    AS_HELP_STRING([--enable-build-gcov], [build POPT instrumented for gcov]), [dnl
+    if test ".$enableval" = .yes; then
+        if test ".`$CC --version 2>&1 | grep 'GCC'`" != .; then
+            dnl # GNU GCC (usually "gcc")
+            CFLAGS="$CFLAGS -fprofile-arcs -ftest-coverage"
+        fi
+    fi
+])
+
+AC_CHECK_FUNC(setreuid, [], [
+    AC_CHECK_LIB(ucb, setreuid, [if echo $LIBS | grep -- -lucb >/dev/null ;then :; else LIBS="$LIBS -lc -lucb" USEUCB=y;fi])
+])
+AC_CHECK_FUNCS(getuid geteuid iconv mtrace __secure_getenv setregid stpcpy strerror vasprintf srandom)
+
+AM_GNU_GETTEXT([external])
+AM_ICONV_LINK
+
+popt_sysconfdir="${sysconfdir}"
+eval "popt_sysconfdir=\"${popt_sysconfdir}\"" # expand contained ${prefix}
+AC_DEFINE_UNQUOTED([POPT_SYSCONFDIR], ["$popt_sysconfdir"], [Full path to default POPT configuration directory])
+
+
+# Define a (hope) portable Libs pkgconfig directive that 
+# - Don't harm if the default library search path include ${libdir}
+#   (https://bugzilla.novell.com/show_bug.cgi?id=529921)
+# - Don't require a not upstream patch to pkgconfig
+#   (https://bugs.freedesktop.org/show_bug.cgi?id=16095)
+popt_pkgconfig_libs='-L${libdir} -lpopt'
+case "${host}" in
+    *-*-linux*)
+	case "${libdir}" in
+	    /usr/lib|/usr/lib64|/lib|/lib64)
+       		   popt_pkgconfig_libs='-lpopt'
+		;;
+    		*)
+		popt_pkgconfig_libs='-L${libdir} -lpopt'
+	;;
+	esac
+      ;;
+    *-*-gnu*)
+	case "${libdir}" in
+	    /usr/lib|/usr/lib64|/lib|/lib64)
+       		   popt_pkgconfig_libs='-lpopt'
+		;;
+    		*)
+		popt_pkgconfig_libs='-L${libdir} -lpopt'
+	;;
+	esac
+      ;;
+esac
+AC_SUBST([POPT_PKGCONFIG_LIBS],"$popt_pkgconfig_libs")
+
+POPT_SOURCE_PATH="`pwd`"
+AC_DEFINE_UNQUOTED(POPT_SOURCE_PATH, "$POPT_SOURCE_PATH",
+	[Full path to popt top_srcdir.])
+AC_SUBST(POPT_SOURCE_PATH)
+
+AC_CONFIG_SUBDIRS()
+AC_CONFIG_FILES([ po/Makefile.in m4/Makefile
+    Doxyfile Makefile popt.pc popt.spec test-poptrc
+    auto/Makefile auto/desc auto/types
+])
+AC_OUTPUT
diff --git a/popt-1.16/depcomp b/popt-1.16/depcomp
new file mode 100755
index 0000000..df8eea7
--- /dev/null
+++ b/popt-1.16/depcomp
@@ -0,0 +1,630 @@
+#! /bin/sh
+# depcomp - compile a program generating dependencies as side-effects
+
+scriptversion=2009-04-28.21; # UTC
+
+# Copyright (C) 1999, 2000, 2003, 2004, 2005, 2006, 2007, 2009 Free
+# Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Originally written by Alexandre Oliva <oliva@dcc.unicamp.br>.
+
+case $1 in
+  '')
+     echo "$0: No command.  Try \`$0 --help' for more information." 1>&2
+     exit 1;
+     ;;
+  -h | --h*)
+    cat <<\EOF
+Usage: depcomp [--help] [--version] PROGRAM [ARGS]
+
+Run PROGRAMS ARGS to compile a file, generating dependencies
+as side-effects.
+
+Environment variables:
+  depmode     Dependency tracking mode.
+  source      Source file read by `PROGRAMS ARGS'.
+  object      Object file output by `PROGRAMS ARGS'.
+  DEPDIR      directory where to store dependencies.
+  depfile     Dependency file to output.
+  tmpdepfile  Temporary file to use when outputing dependencies.
+  libtool     Whether libtool is used (yes/no).
+
+Report bugs to <bug-automake@gnu.org>.
+EOF
+    exit $?
+    ;;
+  -v | --v*)
+    echo "depcomp $scriptversion"
+    exit $?
+    ;;
+esac
+
+if test -z "$depmode" || test -z "$source" || test -z "$object"; then
+  echo "depcomp: Variables source, object and depmode must be set" 1>&2
+  exit 1
+fi
+
+# Dependencies for sub/bar.o or sub/bar.obj go into sub/.deps/bar.Po.
+depfile=${depfile-`echo "$object" |
+  sed 's|[^\\/]*$|'${DEPDIR-.deps}'/&|;s|\.\([^.]*\)$|.P\1|;s|Pobj$|Po|'`}
+tmpdepfile=${tmpdepfile-`echo "$depfile" | sed 's/\.\([^.]*\)$/.T\1/'`}
+
+rm -f "$tmpdepfile"
+
+# Some modes work just like other modes, but use different flags.  We
+# parameterize here, but still list the modes in the big case below,
+# to make depend.m4 easier to write.  Note that we *cannot* use a case
+# here, because this file can only contain one case statement.
+if test "$depmode" = hp; then
+  # HP compiler uses -M and no extra arg.
+  gccflag=-M
+  depmode=gcc
+fi
+
+if test "$depmode" = dashXmstdout; then
+   # This is just like dashmstdout with a different argument.
+   dashmflag=-xM
+   depmode=dashmstdout
+fi
+
+cygpath_u="cygpath -u -f -"
+if test "$depmode" = msvcmsys; then
+   # This is just like msvisualcpp but w/o cygpath translation.
+   # Just convert the backslash-escaped backslashes to single forward
+   # slashes to satisfy depend.m4
+   cygpath_u="sed s,\\\\\\\\,/,g"
+   depmode=msvisualcpp
+fi
+
+case "$depmode" in
+gcc3)
+## gcc 3 implements dependency tracking that does exactly what
+## we want.  Yay!  Note: for some reason libtool 1.4 doesn't like
+## it if -MD -MP comes after the -MF stuff.  Hmm.
+## Unfortunately, FreeBSD c89 acceptance of flags depends upon
+## the command line argument order; so add the flags where they
+## appear in depend2.am.  Note that the slowdown incurred here
+## affects only configure: in makefiles, %FASTDEP% shortcuts this.
+  for arg
+  do
+    case $arg in
+    -c) set fnord "$@" -MT "$object" -MD -MP -MF "$tmpdepfile" "$arg" ;;
+    *)  set fnord "$@" "$arg" ;;
+    esac
+    shift # fnord
+    shift # $arg
+  done
+  "$@"
+  stat=$?
+  if test $stat -eq 0; then :
+  else
+    rm -f "$tmpdepfile"
+    exit $stat
+  fi
+  mv "$tmpdepfile" "$depfile"
+  ;;
+
+gcc)
+## There are various ways to get dependency output from gcc.  Here's
+## why we pick this rather obscure method:
+## - Don't want to use -MD because we'd like the dependencies to end
+##   up in a subdir.  Having to rename by hand is ugly.
+##   (We might end up doing this anyway to support other compilers.)
+## - The DEPENDENCIES_OUTPUT environment variable makes gcc act like
+##   -MM, not -M (despite what the docs say).
+## - Using -M directly means running the compiler twice (even worse
+##   than renaming).
+  if test -z "$gccflag"; then
+    gccflag=-MD,
+  fi
+  "$@" -Wp,"$gccflag$tmpdepfile"
+  stat=$?
+  if test $stat -eq 0; then :
+  else
+    rm -f "$tmpdepfile"
+    exit $stat
+  fi
+  rm -f "$depfile"
+  echo "$object : \\" > "$depfile"
+  alpha=ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz
+## The second -e expression handles DOS-style file names with drive letters.
+  sed -e 's/^[^:]*: / /' \
+      -e 's/^['$alpha']:\/[^:]*: / /' < "$tmpdepfile" >> "$depfile"
+## This next piece of magic avoids the `deleted header file' problem.
+## The problem is that when a header file which appears in a .P file
+## is deleted, the dependency causes make to die (because there is
+## typically no way to rebuild the header).  We avoid this by adding
+## dummy dependencies for each header file.  Too bad gcc doesn't do
+## this for us directly.
+  tr ' ' '
+' < "$tmpdepfile" |
+## Some versions of gcc put a space before the `:'.  On the theory
+## that the space means something, we add a space to the output as
+## well.
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly.  Breaking it into two sed invocations is a workaround.
+    sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+hp)
+  # This case exists only to let depend.m4 do its work.  It works by
+  # looking at the text of this script.  This case will never be run,
+  # since it is checked for above.
+  exit 1
+  ;;
+
+sgi)
+  if test "$libtool" = yes; then
+    "$@" "-Wp,-MDupdate,$tmpdepfile"
+  else
+    "$@" -MDupdate "$tmpdepfile"
+  fi
+  stat=$?
+  if test $stat -eq 0; then :
+  else
+    rm -f "$tmpdepfile"
+    exit $stat
+  fi
+  rm -f "$depfile"
+
+  if test -f "$tmpdepfile"; then  # yes, the sourcefile depend on other files
+    echo "$object : \\" > "$depfile"
+
+    # Clip off the initial element (the dependent).  Don't try to be
+    # clever and replace this with sed code, as IRIX sed won't handle
+    # lines with more than a fixed number of characters (4096 in
+    # IRIX 6.2 sed, 8192 in IRIX 6.5).  We also remove comment lines;
+    # the IRIX cc adds comments like `#:fec' to the end of the
+    # dependency line.
+    tr ' ' '
+' < "$tmpdepfile" \
+    | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' | \
+    tr '
+' ' ' >> "$depfile"
+    echo >> "$depfile"
+
+    # The second pass generates a dummy entry for each header file.
+    tr ' ' '
+' < "$tmpdepfile" \
+   | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' -e 's/$/:/' \
+   >> "$depfile"
+  else
+    # The sourcefile does not contain any dependencies, so just
+    # store a dummy comment line, to avoid errors with the Makefile
+    # "include basename.Plo" scheme.
+    echo "#dummy" > "$depfile"
+  fi
+  rm -f "$tmpdepfile"
+  ;;
+
+aix)
+  # The C for AIX Compiler uses -M and outputs the dependencies
+  # in a .u file.  In older versions, this file always lives in the
+  # current directory.  Also, the AIX compiler puts `$object:' at the
+  # start of each line; $object doesn't have directory information.
+  # Version 6 uses the directory in both cases.
+  dir=`echo "$object" | sed -e 's|/[^/]*$|/|'`
+  test "x$dir" = "x$object" && dir=
+  base=`echo "$object" | sed -e 's|^.*/||' -e 's/\.o$//' -e 's/\.lo$//'`
+  if test "$libtool" = yes; then
+    tmpdepfile1=$dir$base.u
+    tmpdepfile2=$base.u
+    tmpdepfile3=$dir.libs/$base.u
+    "$@" -Wc,-M
+  else
+    tmpdepfile1=$dir$base.u
+    tmpdepfile2=$dir$base.u
+    tmpdepfile3=$dir$base.u
+    "$@" -M
+  fi
+  stat=$?
+
+  if test $stat -eq 0; then :
+  else
+    rm -f "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+    exit $stat
+  fi
+
+  for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+  do
+    test -f "$tmpdepfile" && break
+  done
+  if test -f "$tmpdepfile"; then
+    # Each line is of the form `foo.o: dependent.h'.
+    # Do two passes, one to just change these to
+    # `$object: dependent.h' and one to simply `dependent.h:'.
+    sed -e "s,^.*\.[a-z]*:,$object:," < "$tmpdepfile" > "$depfile"
+    # That's a tab and a space in the [].
+    sed -e 's,^.*\.[a-z]*:[	 ]*,,' -e 's,$,:,' < "$tmpdepfile" >> "$depfile"
+  else
+    # The sourcefile does not contain any dependencies, so just
+    # store a dummy comment line, to avoid errors with the Makefile
+    # "include basename.Plo" scheme.
+    echo "#dummy" > "$depfile"
+  fi
+  rm -f "$tmpdepfile"
+  ;;
+
+icc)
+  # Intel's C compiler understands `-MD -MF file'.  However on
+  #    icc -MD -MF foo.d -c -o sub/foo.o sub/foo.c
+  # ICC 7.0 will fill foo.d with something like
+  #    foo.o: sub/foo.c
+  #    foo.o: sub/foo.h
+  # which is wrong.  We want:
+  #    sub/foo.o: sub/foo.c
+  #    sub/foo.o: sub/foo.h
+  #    sub/foo.c:
+  #    sub/foo.h:
+  # ICC 7.1 will output
+  #    foo.o: sub/foo.c sub/foo.h
+  # and will wrap long lines using \ :
+  #    foo.o: sub/foo.c ... \
+  #     sub/foo.h ... \
+  #     ...
+
+  "$@" -MD -MF "$tmpdepfile"
+  stat=$?
+  if test $stat -eq 0; then :
+  else
+    rm -f "$tmpdepfile"
+    exit $stat
+  fi
+  rm -f "$depfile"
+  # Each line is of the form `foo.o: dependent.h',
+  # or `foo.o: dep1.h dep2.h \', or ` dep3.h dep4.h \'.
+  # Do two passes, one to just change these to
+  # `$object: dependent.h' and one to simply `dependent.h:'.
+  sed "s,^[^:]*:,$object :," < "$tmpdepfile" > "$depfile"
+  # Some versions of the HPUX 10.20 sed can't process this invocation
+  # correctly.  Breaking it into two sed invocations is a workaround.
+  sed 's,^[^:]*: \(.*\)$,\1,;s/^\\$//;/^$/d;/:$/d' < "$tmpdepfile" |
+    sed -e 's/$/ :/' >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+hp2)
+  # The "hp" stanza above does not work with aCC (C++) and HP's ia64
+  # compilers, which have integrated preprocessors.  The correct option
+  # to use with these is +Maked; it writes dependencies to a file named
+  # 'foo.d', which lands next to the object file, wherever that
+  # happens to be.
+  # Much of this is similar to the tru64 case; see comments there.
+  dir=`echo "$object" | sed -e 's|/[^/]*$|/|'`
+  test "x$dir" = "x$object" && dir=
+  base=`echo "$object" | sed -e 's|^.*/||' -e 's/\.o$//' -e 's/\.lo$//'`
+  if test "$libtool" = yes; then
+    tmpdepfile1=$dir$base.d
+    tmpdepfile2=$dir.libs/$base.d
+    "$@" -Wc,+Maked
+  else
+    tmpdepfile1=$dir$base.d
+    tmpdepfile2=$dir$base.d
+    "$@" +Maked
+  fi
+  stat=$?
+  if test $stat -eq 0; then :
+  else
+     rm -f "$tmpdepfile1" "$tmpdepfile2"
+     exit $stat
+  fi
+
+  for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2"
+  do
+    test -f "$tmpdepfile" && break
+  done
+  if test -f "$tmpdepfile"; then
+    sed -e "s,^.*\.[a-z]*:,$object:," "$tmpdepfile" > "$depfile"
+    # Add `dependent.h:' lines.
+    sed -ne '2,${
+	       s/^ *//
+	       s/ \\*$//
+	       s/$/:/
+	       p
+	     }' "$tmpdepfile" >> "$depfile"
+  else
+    echo "#dummy" > "$depfile"
+  fi
+  rm -f "$tmpdepfile" "$tmpdepfile2"
+  ;;
+
+tru64)
+   # The Tru64 compiler uses -MD to generate dependencies as a side
+   # effect.  `cc -MD -o foo.o ...' puts the dependencies into `foo.o.d'.
+   # At least on Alpha/Redhat 6.1, Compaq CCC V6.2-504 seems to put
+   # dependencies in `foo.d' instead, so we check for that too.
+   # Subdirectories are respected.
+   dir=`echo "$object" | sed -e 's|/[^/]*$|/|'`
+   test "x$dir" = "x$object" && dir=
+   base=`echo "$object" | sed -e 's|^.*/||' -e 's/\.o$//' -e 's/\.lo$//'`
+
+   if test "$libtool" = yes; then
+      # With Tru64 cc, shared objects can also be used to make a
+      # static library.  This mechanism is used in libtool 1.4 series to
+      # handle both shared and static libraries in a single compilation.
+      # With libtool 1.4, dependencies were output in $dir.libs/$base.lo.d.
+      #
+      # With libtool 1.5 this exception was removed, and libtool now
+      # generates 2 separate objects for the 2 libraries.  These two
+      # compilations output dependencies in $dir.libs/$base.o.d and
+      # in $dir$base.o.d.  We have to check for both files, because
+      # one of the two compilations can be disabled.  We should prefer
+      # $dir$base.o.d over $dir.libs/$base.o.d because the latter is
+      # automatically cleaned when .libs/ is deleted, while ignoring
+      # the former would cause a distcleancheck panic.
+      tmpdepfile1=$dir.libs/$base.lo.d   # libtool 1.4
+      tmpdepfile2=$dir$base.o.d          # libtool 1.5
+      tmpdepfile3=$dir.libs/$base.o.d    # libtool 1.5
+      tmpdepfile4=$dir.libs/$base.d      # Compaq CCC V6.2-504
+      "$@" -Wc,-MD
+   else
+      tmpdepfile1=$dir$base.o.d
+      tmpdepfile2=$dir$base.d
+      tmpdepfile3=$dir$base.d
+      tmpdepfile4=$dir$base.d
+      "$@" -MD
+   fi
+
+   stat=$?
+   if test $stat -eq 0; then :
+   else
+      rm -f "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3" "$tmpdepfile4"
+      exit $stat
+   fi
+
+   for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3" "$tmpdepfile4"
+   do
+     test -f "$tmpdepfile" && break
+   done
+   if test -f "$tmpdepfile"; then
+      sed -e "s,^.*\.[a-z]*:,$object:," < "$tmpdepfile" > "$depfile"
+      # That's a tab and a space in the [].
+      sed -e 's,^.*\.[a-z]*:[	 ]*,,' -e 's,$,:,' < "$tmpdepfile" >> "$depfile"
+   else
+      echo "#dummy" > "$depfile"
+   fi
+   rm -f "$tmpdepfile"
+   ;;
+
+#nosideeffect)
+  # This comment above is used by automake to tell side-effect
+  # dependency tracking mechanisms from slower ones.
+
+dashmstdout)
+  # Important note: in order to support this mode, a compiler *must*
+  # always write the preprocessed file to stdout, regardless of -o.
+  "$@" || exit $?
+
+  # Remove the call to Libtool.
+  if test "$libtool" = yes; then
+    while test "X$1" != 'X--mode=compile'; do
+      shift
+    done
+    shift
+  fi
+
+  # Remove `-o $object'.
+  IFS=" "
+  for arg
+  do
+    case $arg in
+    -o)
+      shift
+      ;;
+    $object)
+      shift
+      ;;
+    *)
+      set fnord "$@" "$arg"
+      shift # fnord
+      shift # $arg
+      ;;
+    esac
+  done
+
+  test -z "$dashmflag" && dashmflag=-M
+  # Require at least two characters before searching for `:'
+  # in the target name.  This is to cope with DOS-style filenames:
+  # a dependency such as `c:/foo/bar' could be seen as target `c' otherwise.
+  "$@" $dashmflag |
+    sed 's:^[  ]*[^: ][^:][^:]*\:[    ]*:'"$object"'\: :' > "$tmpdepfile"
+  rm -f "$depfile"
+  cat < "$tmpdepfile" > "$depfile"
+  tr ' ' '
+' < "$tmpdepfile" | \
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly.  Breaking it into two sed invocations is a workaround.
+    sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+dashXmstdout)
+  # This case only exists to satisfy depend.m4.  It is never actually
+  # run, as this mode is specially recognized in the preamble.
+  exit 1
+  ;;
+
+makedepend)
+  "$@" || exit $?
+  # Remove any Libtool call
+  if test "$libtool" = yes; then
+    while test "X$1" != 'X--mode=compile'; do
+      shift
+    done
+    shift
+  fi
+  # X makedepend
+  shift
+  cleared=no eat=no
+  for arg
+  do
+    case $cleared in
+    no)
+      set ""; shift
+      cleared=yes ;;
+    esac
+    if test $eat = yes; then
+      eat=no
+      continue
+    fi
+    case "$arg" in
+    -D*|-I*)
+      set fnord "$@" "$arg"; shift ;;
+    # Strip any option that makedepend may not understand.  Remove
+    # the object too, otherwise makedepend will parse it as a source file.
+    -arch)
+      eat=yes ;;
+    -*|$object)
+      ;;
+    *)
+      set fnord "$@" "$arg"; shift ;;
+    esac
+  done
+  obj_suffix=`echo "$object" | sed 's/^.*\././'`
+  touch "$tmpdepfile"
+  ${MAKEDEPEND-makedepend} -o"$obj_suffix" -f"$tmpdepfile" "$@"
+  rm -f "$depfile"
+  cat < "$tmpdepfile" > "$depfile"
+  sed '1,2d' "$tmpdepfile" | tr ' ' '
+' | \
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly.  Breaking it into two sed invocations is a workaround.
+    sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile"
+  rm -f "$tmpdepfile" "$tmpdepfile".bak
+  ;;
+
+cpp)
+  # Important note: in order to support this mode, a compiler *must*
+  # always write the preprocessed file to stdout.
+  "$@" || exit $?
+
+  # Remove the call to Libtool.
+  if test "$libtool" = yes; then
+    while test "X$1" != 'X--mode=compile'; do
+      shift
+    done
+    shift
+  fi
+
+  # Remove `-o $object'.
+  IFS=" "
+  for arg
+  do
+    case $arg in
+    -o)
+      shift
+      ;;
+    $object)
+      shift
+      ;;
+    *)
+      set fnord "$@" "$arg"
+      shift # fnord
+      shift # $arg
+      ;;
+    esac
+  done
+
+  "$@" -E |
+    sed -n -e '/^# [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' \
+       -e '/^#line [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' |
+    sed '$ s: \\$::' > "$tmpdepfile"
+  rm -f "$depfile"
+  echo "$object : \\" > "$depfile"
+  cat < "$tmpdepfile" >> "$depfile"
+  sed < "$tmpdepfile" '/^$/d;s/^ //;s/ \\$//;s/$/ :/' >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+msvisualcpp)
+  # Important note: in order to support this mode, a compiler *must*
+  # always write the preprocessed file to stdout.
+  "$@" || exit $?
+
+  # Remove the call to Libtool.
