Project import
diff --git a/Makefile b/Makefile
new file mode 100644
index 0000000..388fcbf
--- /dev/null
+++ b/Makefile
@@ -0,0 +1,123 @@
+#
+# Copyright (c) 2012 Nest Labs, Inc.
+# All rights reserved.
+#
+# This document is the property of Nest. It is considered
+# confidential and proprietary information.
+#
+# This document may not be reproduced or transmitted in any form,
+# in whole or in part, without the express written permission of
+# Nest.
+#
+# Description:
+# This file is the make file for popt, a library for parsing
+# command-line arguments.
+#
+
+BuildConfigSpecialized := No
+BuildProductSpecialized := No
+
+include pre.mak
+
+PackageName := popt
+
+PackageExtension := tar.gz
+PackageSeparator := -
+
+PackagePatchArgs := -p1
+
+PackageArchive := $(PackageName).$(PackageExtension)
+PackageSourceDir := $(PackageName)$(PackageSeparator)$(PackageVersion)
+
+PackageBuildMakefile = $(call GenerateBuildPaths,Makefile)
+
+LicenseSourceFile := $(PackageSourceDir)/COPYING
+
+CleanPaths += $(PackageLicenseFile)
+
+all: $(PackageDefaultGoal)
+
+# Generate the package license contents.
+
+$(LicenseSourceFile): source
+
+$(PackageLicenseFile): $(LicenseSourceFile)
+ $(copy-result)
+
+# Extract the source from the archive and apply patches, if any.
+
+$(PackageSourceDir): $(PackageArchive) $(PackagePatchPaths)
+ $(expand-and-patch-package)
+
+# Prepare the sources.
+
+.PHONY: source
+source: | $(PackageSourceDir)
+
+# Patch the sources, if necessary.
+
+.PHONY: patch
+patch: source
+
+# Generate the package build makefile.
+
+$(PackageBuildMakefile): | $(PackageSourceDir) $(BuildDirectory) $(ResultDirectory)
+ $(Verbose)cd $(BuildDirectory) && \
+ $(CURDIR)/$(PackageSourceDir)/configure \
+ CC="$(CC)" CXX="$(CXX)" AR=$(AR) NM=$(NM) RANLIB=$(RANLIB) STRIP=$(STRIP) \
+ INSTALL="$(INSTALL) $(INSTALLFLAGS)" \
+ --build=$(HostTuple) \
+ --host=$(TargetTuple) \
+ --prefix=/usr \
+ --sysconfdir=/etc \
+ --localstatedir=/var
+
+# Configure the source for building.
+
+.PHONY: configure
+configure: source $(PackageBuildMakefile)
+
+# Build the source.
+#
+# We have to unset MAKEFLAGS since they confuse the package build otherwise.
+
+.PHONY: build
+build: configure
+ $(Verbose)unset MAKEFLAGS && \
+ $(MAKE) $(JOBSFLAG) -C $(BuildDirectory) \
+ all
+
+# Stage the build to a temporary installation area.
+#
+# We have to unset MAKEFLAGS since they confuse the package build otherwise.
+#
+# We explictly remove 'libpopt.la' because some packages that depend
+# on expat use libtool. If libtool finds a '*.la' file for a library,
+# it uses the value of 'libdir=<dir>' it finds. In our case, since
+# '--prefix=/usr' this value is '/usr/lib'. It then resolves '-lexpat'
+# to '/usr/lib/libpopt.so'. In a cross-compilation environment, this
+# is likely to be neither the right architecture nor the right
+# version to link against. In short, we lose.
+#
+# We could also handle this by removing DESTDIR and setting the prefix
+# to $(ResultDirectory); however, that results in libtool hard-coding
+# $(ResultDirectory) as the RPATH in the linked executables which is
+# NOT what we want either. We lose again.
+#
+# By removing the '*.la' file, we win by ensuring neither a
+# misdirected link nor an RPATH.
+
+.PHONY: stage
+stage: build | $(ResultDirectory)
+ $(Verbose)unset MAKEFLAGS && \
+ $(MAKE) $(JOBSFLAG) -C $(BuildDirectory) \
+ DESTDIR=$(ResultDirectory) \
+ install
+ $(Verbose)$(RM) $(RMFLAGS) $(call GenerateResultPaths,,usr/lib/libpopt.la)
+
+clean:
+ $(Verbose)$(RM) $(RMFLAGS) -r $(PackageSourceDir)
+ $(Verbose)$(RM) $(RMFLAGS) -r $(BuildDirectory)
+ $(Verbose)$(RM) $(RMFLAGS) -r $(ResultDirectory)
+
+include post.mak
diff --git a/popt-1.16/ABOUT-NLS b/popt-1.16/ABOUT-NLS
new file mode 100644
index 0000000..83bc72e
--- /dev/null
+++ b/popt-1.16/ABOUT-NLS
@@ -0,0 +1,1068 @@
+1 Notes on the Free Translation Project
+***************************************
+
+Free software is going international! The Free Translation Project is
+a way to get maintainers of free software, translators, and users all
+together, so that free software will gradually become able to speak many
+languages. A few packages already provide translations for their
+messages.
+
+ If you found this `ABOUT-NLS' file inside a distribution, you may
+assume that the distributed package does use GNU `gettext' internally,
+itself available at your nearest GNU archive site. But you do _not_
+need to install GNU `gettext' prior to configuring, installing or using
+this package with messages translated.
+
+ Installers will find here some useful hints. These notes also
+explain how users should proceed for getting the programs to use the
+available translations. They tell how people wanting to contribute and
+work on translations can contact the appropriate team.
+
+ When reporting bugs in the `intl/' directory or bugs which may be
+related to internationalization, you should tell about the version of
+`gettext' which is used. The information can be found in the
+`intl/VERSION' file, in internationalized packages.
+
+1.1 Quick configuration advice
+==============================
+
+If you want to exploit the full power of internationalization, you
+should configure it using
+
+ ./configure --with-included-gettext
+
+to force usage of internationalizing routines provided within this
+package, despite the existence of internationalizing capabilities in the
+operating system where this package is being installed. So far, only
+the `gettext' implementation in the GNU C library version 2 provides as
+many features (such as locale alias, message inheritance, automatic
+charset conversion or plural form handling) as the implementation here.
+It is also not possible to offer this additional functionality on top
+of a `catgets' implementation. Future versions of GNU `gettext' will
+very likely convey even more functionality. So it might be a good idea
+to change to GNU `gettext' as soon as possible.
+
+ So you need _not_ provide this option if you are using GNU libc 2 or
+you have installed a recent copy of the GNU gettext package with the
+included `libintl'.
+
+1.2 INSTALL Matters
+===================
+
+Some packages are "localizable" when properly installed; the programs
+they contain can be made to speak your own native language. Most such
+packages use GNU `gettext'. Other packages have their own ways to
+internationalization, predating GNU `gettext'.