+  if test "$libtool" = yes; then
+    while test "X$1" != 'X--mode=compile'; do
+      shift
+    done
+    shift
+  fi
+
+  IFS=" "
+  for arg
+  do
+    case "$arg" in
+    -o)
+      shift
+      ;;
+    $object)
+      shift
+      ;;
+    "-Gm"|"/Gm"|"-Gi"|"/Gi"|"-ZI"|"/ZI")
+	set fnord "$@"
+	shift
+	shift
+	;;
+    *)
+	set fnord "$@" "$arg"
+	shift
+	shift
+	;;
+    esac
+  done
+  "$@" -E 2>/dev/null |
+  sed -n '/^#line [0-9][0-9]* "\([^"]*\)"/ s::\1:p' | $cygpath_u | sort -u > "$tmpdepfile"
+  rm -f "$depfile"
+  echo "$object : \\" > "$depfile"
+  sed < "$tmpdepfile" -n -e 's% %\\ %g' -e '/^\(.*\)$/ s::	\1 \\:p' >> "$depfile"
+  echo "	" >> "$depfile"
+  sed < "$tmpdepfile" -n -e 's% %\\ %g' -e '/^\(.*\)$/ s::\1\::p' >> "$depfile"
+  rm -f "$tmpdepfile"
+  ;;
+
+msvcmsys)
+  # This case exists only to let depend.m4 do its work.  It works by
+  # looking at the text of this script.  This case will never be run,
+  # since it is checked for above.
+  exit 1
+  ;;
+
+none)
+  exec "$@"
+  ;;
+
+*)
+  echo "Unknown depmode $depmode" 1>&2
+  exit 1
+  ;;
+esac
+
+exit 0
+
+# Local Variables:
+# mode: shell-script
+# sh-indentation: 2
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:
diff --git a/popt-1.16/footer_no_timestamp.html b/popt-1.16/footer_no_timestamp.html
new file mode 100644
index 0000000..d32d210
--- /dev/null
+++ b/popt-1.16/footer_no_timestamp.html
@@ -0,0 +1,5 @@
+<hr size="1"><address style="text-align: right;"><small>Generated for $projectname by&nbsp;
+<a href="http://www.doxygen.org/index.html">
+<img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> $doxygenversion </small></address>
+</body>
+</html>
diff --git a/popt-1.16/install-sh b/popt-1.16/install-sh
new file mode 100755
index 0000000..6781b98
--- /dev/null
+++ b/popt-1.16/install-sh
@@ -0,0 +1,520 @@
+#!/bin/sh
+# install - install a program, script, or datafile
+
+scriptversion=2009-04-28.21; # UTC
+
+# This originates from X11R5 (mit/util/scripts/install.sh), which was
+# later released in X11R6 (xc/config/util/install.sh) with the
+# following copyright and license.
+#
+# Copyright (C) 1994 X Consortium
+#
+# Permission is hereby granted, free of charge, to any person obtaining a copy
+# of this software and associated documentation files (the "Software"), to
+# deal in the Software without restriction, including without limitation the
+# rights to use, copy, modify, merge, publish, distribute, sublicense, and/or
+# sell copies of the Software, and to permit persons to whom the Software is
+# furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice shall be included in
+# all copies or substantial portions of the Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.  IN NO EVENT SHALL THE
+# X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN
+# AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNEC-
+# TION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+#
+# Except as contained in this notice, the name of the X Consortium shall not
+# be used in advertising or otherwise to promote the sale, use or other deal-
+# ings in this Software without prior written authorization from the X Consor-
+# tium.
+#
+#
+# FSF changes to this file are in the public domain.
+#
+# Calling this script install-sh is preferred over install.sh, to prevent
+# `make' implicit rules from creating a file called install from it
+# when there is no Makefile.
+#
+# This script is compatible with the BSD install script, but was written
+# from scratch.
+
+nl='
+'
+IFS=" ""	$nl"
+
+# set DOITPROG to echo to test this script
+
+# Don't use :- since 4.3BSD and earlier shells don't like it.
+doit=${DOITPROG-}
+if test -z "$doit"; then
+  doit_exec=exec
+else
+  doit_exec=$doit
+fi
+
+# Put in absolute file names if you don't have them in your path;
+# or use environment vars.
+
+chgrpprog=${CHGRPPROG-chgrp}
+chmodprog=${CHMODPROG-chmod}
+chownprog=${CHOWNPROG-chown}
+cmpprog=${CMPPROG-cmp}
+cpprog=${CPPROG-cp}
+mkdirprog=${MKDIRPROG-mkdir}
+mvprog=${MVPROG-mv}
+rmprog=${RMPROG-rm}
+stripprog=${STRIPPROG-strip}
+
+posix_glob='?'
+initialize_posix_glob='
+  test "$posix_glob" != "?" || {
+    if (set -f) 2>/dev/null; then
+      posix_glob=
+    else
+      posix_glob=:
+    fi
+  }
+'
+
+posix_mkdir=
+
+# Desired mode of installed file.
+mode=0755
+
+chgrpcmd=
+chmodcmd=$chmodprog
+chowncmd=
+mvcmd=$mvprog
+rmcmd="$rmprog -f"
+stripcmd=
+
+src=
+dst=
+dir_arg=
+dst_arg=
+
+copy_on_change=false
+no_target_directory=
+
+usage="\
+Usage: $0 [OPTION]... [-T] SRCFILE DSTFILE
+   or: $0 [OPTION]... SRCFILES... DIRECTORY
+   or: $0 [OPTION]... -t DIRECTORY SRCFILES...
+   or: $0 [OPTION]... -d DIRECTORIES...
+
+In the 1st form, copy SRCFILE to DSTFILE.
+In the 2nd and 3rd, copy all SRCFILES to DIRECTORY.
+In the 4th, create DIRECTORIES.
+
+Options:
+     --help     display this help and exit.
+     --version  display version info and exit.
+
+  -c            (ignored)
+  -C            install only if different (preserve the last data modification time)
+  -d            create directories instead of installing files.
+  -g GROUP      $chgrpprog installed files to GROUP.
+  -m MODE       $chmodprog installed files to MODE.
+  -o USER       $chownprog installed files to USER.
+  -s            $stripprog installed files.
+  -t DIRECTORY  install into DIRECTORY.
+  -T            report an error if DSTFILE is a directory.
+
+Environment variables override the default commands:
+  CHGRPPROG CHMODPROG CHOWNPROG CMPPROG CPPROG MKDIRPROG MVPROG
+  RMPROG STRIPPROG
+"
+
+while test $# -ne 0; do
+  case $1 in
+    -c) ;;
+
+    -C) copy_on_change=true;;
+
+    -d) dir_arg=true;;
+
+    -g) chgrpcmd="$chgrpprog $2"
+	shift;;
+
+    --help) echo "$usage"; exit $?;;
+
+    -m) mode=$2
+	case $mode in
+	  *' '* | *'	'* | *'
+'*	  | *'*'* | *'?'* | *'['*)
+	    echo "$0: invalid mode: $mode" >&2
+	    exit 1;;
+	esac
+	shift;;
+
+    -o) chowncmd="$chownprog $2"
+	shift;;
+
+    -s) stripcmd=$stripprog;;
+
+    -t) dst_arg=$2
+	shift;;
+
+    -T) no_target_directory=true;;
+
+    --version) echo "$0 $scriptversion"; exit $?;;
+
+    --)	shift
+	break;;
+
+    -*)	echo "$0: invalid option: $1" >&2
+	exit 1;;
+
+    *)  break;;
+  esac
+  shift
+done
+
+if test $# -ne 0 && test -z "$dir_arg$dst_arg"; then
+  # When -d is used, all remaining arguments are directories to create.
+  # When -t is used, the destination is already specified.
+  # Otherwise, the last argument is the destination.  Remove it from $@.
+  for arg
+  do
+    if test -n "$dst_arg"; then
+      # $@ is not empty: it contains at least $arg.
+      set fnord "$@" "$dst_arg"
+      shift # fnord
+    fi
+    shift # arg
+    dst_arg=$arg
+  done
+fi
+
+if test $# -eq 0; then
+  if test -z "$dir_arg"; then
+    echo "$0: no input file specified." >&2
+    exit 1
+  fi
+  # It's OK to call `install-sh -d' without argument.
+  # This can happen when creating conditional directories.
+  exit 0
+fi
+
+if test -z "$dir_arg"; then
+  trap '(exit $?); exit' 1 2 13 15
+
+  # Set umask so as not to create temps with too-generous modes.
+  # However, 'strip' requires both read and write access to temps.
+  case $mode in
+    # Optimize common cases.
+    *644) cp_umask=133;;
+    *755) cp_umask=22;;
+
+    *[0-7])
+      if test -z "$stripcmd"; then
+	u_plus_rw=
+      else
+	u_plus_rw='% 200'
+      fi
+      cp_umask=`expr '(' 777 - $mode % 1000 ')' $u_plus_rw`;;
+    *)
+      if test -z "$stripcmd"; then
+	u_plus_rw=
+      else
+	u_plus_rw=,u+rw
+      fi
+      cp_umask=$mode$u_plus_rw;;
+  esac
+fi
+
+for src
+do
+  # Protect names starting with `-'.
+  case $src in
+    -*) src=./$src;;
+  esac
+
+  if test -n "$dir_arg"; then
+    dst=$src
+    dstdir=$dst
+    test -d "$dstdir"
+    dstdir_status=$?
+  else
+
+    # Waiting for this to be detected by the "$cpprog $src $dsttmp" command
+    # might cause directories to be created, which would be especially bad
+    # if $src (and thus $dsttmp) contains '*'.
+    if test ! -f "$src" && test ! -d "$src"; then
+      echo "$0: $src does not exist." >&2
+      exit 1
+    fi
+
+    if test -z "$dst_arg"; then
+      echo "$0: no destination specified." >&2
+      exit 1
+    fi
+
+    dst=$dst_arg
+    # Protect names starting with `-'.
+    case $dst in
+      -*) dst=./$dst;;
+    esac
+
+    # If destination is a directory, append the input filename; won't work
+    # if double slashes aren't ignored.
+    if test -d "$dst"; then
+      if test -n "$no_target_directory"; then
+	echo "$0: $dst_arg: Is a directory" >&2
+	exit 1
+      fi
+      dstdir=$dst
+      dst=$dstdir/`basename "$src"`
+      dstdir_status=0
+    else
+      # Prefer dirname, but fall back on a substitute if dirname fails.
+      dstdir=`
+	(dirname "$dst") 2>/dev/null ||
+	expr X"$dst" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+	     X"$dst" : 'X\(//\)[^/]' \| \
+	     X"$dst" : 'X\(//\)$' \| \
+	     X"$dst" : 'X\(/\)' \| . 2>/dev/null ||
+	echo X"$dst" |
+	    sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+		   s//\1/
+		   q
+		 }
+		 /^X\(\/\/\)[^/].*/{
+		   s//\1/
+		   q
+		 }
+		 /^X\(\/\/\)$/{
+		   s//\1/
+		   q
+		 }
+		 /^X\(\/\).*/{
+		   s//\1/
+		   q
+		 }
+		 s/.*/./; q'
+      `
+
+      test -d "$dstdir"
+      dstdir_status=$?
+    fi
+  fi
+
+  obsolete_mkdir_used=false
+
+  if test $dstdir_status != 0; then
+    case $posix_mkdir in
+      '')
+	# Create intermediate dirs using mode 755 as modified by the umask.
+	# This is like FreeBSD 'install' as of 1997-10-28.
+	umask=`umask`
+	case $stripcmd.$umask in
+	  # Optimize common cases.
+	  *[2367][2367]) mkdir_umask=$umask;;
+	  .*0[02][02] | .[02][02] | .[02]) mkdir_umask=22;;
+
+	  *[0-7])
+	    mkdir_umask=`expr $umask + 22 \
+	      - $umask % 100 % 40 + $umask % 20 \
+	      - $umask % 10 % 4 + $umask % 2
+	    `;;
+	  *) mkdir_umask=$umask,go-w;;
+	esac
+
+	# With -d, create the new directory with the user-specified mode.
+	# Otherwise, rely on $mkdir_umask.
+	if test -n "$dir_arg"; then
+	  mkdir_mode=-m$mode
+	else
+	  mkdir_mode=
+	fi
+
+	posix_mkdir=false
+	case $umask in
+	  *[123567][0-7][0-7])
+	    # POSIX mkdir -p sets u+wx bits regardless of umask, which
+	    # is incompatible with FreeBSD 'install' when (umask & 300) != 0.
+	    ;;
+	  *)
+	    tmpdir=${TMPDIR-/tmp}/ins$RANDOM-$$
+	    trap 'ret=$?; rmdir "$tmpdir/d" "$tmpdir" 2>/dev/null; exit $ret' 0
+
+	    if (umask $mkdir_umask &&
+		exec $mkdirprog $mkdir_mode -p -- "$tmpdir/d") >/dev/null 2>&1
+	    then
+	      if test -z "$dir_arg" || {
+		   # Check for POSIX incompatibilities with -m.
+		   # HP-UX 11.23 and IRIX 6.5 mkdir -m -p sets group- or
+		   # other-writeable bit of parent directory when it shouldn't.
+		   # FreeBSD 6.1 mkdir -m -p sets mode of existing directory.
+		   ls_ld_tmpdir=`ls -ld "$tmpdir"`
+		   case $ls_ld_tmpdir in
+		     d????-?r-*) different_mode=700;;
+		     d????-?--*) different_mode=755;;
+		     *) false;;
+		   esac &&
+		   $mkdirprog -m$different_mode -p -- "$tmpdir" && {
+		     ls_ld_tmpdir_1=`ls -ld "$tmpdir"`
+		     test "$ls_ld_tmpdir" = "$ls_ld_tmpdir_1"
+		   }
+		 }
+	      then posix_mkdir=:
+	      fi
+	      rmdir "$tmpdir/d" "$tmpdir"
+	    else
+	      # Remove any dirs left behind by ancient mkdir implementations.
+	      rmdir ./$mkdir_mode ./-p ./-- 2>/dev/null
+	    fi
+	    trap '' 0;;
+	esac;;
+    esac
+
+    if
+      $posix_mkdir && (
+	umask $mkdir_umask &&
+	$doit_exec $mkdirprog $mkdir_mode -p -- "$dstdir"
+      )
+    then :
+    else
+
+      # The umask is ridiculous, or mkdir does not conform to POSIX,
+      # or it failed possibly due to a race condition.  Create the
+      # directory the slow way, step by step, checking for races as we go.
+
+      case $dstdir in
+	/*) prefix='/';;
+	-*) prefix='./';;
+	*)  prefix='';;
+      esac
+
+      eval "$initialize_posix_glob"
+
+      oIFS=$IFS
+      IFS=/
+      $posix_glob set -f
+      set fnord $dstdir
+      shift
+      $posix_glob set +f
+      IFS=$oIFS
+
+      prefixes=
+
+      for d
+      do
+	test -z "$d" && continue
+
+	prefix=$prefix$d
+	if test -d "$prefix"; then
+	  prefixes=
+	else
+	  if $posix_mkdir; then
+	    (umask=$mkdir_umask &&
+	     $doit_exec $mkdirprog $mkdir_mode -p -- "$dstdir") && break
+	    # Don't fail if two instances are running concurrently.
+	    test -d "$prefix" || exit 1
+	  else
+	    case $prefix in
+	      *\'*) qprefix=`echo "$prefix" | sed "s/'/'\\\\\\\\''/g"`;;
+	      *) qprefix=$prefix;;
+	    esac
+	    prefixes="$prefixes '$qprefix'"
+	  fi
+	fi
+	prefix=$prefix/
+      done
+
+      if test -n "$prefixes"; then
+	# Don't fail if two instances are running concurrently.
+	(umask $mkdir_umask &&
+	 eval "\$doit_exec \$mkdirprog $prefixes") ||
+	  test -d "$dstdir" || exit 1
+	obsolete_mkdir_used=true
+      fi
+    fi
+  fi
+
+  if test -n "$dir_arg"; then
+    { test -z "$chowncmd" || $doit $chowncmd "$dst"; } &&
+    { test -z "$chgrpcmd" || $doit $chgrpcmd "$dst"; } &&
+    { test "$obsolete_mkdir_used$chowncmd$chgrpcmd" = false ||
+      test -z "$chmodcmd" || $doit $chmodcmd $mode "$dst"; } || exit 1
+  else
+
+    # Make a couple of temp file names in the proper directory.
+    dsttmp=$dstdir/_inst.$$_
+    rmtmp=$dstdir/_rm.$$_
+
+    # Trap to clean up those temp files at exit.
+    trap 'ret=$?; rm -f "$dsttmp" "$rmtmp" && exit $ret' 0
+
+    # Copy the file name to the temp name.
+    (umask $cp_umask && $doit_exec $cpprog "$src" "$dsttmp") &&
+
+    # and set any options; do chmod last to preserve setuid bits.
+    #
+    # If any of these fail, we abort the whole thing.  If we want to
+    # ignore errors from any of these, just make sure not to ignore
+    # errors from the above "$doit $cpprog $src $dsttmp" command.
+    #
+    { test -z "$chowncmd" || $doit $chowncmd "$dsttmp"; } &&
+    { test -z "$chgrpcmd" || $doit $chgrpcmd "$dsttmp"; } &&
+    { test -z "$stripcmd" || $doit $stripcmd "$dsttmp"; } &&
+    { test -z "$chmodcmd" || $doit $chmodcmd $mode "$dsttmp"; } &&
+
+    # If -C, don't bother to copy if it wouldn't change the file.
+    if $copy_on_change &&
+       old=`LC_ALL=C ls -dlL "$dst"	2>/dev/null` &&
+       new=`LC_ALL=C ls -dlL "$dsttmp"	2>/dev/null` &&
+
+       eval "$initialize_posix_glob" &&
+       $posix_glob set -f &&
+       set X $old && old=:$2:$4:$5:$6 &&
+       set X $new && new=:$2:$4:$5:$6 &&
+       $posix_glob set +f &&
+
+       test "$old" = "$new" &&
+       $cmpprog "$dst" "$dsttmp" >/dev/null 2>&1
+    then
+      rm -f "$dsttmp"
+    else
+      # Rename the file to the real destination.
+      $doit $mvcmd -f "$dsttmp" "$dst" 2>/dev/null ||
+
+      # The rename failed, perhaps because mv can't rename something else
+      # to itself, or perhaps because mv is so ancient that it does not
+      # support -f.
+      {
+	# Now remove or move aside any old file at destination location.
+	# We try this two ways since rm can't unlink itself on some
+	# systems and the destination file might be busy for other
+	# reasons.  In this case, the final cleanup might fail but the new
+	# file should still install successfully.
+	{
+	  test ! -f "$dst" ||
+	  $doit $rmcmd -f "$dst" 2>/dev/null ||
+	  { $doit $mvcmd -f "$dst" "$rmtmp" 2>/dev/null &&
+	    { $doit $rmcmd -f "$rmtmp" 2>/dev/null; :; }
+	  } ||
+	  { echo "$0: cannot unlink or rename $dst" >&2
+	    (exit 1); exit 1
+	  }
+	} &&
+
+	# Now rename the file to the real destination.
+	$doit $mvcmd "$dsttmp" "$dst"
+      }
+    fi || exit 1
+
+    trap '' 0
+  fi
+done
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:
diff --git a/popt-1.16/libpopt.vers b/popt-1.16/libpopt.vers
new file mode 100644
index 0000000..3ac5e52
--- /dev/null
+++ b/popt-1.16/libpopt.vers
@@ -0,0 +1,58 @@
+LIBPOPT_0
+{
+  global:
+    _fini;
+    _init;
+    _poptArgMask;
+    _poptGroupMask;
+    poptAddAlias;
+    poptAddItem;
+    poptAliasOptions;
+    poptBadOption;
+    _poptBitsN;
+    _poptBitsM;
+    _poptBitsK;
+    poptBitsAdd;
+    poptBitsArgs;
+    poptBitsChk;
+    poptBitsClr;
+    poptBitsDel;
+    poptBitsIntersect;
+    poptBitsUnion;
+    poptConfigFileToString;
+    poptDupArgv;
+    poptFini;
+    poptFreeContext;
+    poptGetArg;
+    poptGetArgs;
+    poptGetContext;
+    poptGetInvocationName;
+    poptGetNextOpt;
+    poptGetOptArg;
+    poptHelpOptions;
+    poptHelpOptionsI18N;
+    poptInit;
+    poptParseArgvString;
+    poptPeekArg;
+    poptPrintHelp;
+    poptPrintUsage;
+    poptReadFile;
+    poptReadConfigFile;
+    poptReadConfigFiles;
+    poptReadDefaultConfig;
+    poptResetContext;
+    poptSaneFile;
+    poptSaveBits;
+    poptSaveInt;
+    poptSaveLong;
+    poptSaveLongLong;
+    poptSaveShort;
+    poptSaveString;
+    poptSetExecPath;
+    poptSetOtherOptionHelp;
+    poptStrerror;
+    poptStrippedArgv;
+    poptStuffArgs;
+  local:
+    *;
+};
diff --git a/popt-1.16/lookup3.c b/popt-1.16/lookup3.c
new file mode 100644
index 0000000..0584c39
--- /dev/null
+++ b/popt-1.16/lookup3.c
@@ -0,0 +1,969 @@
+/* -------------------------------------------------------------------- */
+/*
+ * lookup3.c, by Bob Jenkins, May 2006, Public Domain.
+ * 
+ * These are functions for producing 32-bit hashes for hash table lookup.
+ * jlu32w(), jlu32l(), jlu32lpair(), jlu32b(), _JLU3_MIX(), and _JLU3_FINAL() 
+ * are externally useful functions.  Routines to test the hash are included 
+ * if SELF_TEST is defined.  You can use this free for any purpose.  It's in
+ * the public domain.  It has no warranty.
+ * 
+ * You probably want to use jlu32l().  jlu32l() and jlu32b()
+ * hash byte arrays.  jlu32l() is is faster than jlu32b() on
+ * little-endian machines.  Intel and AMD are little-endian machines.
+ * On second thought, you probably want jlu32lpair(), which is identical to
+ * jlu32l() except it returns two 32-bit hashes for the price of one.  
+ * You could implement jlu32bpair() if you wanted but I haven't bothered here.
+ * 
+ * If you want to find a hash of, say, exactly 7 integers, do
+ *   a = i1;  b = i2;  c = i3;
+ *   _JLU3_MIX(a,b,c);
+ *   a += i4; b += i5; c += i6;
+ *   _JLU3_MIX(a,b,c);
+ *   a += i7;
+ *   _JLU3_FINAL(a,b,c);
+ * then use c as the hash value.  If you have a variable size array of
+ * 4-byte integers to hash, use jlu32w().  If you have a byte array (like
+ * a character string), use jlu32l().  If you have several byte arrays, or
+ * a mix of things, see the comments above jlu32l().  
+ * 
+ * Why is this so big?  I read 12 bytes at a time into 3 4-byte integers, 
+ * then mix those integers.  This is fast (you can do a lot more thorough
+ * mixing with 12*3 instructions on 3 integers than you can with 3 instructions
+ * on 1 byte), but shoehorning those bytes into integers efficiently is messy.
+*/
+/* -------------------------------------------------------------------- */
+
+#include <stdint.h>
+
+#if defined(_JLU3_SELFTEST)
+# define _JLU3_jlu32w		1
+# define _JLU3_jlu32l		1
+# define _JLU3_jlu32lpair	1
+# define _JLU3_jlu32b		1
+#endif
+
+/*@-redef@*/
+/*@unchecked@*/
+static const union _dbswap {
+    const uint32_t ui;
+    const unsigned char uc[4];
+} endian = { .ui = 0x11223344 };
+# define HASH_LITTLE_ENDIAN	(endian.uc[0] == (unsigned char) 0x44)
+# define HASH_BIG_ENDIAN	(endian.uc[0] == (unsigned char) 0x11)
+/*@=redef@*/
+
+#ifndef ROTL32
+# define ROTL32(x, s) (((x) << (s)) | ((x) >> (32 - (s))))
+#endif
+
+/* NOTE: The _size parameter should be in bytes. */
+#define	_JLU3_INIT(_h, _size)	(0xdeadbeef + ((uint32_t)(_size)) + (_h))
+
+/* -------------------------------------------------------------------- */
+/*
+ * _JLU3_MIX -- mix 3 32-bit values reversibly.
+ * 
+ * This is reversible, so any information in (a,b,c) before _JLU3_MIX() is
+ * still in (a,b,c) after _JLU3_MIX().
+ * 
+ * If four pairs of (a,b,c) inputs are run through _JLU3_MIX(), or through
+ * _JLU3_MIX() in reverse, there are at least 32 bits of the output that
+ * are sometimes the same for one pair and different for another pair.
+ * This was tested for:
+ * * pairs that differed by one bit, by two bits, in any combination
+ *   of top bits of (a,b,c), or in any combination of bottom bits of
+ *   (a,b,c).
+ * * "differ" is defined as +, -, ^, or ~^.  For + and -, I transformed
+ *   the output delta to a Gray code (a^(a>>1)) so a string of 1's (as
+ *   is commonly produced by subtraction) look like a single 1-bit
+ *   difference.
+ * * the base values were pseudorandom, all zero but one bit set, or 
+ *   all zero plus a counter that starts at zero.
+ * 
+ * Some k values for my "a-=c; a^=ROTL32(c,k); c+=b;" arrangement that
+ * satisfy this are
+ *     4  6  8 16 19  4
+ *     9 15  3 18 27 15
+ *    14  9  3  7 17  3
+ * Well, "9 15 3 18 27 15" didn't quite get 32 bits diffing
+ * for "differ" defined as + with a one-bit base and a two-bit delta.  I
+ * used http://burtleburtle.net/bob/hash/avalanche.html to choose 
+ * the operations, constants, and arrangements of the variables.
+ * 
+ * This does not achieve avalanche.  There are input bits of (a,b,c)
+ * that fail to affect some output bits of (a,b,c), especially of a.  The
+ * most thoroughly mixed value is c, but it doesn't really even achieve
+ * avalanche in c.
+ * 
+ * This allows some parallelism.  Read-after-writes are good at doubling
+ * the number of bits affected, so the goal of mixing pulls in the opposite
+ * direction as the goal of parallelism.  I did what I could.  Rotates
+ * seem to cost as much as shifts on every machine I could lay my hands
+ * on, and rotates are much kinder to the top and bottom bits, so I used
+ * rotates.
+ */
+/* -------------------------------------------------------------------- */
+#define _JLU3_MIX(a,b,c) \
+{ \
+  a -= c;  a ^= ROTL32(c, 4);  c += b; \
+  b -= a;  b ^= ROTL32(a, 6);  a += c; \
+  c -= b;  c ^= ROTL32(b, 8);  b += a; \
+  a -= c;  a ^= ROTL32(c,16);  c += b; \
+  b -= a;  b ^= ROTL32(a,19);  a += c; \
+  c -= b;  c ^= ROTL32(b, 4);  b += a; \
+}
+
+/* -------------------------------------------------------------------- */
+/**
+ * _JLU3_FINAL -- final mixing of 3 32-bit values (a,b,c) into c
+ * 
+ * Pairs of (a,b,c) values differing in only a few bits will usually
+ * produce values of c that look totally different.  This was tested for
+ * * pairs that differed by one bit, by two bits, in any combination
+ *   of top bits of (a,b,c), or in any combination of bottom bits of
+ *   (a,b,c).
+ * * "differ" is defined as +, -, ^, or ~^.  For + and -, I transformed
+ *   the output delta to a Gray code (a^(a>>1)) so a string of 1's (as
+ *   is commonly produced by subtraction) look like a single 1-bit
+ *   difference.
+ * * the base values were pseudorandom, all zero but one bit set, or 
+ *   all zero plus a counter that starts at zero.
+ * 
+ * These constants passed:
+ *  14 11 25 16 4 14 24
+ *  12 14 25 16 4 14 24
+ * and these came close:
+ *   4  8 15 26 3 22 24
+ *  10  8 15 26 3 22 24
+ *  11  8 15 26 3 22 24
+ */
+/* -------------------------------------------------------------------- */
+#define _JLU3_FINAL(a,b,c) \
+{ \
+  c ^= b; c -= ROTL32(b,14); \
+  a ^= c; a -= ROTL32(c,11); \
+  b ^= a; b -= ROTL32(a,25); \
+  c ^= b; c -= ROTL32(b,16); \
+  a ^= c; a -= ROTL32(c,4);  \
+  b ^= a; b -= ROTL32(a,14); \
+  c ^= b; c -= ROTL32(b,24); \
+}
+
+#if defined(_JLU3_jlu32w)
+uint32_t jlu32w(uint32_t h, /*@null@*/ const uint32_t *k, size_t size)
+	/*@*/;
+/* -------------------------------------------------------------------- */
+/**
+ *  This works on all machines.  To be useful, it requires
+ *  -- that the key be an array of uint32_t's, and
+ *  -- that the size be the number of uint32_t's in the key
+ * 
+ *  The function jlu32w() is identical to jlu32l() on little-endian
+ *  machines, and identical to jlu32b() on big-endian machines,
+ *  except that the size has to be measured in uint32_ts rather than in
+ *  bytes.  jlu32l() is more complicated than jlu32w() only because
+ *  jlu32l() has to dance around fitting the key bytes into registers.
+ *
+ * @param h		the previous hash, or an arbitrary value
+ * @param *k		the key, an array of uint32_t values
+ * @param size		the size of the key, in uint32_ts
+ * @return		the lookup3 hash
+ */
+/* -------------------------------------------------------------------- */
+uint32_t jlu32w(uint32_t h, const uint32_t *k, size_t size)
+{
+    uint32_t a = _JLU3_INIT(h, (size * sizeof(*k)));
+    uint32_t b = a;
+    uint32_t c = a;
+
+    if (k == NULL)
+	goto exit;
+
+    /*----------------------------------------------- handle most of the key */
+    while (size > 3) {
+	a += k[0];
+	b += k[1];
+	c += k[2];
+	_JLU3_MIX(a,b,c);
+	size -= 3;
+	k += 3;
+    }
+
+    /*----------------------------------------- handle the last 3 uint32_t's */
+    switch (size) {
+    case 3 : c+=k[2];
+    case 2 : b+=k[1];
+    case 1 : a+=k[0];
+	_JLU3_FINAL(a,b,c);
+	/*@fallthrough@*/
+    case 0:
+	break;
+    }
+    /*---------------------------------------------------- report the result */
+exit:
+    return c;
+}
+#endif	/* defined(_JLU3_jlu32w) */
+
+#if defined(_JLU3_jlu32l)
+uint32_t jlu32l(uint32_t h, const void *key, size_t size)
+	/*@*/;
+/* -------------------------------------------------------------------- */
+/*
+ * jlu32l() -- hash a variable-length key into a 32-bit value
+ *   h       : can be any 4-byte value
+ *   k       : the key (the unaligned variable-length array of bytes)
+ *   size    : the size of the key, counting by bytes
+ * Returns a 32-bit value.  Every bit of the key affects every bit of
+ * the return value.  Two keys differing by one or two bits will have
+ * totally different hash values.
+ * 
+ * The best hash table sizes are powers of 2.  There is no need to do
+ * mod a prime (mod is sooo slow!).  If you need less than 32 bits,
+ * use a bitmask.  For example, if you need only 10 bits, do
+ *   h = (h & hashmask(10));
+ * In which case, the hash table should have hashsize(10) elements.
+ * 
+ * If you are hashing n strings (uint8_t **)k, do it like this:
+ *   for (i=0, h=0; i<n; ++i) h = jlu32l(h, k[i], len[i]);
+ * 
+ * By Bob Jenkins, 2006.  bob_jenkins@burtleburtle.net.  You may use this
+ * code any way you wish, private, educational, or commercial.  It's free.
+ * 
+ * Use for hash table lookup, or anything where one collision in 2^^32 is
+ * acceptable.  Do NOT use for cryptographic purposes.
+ *
+ * @param h		the previous hash, or an arbitrary value
+ * @param *k		the key, an array of uint8_t values
+ * @param size		the size of the key
+ * @return		the lookup3 hash
+ */
+/* -------------------------------------------------------------------- */
+uint32_t jlu32l(uint32_t h, const void *key, size_t size)
+{
+    union { const void *ptr; size_t i; } u;
+    uint32_t a = _JLU3_INIT(h, size);
+    uint32_t b = a;
+    uint32_t c = a;
+
+    if (key == NULL)
+	goto exit;
+
+    u.ptr = key;
+    if (HASH_LITTLE_ENDIAN && ((u.i & 0x3) == 0)) {
+	const uint32_t *k = (const uint32_t *)key;	/* read 32-bit chunks */
+#ifdef	VALGRIND
+	const uint8_t  *k8;
+#endif
+
+    /*------ all but last block: aligned reads and affect 32 bits of (a,b,c) */
+	while (size > 12) {
+	    a += k[0];
+	    b += k[1];
+	    c += k[2];
+	    _JLU3_MIX(a,b,c);
+	    size -= 12;
+	    k += 3;
+	}
+
+	/*------------------------- handle the last (probably partial) block */
+	/* 
+	 * "k[2]&0xffffff" actually reads beyond the end of the string, but
+	 * then masks off the part it's not allowed to read.  Because the
+	 * string is aligned, the masked-off tail is in the same word as the
+	 * rest of the string.  Every machine with memory protection I've seen
+	 * does it on word boundaries, so is OK with this.  But VALGRIND will
+	 * still catch it and complain.  The masking trick does make the hash
+	 * noticably faster for short strings (like English words).
+	 */
+#ifndef VALGRIND
+
+	switch (size) {
+	case 12:	c += k[2]; b+=k[1]; a+=k[0]; break;
+	case 11:	c += k[2]&0xffffff; b+=k[1]; a+=k[0]; break;
+	case 10:	c += k[2]&0xffff; b+=k[1]; a+=k[0]; break;
+	case  9:	c += k[2]&0xff; b+=k[1]; a+=k[0]; break;
+	case  8:	b += k[1]; a+=k[0]; break;
+	case  7:	b += k[1]&0xffffff; a+=k[0]; break;
+	case  6:	b += k[1]&0xffff; a+=k[0]; break;
+	case  5:	b += k[1]&0xff; a+=k[0]; break;
+	case  4:	a += k[0]; break;
+	case  3:	a += k[0]&0xffffff; break;
+	case  2:	a += k[0]&0xffff; break;
+	case  1:	a += k[0]&0xff; break;
+	case  0:	goto exit;
+	}
+
+#else /* make valgrind happy */
+
+	k8 = (const uint8_t *)k;
+	switch (size) {
+	case 12:	c += k[2]; b+=k[1]; a+=k[0]	break;
+	case 11:	c += ((uint32_t)k8[10])<<16;	/*@fallthrough@*/
+	case 10:	c += ((uint32_t)k8[9])<<8;	/*@fallthrough@*/
+	case  9:	c += k8[8];			/*@fallthrough@*/
+	case  8:	b += k[1]; a+=k[0];		break;
+	case  7:	b += ((uint32_t)k8[6])<<16;	/*@fallthrough@*/
+	case  6:	b += ((uint32_t)k8[5])<<8;	/*@fallthrough@*/
+	case  5:	b += k8[4];			/*@fallthrough@*/
+	case  4:	a += k[0];			break;
+	case  3:	a += ((uint32_t)k8[2])<<16;	/*@fallthrough@*/
+	case  2:	a += ((uint32_t)k8[1])<<8;	/*@fallthrough@*/
+	case  1:	a += k8[0];			break;
+	case  0:	goto exit;
+	}
+
+#endif /* !valgrind */
+
+    } else if (HASH_LITTLE_ENDIAN && ((u.i & 0x1) == 0)) {
+	const uint16_t *k = (const uint16_t *)key;	/* read 16-bit chunks */
+	const uint8_t  *k8;
+
+	/*----------- all but last block: aligned reads and different mixing */
+	while (size > 12) {
+	    a += k[0] + (((uint32_t)k[1])<<16);
+	    b += k[2] + (((uint32_t)k[3])<<16);
+	    c += k[4] + (((uint32_t)k[5])<<16);
+	    _JLU3_MIX(a,b,c);
+	    size -= 12;
+	    k += 6;
+	}
+
+	/*------------------------- handle the last (probably partial) block */
+	k8 = (const uint8_t *)k;
+	switch (size) {
+	case 12:
+	    c += k[4]+(((uint32_t)k[5])<<16);
+	    b += k[2]+(((uint32_t)k[3])<<16);
+	    a += k[0]+(((uint32_t)k[1])<<16);
+	    break;
+	case 11:
+	    c += ((uint32_t)k8[10])<<16;
+	    /*@fallthrough@*/
+	case 10:
+	    c += (uint32_t)k[4];
+	    b += k[2]+(((uint32_t)k[3])<<16);
+	    a += k[0]+(((uint32_t)k[1])<<16);
+	    break;
+	case  9:
+	    c += (uint32_t)k8[8];
+	    /*@fallthrough@*/
+	case  8:
+	    b += k[2]+(((uint32_t)k[3])<<16);
+	    a += k[0]+(((uint32_t)k[1])<<16);
+	    break;
+	case  7:
+	    b += ((uint32_t)k8[6])<<16;
+	    /*@fallthrough@*/
+	case  6:
+	    b += (uint32_t)k[2];
+	    a += k[0]+(((uint32_t)k[1])<<16);
+	    break;
+	case  5:
+	    b += (uint32_t)k8[4];
+	    /*@fallthrough@*/
+	case  4:
+	    a += k[0]+(((uint32_t)k[1])<<16);
+	    break;
+	case  3:
+	    a += ((uint32_t)k8[2])<<16;
+	    /*@fallthrough@*/
+	case  2:
+	    a += (uint32_t)k[0];
+	    break;
+	case  1:
+	    a += (uint32_t)k8[0];
+	    break;
+	case  0:
+	    goto exit;
+	}
+
+    } else {		/* need to read the key one byte at a time */
+	const uint8_t *k = (const uint8_t *)key;
+
+	/*----------- all but the last block: affect some 32 bits of (a,b,c) */
+	while (size > 12) {
+	    a += (uint32_t)k[0];
+	    a += ((uint32_t)k[1])<<8;
+	    a += ((uint32_t)k[2])<<16;
+	    a += ((uint32_t)k[3])<<24;
+	    b += (uint32_t)k[4];
+	    b += ((uint32_t)k[5])<<8;
+	    b += ((uint32_t)k[6])<<16;
+	    b += ((uint32_t)k[7])<<24;
+	    c += (uint32_t)k[8];
+	    c += ((uint32_t)k[9])<<8;
+	    c += ((uint32_t)k[10])<<16;
+	    c += ((uint32_t)k[11])<<24;
+	    _JLU3_MIX(a,b,c);
+	    size -= 12;
+	    k += 12;
+	}
+
+	/*---------------------------- last block: affect all 32 bits of (c) */
+	switch (size) {
+	case 12:	c += ((uint32_t)k[11])<<24;	/*@fallthrough@*/
+	case 11:	c += ((uint32_t)k[10])<<16;	/*@fallthrough@*/
+	case 10:	c += ((uint32_t)k[9])<<8;	/*@fallthrough@*/
+	case  9:	c += (uint32_t)k[8];		/*@fallthrough@*/
+	case  8:	b += ((uint32_t)k[7])<<24;	/*@fallthrough@*/
+	case  7:	b += ((uint32_t)k[6])<<16;	/*@fallthrough@*/
+	case  6:	b += ((uint32_t)k[5])<<8;	/*@fallthrough@*/
+	case  5:	b += (uint32_t)k[4];		/*@fallthrough@*/
+	case  4:	a += ((uint32_t)k[3])<<24;	/*@fallthrough@*/
+	case  3:	a += ((uint32_t)k[2])<<16;	/*@fallthrough@*/
+	case  2:	a += ((uint32_t)k[1])<<8;	/*@fallthrough@*/
+	case  1:	a += (uint32_t)k[0];
+	    break;
+	case  0:
+	    goto exit;
+	}
+    }
+
+    _JLU3_FINAL(a,b,c);
+
+exit:
+    return c;
+}
+#endif	/* defined(_JLU3_jlu32l) */
+
+#if defined(_JLU3_jlu32lpair)
+/**
+ * jlu32lpair: return 2 32-bit hash values.
+ *
+ * This is identical to jlu32l(), except it returns two 32-bit hash
+ * values instead of just one.  This is good enough for hash table
+ * lookup with 2^^64 buckets, or if you want a second hash if you're not
+ * happy with the first, or if you want a probably-unique 64-bit ID for
+ * the key.  *pc is better mixed than *pb, so use *pc first.  If you want
+ * a 64-bit value do something like "*pc + (((uint64_t)*pb)<<32)".
+ *
+ * @param h		the previous hash, or an arbitrary value
+ * @param *key		the key, an array of uint8_t values
+ * @param size		the size of the key in bytes
+ * @retval *pc,		IN: primary initval, OUT: primary hash
+ * *retval *pb		IN: secondary initval, OUT: secondary hash
+ */
+void jlu32lpair(const void *key, size_t size, uint32_t *pc, uint32_t *pb)
+{
+    union { const void *ptr; size_t i; } u;
+    uint32_t a = _JLU3_INIT(*pc, size);
+    uint32_t b = a;
+    uint32_t c = a;
+
+    if (key == NULL)
+	goto exit;
+
+    c += *pb;	/* Add the secondary hash. */
+
+    u.ptr = key;
+    if (HASH_LITTLE_ENDIAN && ((u.i & 0x3) == 0)) {
+	const uint32_t *k = (const uint32_t *)key;	/* read 32-bit chunks */
+#ifdef	VALGRIND
+	const uint8_t  *k8;
+#endif
+
+	/*-- all but last block: aligned reads and affect 32 bits of (a,b,c) */
+	while (size > (size_t)12) {
+	    a += k[0];
+	    b += k[1];
+	    c += k[2];
+	    _JLU3_MIX(a,b,c);
+	    size -= 12;
+	    k += 3;
+	}
+	/*------------------------- handle the last (probably partial) block */
+	/* 
+	 * "k[2]&0xffffff" actually reads beyond the end of the string, but
+	 * then masks off the part it's not allowed to read.  Because the
+	 * string is aligned, the masked-off tail is in the same word as the
+	 * rest of the string.  Every machine with memory protection I've seen
+	 * does it on word boundaries, so is OK with this.  But VALGRIND will
+	 * still catch it and complain.  The masking trick does make the hash
+	 * noticably faster for short strings (like English words).
+	 */
+#ifndef VALGRIND
+
+	switch (size) {
+	case 12:	c += k[2]; b+=k[1]; a+=k[0]; break;
+	case 11:	c += k[2]&0xffffff; b+=k[1]; a+=k[0]; break;
+	case 10:	c += k[2]&0xffff; b+=k[1]; a+=k[0]; break;
+	case  9:	c += k[2]&0xff; b+=k[1]; a+=k[0]; break;
+	case  8:	b += k[1]; a+=k[0]; break;
+	case  7:	b += k[1]&0xffffff; a+=k[0]; break;
+	case  6:	b += k[1]&0xffff; a+=k[0]; break;
+	case  5:	b += k[1]&0xff; a+=k[0]; break;
+	case  4:	a += k[0]; break;
+	case  3:	a += k[0]&0xffffff; break;
+	case  2:	a += k[0]&0xffff; break;
+	case  1:	a += k[0]&0xff; break;
+	case  0:	goto exit;
+	}
+
+#else /* make valgrind happy */
+
+	k8 = (const uint8_t *)k;
+	switch (size) {
+	case 12:	c += k[2]; b+=k[1]; a+=k[0];	break;
+	case 11:	c += ((uint32_t)k8[10])<<16;	/*@fallthrough@*/
+	case 10:	c += ((uint32_t)k8[9])<<8;	/*@fallthrough@*/
+	case  9:	c += k8[8];			/*@fallthrough@*/
+	case  8:	b += k[1]; a+=k[0];		break;
+	case  7:	b += ((uint32_t)k8[6])<<16;	/*@fallthrough@*/
+	case  6:	b += ((uint32_t)k8[5])<<8;	/*@fallthrough@*/
+	case  5:	b += k8[4];			/*@fallthrough@*/
+	case  4:	a += k[0];			break;
+	case  3:	a += ((uint32_t)k8[2])<<16;	/*@fallthrough@*/
+	case  2:	a += ((uint32_t)k8[1])<<8;	/*@fallthrough@*/
+	case  1:	a += k8[0];			break;
+	case  0:	goto exit;
+	}
+
+#endif /* !valgrind */
+
+    } else if (HASH_LITTLE_ENDIAN && ((u.i & 0x1) == 0)) {
+	const uint16_t *k = (const uint16_t *)key;	/* read 16-bit chunks */
+	const uint8_t  *k8;
+
+	/*----------- all but last block: aligned reads and different mixing */
+	while (size > (size_t)12) {
+	    a += k[0] + (((uint32_t)k[1])<<16);
+	    b += k[2] + (((uint32_t)k[3])<<16);
+	    c += k[4] + (((uint32_t)k[5])<<16);
+	    _JLU3_MIX(a,b,c);
+	    size -= 12;
+	    k += 6;
+	}
+
+	/*------------------------- handle the last (probably partial) block */
+	k8 = (const uint8_t *)k;
+	switch (size) {
+	case 12:
+	    c += k[4]+(((uint32_t)k[5])<<16);
+	    b += k[2]+(((uint32_t)k[3])<<16);
+	    a += k[0]+(((uint32_t)k[1])<<16);
+	    break;
+	case 11:
+	    c += ((uint32_t)k8[10])<<16;
+	    /*@fallthrough@*/
+	case 10:
+	    c += k[4];
+	    b += k[2]+(((uint32_t)k[3])<<16);
+	    a += k[0]+(((uint32_t)k[1])<<16);
+	    break;
+	case  9:
+	    c += k8[8];
+	    /*@fallthrough@*/
+	case  8:
+	    b += k[2]+(((uint32_t)k[3])<<16);
+	    a += k[0]+(((uint32_t)k[1])<<16);
+	    break;
+	case  7:
+	    b += ((uint32_t)k8[6])<<16;
+	    /*@fallthrough@*/
+	case  6:
+	    b += k[2];
+	    a += k[0]+(((uint32_t)k[1])<<16);
+	    break;
+	case  5:
+	    b += k8[4];
+	    /*@fallthrough@*/
+	case  4:
+	    a += k[0]+(((uint32_t)k[1])<<16);
+	    break;
+	case  3:
+	    a += ((uint32_t)k8[2])<<16;
+	    /*@fallthrough@*/
+	case  2:
+	    a += k[0];
+	    break;
+	case  1:
+	    a += k8[0];
+	    break;
+	case  0:
+	    goto exit;
+	}
+
+    } else {		/* need to read the key one byte at a time */
+	const uint8_t *k = (const uint8_t *)key;
+
+	/*----------- all but the last block: affect some 32 bits of (a,b,c) */
+	while (size > (size_t)12) {
+	    a += k[0];
+	    a += ((uint32_t)k[1])<<8;
+	    a += ((uint32_t)k[2])<<16;
+	    a += ((uint32_t)k[3])<<24;
+	    b += k[4];
+	    b += ((uint32_t)k[5])<<8;
+	    b += ((uint32_t)k[6])<<16;
+	    b += ((uint32_t)k[7])<<24;
+	    c += k[8];
+	    c += ((uint32_t)k[9])<<8;
+	    c += ((uint32_t)k[10])<<16;
+	    c += ((uint32_t)k[11])<<24;
+	    _JLU3_MIX(a,b,c);
+	    size -= 12;
+	    k += 12;
+	}
+
+	/*---------------------------- last block: affect all 32 bits of (c) */
+	switch (size) {
+	case 12:	c += ((uint32_t)k[11])<<24;	/*@fallthrough@*/
+	case 11:	c += ((uint32_t)k[10])<<16;	/*@fallthrough@*/
+	case 10:	c += ((uint32_t)k[9])<<8;	/*@fallthrough@*/
+	case  9:	c += k[8];			/*@fallthrough@*/
+	case  8:	b += ((uint32_t)k[7])<<24;	/*@fallthrough@*/
+	case  7:	b += ((uint32_t)k[6])<<16;	/*@fallthrough@*/
+	case  6:	b += ((uint32_t)k[5])<<8;	/*@fallthrough@*/
+	case  5:	b += k[4];			/*@fallthrough@*/
+	case  4:	a += ((uint32_t)k[3])<<24;	/*@fallthrough@*/
+	case  3:	a += ((uint32_t)k[2])<<16;	/*@fallthrough@*/
+	case  2:	a += ((uint32_t)k[1])<<8;	/*@fallthrough@*/
+	case  1:	a += k[0];
+	    break;
+	case  0:
+	    goto exit;
+	}
+    }
+
+    _JLU3_FINAL(a,b,c);
+
+exit:
+    *pc = c;
+    *pb = b;
+    return;
+}
+#endif	/* defined(_JLU3_jlu32lpair) */
+
+#if defined(_JLU3_jlu32b)
+uint32_t jlu32b(uint32_t h, /*@null@*/ const void *key, size_t size)
+	/*@*/;
+/*
+ * jlu32b():
+ * This is the same as jlu32w() on big-endian machines.  It is different
+ * from jlu32l() on all machines.  jlu32b() takes advantage of
+ * big-endian byte ordering. 