+
+ By default, this package will be installed to allow translation of
+messages. It will automatically detect whether the system already
+provides the GNU `gettext' functions. If not, the included GNU
+`gettext' library will be used. This library is wholly contained
+within this package, usually in the `intl/' subdirectory, so prior
+installation of the GNU `gettext' package is _not_ required.
+Installers may use special options at configuration time for changing
+the default behaviour. The commands:
+
+ ./configure --with-included-gettext
+ ./configure --disable-nls
+
+will, respectively, bypass any pre-existing `gettext' to use the
+internationalizing routines provided within this package, or else,
+_totally_ disable translation of messages.
+
+ When you already have GNU `gettext' installed on your system and run
+configure without an option for your new package, `configure' will
+probably detect the previously built and installed `libintl.a' file and
+will decide to use this. This might not be desirable. You should use
+the more recent version of the GNU `gettext' library. I.e. if the file
+`intl/VERSION' shows that the library which comes with this package is
+more recent, you should use
+
+ ./configure --with-included-gettext
+
+to prevent auto-detection.
+
+ The configuration process will not test for the `catgets' function
+and therefore it will not be used. The reason is that even an
+emulation of `gettext' on top of `catgets' could not provide all the
+extensions of the GNU `gettext' library.
+
+ Internationalized packages usually have many `po/LL.po' files, where
+LL gives an ISO 639 two-letter code identifying the language. Unless
+translations have been forbidden at `configure' time by using the
+`--disable-nls' switch, all available translations are installed
+together with the package. However, the environment variable `LINGUAS'
+may be set, prior to configuration, to limit the installed set.
+`LINGUAS' should then contain a space separated list of two-letter
+codes, stating which languages are allowed.
+
+1.3 Using This Package
+======================
+
+As a user, if your language has been installed for this package, you
+only have to set the `LANG' environment variable to the appropriate
+`LL_CC' combination. If you happen to have the `LC_ALL' or some other
+`LC_xxx' environment variables set, you should unset them before
+setting `LANG', otherwise the setting of `LANG' will not have the
+desired effect. Here `LL' is an ISO 639 two-letter language code, and
+`CC' is an ISO 3166 two-letter country code. For example, let's
+suppose that you speak German and live in Germany. At the shell
+prompt, merely execute `setenv LANG de_DE' (in `csh'),
+`export LANG; LANG=de_DE' (in `sh') or `export LANG=de_DE' (in `bash').
+This can be done from your `.login' or `.profile' file, once and for
+all.
+
+ You might think that the country code specification is redundant.
+But in fact, some languages have dialects in different countries. For
+example, `de_AT' is used for Austria, and `pt_BR' for Brazil. The
+country code serves to distinguish the dialects.
+
+ The locale naming convention of `LL_CC', with `LL' denoting the
+language and `CC' denoting the country, is the one use on systems based
+on GNU libc. On other systems, some variations of this scheme are
+used, such as `LL' or `LL_CC.ENCODING'. You can get the list of
+locales supported by your system for your language by running the
+command `locale -a | grep '^LL''.
+
+ Not all programs have translations for all languages. By default, an
+English message is shown in place of a nonexistent translation. If you
+understand other languages, you can set up a priority list of languages.
+This is done through a different environment variable, called
+`LANGUAGE'. GNU `gettext' gives preference to `LANGUAGE' over `LANG'
+for the purpose of message handling, but you still need to have `LANG'
+set to the primary language; this is required by other parts of the
+system libraries. For example, some Swedish users who would rather
+read translations in German than English for when Swedish is not
+available, set `LANGUAGE' to `sv:de' while leaving `LANG' to `sv_SE'.
+
+ Special advice for Norwegian users: The language code for Norwegian
+bokma*l changed from `no' to `nb' recently (in 2003). During the
+transition period, while some message catalogs for this language are
+installed under `nb' and some older ones under `no', it's recommended
+for Norwegian users to set `LANGUAGE' to `nb:no' so that both newer and
+older translations are used.
+
+ In the `LANGUAGE' environment variable, but not in the `LANG'
+environment variable, `LL_CC' combinations can be abbreviated as `LL'
+to denote the language's main dialect. For example, `de' is equivalent
+to `de_DE' (German as spoken in Germany), and `pt' to `pt_PT'
+(Portuguese as spoken in Portugal) in this context.
+
+1.4 Translating Teams
+=====================
+
+For the Free Translation Project to be a success, we need interested
+people who like their own language and write it well, and who are also
+able to synergize with other translators speaking the same language.
+Each translation team has its own mailing list. The up-to-date list of
+teams can be found at the Free Translation Project's homepage,
+`http://translationproject.org/', in the "Teams" area.
+
+ If you'd like to volunteer to _work_ at translating messages, you
+should become a member of the translating team for your own language.
+The subscribing address is _not_ the same as the list itself, it has
+`-request' appended. For example, speakers of Swedish can send a
+message to `sv-request@li.org', having this message body:
+
+ subscribe
+
+ Keep in mind that team members are expected to participate
+_actively_ in translations, or at solving translational difficulties,
+rather than merely lurking around. If your team does not exist yet and
+you want to start one, or if you are unsure about what to do or how to
+get started, please write to `coordinator@translationproject.org' to
+reach the coordinator for all translator teams.
+
+ The English team is special. It works at improving and uniformizing
+the terminology in use. Proven linguistic skills are praised more than
+programming skills, here.
+
+1.5 Available Packages
+======================
+
+Languages are not equally supported in all packages. The following
+matrix shows the current state of internationalization, as of November
+2007. The matrix shows, in regard of each package, for which languages
+PO files have been submitted to translation coordination, with a
+translation percentage of at least 50%.
+
+ Ready PO files af am ar az be bg bs ca cs cy da de el en en_GB eo
+ +----------------------------------------------------+
+ Compendium | [] [] [] [] |
+ a2ps | [] [] [] [] [] |
+ aegis | () |
+ ant-phone | () |
+ anubis | [] |
+ ap-utils | |
+ aspell | [] [] [] [] [] |
+ bash | [] |
+ bfd | |
+ bibshelf | [] |
+ binutils | |
+ bison | [] [] |
+ bison-runtime | [] |
+ bluez-pin | [] [] [] [] [] |
+ cflow | [] |
+ clisp | [] [] [] |
+ console-tools | [] [] |
+ coreutils | [] [] [] [] |
+ cpio | |
+ cpplib | [] [] [] |
+ cryptonit | [] |
+ dialog | |
+ diffutils | [] [] [] [] [] [] |
+ doodle | [] |
+ e2fsprogs | [] [] |
+ enscript | [] [] [] [] |
+ fetchmail | [] [] () [] [] |
+ findutils | [] |
+ findutils_stable | [] [] [] |
+ flex | [] [] [] |
+ fslint | |
+ gas | |
+ gawk | [] [] [] |
+ gcal | [] |
+ gcc | [] |
+ gettext-examples | [] [] [] [] [] |
+ gettext-runtime | [] [] [] [] [] |
+ gettext-tools | [] [] |
+ gip | [] |
+ gliv | [] [] |
+ glunarclock | [] |
+ gmult | [] [] |
+ gnubiff | () |
+ gnucash | [] [] () () [] |
+ gnuedu | |
+ gnulib | [] |
+ gnunet | |
+ gnunet-gtk | |
+ gnutls | [] |
+ gpe-aerial | [] [] |
+ gpe-beam | [] [] |
+ gpe-calendar | |
+ gpe-clock | [] [] |
+ gpe-conf | [] [] |
+ gpe-contacts | |
+ gpe-edit | [] |
+ gpe-filemanager | |
+ gpe-go | [] |
+ gpe-login | [] [] |
+ gpe-ownerinfo | [] [] |
+ gpe-package | |
+ gpe-sketchbook | [] [] |
+ gpe-su | [] [] |
+ gpe-taskmanager | [] [] |
+ gpe-timesheet | [] |
+ gpe-today | [] [] |
+ gpe-todo | |
+ gphoto2 | [] [] [] [] |
+ gprof | [] [] |
+ gpsdrive | |
+ gramadoir | [] [] |
+ grep | [] [] |
+ gretl | () |
+ gsasl | |
+ gss | |
+ gst-plugins-bad | [] [] |
+ gst-plugins-base | [] [] |
+ gst-plugins-good | [] [] [] |
+ gst-plugins-ugly | [] [] |
+ gstreamer | [] [] [] [] [] [] [] |
+ gtick | () |
+ gtkam | [] [] [] [] |
+ gtkorphan | [] [] |
+ gtkspell | [] [] [] [] |
+ gutenprint | [] |
+ hello | [] [] [] [] [] |
+ herrie | [] |
+ hylafax | |
+ idutils | [] [] |
+ indent | [] [] [] [] |
+ iso_15924 | |
+ iso_3166 | [] [] [] [] [] [] [] [] [] [] [] |
+ iso_3166_2 | |
+ iso_4217 | [] [] [] |
+ iso_639 | [] [] [] [] |
+ jpilot | [] |
+ jtag | |
+ jwhois | |
+ kbd | [] [] [] [] |
+ keytouch | [] [] |
+ keytouch-editor | [] |
+ keytouch-keyboa... | [] |
+ latrine | () |
+ ld | [] |
+ leafpad | [] [] [] [] [] |
+ libc | [] [] [] [] |
+ libexif | [] |
+ libextractor | [] |
+ libgpewidget | [] [] [] |
+ libgpg-error | [] |
+ libgphoto2 | [] [] |
+ libgphoto2_port | [] [] |
+ libgsasl | |
+ libiconv | [] [] |
+ libidn | [] [] [] |
+ lifelines | [] () |
+ lilypond | [] |
+ lingoteach | |
+ lprng | |
+ lynx | [] [] [] [] |
+ m4 | [] [] [] [] |
+ mailfromd | |
+ mailutils | [] |
+ make | [] [] |
+ man-db | [] [] [] |
+ minicom | [] [] [] |
+ nano | [] [] [] |
+ opcodes | [] |
+ parted | [] [] |
+ pilot-qof | |
+ popt | [] [] [] |
+ psmisc | [] |
+ pwdutils | |
+ qof | |
+ radius | [] |
+ recode | [] [] [] [] [] [] |
+ rpm | [] |
+ screem | |
+ scrollkeeper | [] [] [] [] [] [] [] [] |
+ sed | [] [] [] |
+ shared-mime-info | [] [] [] [] () [] [] [] |
+ sharutils | [] [] [] [] [] [] |
+ shishi | |
+ skencil | [] () |
+ solfege | |
+ soundtracker | [] [] |
+ sp | [] |
+ system-tools-ba... | [] [] [] [] [] [] [] [] [] |
+ tar | [] [] |
+ texinfo | [] [] [] |
+ tin | () () |
+ tuxpaint | [] [] [] [] [] [] |
+ unicode-han-tra... | |
+ unicode-transla... | |
+ util-linux | [] [] [] [] |
+ util-linux-ng | [] [] [] [] |
+ vorbis-tools | [] |
+ wastesedge | () |
+ wdiff | [] [] [] [] |
+ wget | [] [] [] |
+ xchat | [] [] [] [] [] [] [] |
+ xkeyboard-config | [] |
+ xpad | [] [] [] |
+ +----------------------------------------------------+
+ af am ar az be bg bs ca cs cy da de el en en_GB eo
+ 6 0 2 1 8 26 2 40 48 2 56 88 15 1 15 18
+
+ es et eu fa fi fr ga gl gu he hi hr hu id is it
+ +--------------------------------------------------+
+ Compendium | [] [] [] [] [] |
+ a2ps | [] [] [] () |
+ aegis | |
+ ant-phone | [] |
+ anubis | [] |
+ ap-utils | [] [] |
+ aspell | [] [] [] |
+ bash | [] |
+ bfd | [] [] |
+ bibshelf | [] [] [] |
+ binutils | [] [] [] |
+ bison | [] [] [] [] [] [] |
+ bison-runtime | [] [] [] [] [] |
+ bluez-pin | [] [] [] [] [] |
+ cflow | [] |
+ clisp | [] [] |
+ console-tools | |
+ coreutils | [] [] [] [] [] [] |
+ cpio | [] [] [] |
+ cpplib | [] [] |
+ cryptonit | [] |
+ dialog | [] [] [] |
+ diffutils | [] [] [] [] [] [] [] [] [] |
+ doodle | [] [] |
+ e2fsprogs | [] [] [] |
+ enscript | [] [] [] |
+ fetchmail | [] |
+ findutils | [] [] [] |
+ findutils_stable | [] [] [] [] |
+ flex | [] [] [] |
+ fslint | |
+ gas | [] [] |
+ gawk | [] [] [] [] () |
+ gcal | [] [] |
+ gcc | [] |
+ gettext-examples | [] [] [] [] [] [] [] |
+ gettext-runtime | [] [] [] [] [] [] |
+ gettext-tools | [] [] [] [] |
+ gip | [] [] [] [] |
+ gliv | () |
+ glunarclock | [] [] [] |
+ gmult | [] [] [] |
+ gnubiff | () () |