+ *
+ * @param h		the previous hash, or an arbitrary value
+ * @param *k		the key, an array of uint8_t values
+ * @param size		the size of the key
+ * @return		the lookup3 hash
+ */
+uint32_t jlu32b(uint32_t h, const void *key, size_t size)
+{
+    union { const void *ptr; size_t i; } u;
+    uint32_t a = _JLU3_INIT(h, size);
+    uint32_t b = a;
+    uint32_t c = a;
+
+    if (key == NULL)
+	return h;
+
+    u.ptr = key;
+    if (HASH_BIG_ENDIAN && ((u.i & 0x3) == 0)) {
+	const uint32_t *k = (const uint32_t *)key;	/* read 32-bit chunks */
+#ifdef	VALGRIND
+	const uint8_t  *k8;
+#endif
+
+	/*-- all but last block: aligned reads and affect 32 bits of (a,b,c) */
+	while (size > 12) {
+	    a += k[0];
+	    b += k[1];
+	    c += k[2];
+	    _JLU3_MIX(a,b,c);
+	    size -= 12;
+	    k += 3;
+	}
+
+	/*------------------------- handle the last (probably partial) block */
+	/* 
+	 * "k[2]<<8" actually reads beyond the end of the string, but
+	 * then shifts out the part it's not allowed to read.  Because the
+	 * string is aligned, the illegal read is in the same word as the
+	 * rest of the string.  Every machine with memory protection I've seen
+	 * does it on word boundaries, so is OK with this.  But VALGRIND will
+	 * still catch it and complain.  The masking trick does make the hash
+	 * noticably faster for short strings (like English words).
+	 */
+#ifndef VALGRIND
+
+	switch (size) {
+	case 12:	c += k[2]; b+=k[1]; a+=k[0]; break;
+	case 11:	c += k[2]&0xffffff00; b+=k[1]; a+=k[0]; break;
+	case 10:	c += k[2]&0xffff0000; b+=k[1]; a+=k[0]; break;
+	case  9:	c += k[2]&0xff000000; b+=k[1]; a+=k[0]; break;
+	case  8:	b += k[1]; a+=k[0]; break;
+	case  7:	b += k[1]&0xffffff00; a+=k[0]; break;
+	case  6:	b += k[1]&0xffff0000; a+=k[0]; break;
+	case  5:	b += k[1]&0xff000000; a+=k[0]; break;
+	case  4:	a += k[0]; break;
+	case  3:	a += k[0]&0xffffff00; break;
+	case  2:	a += k[0]&0xffff0000; break;
+	case  1:	a += k[0]&0xff000000; break;
+	case  0:	goto exit;
+    }
+
+#else  /* make valgrind happy */
+
+	k8 = (const uint8_t *)k;
+	switch (size) {	/* all the case statements fall through */
+	case 12:	c += k[2]; b+=k[1]; a+=k[0];	break;
+	case 11:	c += ((uint32_t)k8[10])<<8;	/*@fallthrough@*/
+	case 10:	c += ((uint32_t)k8[9])<<16;	/*@fallthrough@*/
+	case  9:	c += ((uint32_t)k8[8])<<24;	/*@fallthrough@*/
+	case  8:	b += k[1]; a+=k[0];		break;
+	case  7:	b += ((uint32_t)k8[6])<<8;	/*@fallthrough@*/
+	case  6:	b += ((uint32_t)k8[5])<<16;	/*@fallthrough@*/
+	case  5:	b += ((uint32_t)k8[4])<<24;	/*@fallthrough@*/
+	case  4:	a += k[0];			break;
+	case  3:	a += ((uint32_t)k8[2])<<8;	/*@fallthrough@*/
+	case  2:	a += ((uint32_t)k8[1])<<16;	/*@fallthrough@*/
+	case  1:	a += ((uint32_t)k8[0])<<24;	break;
+	case  0:	goto exit;
+    }
+
+#endif /* !VALGRIND */
+
+    } else {                        /* need to read the key one byte at a time */
+	const uint8_t *k = (const uint8_t *)key;
+
+	/*----------- all but the last block: affect some 32 bits of (a,b,c) */
+	while (size > 12) {
+	    a += ((uint32_t)k[0])<<24;
+	    a += ((uint32_t)k[1])<<16;
+	    a += ((uint32_t)k[2])<<8;
+	    a += ((uint32_t)k[3]);
+	    b += ((uint32_t)k[4])<<24;
+	    b += ((uint32_t)k[5])<<16;
+	    b += ((uint32_t)k[6])<<8;
+	    b += ((uint32_t)k[7]);
+	    c += ((uint32_t)k[8])<<24;
+	    c += ((uint32_t)k[9])<<16;
+	    c += ((uint32_t)k[10])<<8;
+	    c += ((uint32_t)k[11]);
+	    _JLU3_MIX(a,b,c);
+	    size -= 12;
+	    k += 12;
+	}
+
+	/*---------------------------- last block: affect all 32 bits of (c) */
+	switch (size) {	/* all the case statements fall through */
+	case 12:	c += k[11];			/*@fallthrough@*/
+	case 11:	c += ((uint32_t)k[10])<<8;	/*@fallthrough@*/
+	case 10:	c += ((uint32_t)k[9])<<16;	/*@fallthrough@*/
+	case  9:	c += ((uint32_t)k[8])<<24;	/*@fallthrough@*/
+	case  8:	b += k[7];			/*@fallthrough@*/
+	case  7:	b += ((uint32_t)k[6])<<8;	/*@fallthrough@*/
+	case  6:	b += ((uint32_t)k[5])<<16;	/*@fallthrough@*/
+	case  5:	b += ((uint32_t)k[4])<<24;	/*@fallthrough@*/
+	case  4:	a += k[3];			/*@fallthrough@*/
+	case  3:	a += ((uint32_t)k[2])<<8;	/*@fallthrough@*/
+	case  2:	a += ((uint32_t)k[1])<<16;	/*@fallthrough@*/
+	case  1:	a += ((uint32_t)k[0])<<24;	/*@fallthrough@*/
+	    break;
+	case  0:
+	    goto exit;
+	}
+    }
+
+    _JLU3_FINAL(a,b,c);
+
+exit:
+    return c;
+}
+#endif	/* defined(_JLU3_jlu32b) */
+
+#if defined(_JLU3_SELFTEST)
+
+/* used for timings */
+static void driver1(void)
+	/*@*/
+{
+    uint8_t buf[256];
+    uint32_t i;
+    uint32_t h=0;
+    time_t a,z;
+
+    time(&a);
+    for (i=0; i<256; ++i) buf[i] = 'x';
+    for (i=0; i<1; ++i) {
+	h = jlu32l(h, &buf[0], sizeof(buf[0]));
+    }
+    time(&z);
+    if (z-a > 0) printf("time %d %.8x\n", (int)(z-a), h);
+}
+
+/* check that every input bit changes every output bit half the time */
+#define HASHSTATE 1
+#define HASHLEN   1
+#define MAXPAIR 60
+#define MAXLEN  70
+static void driver2(void)
+	/*@*/
+{
+    uint8_t qa[MAXLEN+1], qb[MAXLEN+2], *a = &qa[0], *b = &qb[1];
+    uint32_t c[HASHSTATE], d[HASHSTATE], i=0, j=0, k, l, m=0, z;
+    uint32_t e[HASHSTATE],f[HASHSTATE],g[HASHSTATE],h[HASHSTATE];
+    uint32_t x[HASHSTATE],y[HASHSTATE];
+    uint32_t hlen;
+
+    printf("No more than %d trials should ever be needed \n",MAXPAIR/2);
+    for (hlen=0; hlen < MAXLEN; ++hlen) {
+	z=0;
+	for (i=0; i<hlen; ++i) {	/*-------------- for each input byte, */
+	    for (j=0; j<8; ++j) {	/*--------------- for each input bit, */
+		for (m=1; m<8; ++m) {	/*--- for serveral possible initvals, */
+		    for (l=0; l<HASHSTATE; ++l)
+			e[l]=f[l]=g[l]=h[l]=x[l]=y[l]=~((uint32_t)0);
+
+		    /* check that every output bit is affected by that input bit */
+		    for (k=0; k<MAXPAIR; k+=2) { 
+			uint32_t finished=1;
+			/* keys have one bit different */
+			for (l=0; l<hlen+1; ++l) {a[l] = b[l] = (uint8_t)0;}
+			/* have a and b be two keys differing in only one bit */
+			a[i] ^= (k<<j);
+			a[i] ^= (k>>(8-j));
+			c[0] = jlu32l(m, a, hlen);
+			b[i] ^= ((k+1)<<j);
+			b[i] ^= ((k+1)>>(8-j));
+			d[0] = jlu32l(m, b, hlen);
+			/* check every bit is 1, 0, set, and not set at least once */
+			for (l=0; l<HASHSTATE; ++l) {
+			    e[l] &= (c[l]^d[l]);
+			    f[l] &= ~(c[l]^d[l]);
+			    g[l] &= c[l];
+			    h[l] &= ~c[l];
+			    x[l] &= d[l];
+			    y[l] &= ~d[l];
+			    if (e[l]|f[l]|g[l]|h[l]|x[l]|y[l]) finished=0;
+			}
+			if (finished) break;
+		    }
+		    if (k>z) z=k;
+		    if (k == MAXPAIR) {
+			printf("Some bit didn't change: ");
+			printf("%.8x %.8x %.8x %.8x %.8x %.8x  ",
+				e[0],f[0],g[0],h[0],x[0],y[0]);
+			printf("i %d j %d m %d len %d\n", i, j, m, hlen);
+		    }
+		    if (z == MAXPAIR) goto done;
+		}
+	    }
+	}
+   done:
+	if (z < MAXPAIR) {
+	    printf("Mix success  %2d bytes  %2d initvals  ",i,m);
+	    printf("required  %d  trials\n", z/2);
+	}
+    }
+    printf("\n");
+}
+
+/* Check for reading beyond the end of the buffer and alignment problems */
+static void driver3(void)
+	/*@*/
+{
+    uint8_t buf[MAXLEN+20], *b;
+    uint32_t len;
+    uint8_t q[] = "This is the time for all good men to come to the aid of their country...";
+    uint32_t h;
+    uint8_t qq[] = "xThis is the time for all good men to come to the aid of their country...";
+    uint32_t i;
+    uint8_t qqq[] = "xxThis is the time for all good men to come to the aid of their country...";
+    uint32_t j;
+    uint8_t qqqq[] = "xxxThis is the time for all good men to come to the aid of their country...";
+    uint32_t ref,x,y;
+    uint8_t *p;
+    uint32_t m = 13;
+
+    printf("Endianness.  These lines should all be the same (for values filled in):\n");
+    printf("%.8x                            %.8x                            %.8x\n",
+	jlu32w(m, (const uint32_t *)q, (sizeof(q)-1)/4),
+	jlu32w(m, (const uint32_t *)q, (sizeof(q)-5)/4),
+	jlu32w(m, (const uint32_t *)q, (sizeof(q)-9)/4));
+    p = q;
+    printf("%.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x\n",
+	jlu32l(m, p, sizeof(q)-1), jlu32l(m, p, sizeof(q)-2),
+	jlu32l(m, p, sizeof(q)-3), jlu32l(m, p, sizeof(q)-4),
+	jlu32l(m, p, sizeof(q)-5), jlu32l(m, p, sizeof(q)-6),
+	jlu32l(m, p, sizeof(q)-7), jlu32l(m, p, sizeof(q)-8),
+	jlu32l(m, p, sizeof(q)-9), jlu32l(m, p, sizeof(q)-10),
+	jlu32l(m, p, sizeof(q)-11), jlu32l(m, p, sizeof(q)-12));
+    p = &qq[1];
+    printf("%.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x\n",
+	jlu32l(m, p, sizeof(q)-1), jlu32l(m, p, sizeof(q)-2),
+	jlu32l(m, p, sizeof(q)-3), jlu32l(m, p, sizeof(q)-4),
+	jlu32l(m, p, sizeof(q)-5), jlu32l(m, p, sizeof(q)-6),
+	jlu32l(m, p, sizeof(q)-7), jlu32l(m, p, sizeof(q)-8),
+	jlu32l(m, p, sizeof(q)-9), jlu32l(m, p, sizeof(q)-10),
+	jlu32l(m, p, sizeof(q)-11), jlu32l(m, p, sizeof(q)-12));
+    p = &qqq[2];
+    printf("%.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x\n",
+	jlu32l(m, p, sizeof(q)-1), jlu32l(m, p, sizeof(q)-2),
+	jlu32l(m, p, sizeof(q)-3), jlu32l(m, p, sizeof(q)-4),
+	jlu32l(m, p, sizeof(q)-5), jlu32l(m, p, sizeof(q)-6),
+	jlu32l(m, p, sizeof(q)-7), jlu32l(m, p, sizeof(q)-8),
+	jlu32l(m, p, sizeof(q)-9), jlu32l(m, p, sizeof(q)-10),
+	jlu32l(m, p, sizeof(q)-11), jlu32l(m, p, sizeof(q)-12));
+    p = &qqqq[3];
+    printf("%.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x\n",
+	jlu32l(m, p, sizeof(q)-1), jlu32l(m, p, sizeof(q)-2),
+	jlu32l(m, p, sizeof(q)-3), jlu32l(m, p, sizeof(q)-4),
+	jlu32l(m, p, sizeof(q)-5), jlu32l(m, p, sizeof(q)-6),
+	jlu32l(m, p, sizeof(q)-7), jlu32l(m, p, sizeof(q)-8),
+	jlu32l(m, p, sizeof(q)-9), jlu32l(m, p, sizeof(q)-10),
+	jlu32l(m, p, sizeof(q)-11), jlu32l(m, p, sizeof(q)-12));
+    printf("\n");
+    for (h=0, b=buf+1; h<8; ++h, ++b) {
+	for (i=0; i<MAXLEN; ++i) {
+	    len = i;
+	    for (j=0; j<i; ++j)
+		*(b+j)=0;
+
+	    /* these should all be equal */
+	    m = 1;
+	    ref = jlu32l(m, b, len);
+	    *(b+i)=(uint8_t)~0;
+	    *(b-1)=(uint8_t)~0;
+	    x = jlu32l(m, b, len);
+	    y = jlu32l(m, b, len);
+	    if ((ref != x) || (ref != y)) 
+		printf("alignment error: %.8x %.8x %.8x %d %d\n",ref,x,y, h, i);
+	}
+    }
+}
+
+/* check for problems with nulls */
+static void driver4(void)
+	/*@*/
+{
+    uint8_t buf[1];
+    uint32_t h;
+    uint32_t i;
+    uint32_t state[HASHSTATE];
+
+    buf[0] = ~0;
+    for (i=0; i<HASHSTATE; ++i)
+	state[i] = 1;
+    printf("These should all be different\n");
+    h = 0;
+    for (i=0; i<8; ++i) {
+	h = jlu32l(h, buf, 0);
+	printf("%2ld  0-byte strings, hash is  %.8x\n", (long)i, h);
+    }
+}
+
+
+int main(int argc, char ** argv)
+{
+    driver1();	/* test that the key is hashed: used for timings */
+    driver2();	/* test that whole key is hashed thoroughly */
+    driver3();	/* test that nothing but the key is hashed */
+    driver4();	/* test hashing multiple buffers (all buffers are null) */
+    return 1;
+}
+
+#endif  /* _JLU3_SELFTEST */
diff --git a/popt-1.16/ltmain.sh b/popt-1.16/ltmain.sh
new file mode 100755
index 0000000..6939dcc
--- /dev/null
+++ b/popt-1.16/ltmain.sh
@@ -0,0 +1,8406 @@
+# Generated from ltmain.m4sh.
+
+# ltmain.sh (GNU libtool) 2.2.6
+# Written by Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005, 2006, 2007 2008 Free Software Foundation, Inc.
+# This is free software; see the source for copying conditions.  There is NO
+# warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
+
+# GNU Libtool is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# As a special exception to the GNU General Public License,
+# if you distribute this file as part of a program or library that
+# is built using GNU Libtool, you may include this file under the
+# same distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with GNU Libtool; see the file COPYING.  If not, a copy
+# can be downloaded from http://www.gnu.org/licenses/gpl.html,
+# or obtained by writing to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+# Usage: $progname [OPTION]... [MODE-ARG]...
+#
+# Provide generalized library-building support services.
+#
+#     --config             show all configuration variables
+#     --debug              enable verbose shell tracing
+# -n, --dry-run            display commands without modifying any files
+#     --features           display basic configuration information and exit
+#     --mode=MODE          use operation mode MODE
+#     --preserve-dup-deps  don't remove duplicate dependency libraries
+#     --quiet, --silent    don't print informational messages
+#     --tag=TAG            use configuration variables from tag TAG
+# -v, --verbose            print informational messages (default)
+#     --version            print version information
+# -h, --help               print short or long help message
+#
+# MODE must be one of the following:
+#
+#       clean              remove files from the build directory
+#       compile            compile a source file into a libtool object
+#       execute            automatically set library path, then run a program
+#       finish             complete the installation of libtool libraries
+#       install            install libraries or executables
+#       link               create a library or an executable
+#       uninstall          remove libraries from an installed directory
+#
+# MODE-ARGS vary depending on the MODE.
+# Try `$progname --help --mode=MODE' for a more detailed description of MODE.
+#
+# When reporting a bug, please describe a test case to reproduce it and
+# include the following information:
+#
+#       host-triplet:	$host
+#       shell:		$SHELL
+#       compiler:		$LTCC
+#       compiler flags:		$LTCFLAGS
+#       linker:		$LD (gnu? $with_gnu_ld)
+#       $progname:		(GNU libtool) 2.2.6
+#       automake:		$automake_version
+#       autoconf:		$autoconf_version
+#
+# Report bugs to <bug-libtool@gnu.org>.
+
+PROGRAM=ltmain.sh
+PACKAGE=libtool
+VERSION=2.2.6
+TIMESTAMP=""
+package_revision=1.3012
+
+# Be Bourne compatible
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then
+  emulate sh
+  NULLCMD=:
+  # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which
+  # is contrary to our usage.  Disable this feature.
+  alias -g '${1+"$@"}'='"$@"'
+  setopt NO_GLOB_SUBST
+else
+  case `(set -o) 2>/dev/null` in *posix*) set -o posix;; esac
+fi
+BIN_SH=xpg4; export BIN_SH # for Tru64
+DUALCASE=1; export DUALCASE # for MKS sh
+
+# NLS nuisances: We save the old values to restore during execute mode.
+# Only set LANG and LC_ALL to C if already set.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+lt_user_locale=
+lt_safe_locale=
+for lt_var in LANG LANGUAGE LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES
+do
+  eval "if test \"\${$lt_var+set}\" = set; then
+          save_$lt_var=\$$lt_var
+          $lt_var=C
+	  export $lt_var
+	  lt_user_locale=\"$lt_var=\\\$save_\$lt_var; \$lt_user_locale\"
+	  lt_safe_locale=\"$lt_var=C; \$lt_safe_locale\"
+	fi"
+done
+
+$lt_unset CDPATH
+
+
+
+
+
+: ${CP="cp -f"}
+: ${ECHO="echo"}
+: ${EGREP="/bin/grep -E"}
+: ${FGREP="/bin/grep -F"}
+: ${GREP="/bin/grep"}
+: ${LN_S="ln -s"}
+: ${MAKE="make"}
+: ${MKDIR="mkdir"}
+: ${MV="mv -f"}
+: ${RM="rm -f"}
+: ${SED="/bin/sed"}
+: ${SHELL="${CONFIG_SHELL-/bin/sh}"}
+: ${Xsed="$SED -e 1s/^X//"}
+
+# Global variables:
+EXIT_SUCCESS=0
+EXIT_FAILURE=1
+EXIT_MISMATCH=63  # $? = 63 is used to indicate version mismatch to missing.
+EXIT_SKIP=77	  # $? = 77 is used to indicate a skipped test to automake.