+ gnucash | () () () |
+ gnuedu | [] |
+ gnulib | [] [] [] |
+ gnunet | |
+ gnunet-gtk | |
+ gnutls | |
+ gpe-aerial | [] [] |
+ gpe-beam | [] [] |
+ gpe-calendar | |
+ gpe-clock | [] [] [] [] |
+ gpe-conf | [] |
+ gpe-contacts | [] [] |
+ gpe-edit | [] [] [] [] |
+ gpe-filemanager | [] |
+ gpe-go | [] [] [] |
+ gpe-login | [] [] [] |
+ gpe-ownerinfo | [] [] [] [] [] |
+ gpe-package | [] |
+ gpe-sketchbook | [] [] |
+ gpe-su | [] [] [] [] |
+ gpe-taskmanager | [] [] [] |
+ gpe-timesheet | [] [] [] [] |
+ gpe-today | [] [] [] [] |
+ gpe-todo | [] |
+ gphoto2 | [] [] [] [] [] |
+ gprof | [] [] [] [] [] |
+ gpsdrive | [] |
+ gramadoir | [] [] |
+ grep | [] [] [] |
+ gretl | [] [] [] () |
+ gsasl | [] [] |
+ gss | [] [] |
+ gst-plugins-bad | [] [] [] [] |
+ gst-plugins-base | [] [] [] [] |
+ gst-plugins-good | [] [] [] [] [] |
+ gst-plugins-ugly | [] [] [] [] |
+ gstreamer | [] [] [] |
+ gtick | [] [] [] |
+ gtkam | [] [] [] [] |
+ gtkorphan | [] [] |
+ gtkspell | [] [] [] [] [] [] [] |
+ gutenprint | [] |
+ hello | [] [] [] [] [] [] [] [] [] [] [] [] [] |
+ herrie | [] |
+ hylafax | |
+ idutils | [] [] [] [] [] |
+ indent | [] [] [] [] [] [] [] [] [] [] |
+ iso_15924 | [] |
+ iso_3166 | [] [] [] [] [] [] [] [] [] [] [] [] [] |
+ iso_3166_2 | [] |
+ iso_4217 | [] [] [] [] [] [] |
+ iso_639 | [] [] [] [] [] [] |
+ jpilot | [] [] |
+ jtag | [] |
+ jwhois | [] [] [] [] [] |
+ kbd | [] [] |
+ keytouch | [] [] [] |
+ keytouch-editor | [] |
+ keytouch-keyboa... | [] [] |
+ latrine | [] [] |
+ ld | [] [] [] [] |
+ leafpad | [] [] [] [] [] [] |
+ libc | [] [] [] [] [] |
+ libexif | [] |
+ libextractor | [] |
+ libgpewidget | [] [] [] [] [] |
+ libgpg-error | [] |
+ libgphoto2 | [] [] [] |
+ libgphoto2_port | [] [] |
+ libgsasl | [] [] |
+ libiconv | [] [] [] |
+ libidn | [] [] |
+ lifelines | () |
+ lilypond | [] [] [] |
+ lingoteach | [] [] [] |
+ lprng | |
+ lynx | [] [] [] |
+ m4 | [] [] [] [] |
+ mailfromd | |
+ mailutils | [] [] |
+ make | [] [] [] [] [] [] [] [] |
+ man-db | [] |
+ minicom | [] [] [] [] |
+ nano | [] [] [] [] [] [] [] |
+ opcodes | [] [] [] [] |
+ parted | [] [] [] |
+ pilot-qof | |
+ popt | [] [] [] [] |
+ psmisc | [] [] |
+ pwdutils | |
+ qof | [] |
+ radius | [] [] |
+ recode | [] [] [] [] [] [] [] [] |
+ rpm | [] [] |
+ screem | |
+ scrollkeeper | [] [] [] |
+ sed | [] [] [] [] [] |
+ shared-mime-info | [] [] [] [] [] [] |
+ sharutils | [] [] [] [] [] [] [] [] |
+ shishi | [] |
+ skencil | [] [] |
+ solfege | [] |
+ soundtracker | [] [] [] |
+ sp | [] |
+ system-tools-ba... | [] [] [] [] [] [] [] [] [] |
+ tar | [] [] [] [] [] |
+ texinfo | [] [] [] |
+ tin | [] () |
+ tuxpaint | [] [] |
+ unicode-han-tra... | |
+ unicode-transla... | [] [] |
+ util-linux | [] [] [] [] [] [] [] |
+ util-linux-ng | [] [] [] [] [] [] [] |
+ vorbis-tools | |
+ wastesedge | () |
+ wdiff | [] [] [] [] [] [] [] [] |
+ wget | [] [] [] [] [] [] [] [] |
+ xchat | [] [] [] [] [] [] [] |
+ xkeyboard-config | [] [] [] [] |
+ xpad | [] [] [] |
+ +--------------------------------------------------+
+ es et eu fa fi fr ga gl gu he hi hr hu id is it
+ 85 22 14 2 48 101 61 12 2 8 2 6 53 29 1 52
+
+ ja ka ko ku ky lg lt lv mk mn ms mt nb ne nl nn
+ +--------------------------------------------------+
+ Compendium | [] |
+ a2ps | () [] [] |
+ aegis | () |
+ ant-phone | [] |
+ anubis | [] [] [] |
+ ap-utils | [] |
+ aspell | [] [] |
+ bash | [] |
+ bfd | |
+ bibshelf | [] |
+ binutils | |
+ bison | [] [] [] |
+ bison-runtime | [] [] [] |
+ bluez-pin | [] [] [] |
+ cflow | |
+ clisp | [] |
+ console-tools | |
+ coreutils | [] |
+ cpio | [] |
+ cpplib | [] |
+ cryptonit | [] |
+ dialog | [] [] |
+ diffutils | [] [] [] |
+ doodle | |
+ e2fsprogs | [] |
+ enscript | [] |
+ fetchmail | [] [] |
+ findutils | [] |
+ findutils_stable | [] |
+ flex | [] [] |
+ fslint | |
+ gas | |
+ gawk | [] [] |
+ gcal | |
+ gcc | |
+ gettext-examples | [] [] [] |
+ gettext-runtime | [] [] [] |
+ gettext-tools | [] [] |
+ gip | [] [] |
+ gliv | [] |
+ glunarclock | [] [] |
+ gmult | [] [] [] |
+ gnubiff | |
+ gnucash | () () () |
+ gnuedu | |
+ gnulib | [] [] |
+ gnunet | |
+ gnunet-gtk | |
+ gnutls | [] |
+ gpe-aerial | [] |
+ gpe-beam | [] |
+ gpe-calendar | [] |
+ gpe-clock | [] [] [] |
+ gpe-conf | [] [] [] |
+ gpe-contacts | [] |
+ gpe-edit | [] [] [] |
+ gpe-filemanager | [] [] |
+ gpe-go | [] [] [] |
+ gpe-login | [] [] [] |
+ gpe-ownerinfo | [] [] |
+ gpe-package | [] [] |
+ gpe-sketchbook | [] [] |
+ gpe-su | [] [] [] |
+ gpe-taskmanager | [] [] [] [] |
+ gpe-timesheet | [] |
+ gpe-today | [] [] |
+ gpe-todo | [] |
+ gphoto2 | [] [] |
+ gprof | [] |
+ gpsdrive | [] |
+ gramadoir | () |
+ grep | [] [] |
+ gretl | |
+ gsasl | [] |
+ gss | |
+ gst-plugins-bad | [] |
+ gst-plugins-base | [] |
+ gst-plugins-good | [] |
+ gst-plugins-ugly | [] |
+ gstreamer | [] |
+ gtick | [] |
+ gtkam | [] [] |
+ gtkorphan | [] |
+ gtkspell | [] [] |
+ gutenprint | [] |
+ hello | [] [] [] [] [] [] [] |
+ herrie | [] |
+ hylafax | |
+ idutils | [] |
+ indent | [] [] |
+ iso_15924 | [] |
+ iso_3166 | [] [] [] [] [] [] [] [] |
+ iso_3166_2 | [] |
+ iso_4217 | [] [] [] |
+ iso_639 | [] [] [] [] |
+ jpilot | () () |
+ jtag | |
+ jwhois | [] |
+ kbd | [] |
+ keytouch | [] |
+ keytouch-editor | [] |
+ keytouch-keyboa... | |
+ latrine | [] |
+ ld | |
+ leafpad | [] [] |
+ libc | [] [] [] |
+ libexif | |
+ libextractor | |
+ libgpewidget | [] |
+ libgpg-error | |
+ libgphoto2 | [] |
+ libgphoto2_port | [] |
+ libgsasl | [] |
+ libiconv | [] |
+ libidn | [] [] |
+ lifelines | [] |
+ lilypond | [] |
+ lingoteach | [] |
+ lprng | |
+ lynx | [] [] |
+ m4 | [] [] |
+ mailfromd | |
+ mailutils | |
+ make | [] [] [] |
+ man-db | |
+ minicom | [] |
+ nano | [] [] [] |
+ opcodes | [] |
+ parted | [] [] |
+ pilot-qof | |
+ popt | [] [] [] |
+ psmisc | [] [] [] |
+ pwdutils | |
+ qof | |
+ radius | |
+ recode | [] |
+ rpm | [] [] |
+ screem | [] |
+ scrollkeeper | [] [] [] [] |
+ sed | [] [] |
+ shared-mime-info | [] [] [] [] [] [] [] |
+ sharutils | [] [] |
+ shishi | |
+ skencil | |
+ solfege | () () |
+ soundtracker | |
+ sp | () |
+ system-tools-ba... | [] [] [] [] |
+ tar | [] [] [] |
+ texinfo | [] [] |
+ tin | |
+ tuxpaint | () [] [] |
+ unicode-han-tra... | |
+ unicode-transla... | |
+ util-linux | [] [] |
+ util-linux-ng | [] [] |
+ vorbis-tools | |
+ wastesedge | [] |
+ wdiff | [] [] |
+ wget | [] [] |
+ xchat | [] [] [] [] |
+ xkeyboard-config | [] [] [] |
+ xpad | [] [] [] |
+ +--------------------------------------------------+
+ ja ka ko ku ky lg lt lv mk mn ms mt nb ne nl nn
+ 51 2 25 3 2 0 6 0 2 2 20 0 11 1 103 6
+
+ or pa pl pt pt_BR rm ro ru rw sk sl sq sr sv ta
+ +--------------------------------------------------+
+ Compendium | [] [] [] [] [] |
+ a2ps | () [] [] [] [] [] [] |
+ aegis | () () |
+ ant-phone | [] [] |
+ anubis | [] [] [] |
+ ap-utils | () |
+ aspell | [] [] [] |
+ bash | [] [] |
+ bfd | |
+ bibshelf | [] |
+ binutils | [] [] |
+ bison | [] [] [] [] [] |
+ bison-runtime | [] [] [] [] [] |
+ bluez-pin | [] [] [] [] [] [] [] [] [] |
+ cflow | [] |
+ clisp | [] |
+ console-tools | [] |
+ coreutils | [] [] [] [] |
+ cpio | [] [] [] |
+ cpplib | [] |
+ cryptonit | [] [] |
+ dialog | [] |
+ diffutils | [] [] [] [] [] [] |
+ doodle | [] [] |
+ e2fsprogs | [] [] |
+ enscript | [] [] [] [] [] |
+ fetchmail | [] [] [] |
+ findutils | [] [] [] |
+ findutils_stable | [] [] [] [] [] [] |
+ flex | [] [] [] [] [] |
+ fslint | [] |
+ gas | |
+ gawk | [] [] [] [] |
+ gcal | [] |
+ gcc | [] [] |
+ gettext-examples | [] [] [] [] [] [] [] [] |
+ gettext-runtime | [] [] [] [] [] [] [] [] |
+ gettext-tools | [] [] [] [] [] [] [] |
+ gip | [] [] [] [] |
+ gliv | [] [] [] [] [] [] |
+ glunarclock | [] [] [] [] [] [] |
+ gmult | [] [] [] [] |
+ gnubiff | () [] |
+ gnucash | () [] |
+ gnuedu | |
+ gnulib | [] [] [] |
+ gnunet | |
+ gnunet-gtk | [] |
+ gnutls | [] [] |
+ gpe-aerial | [] [] [] [] [] [] [] |
+ gpe-beam | [] [] [] [] [] [] [] |
+ gpe-calendar | [] [] [] [] |
+ gpe-clock | [] [] [] [] [] [] [] [] |
+ gpe-conf | [] [] [] [] [] [] [] |
+ gpe-contacts | [] [] [] [] [] |
+ gpe-edit | [] [] [] [] [] [] [] [] [] |
+ gpe-filemanager | [] [] |
+ gpe-go | [] [] [] [] [] [] [] [] |
+ gpe-login | [] [] [] [] [] [] [] [] |
+ gpe-ownerinfo | [] [] [] [] [] [] [] [] |
+ gpe-package | [] [] |
+ gpe-sketchbook | [] [] [] [] [] [] [] [] |
+ gpe-su | [] [] [] [] [] [] [] [] |
+ gpe-taskmanager | [] [] [] [] [] [] [] [] |
+ gpe-timesheet | [] [] [] [] [] [] [] [] |
+ gpe-today | [] [] [] [] [] [] [] [] |
+ gpe-todo | [] [] [] [] |
+ gphoto2 | [] [] [] [] [] [] |
+ gprof | [] [] [] |
+ gpsdrive | [] [] |
+ gramadoir | [] [] |
+ grep | [] [] [] [] |
+ gretl | [] [] [] |
+ gsasl | [] [] [] |
+ gss | [] [] [] [] |
+ gst-plugins-bad | [] [] [] |
+ gst-plugins-base | [] [] |
+ gst-plugins-good | [] [] |
+ gst-plugins-ugly | [] [] [] |
+ gstreamer | [] [] [] [] |
+ gtick | [] |
+ gtkam | [] [] [] [] [] |
+ gtkorphan | [] |
+ gtkspell | [] [] [] [] [] [] [] [] |
+ gutenprint | [] |
+ hello | [] [] [] [] [] [] [] [] |
+ herrie | [] [] [] |
+ hylafax | |
+ idutils | [] [] [] [] [] |
+ indent | [] [] [] [] [] [] [] |
+ iso_15924 | |
+ iso_3166 | [] [] [] [] [] [] [] [] [] [] [] [] [] |
+ iso_3166_2 | |
+ iso_4217 | [] [] [] [] [] [] [] |
+ iso_639 | [] [] [] [] [] [] [] |
+ jpilot | |
+ jtag | [] |
+ jwhois | [] [] [] [] |
+ kbd | [] [] [] |
+ keytouch | [] |
+ keytouch-editor | [] |
+ keytouch-keyboa... | [] |
+ latrine | |
+ ld | [] |
+ leafpad | [] [] [] [] [] [] |
+ libc | [] [] [] [] |
+ libexif | [] [] |
+ libextractor | [] [] |
+ libgpewidget | [] [] [] [] [] [] [] [] |
+ libgpg-error | [] [] [] |
+ libgphoto2 | [] |
+ libgphoto2_port | [] [] [] |
+ libgsasl | [] [] [] [] |
+ libiconv | [] [] [] |