+
+exit_status=$EXIT_SUCCESS
+
+# Make sure IFS has a sensible default
+lt_nl='
+'
+IFS=" 	$lt_nl"
+
+dirname="s,/[^/]*$,,"
+basename="s,^.*/,,"
+
+# func_dirname_and_basename file append nondir_replacement
+# perform func_basename and func_dirname in a single function
+# call:
+#   dirname:  Compute the dirname of FILE.  If nonempty,
+#             add APPEND to the result, otherwise set result
+#             to NONDIR_REPLACEMENT.
+#             value returned in "$func_dirname_result"
+#   basename: Compute filename of FILE.
+#             value retuned in "$func_basename_result"
+# Implementation must be kept synchronized with func_dirname
+# and func_basename. For efficiency, we do not delegate to
+# those functions but instead duplicate the functionality here.
+func_dirname_and_basename ()
+{
+  # Extract subdirectory from the argument.
+  func_dirname_result=`$ECHO "X${1}" | $Xsed -e "$dirname"`
+  if test "X$func_dirname_result" = "X${1}"; then
+    func_dirname_result="${3}"
+  else
+    func_dirname_result="$func_dirname_result${2}"
+  fi
+  func_basename_result=`$ECHO "X${1}" | $Xsed -e "$basename"`
+}
+
+# Generated shell functions inserted here.
+
+# Work around backward compatibility issue on IRIX 6.5. On IRIX 6.4+, sh
+# is ksh but when the shell is invoked as "sh" and the current value of
+# the _XPG environment variable is not equal to 1 (one), the special
+# positional parameter $0, within a function call, is the name of the
+# function.
+progpath="$0"
+
+# The name of this program:
+# In the unlikely event $progname began with a '-', it would play havoc with
+# func_echo (imagine progname=-n), so we prepend ./ in that case:
+func_dirname_and_basename "$progpath"
+progname=$func_basename_result
+case $progname in
+  -*) progname=./$progname ;;
+esac
+
+# Make sure we have an absolute path for reexecution:
+case $progpath in
+  [\\/]*|[A-Za-z]:\\*) ;;
+  *[\\/]*)
+     progdir=$func_dirname_result
+     progdir=`cd "$progdir" && pwd`
+     progpath="$progdir/$progname"
+     ;;
+  *)
+     save_IFS="$IFS"
+     IFS=:
+     for progdir in $PATH; do
+       IFS="$save_IFS"
+       test -x "$progdir/$progname" && break
+     done
+     IFS="$save_IFS"
+     test -n "$progdir" || progdir=`pwd`
+     progpath="$progdir/$progname"
+     ;;
+esac
+
+# Sed substitution that helps us do robust quoting.  It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed="${SED}"' -e 1s/^X//'
+sed_quote_subst='s/\([`"$\\]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\(["`\\]\)/\\\1/g'
+
+# Re-`\' parameter expansions in output of double_quote_subst that were
+# `\'-ed in input to the same.  If an odd number of `\' preceded a '$'
+# in input to double_quote_subst, that '$' was protected from expansion.
+# Since each input `\' is now two `\'s, look for any number of runs of
+# four `\'s followed by two `\'s and then a '$'.  `\' that '$'.
+bs='\\'
+bs2='\\\\'
+bs4='\\\\\\\\'
+dollar='\$'
+sed_double_backslash="\
+  s/$bs4/&\\
+/g
+  s/^$bs2$dollar/$bs&/
+  s/\\([^$bs]\\)$bs2$dollar/\\1$bs2$bs$dollar/g
+  s/\n//g"
+
+# Standard options:
+opt_dry_run=false
+opt_help=false
+opt_quiet=false
+opt_verbose=false
+opt_warning=:
+
+# func_echo arg...
+# Echo program name prefixed message, along with the current mode
+# name if it has been set yet.
+func_echo ()
+{
+    $ECHO "$progname${mode+: }$mode: $*"
+}
+
+# func_verbose arg...
+# Echo program name prefixed message in verbose mode only.
+func_verbose ()
+{
+    $opt_verbose && func_echo ${1+"$@"}
+
+    # A bug in bash halts the script if the last line of a function
+    # fails when set -e is in force, so we need another command to
+    # work around that:
+    :
+}
+
+# func_error arg...
+# Echo program name prefixed message to standard error.
+func_error ()
+{
+    $ECHO "$progname${mode+: }$mode: "${1+"$@"} 1>&2
+}
+
+# func_warning arg...
+# Echo program name prefixed warning message to standard error.
+func_warning ()
+{
+    $opt_warning && $ECHO "$progname${mode+: }$mode: warning: "${1+"$@"} 1>&2
+
+    # bash bug again:
+    :
+}
+
+# func_fatal_error arg...
+# Echo program name prefixed message to standard error, and exit.
+func_fatal_error ()
+{
+    func_error ${1+"$@"}
+    exit $EXIT_FAILURE
+}
+
+# func_fatal_help arg...
+# Echo program name prefixed message to standard error, followed by
+# a help hint, and exit.
+func_fatal_help ()
+{
+    func_error ${1+"$@"}
+    func_fatal_error "$help"
+}
+help="Try \`$progname --help' for more information."  ## default
+
+
+# func_grep expression filename
+# Check whether EXPRESSION matches any line of FILENAME, without output.
+func_grep ()
+{
+    $GREP "$1" "$2" >/dev/null 2>&1
+}
+
+
+# func_mkdir_p directory-path
+# Make sure the entire path to DIRECTORY-PATH is available.
+func_mkdir_p ()
+{
+    my_directory_path="$1"
+    my_dir_list=
+
+    if test -n "$my_directory_path" && test "$opt_dry_run" != ":"; then
+
+      # Protect directory names starting with `-'
+      case $my_directory_path in
+        -*) my_directory_path="./$my_directory_path" ;;
+      esac
+
+      # While some portion of DIR does not yet exist...
+      while test ! -d "$my_directory_path"; do
+        # ...make a list in topmost first order.  Use a colon delimited
+	# list incase some portion of path contains whitespace.
+        my_dir_list="$my_directory_path:$my_dir_list"
+
+        # If the last portion added has no slash in it, the list is done
+        case $my_directory_path in */*) ;; *) break ;; esac
+
+        # ...otherwise throw away the child directory and loop
+        my_directory_path=`$ECHO "X$my_directory_path" | $Xsed -e "$dirname"`
+      done
+      my_dir_list=`$ECHO "X$my_dir_list" | $Xsed -e 's,:*$,,'`
+
+      save_mkdir_p_IFS="$IFS"; IFS=':'
+      for my_dir in $my_dir_list; do
+	IFS="$save_mkdir_p_IFS"
+        # mkdir can fail with a `File exist' error if two processes
+        # try to create one of the directories concurrently.  Don't
+        # stop in that case!
+        $MKDIR "$my_dir" 2>/dev/null || :
+      done
+      IFS="$save_mkdir_p_IFS"
+
+      # Bail out if we (or some other process) failed to create a directory.
+      test -d "$my_directory_path" || \
+        func_fatal_error "Failed to create \`$1'"
+    fi
+}
+
+
+# func_mktempdir [string]
+# Make a temporary directory that won't clash with other running
+# libtool processes, and avoids race conditions if possible.  If
+# given, STRING is the basename for that directory.
+func_mktempdir ()
+{
+    my_template="${TMPDIR-/tmp}/${1-$progname}"
+
+    if test "$opt_dry_run" = ":"; then
+      # Return a directory name, but don't create it in dry-run mode
+      my_tmpdir="${my_template}-$$"
+    else
+
+      # If mktemp works, use that first and foremost
+      my_tmpdir=`mktemp -d "${my_template}-XXXXXXXX" 2>/dev/null`
+
+      if test ! -d "$my_tmpdir"; then
+        # Failing that, at least try and use $RANDOM to avoid a race
+        my_tmpdir="${my_template}-${RANDOM-0}$$"
+
+        save_mktempdir_umask=`umask`
+        umask 0077
+        $MKDIR "$my_tmpdir"
+        umask $save_mktempdir_umask
+      fi
+
+      # If we're not in dry-run mode, bomb out on failure
+      test -d "$my_tmpdir" || \
+        func_fatal_error "cannot create temporary directory \`$my_tmpdir'"
+    fi
+
+    $ECHO "X$my_tmpdir" | $Xsed
+}
+
+
+# func_quote_for_eval arg
+# Aesthetically quote ARG to be evaled later.
+# This function returns two values: FUNC_QUOTE_FOR_EVAL_RESULT
+# is double-quoted, suitable for a subsequent eval, whereas
+# FUNC_QUOTE_FOR_EVAL_UNQUOTED_RESULT has merely all characters
+# which are still active within double quotes backslashified.
+func_quote_for_eval ()
+{
+    case $1 in
+      *[\\\`\"\$]*)
+	func_quote_for_eval_unquoted_result=`$ECHO "X$1" | $Xsed -e "$sed_quote_subst"` ;;
+      *)
+        func_quote_for_eval_unquoted_result="$1" ;;
+    esac
+
+    case $func_quote_for_eval_unquoted_result in
+      # Double-quote args containing shell metacharacters to delay
+      # word splitting, command substitution and and variable
+      # expansion for a subsequent eval.
+      # Many Bourne shells cannot handle close brackets correctly
+      # in scan sets, so we specify it separately.
+      *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \	]*|*]*|"")
+        func_quote_for_eval_result="\"$func_quote_for_eval_unquoted_result\""
+        ;;
+      *)
+        func_quote_for_eval_result="$func_quote_for_eval_unquoted_result"
+    esac
+}
+
+
+# func_quote_for_expand arg
+# Aesthetically quote ARG to be evaled later; same as above,
+# but do not quote variable references.
+func_quote_for_expand ()
+{
+    case $1 in
+      *[\\\`\"]*)
+	my_arg=`$ECHO "X$1" | $Xsed \
+	    -e "$double_quote_subst" -e "$sed_double_backslash"` ;;
+      *)
+        my_arg="$1" ;;
+    esac
+
+    case $my_arg in
+      # Double-quote args containing shell metacharacters to delay
+      # word splitting and command substitution for a subsequent eval.
+      # Many Bourne shells cannot handle close brackets correctly
+      # in scan sets, so we specify it separately.
+      *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \	]*|*]*|"")
+        my_arg="\"$my_arg\""
+        ;;
+    esac
+
+    func_quote_for_expand_result="$my_arg"
+}
+
+
+# func_show_eval cmd [fail_exp]
+# Unless opt_silent is true, then output CMD.  Then, if opt_dryrun is
+# not true, evaluate CMD.  If the evaluation of CMD fails, and FAIL_EXP
+# is given, then evaluate it.
+func_show_eval ()
+{
+    my_cmd="$1"
+    my_fail_exp="${2-:}"
+
+    ${opt_silent-false} || {
+      func_quote_for_expand "$my_cmd"
+      eval "func_echo $func_quote_for_expand_result"
+    }
+
+    if ${opt_dry_run-false}; then :; else
+      eval "$my_cmd"
+      my_status=$?
+      if test "$my_status" -eq 0; then :; else
+	eval "(exit $my_status); $my_fail_exp"
+      fi
+    fi
+}
+
+
+# func_show_eval_locale cmd [fail_exp]
+# Unless opt_silent is true, then output CMD.  Then, if opt_dryrun is
+# not true, evaluate CMD.  If the evaluation of CMD fails, and FAIL_EXP
+# is given, then evaluate it.  Use the saved locale for evaluation.
+func_show_eval_locale ()
+{
+    my_cmd="$1"
+    my_fail_exp="${2-:}"
+
+    ${opt_silent-false} || {
+      func_quote_for_expand "$my_cmd"
+      eval "func_echo $func_quote_for_expand_result"
+    }
+
+    if ${opt_dry_run-false}; then :; else
+      eval "$lt_user_locale
+	    $my_cmd"
+      my_status=$?
+      eval "$lt_safe_locale"
+      if test "$my_status" -eq 0; then :; else
+	eval "(exit $my_status); $my_fail_exp"
+      fi
+    fi
+}
+
+
+
+
+
+# func_version
+# Echo version message to standard output and exit.
+func_version ()
+{
+    $SED -n '/^# '$PROGRAM' (GNU /,/# warranty; / {
+        s/^# //
+	s/^# *$//
+        s/\((C)\)[ 0-9,-]*\( [1-9][0-9]*\)/\1\2/
+        p
+     }' < "$progpath"
+     exit $?
+}
+
+# func_usage
+# Echo short help message to standard output and exit.
+func_usage ()
+{
+    $SED -n '/^# Usage:/,/# -h/ {
+        s/^# //
+	s/^# *$//
+	s/\$progname/'$progname'/
+	p
+    }' < "$progpath"
+    $ECHO
+    $ECHO "run \`$progname --help | more' for full usage"
+    exit $?
+}
+
+# func_help
+# Echo long help message to standard output and exit.
+func_help ()
+{
+    $SED -n '/^# Usage:/,/# Report bugs to/ {
+        s/^# //
+	s/^# *$//
+	s*\$progname*'$progname'*
+	s*\$host*'"$host"'*
+	s*\$SHELL*'"$SHELL"'*
+	s*\$LTCC*'"$LTCC"'*
+	s*\$LTCFLAGS*'"$LTCFLAGS"'*
+	s*\$LD*'"$LD"'*
+	s/\$with_gnu_ld/'"$with_gnu_ld"'/
+	s/\$automake_version/'"`(automake --version) 2>/dev/null |$SED 1q`"'/
+	s/\$autoconf_version/'"`(autoconf --version) 2>/dev/null |$SED 1q`"'/
+	p
+     }' < "$progpath"
+    exit $?
+}
+
+# func_missing_arg argname
+# Echo program name prefixed message to standard error and set global
+# exit_cmd.
+func_missing_arg ()
+{
+    func_error "missing argument for $1"
+    exit_cmd=exit
+}
+
+exit_cmd=:
+
+
+
+
+
+# Check that we have a working $ECHO.
+if test "X$1" = X--no-reexec; then
+  # Discard the --no-reexec flag, and continue.
+  shift
+elif test "X$1" = X--fallback-echo; then
+  # Avoid inline document here, it may be left over
+  :
+elif test "X`{ $ECHO '\t'; } 2>/dev/null`" = 'X\t'; then
+  # Yippee, $ECHO works!
+  :
+else
+  # Restart under the correct shell, and then maybe $ECHO will work.
+  exec $SHELL "$progpath" --no-reexec ${1+"$@"}
+fi
+
+if test "X$1" = X--fallback-echo; then
+  # used as fallback echo
+  shift
+  cat <<EOF
+$*
+EOF
+  exit $EXIT_SUCCESS
+fi
+
+magic="%%%MAGIC variable%%%"
+magic_exe="%%%MAGIC EXE variable%%%"
+
+# Global variables.
+# $mode is unset
+nonopt=
+execute_dlfiles=
+preserve_args=
+lo2o="s/\\.lo\$/.${objext}/"
+o2lo="s/\\.${objext}\$/.lo/"
+extracted_archives=
+extracted_serial=0
+
+opt_dry_run=false
+opt_duplicate_deps=false
+opt_silent=false
+opt_debug=:
+
+# If this variable is set in any of the actions, the command in it
+# will be execed at the end.  This prevents here-documents from being
+# left over by shells.
+exec_cmd=
+
+# func_fatal_configuration arg...
+# Echo program name prefixed message to standard error, followed by
+# a configuration failure hint, and exit.
+func_fatal_configuration ()
+{
+    func_error ${1+"$@"}
+    func_error "See the $PACKAGE documentation for more information."
+    func_fatal_error "Fatal configuration error."
+}
+
+
+# func_config
+# Display the configuration for all the tags in this script.
+func_config ()
+{
+    re_begincf='^# ### BEGIN LIBTOOL'
+    re_endcf='^# ### END LIBTOOL'
+
+    # Default configuration.
+    $SED "1,/$re_begincf CONFIG/d;/$re_endcf CONFIG/,\$d" < "$progpath"
+
+    # Now print the configurations for the tags.
+    for tagname in $taglist; do
+      $SED -n "/$re_begincf TAG CONFIG: $tagname\$/,/$re_endcf TAG CONFIG: $tagname\$/p" < "$progpath"
+    done
+
+    exit $?
+}
+
+# func_features
+# Display the features supported by this script.
+func_features ()
+{
+    $ECHO "host: $host"
+    if test "$build_libtool_libs" = yes; then
+      $ECHO "enable shared libraries"
+    else
+      $ECHO "disable shared libraries"
+    fi
+    if test "$build_old_libs" = yes; then
+      $ECHO "enable static libraries"
+    else
+      $ECHO "disable static libraries"
+    fi
+
+    exit $?
+}
+
+# func_enable_tag tagname
+# Verify that TAGNAME is valid, and either flag an error and exit, or
+# enable the TAGNAME tag.  We also add TAGNAME to the global $taglist
+# variable here.
+func_enable_tag ()
+{
+  # Global variable:
+  tagname="$1"
+
+  re_begincf="^# ### BEGIN LIBTOOL TAG CONFIG: $tagname\$"
+  re_endcf="^# ### END LIBTOOL TAG CONFIG: $tagname\$"
+  sed_extractcf="/$re_begincf/,/$re_endcf/p"
+
+  # Validate tagname.
+  case $tagname in
+    *[!-_A-Za-z0-9,/]*)
+      func_fatal_error "invalid tag name: $tagname"
+      ;;
+  esac
+
+  # Don't test for the "default" C tag, as we know it's
+  # there but not specially marked.
+  case $tagname in
+    CC) ;;
+    *)
+      if $GREP "$re_begincf" "$progpath" >/dev/null 2>&1; then
+	taglist="$taglist $tagname"
+
+	# Evaluate the configuration.  Be careful to quote the path
+	# and the sed script, to avoid splitting on whitespace, but
+	# also don't use non-portable quotes within backquotes within
+	# quotes we have to do it in 2 steps:
+	extractedcf=`$SED -n -e "$sed_extractcf" < "$progpath"`
+	eval "$extractedcf"
+      else
+	func_error "ignoring unknown tag $tagname"
+      fi
+      ;;
+  esac
+}
+
+# Parse options once, thoroughly.  This comes as soon as possible in
+# the script to make things like `libtool --version' happen quickly.
+{
+
+  # Shorthand for --mode=foo, only valid as the first argument
+  case $1 in
+  clean|clea|cle|cl)
+    shift; set dummy --mode clean ${1+"$@"}; shift
+    ;;
+  compile|compil|compi|comp|com|co|c)
+    shift; set dummy --mode compile ${1+"$@"}; shift
+    ;;
+  execute|execut|execu|exec|exe|ex|e)
+    shift; set dummy --mode execute ${1+"$@"}; shift
+    ;;
+  finish|finis|fini|fin|fi|f)
+    shift; set dummy --mode finish ${1+"$@"}; shift
+    ;;
+  install|instal|insta|inst|ins|in|i)
+    shift; set dummy --mode install ${1+"$@"}; shift
+    ;;
+  link|lin|li|l)
+    shift; set dummy --mode link ${1+"$@"}; shift
+    ;;
+  uninstall|uninstal|uninsta|uninst|unins|unin|uni|un|u)
+    shift; set dummy --mode uninstall ${1+"$@"}; shift
+    ;;
+  esac
+
+  # Parse non-mode specific arguments:
+  while test "$#" -gt 0; do
+    opt="$1"
+    shift
+
+    case $opt in
+      --config)		func_config					;;
+
+      --debug)		preserve_args="$preserve_args $opt"
+			func_echo "enabling shell trace mode"
+			opt_debug='set -x'
+			$opt_debug
+			;;
+
+      -dlopen)		test "$#" -eq 0 && func_missing_arg "$opt" && break
+			execute_dlfiles="$execute_dlfiles $1"
+			shift
+			;;
+
+      --dry-run | -n)	opt_dry_run=:					;;
+      --features)       func_features					;;
+      --finish)		mode="finish"					;;
+
+      --mode)		test "$#" -eq 0 && func_missing_arg "$opt" && break
+			case $1 in
+			  # Valid mode arguments:
+			  clean)	;;
+			  compile)	;;
+			  execute)	;;
+			  finish)	;;
+			  install)	;;
+			  link)		;;
+			  relink)	;;
+			  uninstall)	;;
+
+			  # Catch anything else as an error
+			  *) func_error "invalid argument for $opt"
+			     exit_cmd=exit
+			     break
+			     ;;
+		        esac
+
+			mode="$1"
+			shift
+			;;
+
+      --preserve-dup-deps)
+			opt_duplicate_deps=:				;;
+
+      --quiet|--silent)	preserve_args="$preserve_args $opt"
+			opt_silent=:
+			;;
+
+      --verbose| -v)	preserve_args="$preserve_args $opt"
+			opt_silent=false
+			;;
+
+      --tag)		test "$#" -eq 0 && func_missing_arg "$opt" && break
+			preserve_args="$preserve_args $opt $1"
+			func_enable_tag "$1"	# tagname is set here
+			shift
+			;;
+
+      # Separate optargs to long options:
+      -dlopen=*|--mode=*|--tag=*)
+			func_opt_split "$opt"
+			set dummy "$func_opt_split_opt" "$func_opt_split_arg" ${1+"$@"}
+			shift
+			;;
+
+      -\?|-h)		func_usage					;;
+      --help)		opt_help=:					;;
+      --version)	func_version					;;
+
+      -*)		func_fatal_help "unrecognized option \`$opt'"	;;
+
+      *)		nonopt="$opt"
+			break
+			;;
+    esac
+  done
+
+
+  case $host in
+    *cygwin* | *mingw* | *pw32* | *cegcc*)
+      # don't eliminate duplications in $postdeps and $predeps
+      opt_duplicate_compiler_generated_deps=:
+      ;;
+    *)
+      opt_duplicate_compiler_generated_deps=$opt_duplicate_deps
+      ;;
+  esac
+
+  # Having warned about all mis-specified options, bail out if
+  # anything was wrong.
+  $exit_cmd $EXIT_FAILURE
+}
+
+# func_check_version_match
+# Ensure that we are using m4 macros, and libtool script from the same
+# release of libtool.
+func_check_version_match ()
+{
+  if test "$package_revision" != "$macro_revision"; then
+    if test "$VERSION" != "$macro_version"; then
+      if test -z "$macro_version"; then
+        cat >&2 <<_LT_EOF
+$progname: Version mismatch error.  This is $PACKAGE $VERSION, but the
+$progname: definition of this LT_INIT comes from an older release.
+$progname: You should recreate aclocal.m4 with macros from $PACKAGE $VERSION
+$progname: and run autoconf again.
+_LT_EOF
+      else
+        cat >&2 <<_LT_EOF
+$progname: Version mismatch error.  This is $PACKAGE $VERSION, but the
+$progname: definition of this LT_INIT comes from $PACKAGE $macro_version.
+$progname: You should recreate aclocal.m4 with macros from $PACKAGE $VERSION
+$progname: and run autoconf again.
+_LT_EOF
+      fi
+    else
+      cat >&2 <<_LT_EOF
+$progname: Version mismatch error.  This is $PACKAGE $VERSION, revision $package_revision,
+$progname: but the definition of this LT_INIT comes from revision $macro_revision.