+ libidn | [] [] () |
+ lifelines | [] [] |
+ lilypond | |
+ lingoteach | [] |
+ lprng | [] |
+ lynx | [] [] [] |
+ m4 | [] [] [] [] [] |
+ mailfromd | [] |
+ mailutils | [] [] [] |
+ make | [] [] [] [] |
+ man-db | [] [] [] [] |
+ minicom | [] [] [] [] [] |
+ nano | [] [] [] [] |
+ opcodes | [] [] |
+ parted | [] |
+ pilot-qof | |
+ popt | [] [] [] [] |
+ psmisc | [] [] |
+ pwdutils | [] [] |
+ qof | [] [] |
+ radius | [] [] |
+ recode | [] [] [] [] [] [] [] |
+ rpm | [] [] [] [] |
+ screem | |
+ scrollkeeper | [] [] [] [] [] [] [] |
+ sed | [] [] [] [] [] [] [] [] [] |
+ shared-mime-info | [] [] [] [] [] [] |
+ sharutils | [] [] [] [] |
+ shishi | [] |
+ skencil | [] [] [] |
+ solfege | [] |
+ soundtracker | [] [] |
+ sp | |
+ system-tools-ba... | [] [] [] [] [] [] [] [] [] |
+ tar | [] [] [] [] |
+ texinfo | [] [] [] [] |
+ tin | () |
+ tuxpaint | [] [] [] [] [] [] |
+ unicode-han-tra... | |
+ unicode-transla... | |
+ util-linux | [] [] [] [] |
+ util-linux-ng | [] [] [] [] |
+ vorbis-tools | [] |
+ wastesedge | |
+ wdiff | [] [] [] [] [] [] [] |
+ wget | [] [] [] [] |
+ xchat | [] [] [] [] [] [] [] |
+ xkeyboard-config | [] [] [] |
+ xpad | [] [] [] |
+ +--------------------------------------------------+
+ or pa pl pt pt_BR rm ro ru rw sk sl sq sr sv ta
+ 0 5 77 31 53 4 58 72 3 45 46 9 45 122 3
+
+ tg th tk tr uk ven vi wa xh zh_CN zh_HK zh_TW zu
+ +---------------------------------------------------+
+ Compendium | [] [] [] [] | 19
+ a2ps | [] [] [] | 19
+ aegis | [] | 1
+ ant-phone | [] [] | 6
+ anubis | [] [] [] | 11
+ ap-utils | () [] | 4
+ aspell | [] [] [] | 16
+ bash | [] | 6
+ bfd | | 2
+ bibshelf | [] | 7
+ binutils | [] [] [] [] | 9
+ bison | [] [] [] [] | 20
+ bison-runtime | [] [] [] [] | 18
+ bluez-pin | [] [] [] [] [] [] | 28
+ cflow | [] [] | 5
+ clisp | | 9
+ console-tools | [] [] | 5
+ coreutils | [] [] [] | 18
+ cpio | [] [] [] [] | 11
+ cpplib | [] [] [] [] [] | 12
+ cryptonit | [] | 6
+ dialog | [] [] [] | 9
+ diffutils | [] [] [] [] [] | 29
+ doodle | [] | 6
+ e2fsprogs | [] [] | 10
+ enscript | [] [] [] | 16
+ fetchmail | [] [] | 12
+ findutils | [] [] [] | 11
+ findutils_stable | [] [] [] [] | 18
+ flex | [] [] | 15
+ fslint | [] | 2
+ gas | [] | 3
+ gawk | [] [] [] | 16
+ gcal | [] | 5
+ gcc | [] [] [] | 7
+ gettext-examples | [] [] [] [] [] [] | 29
+ gettext-runtime | [] [] [] [] [] [] | 28
+ gettext-tools | [] [] [] [] [] | 20
+ gip | [] [] | 13
+ gliv | [] [] | 11
+ glunarclock | [] [] [] | 15
+ gmult | [] [] [] [] | 16
+ gnubiff | [] | 2
+ gnucash | () [] | 5
+ gnuedu | [] | 2
+ gnulib | [] | 10
+ gnunet | | 0
+ gnunet-gtk | [] [] | 3
+ gnutls | | 4
+ gpe-aerial | [] [] | 14
+ gpe-beam | [] [] | 14
+ gpe-calendar | [] [] | 7
+ gpe-clock | [] [] [] [] | 21
+ gpe-conf | [] [] [] | 16
+ gpe-contacts | [] [] | 10
+ gpe-edit | [] [] [] [] [] | 22
+ gpe-filemanager | [] [] | 7
+ gpe-go | [] [] [] [] | 19
+ gpe-login | [] [] [] [] [] | 21
+ gpe-ownerinfo | [] [] [] [] | 21
+ gpe-package | [] | 6
+ gpe-sketchbook | [] [] | 16
+ gpe-su | [] [] [] [] | 21
+ gpe-taskmanager | [] [] [] [] | 21
+ gpe-timesheet | [] [] [] [] | 18
+ gpe-today | [] [] [] [] [] | 21
+ gpe-todo | [] [] | 8
+ gphoto2 | [] [] [] [] | 21
+ gprof | [] [] | 13
+ gpsdrive | [] | 5
+ gramadoir | [] | 7
+ grep | [] | 12
+ gretl | | 6
+ gsasl | [] [] [] | 9
+ gss | [] | 7
+ gst-plugins-bad | [] [] [] | 13
+ gst-plugins-base | [] [] | 11
+ gst-plugins-good | [] [] [] [] [] | 16
+ gst-plugins-ugly | [] [] [] | 13
+ gstreamer | [] [] [] | 18
+ gtick | [] [] | 7
+ gtkam | [] | 16
+ gtkorphan | [] | 7
+ gtkspell | [] [] [] [] [] [] | 27
+ gutenprint | | 4
+ hello | [] [] [] [] [] | 38
+ herrie | [] [] | 8
+ hylafax | | 0
+ idutils | [] [] | 15
+ indent | [] [] [] [] [] | 28
+ iso_15924 | [] [] | 4
+ iso_3166 | [] [] [] [] [] [] [] [] [] | 54
+ iso_3166_2 | [] [] | 4
+ iso_4217 | [] [] [] [] [] | 24
+ iso_639 | [] [] [] [] [] | 26
+ jpilot | [] [] [] [] | 7
+ jtag | [] | 3
+ jwhois | [] [] [] | 13
+ kbd | [] [] [] | 13
+ keytouch | [] | 8
+ keytouch-editor | [] | 5
+ keytouch-keyboa... | [] | 5
+ latrine | [] [] | 5
+ ld | [] [] [] [] | 10
+ leafpad | [] [] [] [] [] | 24
+ libc | [] [] [] | 19
+ libexif | [] | 5
+ libextractor | [] | 5
+ libgpewidget | [] [] [] | 20
+ libgpg-error | [] | 6
+ libgphoto2 | [] [] | 9
+ libgphoto2_port | [] [] [] | 11
+ libgsasl | [] | 8
+ libiconv | [] [] | 11
+ libidn | [] [] | 11
+ lifelines | | 4
+ lilypond | [] | 6
+ lingoteach | [] | 6
+ lprng | [] | 2
+ lynx | [] [] [] | 15
+ m4 | [] [] [] | 18
+ mailfromd | [] [] | 3
+ mailutils | [] [] | 8
+ make | [] [] [] | 20
+ man-db | [] | 9
+ minicom | [] | 14
+ nano | [] [] [] | 20
+ opcodes | [] [] | 10
+ parted | [] [] [] | 11
+ pilot-qof | [] | 1
+ popt | [] [] [] [] | 18
+ psmisc | [] [] | 10
+ pwdutils | [] | 3
+ qof | [] | 4
+ radius | [] [] | 7
+ recode | [] [] [] | 25
+ rpm | [] [] [] [] | 13