+$progname: You should recreate aclocal.m4 with macros from revision $package_revision
+$progname: of $PACKAGE $VERSION and run autoconf again.
+_LT_EOF
+    fi
+
+    exit $EXIT_MISMATCH
+  fi
+}
+
+
+## ----------- ##
+##    Main.    ##
+## ----------- ##
+
+$opt_help || {
+  # Sanity checks first:
+  func_check_version_match
+
+  if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then
+    func_fatal_configuration "not configured to build any kind of library"
+  fi
+
+  test -z "$mode" && func_fatal_error "error: you must specify a MODE."
+
+
+  # Darwin sucks
+  eval std_shrext=\"$shrext_cmds\"
+
+
+  # Only execute mode is allowed to have -dlopen flags.
+  if test -n "$execute_dlfiles" && test "$mode" != execute; then
+    func_error "unrecognized option \`-dlopen'"
+    $ECHO "$help" 1>&2
+    exit $EXIT_FAILURE
+  fi
+
+  # Change the help message to a mode-specific one.
+  generic_help="$help"
+  help="Try \`$progname --help --mode=$mode' for more information."
+}
+
+
+# func_lalib_p file
+# True iff FILE is a libtool `.la' library or `.lo' object file.
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_lalib_p ()
+{
+    test -f "$1" &&
+      $SED -e 4q "$1" 2>/dev/null \
+        | $GREP "^# Generated by .*$PACKAGE" > /dev/null 2>&1
+}
+
+# func_lalib_unsafe_p file
+# True iff FILE is a libtool `.la' library or `.lo' object file.
+# This function implements the same check as func_lalib_p without
+# resorting to external programs.  To this end, it redirects stdin and
+# closes it afterwards, without saving the original file descriptor.
+# As a safety measure, use it only where a negative result would be
+# fatal anyway.  Works if `file' does not exist.
+func_lalib_unsafe_p ()
+{
+    lalib_p=no
+    if test -f "$1" && test -r "$1" && exec 5<&0 <"$1"; then
+	for lalib_p_l in 1 2 3 4
+	do
+	    read lalib_p_line
+	    case "$lalib_p_line" in
+		\#\ Generated\ by\ *$PACKAGE* ) lalib_p=yes; break;;
+	    esac
+	done
+	exec 0<&5 5<&-
+    fi
+    test "$lalib_p" = yes
+}
+
+# func_ltwrapper_script_p file
+# True iff FILE is a libtool wrapper script
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_script_p ()
+{
+    func_lalib_p "$1"
+}
+
+# func_ltwrapper_executable_p file
+# True iff FILE is a libtool wrapper executable
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_executable_p ()
+{
+    func_ltwrapper_exec_suffix=
+    case $1 in
+    *.exe) ;;
+    *) func_ltwrapper_exec_suffix=.exe ;;
+    esac
+    $GREP "$magic_exe" "$1$func_ltwrapper_exec_suffix" >/dev/null 2>&1
+}
+
+# func_ltwrapper_scriptname file
+# Assumes file is an ltwrapper_executable
+# uses $file to determine the appropriate filename for a
+# temporary ltwrapper_script.
+func_ltwrapper_scriptname ()
+{
+    func_ltwrapper_scriptname_result=""
+    if func_ltwrapper_executable_p "$1"; then
+	func_dirname_and_basename "$1" "" "."
+	func_stripname '' '.exe' "$func_basename_result"
+	func_ltwrapper_scriptname_result="$func_dirname_result/$objdir/${func_stripname_result}_ltshwrapper"
+    fi
+}
+
+# func_ltwrapper_p file
+# True iff FILE is a libtool wrapper script or wrapper executable
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_p ()
+{
+    func_ltwrapper_script_p "$1" || func_ltwrapper_executable_p "$1"
+}
+
+
+# func_execute_cmds commands fail_cmd
+# Execute tilde-delimited COMMANDS.
+# If FAIL_CMD is given, eval that upon failure.
+# FAIL_CMD may read-access the current command in variable CMD!
+func_execute_cmds ()
+{
+    $opt_debug
+    save_ifs=$IFS; IFS='~'
+    for cmd in $1; do
+      IFS=$save_ifs
+      eval cmd=\"$cmd\"
+      func_show_eval "$cmd" "${2-:}"
+    done
+    IFS=$save_ifs
+}
+
+
+# func_source file
+# Source FILE, adding directory component if necessary.
+# Note that it is not necessary on cygwin/mingw to append a dot to
+# FILE even if both FILE and FILE.exe exist: automatic-append-.exe
+# behavior happens only for exec(3), not for open(2)!  Also, sourcing
+# `FILE.' does not work on cygwin managed mounts.
+func_source ()
+{
+    $opt_debug
+    case $1 in
+    */* | *\\*)	. "$1" ;;
+    *)		. "./$1" ;;
+    esac
+}
+
+
+# func_infer_tag arg
+# Infer tagged configuration to use if any are available and
+# if one wasn't chosen via the "--tag" command line option.
+# Only attempt this if the compiler in the base compile
+# command doesn't match the default compiler.
+# arg is usually of the form 'gcc ...'
+func_infer_tag ()
+{
+    $opt_debug
+    if test -n "$available_tags" && test -z "$tagname"; then
+      CC_quoted=
+      for arg in $CC; do
+        func_quote_for_eval "$arg"
+	CC_quoted="$CC_quoted $func_quote_for_eval_result"
+      done
+      case $@ in
+      # Blanks in the command may have been stripped by the calling shell,
+      # but not from the CC environment variable when configure was run.
+      " $CC "* | "$CC "* | " `$ECHO $CC` "* | "`$ECHO $CC` "* | " $CC_quoted"* | "$CC_quoted "* | " `$ECHO $CC_quoted` "* | "`$ECHO $CC_quoted` "*) ;;
+      # Blanks at the start of $base_compile will cause this to fail
+      # if we don't check for them as well.
+      *)
+	for z in $available_tags; do
+	  if $GREP "^# ### BEGIN LIBTOOL TAG CONFIG: $z$" < "$progpath" > /dev/null; then
+	    # Evaluate the configuration.
+	    eval "`${SED} -n -e '/^# ### BEGIN LIBTOOL TAG CONFIG: '$z'$/,/^# ### END LIBTOOL TAG CONFIG: '$z'$/p' < $progpath`"
+	    CC_quoted=
+	    for arg in $CC; do
+	      # Double-quote args containing other shell metacharacters.
+	      func_quote_for_eval "$arg"
+	      CC_quoted="$CC_quoted $func_quote_for_eval_result"
+	    done
+	    case "$@ " in
+	      " $CC "* | "$CC "* | " `$ECHO $CC` "* | "`$ECHO $CC` "* | " $CC_quoted"* | "$CC_quoted "* | " `$ECHO $CC_quoted` "* | "`$ECHO $CC_quoted` "*)
+	      # The compiler in the base compile command matches
+	      # the one in the tagged configuration.
+	      # Assume this is the tagged configuration we want.
+	      tagname=$z
+	      break
+	      ;;
+	    esac
+	  fi
+	done
+	# If $tagname still isn't set, then no tagged configuration
+	# was found and let the user know that the "--tag" command
+	# line option must be used.
+	if test -z "$tagname"; then
+	  func_echo "unable to infer tagged configuration"
+	  func_fatal_error "specify a tag with \`--tag'"
+#	else
+#	  func_verbose "using $tagname tagged configuration"
+	fi
+	;;
+      esac
+    fi
+}
+
+
+
+# func_write_libtool_object output_name pic_name nonpic_name
+# Create a libtool object file (analogous to a ".la" file),
+# but don't create it if we're doing a dry run.
+func_write_libtool_object ()
+{
+    write_libobj=${1}
+    if test "$build_libtool_libs" = yes; then
+      write_lobj=\'${2}\'
+    else
+      write_lobj=none
+    fi
+
+    if test "$build_old_libs" = yes; then
+      write_oldobj=\'${3}\'
+    else
+      write_oldobj=none
+    fi
+
+    $opt_dry_run || {
+      cat >${write_libobj}T <<EOF
+# $write_libobj - a libtool object file
+# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION
+#
+# Please DO NOT delete this file!
+# It is necessary for linking the library.
+
+# Name of the PIC object.
+pic_object=$write_lobj
+
+# Name of the non-PIC object
+non_pic_object=$write_oldobj
+
+EOF
+      $MV "${write_libobj}T" "${write_libobj}"
+    }
+}
+
+# func_mode_compile arg...
+func_mode_compile ()
+{
+    $opt_debug
+    # Get the compilation command and the source file.
+    base_compile=
+    srcfile="$nonopt"  #  always keep a non-empty value in "srcfile"
+    suppress_opt=yes
+    suppress_output=
+    arg_mode=normal
+    libobj=
+    later=
+    pie_flag=
+
+    for arg
+    do
+      case $arg_mode in
+      arg  )
+	# do not "continue".  Instead, add this to base_compile
+	lastarg="$arg"
+	arg_mode=normal
+	;;
+
+      target )
+	libobj="$arg"
+	arg_mode=normal
+	continue
+	;;
+
+      normal )
+	# Accept any command-line options.
+	case $arg in
+	-o)
+	  test -n "$libobj" && \
+	    func_fatal_error "you cannot specify \`-o' more than once"
+	  arg_mode=target
+	  continue
+	  ;;
+
+	-pie | -fpie | -fPIE)
+          pie_flag="$pie_flag $arg"
+	  continue
+	  ;;
+
+	-shared | -static | -prefer-pic | -prefer-non-pic)
+	  later="$later $arg"
+	  continue
+	  ;;
+
+	-no-suppress)
+	  suppress_opt=no
+	  continue
+	  ;;
+
+	-Xcompiler)
+	  arg_mode=arg  #  the next one goes into the "base_compile" arg list
+	  continue      #  The current "srcfile" will either be retained or
+	  ;;            #  replaced later.  I would guess that would be a bug.
+
+	-Wc,*)
+	  func_stripname '-Wc,' '' "$arg"
+	  args=$func_stripname_result
+	  lastarg=
+	  save_ifs="$IFS"; IFS=','
+	  for arg in $args; do
+	    IFS="$save_ifs"
+	    func_quote_for_eval "$arg"
+	    lastarg="$lastarg $func_quote_for_eval_result"
+	  done
+	  IFS="$save_ifs"
+	  func_stripname ' ' '' "$lastarg"
+	  lastarg=$func_stripname_result
+
+	  # Add the arguments to base_compile.
+	  base_compile="$base_compile $lastarg"
+	  continue
+	  ;;
+
+	*)
+	  # Accept the current argument as the source file.
+	  # The previous "srcfile" becomes the current argument.
+	  #
+	  lastarg="$srcfile"
+	  srcfile="$arg"
+	  ;;
+	esac  #  case $arg
+	;;
+      esac    #  case $arg_mode
+
+      # Aesthetically quote the previous argument.
+      func_quote_for_eval "$lastarg"
+      base_compile="$base_compile $func_quote_for_eval_result"
+    done # for arg
+
+    case $arg_mode in
+    arg)
+      func_fatal_error "you must specify an argument for -Xcompile"
+      ;;
+    target)
+      func_fatal_error "you must specify a target with \`-o'"
+      ;;
+    *)
+      # Get the name of the library object.
+      test -z "$libobj" && {
+	func_basename "$srcfile"
+	libobj="$func_basename_result"
+      }
+      ;;
+    esac
+
+    # Recognize several different file suffixes.
+    # If the user specifies -o file.o, it is replaced with file.lo
+    case $libobj in
+    *.[cCFSifmso] | \
+    *.ada | *.adb | *.ads | *.asm | \
+    *.c++ | *.cc | *.ii | *.class | *.cpp | *.cxx | \
+    *.[fF][09]? | *.for | *.java | *.obj | *.sx)
+      func_xform "$libobj"
+      libobj=$func_xform_result
+      ;;
+    esac
+
+    case $libobj in
+    *.lo) func_lo2o "$libobj"; obj=$func_lo2o_result ;;
+    *)
+      func_fatal_error "cannot determine name of library object from \`$libobj'"
+      ;;
+    esac
+
+    func_infer_tag $base_compile
+
+    for arg in $later; do
+      case $arg in
+      -shared)
+	test "$build_libtool_libs" != yes && \
+	  func_fatal_configuration "can not build a shared library"
+	build_old_libs=no
+	continue
+	;;
+
+      -static)
+	build_libtool_libs=no
+	build_old_libs=yes
+	continue
+	;;
+
+      -prefer-pic)
+	pic_mode=yes
+	continue
+	;;
+
+      -prefer-non-pic)
+	pic_mode=no
+	continue
+	;;
+      esac
+    done
+
+    func_quote_for_eval "$libobj"
+    test "X$libobj" != "X$func_quote_for_eval_result" \
+      && $ECHO "X$libobj" | $GREP '[]~#^*{};<>?"'"'"'	 &()|`$[]' \
+      && func_warning "libobj name \`$libobj' may not contain shell special characters."
+    func_dirname_and_basename "$obj" "/" ""
+    objname="$func_basename_result"
+    xdir="$func_dirname_result"
+    lobj=${xdir}$objdir/$objname
+
+    test -z "$base_compile" && \
+      func_fatal_help "you must specify a compilation command"
+
+    # Delete any leftover library objects.
+    if test "$build_old_libs" = yes; then
+      removelist="$obj $lobj $libobj ${libobj}T"
+    else
+      removelist="$lobj $libobj ${libobj}T"
+    fi
+
+    # On Cygwin there's no "real" PIC flag so we must build both object types
+    case $host_os in
+    cygwin* | mingw* | pw32* | os2* | cegcc*)
+      pic_mode=default
+      ;;
+    esac
+    if test "$pic_mode" = no && test "$deplibs_check_method" != pass_all; then
+      # non-PIC code in shared libraries is not supported
+      pic_mode=default
+    fi
+
+    # Calculate the filename of the output object if compiler does
+    # not support -o with -c
+    if test "$compiler_c_o" = no; then
+      output_obj=`$ECHO "X$srcfile" | $Xsed -e 's%^.*/%%' -e 's%\.[^.]*$%%'`.${objext}
+      lockfile="$output_obj.lock"
+    else
+      output_obj=
+      need_locks=no
+      lockfile=
+    fi
+
+    # Lock this critical section if it is needed
+    # We use this script file to make the link, it avoids creating a new file
+    if test "$need_locks" = yes; then
+      until $opt_dry_run || ln "$progpath" "$lockfile" 2>/dev/null; do
+	func_echo "Waiting for $lockfile to be removed"
+	sleep 2
+      done
+    elif test "$need_locks" = warn; then
+      if test -f "$lockfile"; then
+	$ECHO "\
+*** ERROR, $lockfile exists and contains:
+`cat $lockfile 2>/dev/null`
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together.  If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+	$opt_dry_run || $RM $removelist
+	exit $EXIT_FAILURE
+      fi
+      removelist="$removelist $output_obj"
+      $ECHO "$srcfile" > "$lockfile"
+    fi
+
+    $opt_dry_run || $RM $removelist
+    removelist="$removelist $lockfile"
+    trap '$opt_dry_run || $RM $removelist; exit $EXIT_FAILURE' 1 2 15
+
+    if test -n "$fix_srcfile_path"; then
+      eval srcfile=\"$fix_srcfile_path\"
+    fi
+    func_quote_for_eval "$srcfile"
+    qsrcfile=$func_quote_for_eval_result
+
+    # Only build a PIC object if we are building libtool libraries.
+    if test "$build_libtool_libs" = yes; then
+      # Without this assignment, base_compile gets emptied.
+      fbsd_hideous_sh_bug=$base_compile
+
+      if test "$pic_mode" != no; then
+	command="$base_compile $qsrcfile $pic_flag"
+      else
+	# Don't build PIC code
+	command="$base_compile $qsrcfile"
+      fi
+
+      func_mkdir_p "$xdir$objdir"
+
+      if test -z "$output_obj"; then
+	# Place PIC objects in $objdir
+	command="$command -o $lobj"
+      fi
+
+      func_show_eval_locale "$command"	\
+          'test -n "$output_obj" && $RM $removelist; exit $EXIT_FAILURE'
+
+      if test "$need_locks" = warn &&
+	 test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then
+	$ECHO "\
+*** ERROR, $lockfile contains:
+`cat $lockfile 2>/dev/null`
+
+but it should contain:
+$srcfile
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together.  If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+	$opt_dry_run || $RM $removelist
+	exit $EXIT_FAILURE
+      fi
+
+      # Just move the object if needed, then go on to compile the next one
+      if test -n "$output_obj" && test "X$output_obj" != "X$lobj"; then
+	func_show_eval '$MV "$output_obj" "$lobj"' \
+	  'error=$?; $opt_dry_run || $RM $removelist; exit $error'
+      fi
+
+      # Allow error messages only from the first compilation.
+      if test "$suppress_opt" = yes; then
+	suppress_output=' >/dev/null 2>&1'
+      fi
+    fi
+
+    # Only build a position-dependent object if we build old libraries.
+    if test "$build_old_libs" = yes; then
+      if test "$pic_mode" != yes; then
+	# Don't build PIC code
+	command="$base_compile $qsrcfile$pie_flag"
+      else
+	command="$base_compile $qsrcfile $pic_flag"
+      fi
+      if test "$compiler_c_o" = yes; then
+	command="$command -o $obj"
+      fi
+
+      # Suppress compiler output if we already did a PIC compilation.
+      command="$command$suppress_output"
+      func_show_eval_locale "$command" \
+        '$opt_dry_run || $RM $removelist; exit $EXIT_FAILURE'
+
+      if test "$need_locks" = warn &&
+	 test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then
+	$ECHO "\
+*** ERROR, $lockfile contains:
+`cat $lockfile 2>/dev/null`
+
+but it should contain:
+$srcfile
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together.  If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+	$opt_dry_run || $RM $removelist
+	exit $EXIT_FAILURE
+      fi
+
+      # Just move the object if needed
+      if test -n "$output_obj" && test "X$output_obj" != "X$obj"; then
+	func_show_eval '$MV "$output_obj" "$obj"' \
+	  'error=$?; $opt_dry_run || $RM $removelist; exit $error'
+      fi
+    fi
+
+    $opt_dry_run || {
+      func_write_libtool_object "$libobj" "$objdir/$objname" "$objname"
+
+      # Unlock the critical section if it was locked
+      if test "$need_locks" != no; then
+	removelist=$lockfile
+        $RM "$lockfile"
+      fi
+    }
+
+    exit $EXIT_SUCCESS
+}
+
+$opt_help || {
+test "$mode" = compile && func_mode_compile ${1+"$@"}
+}
+
+func_mode_help ()
+{
+    # We need to display help for each of the modes.
+    case $mode in
+      "")
+        # Generic help is extracted from the usage comments
+        # at the start of this file.
+        func_help
+        ;;
+
+      clean)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=clean RM [RM-OPTION]... FILE...
+
+Remove files from the build directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm').  RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, object or program, all the files associated
+with it are deleted. Otherwise, only FILE itself is deleted using RM."
+        ;;
+
+      compile)
+      $ECHO \
+"Usage: $progname [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE
+
+Compile a source file into a libtool library object.
+
+This mode accepts the following additional options:
+
+  -o OUTPUT-FILE    set the output file name to OUTPUT-FILE
+  -no-suppress      do not suppress compiler output for multiple passes
+  -prefer-pic       try to building PIC objects only
+  -prefer-non-pic   try to building non-PIC objects only
+  -shared           do not build a \`.o' file suitable for static linking
+  -static           only build a \`.o' file suitable for static linking
+
+COMPILE-COMMAND is a command to be used in creating a \`standard' object file
+from the given SOURCEFILE.
+
+The output file name is determined by removing the directory component from
+SOURCEFILE, then substituting the C source code suffix \`.c' with the
+library object suffix, \`.lo'."
+        ;;
+
+      execute)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=execute COMMAND [ARGS]...
+
+Automatically set library path, then run a program.
+
+This mode accepts the following additional options:
+
+  -dlopen FILE      add the directory containing FILE to the library path
+
+This mode sets the library path environment variable according to \`-dlopen'
+flags.
+
+If any of the ARGS are libtool executable wrappers, then they are translated
+into their corresponding uninstalled binary, and any of their required library
+directories are added to the library path.
+
+Then, COMMAND is executed, with ARGS as arguments."
+        ;;
+
+      finish)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=finish [LIBDIR]...
+
+Complete the installation of libtool libraries.
+
+Each LIBDIR is a directory that contains libtool libraries.
+
+The commands that this mode executes may require superuser privileges.  Use
+the \`--dry-run' option if you just want to see what would be executed."
+        ;;
+
+      install)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=install INSTALL-COMMAND...
+
+Install executables or libraries.
+
+INSTALL-COMMAND is the installation command.  The first component should be
+either the \`install' or \`cp' program.
+
+The following components of INSTALL-COMMAND are treated specially:
+
+  -inst-prefix PREFIX-DIR  Use PREFIX-DIR as a staging area for installation
+
+The rest of the components are interpreted as arguments to that command (only
+BSD-compatible install options are recognized)."
+        ;;
+
+      link)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=link LINK-COMMAND...
+
+Link object files or libraries together to form another library, or to
+create an executable program.
+
+LINK-COMMAND is a command using the C compiler that you would use to create
+a program from several object files.
+
+The following components of LINK-COMMAND are treated specially:
+
+  -all-static       do not do any dynamic linking at all
+  -avoid-version    do not add a version suffix if possible
+  -dlopen FILE      \`-dlpreopen' FILE if it cannot be dlopened at runtime
+  -dlpreopen FILE   link in FILE and add its symbols to lt_preloaded_symbols
+  -export-dynamic   allow symbols from OUTPUT-FILE to be resolved with dlsym(3)
+  -export-symbols SYMFILE
+                    try to export only the symbols listed in SYMFILE
+  -export-symbols-regex REGEX
+                    try to export only the symbols matching REGEX
+  -LLIBDIR          search LIBDIR for required installed libraries
+  -lNAME            OUTPUT-FILE requires the installed library libNAME
+  -module           build a library that can dlopened
+  -no-fast-install  disable the fast-install mode
+  -no-install       link a not-installable executable
+  -no-undefined     declare that a library does not refer to external symbols
+  -o OUTPUT-FILE    create OUTPUT-FILE from the specified objects
+  -objectlist FILE  Use a list of object files found in FILE to specify objects
+  -precious-files-regex REGEX
+                    don't remove output files matching REGEX
+  -release RELEASE  specify package release information
+  -rpath LIBDIR     the created library will eventually be installed in LIBDIR
+  -R[ ]LIBDIR       add LIBDIR to the runtime path of programs and libraries
+  -shared           only do dynamic linking of libtool libraries
+  -shrext SUFFIX    override the standard shared library file extension
+  -static           do not do any dynamic linking of uninstalled libtool libraries
+  -static-libtool-libs
+                    do not do any dynamic linking of libtool libraries
+  -version-info CURRENT[:REVISION[:AGE]]
+                    specify library version info [each variable defaults to 0]
+  -weak LIBNAME     declare that the target provides the LIBNAME interface
+
+All other options (arguments beginning with \`-') are ignored.
+
+Every other argument is treated as a filename.  Files ending in \`.la' are
+treated as uninstalled libtool libraries, other files are standard or library
+object files.
+
+If the OUTPUT-FILE ends in \`.la', then a libtool library is created,
+only library objects (\`.lo' files) may be specified, and \`-rpath' is
+required, except when creating a convenience library.
+
+If OUTPUT-FILE ends in \`.a' or \`.lib', then a standard library is created
+using \`ar' and \`ranlib', or on Windows using \`lib'.
+
+If OUTPUT-FILE ends in \`.lo' or \`.${objext}', then a reloadable object file
+is created, otherwise an executable program is created."
+        ;;
+
+      uninstall)
+        $ECHO \
+"Usage: $progname [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE...
+
+Remove libraries from an installation directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm').  RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, all the files associated with it are deleted.
+Otherwise, only FILE itself is deleted using RM."
+        ;;
+
+      *)
+        func_fatal_help "invalid operation mode \`$mode'"
+        ;;
+    esac
+
+    $ECHO
+    $ECHO "Try \`$progname --help' for more information about other modes."
+
+    exit $?
+}
+
+  # Now that we've collected a possible --mode arg, show help if necessary
+  $opt_help && func_mode_help
+
+
+# func_mode_execute arg...
+func_mode_execute ()
+{
+    $opt_debug
+    # The first argument is the command name.
+    cmd="$nonopt"
+    test -z "$cmd" && \
+      func_fatal_help "you must specify a COMMAND"
+
+    # Handle -dlopen flags immediately.
+    for file in $execute_dlfiles; do
+      test -f "$file" \
+	|| func_fatal_help "\`$file' is not a file"
+
+      dir=
+      case $file in
+      *.la)
+	# Check to see that this really is a libtool archive.
+	func_lalib_unsafe_p "$file" \
+	  || func_fatal_help "\`$lib' is not a valid libtool archive"
+
+	# Read the libtool library.
+	dlname=
+	library_names=
+	func_source "$file"
+
+	# Skip this library if it cannot be dlopened.
+	if test -z "$dlname"; then
+	  # Warn if it was a shared library.
+	  test -n "$library_names" && \
+	    func_warning "\`$file' was not linked with \`-export-dynamic'"
+	  continue
+	fi
+
+	func_dirname "$file" "" "."
+	dir="$func_dirname_result"
+
+	if test -f "$dir/$objdir/$dlname"; then
+	  dir="$dir/$objdir"
+	else
+	  if test ! -f "$dir/$dlname"; then
+	    func_fatal_error "cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'"
+	  fi
+	fi
+	;;
+
+      *.lo)
+	# Just add the directory containing the .lo file.
+	func_dirname "$file" "" "."
+	dir="$func_dirname_result"
+	;;
+
+      *)
+	func_warning "\`-dlopen' is ignored for non-libtool libraries and objects"
+	continue
+	;;
+      esac
+
+      # Get the absolute pathname.
+      absdir=`cd "$dir" && pwd`
+      test -n "$absdir" && dir="$absdir"
+
+      # Now add the directory to shlibpath_var.
+      if eval "test -z \"\$$shlibpath_var\""; then
+	eval "$shlibpath_var=\"\$dir\""
+      else
+	eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\""
+      fi
+    done
+
+    # This variable tells wrapper scripts just to set shlibpath_var
+    # rather than running their programs.
+    libtool_execute_magic="$magic"
+
+    # Check if any of the arguments is a wrapper script.
+    args=
+    for file
+    do
+      case $file in
+      -*) ;;
+      *)
+	# Do a test to see if this is really a libtool program.
+	if func_ltwrapper_script_p "$file"; then
+	  func_source "$file"
+	  # Transform arg to wrapped name.
+	  file="$progdir/$program"
+	elif func_ltwrapper_executable_p "$file"; then
+	  func_ltwrapper_scriptname "$file"
+	  func_source "$func_ltwrapper_scriptname_result"
+	  # Transform arg to wrapped name.
+	  file="$progdir/$program"
+	fi
+	;;
+      esac
+      # Quote arguments (to preserve shell metacharacters).
+      func_quote_for_eval "$file"
+      args="$args $func_quote_for_eval_result"
+    done
+
+    if test "X$opt_dry_run" = Xfalse; then
+      if test -n "$shlibpath_var"; then
+	# Export the shlibpath_var.
+	eval "export $shlibpath_var"
+      fi
+
+      # Restore saved environment variables
+      for lt_var in LANG LANGUAGE LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES
+      do
+	eval "if test \"\${save_$lt_var+set}\" = set; then
+                $lt_var=\$save_$lt_var; export $lt_var
+	      else
+		$lt_unset $lt_var
+	      fi"
+      done
+
+      # Now prepare to actually exec the command.
+      exec_cmd="\$cmd$args"
+    else
+      # Display what would be done.
+      if test -n "$shlibpath_var"; then
+	eval "\$ECHO \"\$shlibpath_var=\$$shlibpath_var\""
+	$ECHO "export $shlibpath_var"
+      fi
+      $ECHO "$cmd$args"
+      exit $EXIT_SUCCESS
+    fi
+}
+
+test "$mode" = execute && func_mode_execute ${1+"$@"}
+
+
+# func_mode_finish arg...
+func_mode_finish ()
+{
+    $opt_debug
+    libdirs="$nonopt"
+    admincmds=
+
+    if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then
+      for dir
+      do
+	libdirs="$libdirs $dir"
+      done
+
+      for libdir in $libdirs; do
+	if test -n "$finish_cmds"; then
+	  # Do each command in the finish commands.
+	  func_execute_cmds "$finish_cmds" 'admincmds="$admincmds
+'"$cmd"'"'
+	fi
+	if test -n "$finish_eval"; then
+	  # Do the single finish_eval.
+	  eval cmds=\"$finish_eval\"
+	  $opt_dry_run || eval "$cmds" || admincmds="$admincmds
+       $cmds"
+	fi
+      done
+    fi
+
+    # Exit here if they wanted silent mode.
+    $opt_silent && exit $EXIT_SUCCESS
+
+    $ECHO "X----------------------------------------------------------------------" | $Xsed
+    $ECHO "Libraries have been installed in:"
+    for libdir in $libdirs; do
+      $ECHO "   $libdir"
+    done
+    $ECHO
+    $ECHO "If you ever happen to want to link against installed libraries"
+    $ECHO "in a given directory, LIBDIR, you must either use libtool, and"
+    $ECHO "specify the full pathname of the library, or use the \`-LLIBDIR'"
+    $ECHO "flag during linking and do at least one of the following:"
+    if test -n "$shlibpath_var"; then
+      $ECHO "   - add LIBDIR to the \`$shlibpath_var' environment variable"
+      $ECHO "     during execution"
+    fi
+    if test -n "$runpath_var"; then
+      $ECHO "   - add LIBDIR to the \`$runpath_var' environment variable"
+      $ECHO "     during linking"
+    fi
+    if test -n "$hardcode_libdir_flag_spec"; then
+      libdir=LIBDIR
+      eval flag=\"$hardcode_libdir_flag_spec\"
+
+      $ECHO "   - use the \`$flag' linker flag"
+    fi
+    if test -n "$admincmds"; then
+      $ECHO "   - have your system administrator run these commands:$admincmds"
+    fi
+    if test -f /etc/ld.so.conf; then
+      $ECHO "   - have your system administrator add LIBDIR to \`/etc/ld.so.conf'"
+    fi
+    $ECHO
+
+    $ECHO "See any operating system documentation about shared libraries for"
+    case $host in
+      solaris2.[6789]|solaris2.1[0-9])
+        $ECHO "more information, such as the ld(1), crle(1) and ld.so(8) manual"
+	$ECHO "pages."
+	;;
+      *)
+        $ECHO "more information, such as the ld(1) and ld.so(8) manual pages."
+        ;;
+    esac
+    $ECHO "X----------------------------------------------------------------------" | $Xsed
+    exit $EXIT_SUCCESS
+}
+
+test "$mode" = finish && func_mode_finish ${1+"$@"}
+
+
+# func_mode_install arg...
+func_mode_install ()
+{
+    $opt_debug
+    # There may be an optional sh(1) argument at the beginning of
+    # install_prog (especially on Windows NT).
+    if test "$nonopt" = "$SHELL" || test "$nonopt" = /bin/sh ||
+       # Allow the use of GNU shtool's install command.
+       $ECHO "X$nonopt" | $GREP shtool >/dev/null; then
+      # Aesthetically quote it.
+      func_quote_for_eval "$nonopt"
+      install_prog="$func_quote_for_eval_result "
+      arg=$1
+      shift
+    else
+      install_prog=
+      arg=$nonopt
+    fi
+
+    # The real first argument should be the name of the installation program.
+    # Aesthetically quote it.
+    func_quote_for_eval "$arg"
+    install_prog="$install_prog$func_quote_for_eval_result"
+
+    # We need to accept at least all the BSD install flags.
+    dest=
+    files=
+    opts=
+    prev=
+    install_type=
+    isdir=no
+    stripme=
+    for arg
+    do
+      if test -n "$dest"; then
+	files="$files $dest"
+	dest=$arg
+	continue
+      fi
+
+      case $arg in
+      -d) isdir=yes ;;
+      -f)
+	case " $install_prog " in
+	*[\\\ /]cp\ *) ;;
+	*) prev=$arg ;;
+	esac
+	;;
+      -g | -m | -o)
+	prev=$arg
+	;;
+      -s)
+	stripme=" -s"
+	continue
+	;;
+      -*)
+	;;
+      *)
+	# If the previous option needed an argument, then skip it.
+	if test -n "$prev"; then
+	  prev=
+	else
+	  dest=$arg
+	  continue
+	fi
+	;;
+      esac
+
+      # Aesthetically quote the argument.
+      func_quote_for_eval "$arg"
+      install_prog="$install_prog $func_quote_for_eval_result"
+    done
+
+    test -z "$install_prog" && \
+      func_fatal_help "you must specify an install program"
+
+    test -n "$prev" && \
+      func_fatal_help "the \`$prev' option requires an argument"
+
+    if test -z "$files"; then
+      if test -z "$dest"; then
+	func_fatal_help "no file or destination specified"
+      else
+	func_fatal_help "you must specify a destination"
+      fi
+    fi
+
+    # Strip any trailing slash from the destination.
+    func_stripname '' '/' "$dest"
+    dest=$func_stripname_result
+
+    # Check to see that the destination is a directory.
+    test -d "$dest" && isdir=yes
+    if test "$isdir" = yes; then
+      destdir="$dest"
+      destname=
+    else
+      func_dirname_and_basename "$dest" "" "."
+      destdir="$func_dirname_result"
+      destname="$func_basename_result"
+
+      # Not a directory, so check to see that there is only one file specified.
+      set dummy $files; shift
+      test "$#" -gt 1 && \
+	func_fatal_help "\`$dest' is not a directory"
+    fi
+    case $destdir in
+    [\\/]* | [A-Za-z]:[\\/]*) ;;
+    *)
+      for file in $files; do
+	case $file in
+	*.lo) ;;
+	*)
+	  func_fatal_help "\`$destdir' must be an absolute directory name"
+	  ;;
+	esac
+      done
+      ;;
+    esac
+
+    # This variable tells wrapper scripts just to set variables rather
+    # than running their programs.
+    libtool_install_magic="$magic"
+
+    staticlibs=
+    future_libdirs=
+    current_libdirs=
+    for file in $files; do
+
+      # Do each installation.
+      case $file in
+      *.$libext)
+	# Do the static libraries later.
+	staticlibs="$staticlibs $file"
+	;;
+
+      *.la)
+	# Check to see that this really is a libtool archive.
+	func_lalib_unsafe_p "$file" \
+	  || func_fatal_help "\`$file' is not a valid libtool archive"
+
+	library_names=
+	old_library=
+	relink_command=
+	func_source "$file"
+
+	# Add the libdir to current_libdirs if it is the destination.
+	if test "X$destdir" = "X$libdir"; then
+	  case "$current_libdirs " in
+	  *" $libdir "*) ;;
+	  *) current_libdirs="$current_libdirs $libdir" ;;
+	  esac
+	else
+	  # Note the libdir as a future libdir.
+	  case "$future_libdirs " in
+	  *" $libdir "*) ;;
+	  *) future_libdirs="$future_libdirs $libdir" ;;
+	  esac
+	fi
+
+	func_dirname "$file" "/" ""
+	dir="$func_dirname_result"
+	dir="$dir$objdir"
+
+	if test -n "$relink_command"; then
+	  # Determine the prefix the user has applied to our future dir.
+	  inst_prefix_dir=`$ECHO "X$destdir" | $Xsed -e "s%$libdir\$%%"`
+
+	  # Don't allow the user to place us outside of our expected
+	  # location b/c this prevents finding dependent libraries that
+	  # are installed to the same prefix.
+	  # At present, this check doesn't affect windows .dll's that
+	  # are installed into $libdir/../bin (currently, that works fine)
+	  # but it's something to keep an eye on.
+	  test "$inst_prefix_dir" = "$destdir" && \
+	    func_fatal_error "error: cannot install \`$file' to a directory not ending in $libdir"
+
+	  if test -n "$inst_prefix_dir"; then
+	    # Stick the inst_prefix_dir data into the link command.
+	    relink_command=`$ECHO "X$relink_command" | $Xsed -e "s%@inst_prefix_dir@%-inst-prefix-dir $inst_prefix_dir%"`
+	  else
+	    relink_command=`$ECHO "X$relink_command" | $Xsed -e "s%@inst_prefix_dir@%%"`
+	  fi
+
+	  func_warning "relinking \`$file'"
+	  func_show_eval "$relink_command" \
+	    'func_fatal_error "error: relink \`$file'\'' with the above command before installing it"'
+	fi
+
+	# See the names of the shared library.
+	set dummy $library_names; shift
+	if test -n "$1"; then
+	  realname="$1"
+	  shift
+
+	  srcname="$realname"
+	  test -n "$relink_command" && srcname="$realname"T
+
+	  # Install the shared library and build the symlinks.
+	  func_show_eval "$install_prog $dir/$srcname $destdir/$realname" \
+	      'exit $?'
+	  tstripme="$stripme"
+	  case $host_os in
+	  cygwin* | mingw* | pw32* | cegcc*)
+	    case $realname in
+	    *.dll.a)
+	      tstripme=""
+	      ;;
+	    esac
+	    ;;
+	  esac
+	  if test -n "$tstripme" && test -n "$striplib"; then
+	    func_show_eval "$striplib $destdir/$realname" 'exit $?'
+	  fi
+
+	  if test "$#" -gt 0; then
+	    # Delete the old symlinks, and create new ones.
+	    # Try `ln -sf' first, because the `ln' binary might depend on
+	    # the symlink we replace!  Solaris /bin/ln does not understand -f,
+	    # so we also need to try rm && ln -s.
+	    for linkname
+	    do
+	      test "$linkname" != "$realname" \
+		&& func_show_eval "(cd $destdir && { $LN_S -f $realname $linkname || { $RM $linkname && $LN_S $realname $linkname; }; })"
+	    done
+	  fi
+
+	  # Do each command in the postinstall commands.
+	  lib="$destdir/$realname"
+	  func_execute_cmds "$postinstall_cmds" 'exit $?'
+	fi
+
+	# Install the pseudo-library for information purposes.
+	func_basename "$file"
+	name="$func_basename_result"
+	instname="$dir/$name"i
+	func_show_eval "$install_prog $instname $destdir/$name" 'exit $?'
+
+	# Maybe install the static library, too.
+	test -n "$old_library" && staticlibs="$staticlibs $dir/$old_library"
+	;;
+
+      *.lo)
+	# Install (i.e. copy) a libtool object.
+
+	# Figure out destination file name, if it wasn't already specified.
+	if test -n "$destname"; then
+	  destfile="$destdir/$destname"
+	else
+	  func_basename "$file"
+	  destfile="$func_basename_result"
+	  destfile="$destdir/$destfile"
+	fi
+
+	# Deduce the name of the destination old-style object file.
+	case $destfile in
+	*.lo)
+	  func_lo2o "$destfile"
+	  staticdest=$func_lo2o_result
+	  ;;
+	*.$objext)
+	  staticdest="$destfile"
+	  destfile=
+	  ;;
+	*)
+	  func_fatal_help "cannot copy a libtool object to \`$destfile'"
+	  ;;
+	esac
+
+	# Install the libtool object if requested.
+	test -n "$destfile" && \
+	  func_show_eval "$install_prog $file $destfile" 'exit $?'
+
+	# Install the old object if enabled.
+	if test "$build_old_libs" = yes; then
+	  # Deduce the name of the old-style object file.
+	  func_lo2o "$file"
+	  staticobj=$func_lo2o_result
+	  func_show_eval "$install_prog \$staticobj \$staticdest" 'exit $?'
+	fi
+	exit $EXIT_SUCCESS
+	;;
+
+      *)
+	# Figure out destination file name, if it wasn't already specified.
+	if test -n "$destname"; then
+	  destfile="$destdir/$destname"
+	else
+	  func_basename "$file"
+	  destfile="$func_basename_result"
+	  destfile="$destdir/$destfile"
+	fi
+
+	# If the file is missing, and there is a .exe on the end, strip it
+	# because it is most likely a libtool script we actually want to
+	# install
+	stripped_ext=""
+	case $file in
+	  *.exe)
+	    if test ! -f "$file"; then
+	      func_stripname '' '.exe' "$file"
+	      file=$func_stripname_result
+	      stripped_ext=".exe"
+	    fi
+	    ;;
+	esac
+
+	# Do a test to see if this is really a libtool program.
+	case $host in
+	*cygwin* | *mingw*)
+	    if func_ltwrapper_executable_p "$file"; then
+	      func_ltwrapper_scriptname "$file"
+	      wrapper=$func_ltwrapper_scriptname_result
+	    else
+	      func_stripname '' '.exe' "$file"
+	      wrapper=$func_stripname_result
+	    fi
+	    ;;
+	*)
+	    wrapper=$file
+	    ;;
+	esac
+	if func_ltwrapper_script_p "$wrapper"; then
+	  notinst_deplibs=
+	  relink_command=
+
+	  func_source "$wrapper"
+
+	  # Check the variables that should have been set.
+	  test -z "$generated_by_libtool_version" && \
+	    func_fatal_error "invalid libtool wrapper script \`$wrapper'"
+
+	  finalize=yes
+	  for lib in $notinst_deplibs; do
+	    # Check to see that each library is installed.
+	    libdir=
+	    if test -f "$lib"; then
+	      func_source "$lib"
+	    fi
+	    libfile="$libdir/"`$ECHO "X$lib" | $Xsed -e 's%^.*/%%g'` ### testsuite: skip nested quoting test
+	    if test -n "$libdir" && test ! -f "$libfile"; then
+	      func_warning "\`$lib' has not been installed in \`$libdir'"
+	      finalize=no
+	    fi
+	  done
+
+	  relink_command=
+	  func_source "$wrapper"
+
+	  outputname=
+	  if test "$fast_install" = no && test -n "$relink_command"; then
+	    $opt_dry_run || {
+	      if test "$finalize" = yes; then
+	        tmpdir=`func_mktempdir`
+		func_basename "$file$stripped_ext"
+		file="$func_basename_result"
+	        outputname="$tmpdir/$file"
+	        # Replace the output file specification.
+	        relink_command=`$ECHO "X$relink_command" | $Xsed -e 's%@OUTPUT@%'"$outputname"'%g'`
+
+	        $opt_silent || {
+	          func_quote_for_expand "$relink_command"
+		  eval "func_echo $func_quote_for_expand_result"
+	        }
+	        if eval "$relink_command"; then :
+	          else
+		  func_error "error: relink \`$file' with the above command before installing it"
+		  $opt_dry_run || ${RM}r "$tmpdir"
+		  continue
+	        fi
+	        file="$outputname"
+	      else
+	        func_warning "cannot relink \`$file'"
+	      fi
+	    }
+	  else
+	    # Install the binary that we compiled earlier.
+	    file=`$ECHO "X$file$stripped_ext" | $Xsed -e "s%\([^/]*\)$%$objdir/\1%"`
+	  fi
+	fi
+
+	# remove .exe since cygwin /usr/bin/install will append another
+	# one anyway
+	case $install_prog,$host in
+	*/usr/bin/install*,*cygwin*)
+	  case $file:$destfile in
+	  *.exe:*.exe)
+	    # this is ok
+	    ;;
+	  *.exe:*)
+	    destfile=$destfile.exe
+	    ;;
+	  *:*.exe)
+	    func_stripname '' '.exe' "$destfile"
+	    destfile=$func_stripname_result
+	    ;;
+	  esac
+	  ;;
+	esac
+	func_show_eval "$install_prog\$stripme \$file \$destfile" 'exit $?'
+	$opt_dry_run || if test -n "$outputname"; then
+	  ${RM}r "$tmpdir"
+	fi
+	;;
+      esac
+    done
+
+    for file in $staticlibs; do
+      func_basename "$file"
+      name="$func_basename_result"
+
+      # Set up the ranlib parameters.
+      oldlib="$destdir/$name"
+
+      func_show_eval "$install_prog \$file \$oldlib" 'exit $?'
+
+      if test -n "$stripme" && test -n "$old_striplib"; then
+	func_show_eval "$old_striplib $oldlib" 'exit $?'
+      fi
+
+      # Do each command in the postinstall commands.
+      func_execute_cmds "$old_postinstall_cmds" 'exit $?'
+    done
+
+    test -n "$future_libdirs" && \
+      func_warning "remember to run \`$progname --finish$future_libdirs'"
+
+    if test -n "$current_libdirs"; then
+      # Maybe just do a dry run.
+      $opt_dry_run && current_libdirs=" -n$current_libdirs"
+      exec_cmd='$SHELL $progpath $preserve_args --finish$current_libdirs'
+    else
+      exit $EXIT_SUCCESS
+    fi
+}
+
+test "$mode" = install && func_mode_install ${1+"$@"}
+
+
+# func_generate_dlsyms outputname originator pic_p
+# Extract symbols from dlprefiles and create ${outputname}S.o with
+# a dlpreopen symbol table.
+func_generate_dlsyms ()
+{
+    $opt_debug
+    my_outputname="$1"
+    my_originator="$2"
+    my_pic_p="${3-no}"
+    my_prefix=`$ECHO "$my_originator" | sed 's%[^a-zA-Z0-9]%_%g'`
+    my_dlsyms=
+
+    if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+      if test -n "$NM" && test -n "$global_symbol_pipe"; then
+	my_dlsyms="${my_outputname}S.c"
+      else
+	func_error "not configured to extract global symbols from dlpreopened files"
+      fi
+    fi
+
+    if test -n "$my_dlsyms"; then
+      case $my_dlsyms in
+      "") ;;
+      *.c)
+	# Discover the nlist of each of the dlfiles.
+	nlist="$output_objdir/${my_outputname}.nm"
+
+	func_show_eval "$RM $nlist ${nlist}S ${nlist}T"
+
+	# Parse the name list into a source file.