+ screem | [] | 2
+ scrollkeeper | [] [] [] [] | 26
+ sed | [] [] [] [] | 23
+ shared-mime-info | [] [] [] | 29
+ sharutils | [] [] [] | 23
+ shishi | [] | 3
+ skencil | [] | 7
+ solfege | [] | 3
+ soundtracker | [] [] | 9
+ sp | [] | 3
+ system-tools-ba... | [] [] [] [] [] [] [] | 38
+ tar | [] [] [] | 17
+ texinfo | [] [] [] | 15
+ tin | | 1
+ tuxpaint | [] [] [] | 19
+ unicode-han-tra... | | 0
+ unicode-transla... | | 2
+ util-linux | [] [] [] | 20
+ util-linux-ng | [] [] [] | 20
+ vorbis-tools | [] [] | 4
+ wastesedge | | 1
+ wdiff | [] [] | 23
+ wget | [] [] [] | 20
+ xchat | [] [] [] [] | 29
+ xkeyboard-config | [] [] [] | 14
+ xpad | [] [] [] | 15
+ +---------------------------------------------------+
+ 76 teams tg th tk tr uk ven vi wa xh zh_CN zh_HK zh_TW zu
+ 163 domains 0 3 1 74 51 0 143 21 1 57 7 45 0 2036
+
+ Some counters in the preceding matrix are higher than the number of
+visible blocks let us expect. This is because a few extra PO files are
+used for implementing regional variants of languages, or language
+dialects.
+
+ For a PO file in the matrix above to be effective, the package to
+which it applies should also have been internationalized and
+distributed as such by its maintainer. There might be an observable
+lag between the mere existence a PO file and its wide availability in a
+distribution.
+
+ If November 2007 seems to be old, you may fetch a more recent copy
+of this `ABOUT-NLS' file on most GNU archive sites. The most
+up-to-date matrix with full percentage details can be found at
+`http://translationproject.org/extra/matrix.html'.
+
+1.6 Using `gettext' in new packages
+===================================
+
+If you are writing a freely available program and want to
+internationalize it you are welcome to use GNU `gettext' in your
+package. Of course you have to respect the GNU Library General Public
+License which covers the use of the GNU `gettext' library. This means
+in particular that even non-free programs can use `libintl' as a shared
+library, whereas only free software can use `libintl' as a static
+library or use modified versions of `libintl'.
+
+ Once the sources are changed appropriately and the setup can handle
+the use of `gettext' the only thing missing are the translations. The
+Free Translation Project is also available for packages which are not
+developed inside the GNU project. Therefore the information given above
+applies also for every other Free Software Project. Contact
+`coordinator@translationproject.org' to make the `.pot' files available
+to the translation teams.
+
diff --git a/popt-1.16/CHANGES b/popt-1.16/CHANGES
new file mode 100644
index 0000000..0062af2
--- /dev/null
+++ b/popt-1.16/CHANGES
@@ -0,0 +1,204 @@
+1.15 -> 1.16:
+ - add lv.po, update translations (Translation Project).
+ - include xcode project files in distributed popt tar ball.
+ - make distcheck is now squeaky clean.
+ - permit VPATH builds.
+ - add shallow tests using ISP/RAS api-sanity-autotest.pl.
+ - prefix bit set routines with popt to avoid symbol coolisions w rpm.
+ - add tdict.c to exercise popt bit sets against /usr/dict/words.
+ - add poptBitsArgs() method to generate args bit set.
+ - add methods for bit set union and intersection.
+ - permit comma separated attribute lists, handle negated attributes.
+ - better test for POPT_ARG_BITSET.
+ - add POPT_ARG_BITSET handling.
+ - add POPT_ARG_SHORT handling.
+ - handle all callback traversals within a C switch (for extendability ease).
+ - add popt.pc.
+ - devzero2000: add AC_CONFIG_AUX_DIR, AC_CONFIG_MACRO_DIR to configure. Create build-aux
+ - devzero2000: del acinclude.m4 : AC_CHECK_VA_COPY is not used
+1.14 -> 1.15:
+ - release popt-1.15.
+ - rse: fix building under --disable-nls
+ - rse: fix building under non GLIBC platforms where glob_pattern_p fallback has to be used
+ - rse: fix building under platforms where FNM_EXTMATCH is not available
+ - jbj: poptReadFile: permit NULL if return values are not desired.
+ - jbj: poptReadFile: add routine.
+ - jbj: trim out escaped newline(s) from file content, other fixes.
+ - jbj: permit popt alias/exec to include content from a file.
+ - jbj: permit glob(3) patterns in appName field of popt alias/exec config.
+ - jbj: add test cases for bit operations and toggles.
+ - jbj: avoid displaying --[no]nofoo with POPT_ARGFLAG_TOGGLE.
+ - jbj: add poptArgInfo() to get argInfo, implementing POPT_ARGFLAG_TOGGLE.
+ - jbj: add longOptionStrcmp() to match w POPT_ARGFLAG_TOGGLE.
+ - jbj: change singleDash arg to a bit enum, use LF_ISSET(ONEDASH) instead.
+ - jbj: rework the glob wrappers into something more useful. portability todo++.
+ - jbj: stub in glob(3) wrappers for popt. more useful poptGlob() API next.
+ - jbj: add poptInit/poptFini/poptReadConfigFiles/poptSaneFile routines.
+ - jbj: rewrite poptReadConfigFile(), styling for (i.e. my) readbility.