+	func_verbose "creating $output_objdir/$my_dlsyms"
+
+	$opt_dry_run || $ECHO > "$output_objdir/$my_dlsyms" "\
+/* $my_dlsyms - symbol resolution table for \`$my_outputname' dlsym emulation. */
+/* Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION */
+
+#ifdef __cplusplus
+extern \"C\" {
+#endif
+
+/* External symbol declarations for the compiler. */\
+"
+
+	if test "$dlself" = yes; then
+	  func_verbose "generating symbol list for \`$output'"
+
+	  $opt_dry_run || echo ': @PROGRAM@ ' > "$nlist"
+
+	  # Add our own program objects to the symbol list.
+	  progfiles=`$ECHO "X$objs$old_deplibs" | $SP2NL | $Xsed -e "$lo2o" | $NL2SP`
+	  for progfile in $progfiles; do
+	    func_verbose "extracting global C symbols from \`$progfile'"
+	    $opt_dry_run || eval "$NM $progfile | $global_symbol_pipe >> '$nlist'"
+	  done
+
+	  if test -n "$exclude_expsyms"; then
+	    $opt_dry_run || {
+	      eval '$EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T'
+	      eval '$MV "$nlist"T "$nlist"'
+	    }
+	  fi
+
+	  if test -n "$export_symbols_regex"; then
+	    $opt_dry_run || {
+	      eval '$EGREP -e "$export_symbols_regex" "$nlist" > "$nlist"T'
+	      eval '$MV "$nlist"T "$nlist"'
+	    }
+	  fi
+
+	  # Prepare the list of exported symbols
+	  if test -z "$export_symbols"; then
+	    export_symbols="$output_objdir/$outputname.exp"
+	    $opt_dry_run || {
+	      $RM $export_symbols
+	      eval "${SED} -n -e '/^: @PROGRAM@ $/d' -e 's/^.* \(.*\)$/\1/p' "'< "$nlist" > "$export_symbols"'
+	      case $host in
+	      *cygwin* | *mingw* | *cegcc* )
+                eval "echo EXPORTS "'> "$output_objdir/$outputname.def"'
+                eval 'cat "$export_symbols" >> "$output_objdir/$outputname.def"'
+	        ;;
+	      esac
+	    }
+	  else
+	    $opt_dry_run || {
+	      eval "${SED} -e 's/\([].[*^$]\)/\\\\\1/g' -e 's/^/ /' -e 's/$/$/'"' < "$export_symbols" > "$output_objdir/$outputname.exp"'
+	      eval '$GREP -f "$output_objdir/$outputname.exp" < "$nlist" > "$nlist"T'
+	      eval '$MV "$nlist"T "$nlist"'
+	      case $host in
+	        *cygwin | *mingw* | *cegcc* )
+	          eval "echo EXPORTS "'> "$output_objdir/$outputname.def"'
+	          eval 'cat "$nlist" >> "$output_objdir/$outputname.def"'
+	          ;;
+	      esac
+	    }
+	  fi
+	fi
+
+	for dlprefile in $dlprefiles; do
+	  func_verbose "extracting global C symbols from \`$dlprefile'"
+	  func_basename "$dlprefile"
+	  name="$func_basename_result"
+	  $opt_dry_run || {
+	    eval '$ECHO ": $name " >> "$nlist"'
+	    eval "$NM $dlprefile 2>/dev/null | $global_symbol_pipe >> '$nlist'"
+	  }
+	done
+
+	$opt_dry_run || {
+	  # Make sure we have at least an empty file.
+	  test -f "$nlist" || : > "$nlist"
+
+	  if test -n "$exclude_expsyms"; then
+	    $EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T
+	    $MV "$nlist"T "$nlist"
+	  fi
+
+	  # Try sorting and uniquifying the output.
+	  if $GREP -v "^: " < "$nlist" |
+	      if sort -k 3 </dev/null >/dev/null 2>&1; then
+		sort -k 3
+	      else
+		sort +2
+	      fi |
+	      uniq > "$nlist"S; then
+	    :
+	  else
+	    $GREP -v "^: " < "$nlist" > "$nlist"S
+	  fi
+
+	  if test -f "$nlist"S; then
+	    eval "$global_symbol_to_cdecl"' < "$nlist"S >> "$output_objdir/$my_dlsyms"'
+	  else
+	    $ECHO '/* NONE */' >> "$output_objdir/$my_dlsyms"
+	  fi
+
+	  $ECHO >> "$output_objdir/$my_dlsyms" "\
+
+/* The mapping between symbol names and symbols.  */
+typedef struct {
+  const char *name;
+  void *address;
+} lt_dlsymlist;
+"
+	  case $host in
+	  *cygwin* | *mingw* | *cegcc* )
+	    $ECHO >> "$output_objdir/$my_dlsyms" "\
+/* DATA imports from DLLs on WIN32 con't be const, because
+   runtime relocations are performed -- see ld's documentation
+   on pseudo-relocs.  */"
+	    lt_dlsym_const= ;;
+	  *osf5*)
+	    echo >> "$output_objdir/$my_dlsyms" "\
+/* This system does not cope well with relocations in const data */"
+	    lt_dlsym_const= ;;
+	  *)
+	    lt_dlsym_const=const ;;
+	  esac
+
+	  $ECHO >> "$output_objdir/$my_dlsyms" "\
+extern $lt_dlsym_const lt_dlsymlist
+lt_${my_prefix}_LTX_preloaded_symbols[];
+$lt_dlsym_const lt_dlsymlist
+lt_${my_prefix}_LTX_preloaded_symbols[] =
+{\
+  { \"$my_originator\", (void *) 0 },"
+
+	  case $need_lib_prefix in
+	  no)
+	    eval "$global_symbol_to_c_name_address" < "$nlist" >> "$output_objdir/$my_dlsyms"
+	    ;;
+	  *)
+	    eval "$global_symbol_to_c_name_address_lib_prefix" < "$nlist" >> "$output_objdir/$my_dlsyms"
+	    ;;
+	  esac
+	  $ECHO >> "$output_objdir/$my_dlsyms" "\
+  {0, (void *) 0}
+};
+
+/* This works around a problem in FreeBSD linker */
+#ifdef FREEBSD_WORKAROUND
+static const void *lt_preloaded_setup() {
+  return lt_${my_prefix}_LTX_preloaded_symbols;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif\
+"
+	} # !$opt_dry_run
+
+	pic_flag_for_symtable=
+	case "$compile_command " in
+	*" -static "*) ;;
+	*)
+	  case $host in
+	  # compiling the symbol table file with pic_flag works around
+	  # a FreeBSD bug that causes programs to crash when -lm is
+	  # linked before any other PIC object.  But we must not use
+	  # pic_flag when linking with -static.  The problem exists in
+	  # FreeBSD 2.2.6 and is fixed in FreeBSD 3.1.
+	  *-*-freebsd2*|*-*-freebsd3.0*|*-*-freebsdelf3.0*)
+	    pic_flag_for_symtable=" $pic_flag -DFREEBSD_WORKAROUND" ;;
+	  *-*-hpux*)
+	    pic_flag_for_symtable=" $pic_flag"  ;;
+	  *)
+	    if test "X$my_pic_p" != Xno; then
+	      pic_flag_for_symtable=" $pic_flag"
+	    fi
+	    ;;
+	  esac
+	  ;;
+	esac
+	symtab_cflags=
+	for arg in $LTCFLAGS; do
+	  case $arg in
+	  -pie | -fpie | -fPIE) ;;
+	  *) symtab_cflags="$symtab_cflags $arg" ;;
+	  esac
+	done
+
+	# Now compile the dynamic symbol file.
+	func_show_eval '(cd $output_objdir && $LTCC$symtab_cflags -c$no_builtin_flag$pic_flag_for_symtable "$my_dlsyms")' 'exit $?'
+
+	# Clean up the generated files.
+	func_show_eval '$RM "$output_objdir/$my_dlsyms" "$nlist" "${nlist}S" "${nlist}T"'
+
+	# Transform the symbol file into the correct name.
+	symfileobj="$output_objdir/${my_outputname}S.$objext"
+	case $host in
+	*cygwin* | *mingw* | *cegcc* )
+	  if test -f "$output_objdir/$my_outputname.def"; then
+	    compile_command=`$ECHO "X$compile_command" | $Xsed -e "s%@SYMFILE@%$output_objdir/$my_outputname.def $symfileobj%"`
+	    finalize_command=`$ECHO "X$finalize_command" | $Xsed -e "s%@SYMFILE@%$output_objdir/$my_outputname.def $symfileobj%"`
+	  else
+	    compile_command=`$ECHO "X$compile_command" | $Xsed -e "s%@SYMFILE@%$symfileobj%"`
+	    finalize_command=`$ECHO "X$finalize_command" | $Xsed -e "s%@SYMFILE@%$symfileobj%"`
+	  fi
+	  ;;
+	*)
+	  compile_command=`$ECHO "X$compile_command" | $Xsed -e "s%@SYMFILE@%$symfileobj%"`
+	  finalize_command=`$ECHO "X$finalize_command" | $Xsed -e "s%@SYMFILE@%$symfileobj%"`
+	  ;;
+	esac
+	;;
+      *)
+	func_fatal_error "unknown suffix for \`$my_dlsyms'"
+	;;
+      esac
+    else
+      # We keep going just in case the user didn't refer to
+      # lt_preloaded_symbols.  The linker will fail if global_symbol_pipe
+      # really was required.
+
+      # Nullify the symbol file.
+      compile_command=`$ECHO "X$compile_command" | $Xsed -e "s% @SYMFILE@%%"`
+      finalize_command=`$ECHO "X$finalize_command" | $Xsed -e "s% @SYMFILE@%%"`
+    fi
+}
+
+# func_win32_libid arg
+# return the library type of file 'arg'
+#
+# Need a lot of goo to handle *both* DLLs and import libs
+# Has to be a shell function in order to 'eat' the argument
+# that is supplied when $file_magic_command is called.
+func_win32_libid ()
+{
+  $opt_debug
+  win32_libid_type="unknown"
+  win32_fileres=`file -L $1 2>/dev/null`
+  case $win32_fileres in
+  *ar\ archive\ import\ library*) # definitely import
+    win32_libid_type="x86 archive import"
+    ;;
+  *ar\ archive*) # could be an import, or static
+    if eval $OBJDUMP -f $1 | $SED -e '10q' 2>/dev/null |
+       $EGREP 'file format pe-i386(.*architecture: i386)?' >/dev/null ; then
+      win32_nmres=`eval $NM -f posix -A $1 |
+	$SED -n -e '
+	    1,100{
+		/ I /{
+		    s,.*,import,
+		    p
+		    q
+		}
+	    }'`
+      case $win32_nmres in
+      import*)  win32_libid_type="x86 archive import";;
+      *)        win32_libid_type="x86 archive static";;
+      esac
+    fi
+    ;;
+  *DLL*)
+    win32_libid_type="x86 DLL"
+    ;;
+  *executable*) # but shell scripts are "executable" too...
+    case $win32_fileres in
+    *MS\ Windows\ PE\ Intel*)
+      win32_libid_type="x86 DLL"
+      ;;
+    esac
+    ;;
+  esac
+  $ECHO "$win32_libid_type"
+}
+
+
+
+# func_extract_an_archive dir oldlib
+func_extract_an_archive ()
+{
+    $opt_debug
+    f_ex_an_ar_dir="$1"; shift
+    f_ex_an_ar_oldlib="$1"
+    func_show_eval "(cd \$f_ex_an_ar_dir && $AR x \"\$f_ex_an_ar_oldlib\")" 'exit $?'
+    if ($AR t "$f_ex_an_ar_oldlib" | sort | sort -uc >/dev/null 2>&1); then
+     :
+    else
+      func_fatal_error "object name conflicts in archive: $f_ex_an_ar_dir/$f_ex_an_ar_oldlib"
+    fi
+}
+
+
+# func_extract_archives gentop oldlib ...
+func_extract_archives ()
+{
+    $opt_debug
+    my_gentop="$1"; shift
+    my_oldlibs=${1+"$@"}
+    my_oldobjs=""
+    my_xlib=""
+    my_xabs=""
+    my_xdir=""
+
+    for my_xlib in $my_oldlibs; do
+      # Extract the objects.
+      case $my_xlib in
+	[\\/]* | [A-Za-z]:[\\/]*) my_xabs="$my_xlib" ;;
+	*) my_xabs=`pwd`"/$my_xlib" ;;
+      esac
+      func_basename "$my_xlib"
+      my_xlib="$func_basename_result"
+      my_xlib_u=$my_xlib
+      while :; do
+        case " $extracted_archives " in
+	*" $my_xlib_u "*)
+	  func_arith $extracted_serial + 1
+	  extracted_serial=$func_arith_result
+	  my_xlib_u=lt$extracted_serial-$my_xlib ;;
+	*) break ;;
+	esac
+      done
+      extracted_archives="$extracted_archives $my_xlib_u"
+      my_xdir="$my_gentop/$my_xlib_u"
+
+      func_mkdir_p "$my_xdir"
+
+      case $host in
+      *-darwin*)
+	func_verbose "Extracting $my_xabs"
+	# Do not bother doing anything if just a dry run
+	$opt_dry_run || {
+	  darwin_orig_dir=`pwd`
+	  cd $my_xdir || exit $?
+	  darwin_archive=$my_xabs
+	  darwin_curdir=`pwd`
+	  darwin_base_archive=`basename "$darwin_archive"`
+	  darwin_arches=`$LIPO -info "$darwin_archive" 2>/dev/null | $GREP Architectures 2>/dev/null || true`
+	  if test -n "$darwin_arches"; then
+	    darwin_arches=`$ECHO "$darwin_arches" | $SED -e 's/.*are://'`
+	    darwin_arch=
+	    func_verbose "$darwin_base_archive has multiple architectures $darwin_arches"
+	    for darwin_arch in  $darwin_arches ; do
+	      func_mkdir_p "unfat-$$/${darwin_base_archive}-${darwin_arch}"
+	      $LIPO -thin $darwin_arch -output "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}" "${darwin_archive}"
+	      cd "unfat-$$/${darwin_base_archive}-${darwin_arch}"
+	      func_extract_an_archive "`pwd`" "${darwin_base_archive}"
+	      cd "$darwin_curdir"
+	      $RM "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}"
+	    done # $darwin_arches
+            ## Okay now we've a bunch of thin objects, gotta fatten them up :)
+	    darwin_filelist=`find unfat-$$ -type f -name \*.o -print -o -name \*.lo -print | $SED -e "$basename" | sort -u`
+	    darwin_file=
+	    darwin_files=
+	    for darwin_file in $darwin_filelist; do
+	      darwin_files=`find unfat-$$ -name $darwin_file -print | $NL2SP`
+	      $LIPO -create -output "$darwin_file" $darwin_files
+	    done # $darwin_filelist
+	    $RM -rf unfat-$$
+	    cd "$darwin_orig_dir"
+	  else
+	    cd $darwin_orig_dir
+	    func_extract_an_archive "$my_xdir" "$my_xabs"
+	  fi # $darwin_arches
+	} # !$opt_dry_run
+	;;
+      *)
+        func_extract_an_archive "$my_xdir" "$my_xabs"
+	;;
+      esac
+      my_oldobjs="$my_oldobjs "`find $my_xdir -name \*.$objext -print -o -name \*.lo -print | $NL2SP`
+    done
+
+    func_extract_archives_result="$my_oldobjs"
+}
+
+
+
+# func_emit_wrapper_part1 [arg=no]
+#
+# Emit the first part of a libtool wrapper script on stdout.
+# For more information, see the description associated with
+# func_emit_wrapper(), below.
+func_emit_wrapper_part1 ()
+{
+	func_emit_wrapper_part1_arg1=no
+	if test -n "$1" ; then
+	  func_emit_wrapper_part1_arg1=$1
+	fi
+
+	$ECHO "\
+#! $SHELL
+
+# $output - temporary wrapper script for $objdir/$outputname
+# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION
+#
+# The $output program cannot be directly executed until all the libtool
+# libraries that it depends on are installed.
+#
+# This wrapper script should never be moved out of the build directory.
+# If it is, it will not operate correctly.
+
+# Sed substitution that helps us do robust quoting.  It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='${SED} -e 1s/^X//'
+sed_quote_subst='$sed_quote_subst'
+
+# Be Bourne compatible
+if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then
+  emulate sh
+  NULLCMD=:
+  # Zsh 3.x and 4.x performs word splitting on \${1+\"\$@\"}, which
+  # is contrary to our usage.  Disable this feature.
+  alias -g '\${1+\"\$@\"}'='\"\$@\"'
+  setopt NO_GLOB_SUBST
+else
+  case \`(set -o) 2>/dev/null\` in *posix*) set -o posix;; esac
+fi
+BIN_SH=xpg4; export BIN_SH # for Tru64
+DUALCASE=1; export DUALCASE # for MKS sh
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+relink_command=\"$relink_command\"
+
+# This environment variable determines our operation mode.
+if test \"\$libtool_install_magic\" = \"$magic\"; then
+  # install mode needs the following variables:
+  generated_by_libtool_version='$macro_version'
+  notinst_deplibs='$notinst_deplibs'
+else
+  # When we are sourced in execute mode, \$file and \$ECHO are already set.
+  if test \"\$libtool_execute_magic\" != \"$magic\"; then
+    ECHO=\"$qecho\"
+    file=\"\$0\"
+    # Make sure echo works.
+    if test \"X\$1\" = X--no-reexec; then
+      # Discard the --no-reexec flag, and continue.
+      shift
+    elif test \"X\`{ \$ECHO '\t'; } 2>/dev/null\`\" = 'X\t'; then
+      # Yippee, \$ECHO works!
+      :
+    else
+      # Restart under the correct shell, and then maybe \$ECHO will work.
+      exec $SHELL \"\$0\" --no-reexec \${1+\"\$@\"}
+    fi
+  fi\
+"
+	$ECHO "\
+
+  # Find the directory that this script lives in.
+  thisdir=\`\$ECHO \"X\$file\" | \$Xsed -e 's%/[^/]*$%%'\`
+  test \"x\$thisdir\" = \"x\$file\" && thisdir=.
+
+  # Follow symbolic links until we get to the real thisdir.
+  file=\`ls -ld \"\$file\" | ${SED} -n 's/.*-> //p'\`
+  while test -n \"\$file\"; do
+    destdir=\`\$ECHO \"X\$file\" | \$Xsed -e 's%/[^/]*\$%%'\`
+
+    # If there was a directory component, then change thisdir.
+    if test \"x\$destdir\" != \"x\$file\"; then
+      case \"\$destdir\" in
+      [\\\\/]* | [A-Za-z]:[\\\\/]*) thisdir=\"\$destdir\" ;;
+      *) thisdir=\"\$thisdir/\$destdir\" ;;
+      esac
+    fi
+
+    file=\`\$ECHO \"X\$file\" | \$Xsed -e 's%^.*/%%'\`
+    file=\`ls -ld \"\$thisdir/\$file\" | ${SED} -n 's/.*-> //p'\`
+  done
+"
+}
+# end: func_emit_wrapper_part1
+
+# func_emit_wrapper_part2 [arg=no]
+#
+# Emit the second part of a libtool wrapper script on stdout.
+# For more information, see the description associated with
+# func_emit_wrapper(), below.
+func_emit_wrapper_part2 ()
+{
+	func_emit_wrapper_part2_arg1=no
+	if test -n "$1" ; then
+	  func_emit_wrapper_part2_arg1=$1
+	fi
+
+	$ECHO "\
+
+  # Usually 'no', except on cygwin/mingw when embedded into
+  # the cwrapper.
+  WRAPPER_SCRIPT_BELONGS_IN_OBJDIR=$func_emit_wrapper_part2_arg1
+  if test \"\$WRAPPER_SCRIPT_BELONGS_IN_OBJDIR\" = \"yes\"; then
+    # special case for '.'
+    if test \"\$thisdir\" = \".\"; then
+      thisdir=\`pwd\`
+    fi
+    # remove .libs from thisdir
+    case \"\$thisdir\" in
+    *[\\\\/]$objdir ) thisdir=\`\$ECHO \"X\$thisdir\" | \$Xsed -e 's%[\\\\/][^\\\\/]*$%%'\` ;;
+    $objdir )   thisdir=. ;;
+    esac
+  fi
+
+  # Try to get the absolute directory name.
+  absdir=\`cd \"\$thisdir\" && pwd\`
+  test -n \"\$absdir\" && thisdir=\"\$absdir\"
+"
+
+	if test "$fast_install" = yes; then
+	  $ECHO "\
+  program=lt-'$outputname'$exeext
+  progdir=\"\$thisdir/$objdir\"
+
+  if test ! -f \"\$progdir/\$program\" ||
+     { file=\`ls -1dt \"\$progdir/\$program\" \"\$progdir/../\$program\" 2>/dev/null | ${SED} 1q\`; \\
+       test \"X\$file\" != \"X\$progdir/\$program\"; }; then
+
+    file=\"\$\$-\$program\"
+
+    if test ! -d \"\$progdir\"; then
+      $MKDIR \"\$progdir\"
+    else
+      $RM \"\$progdir/\$file\"
+    fi"
+
+	  $ECHO "\
+
+    # relink executable if necessary
+    if test -n \"\$relink_command\"; then
+      if relink_command_output=\`eval \$relink_command 2>&1\`; then :
+      else
+	$ECHO \"\$relink_command_output\" >&2
+	$RM \"\$progdir/\$file\"
+	exit 1
+      fi
+    fi
+
+    $MV \"\$progdir/\$file\" \"\$progdir/\$program\" 2>/dev/null ||
+    { $RM \"\$progdir/\$program\";
+      $MV \"\$progdir/\$file\" \"\$progdir/\$program\"; }
+    $RM \"\$progdir/\$file\"
+  fi"
+	else
+	  $ECHO "\
+  program='$outputname'
+  progdir=\"\$thisdir/$objdir\"
+"
+	fi
+
+	$ECHO "\
+
+  if test -f \"\$progdir/\$program\"; then"
+
+	# Export our shlibpath_var if we have one.
+	if test "$shlibpath_overrides_runpath" = yes && test -n "$shlibpath_var" && test -n "$temp_rpath"; then
+	  $ECHO "\
+    # Add our own library path to $shlibpath_var
+    $shlibpath_var=\"$temp_rpath\$$shlibpath_var\"
+
+    # Some systems cannot cope with colon-terminated $shlibpath_var
+    # The second colon is a workaround for a bug in BeOS R4 sed
+    $shlibpath_var=\`\$ECHO \"X\$$shlibpath_var\" | \$Xsed -e 's/::*\$//'\`
+
+    export $shlibpath_var
+"
+	fi
+
+	# fixup the dll searchpath if we need to.
+	if test -n "$dllsearchpath"; then
+	  $ECHO "\
+    # Add the dll search path components to the executable PATH
+    PATH=$dllsearchpath:\$PATH
+"
+	fi
+
+	$ECHO "\
+    if test \"\$libtool_execute_magic\" != \"$magic\"; then
+      # Run the actual