+ - jbj: reserve a bit for --[no]opt prefix toggling.
+ - jbj: fix: check/print argv[0] in --help for NULL.
+ - jbj: permit type/group bitmasks to be changed (if needed somewhen).
+ - jbj: snip out 8 unused bits for argument groups.
+ - jbj: fix: eliminate dead code (CID#5).
+ - jbj: fix: rearrange code to better hint to coverity scan (CID#9).
+ - jbj: fix: rewrite (and simplify) strdup_locale_from_utf8() (CID#7, CID#8, CID#11, CID#12).
+ - jbj: test/use HAVE_SRANDOM to avoid portability issues.
+ - jbj: fix: remove AC_CHECK_VA_COPY check, va_copy is no longer used.
+ - jbj: add eo.po and id.po (Translation Project).
+ - jbj: updated da.po (Translation Project).
+ - jbj: extend coverage to several additional setup routines.
+ - jbj: add tests for --usage/--help coverage.
+ - jbj: add lconv/gcov targets to Makefile.am.
+ - jbj: refactor automagic (*opt->arg) option arg store to poptSaveArg().
+ - ldv: update INPUT tag in Doxyfile.in, fix doxygen warnings in popthelp.c.
+ - start popt-1.15 development.
+
+1.13 -> 1.14:
+ - release popt-1.14.
+ - jbj: remove findme.c, add poptint.c, to po/POTFILES.in.
+ - jbj: use stpcpy 2 more places (Wayne Davison<wayned@samba.org>).
+ - jbj: add @LTLIBICONV@ when needed (Stanislav Brabec<sbrabec@suse.cz>).
+ - jbj: fix: remove the "echo --" Fedorable hack-a-round.
+ - rsc: updated de.po (not from the Translation Project).
+ - jbj: study the mess with splint. Sigh, splint is so easily confused ...
+ - jbj: rewrite findProgramPath & move to popt.c. Nuke the findme.{c,h} toys.
+ - jbj: use stpcpy several more places (Wayne Davison<wayned@samba.org>).
+ - jbj: enable equal after short option (Wayne Davison<wayned@samba.org>).
+ - jbj: permit "#define POPT_fprintf fprintf" to lose the malloc'ing fprintf.
+ - jbj: use vasprintf(3) when available (Wayne Davison<wayned@samba.org>).
+ - jbj: study the mess with splint, remove annotations where possible.
+ - jbj: add -D_GNU_SOURCE for gcc to use __builtin_stpcpy when available.
+ - jbj: add static inline stpcpy for the deprived.
+ - jbj: use stpcpy to eliminate sprintf calls everywhere but popthelp.c
+ - jbj: remove (now unneeded afaik) va_copy() from POPT_fprintf().
+ - jbj: inline strdup_fprintf() => POPT_fprintf keeping (unneeded?) va_copy.
+ - rse: fix memcpy(3) based va_copy(3) fallbacks
+ - jbj: fix: short option with "foo=bar" argument was mishandled.
+ (Wayne Davison<wayned@samba.org>).
+ - jbj: rename _ABS to avoid collisions, define DBL_EPSILON if not present
+ (Wayne Davison<wayned@samba.org>).
+ - jbj: test for <glob.h>, disable reading directory poptrc files if not.
+ - jbj: add __attribute__(__unused__) (Wayne Davison<wayned@samba.org>).
+ - jbj: permit equal after short option (Wayne Davison<wayned@samba.org>).
+ - jbj: make sure that short options are printed only once with --usage.
+ - jbj: don't display hidden short options with --usage.
+ - jbj: updated sv.po (Translation Project).
+ - jbj: updated {fi,nl}.po (Translation Project).
+ - jbj: updated th.po (Translation Project).
+ - rsc: avoid multilib file conflicts in generated doxygen.
+ - jbj: updated vi.po and zh_CN.po (Translation Project).
+ - jbj: fix: keep the poptHelpOptions array exactly the same size.
+ - jbj: updated pl.po (Translation Project).
+ - jbj: add new fi, th, zh_TW translations (Translation Project).
+ - jbj: add "make updatepo" to simplify PO file maintenance.
+ - jbj: display POPT_ARG_ARGV options in --help just like other options.
+ - jbj: add test for POPT_ARG_ARGV handling.
+ - jbj: fix: permit "--foo bar" and "--foo=bar" equivalent forms for aliases.
+ - jbj: fix: tests 20 -> 23 require an explicit '--' arg separator now.
+ - jbj: popt.3: add POPT_ARG_ARGV description.
+ - jbj: use NUL terminator to align help with (possible) multibyte chars.
+ - jbj: add utf8_skip_data table[] to keep track of utf8 character widths.
+ - jbj: refactor the POPT_WCHAR_HACK into stringDisplayWidth().
+ - jbj: add POPT_dgettext() prototype.
+ - jbj: add POPT_dgettext() for popt internal UTF-8 codeset (Takao Fujiwara).
+ - jbj: add POPT_next_char(), backout POPT_fprintf() usage (for the moment).
+ - jbj: finish POPT_ARG_ARGV implementation.
+ - jbj: free aliases/execs with common code.
+ - jbj: rewrite the callback logic using a switch for simplicity.
+ - jbj: hide bit field structure behind F_ISSET/LF_ISSET/CBF_ISSET macros.
+ - jbj: expose poptSaveLongLong and poptSaveString in the loader map.
+ - jbj: add POPT_ARG_ARGV, starting with the poptSaveString() method.
+ - jbj: add help for POPT_ARG_LONGLONG.
+ - jbj: hmmm, POSIXly correct --echo-args needs fixing, disable for now.
+ - jbj: poptint.h: typedef's for string and string arrays.
+ - jbj: add POPT_ARG_LONGLONG, and poptSaveLongLong().
+ - jbj: poptint.h: add poptSubstituteHelpI18N() to bury the ABI hack.
+ - jbj: start using poptArg and poptArgType() where useful.
+ - jbj: poptint.h: add a poptArgType define for bitfield type abstraction.
+ - jbj: poptint.h: add a poptArg union for opt->arg access without casts.
+ - jbj: include "-- Terminate options" end-of-options msg in poptHelpOptions.
+ - jbj: opt->argDescrip[0] determines "--foo=bar" or "--foo bar".
+ - jbj: --long always padded for alignment with/without "-X, ".
+ - jbj: Display shortName iff printable non-space.
+ - jbj: POPT_AUTOALIAS: if no popt aliases/execs, don't display the sub-head.
+ - jbj: add --libdir=/%{_lib} to popt.spec.
+ - jbj: add .cvsignore to m4 subdirectory.
+ - jbj: remove duplicate nb locale from ALL_LINGUAS.
+ - jbj: autogen.sh: on linux, add --libdir=/lib (no /lib64 autodetect yet).
+
+1.12 -> 1.13:
+ - release popt-1.13.
+ - jbj: add a %track section (as in rpm-5.0) to popt.spec.
+ - jbj: chg poptGetOptArg() to "char *", document application needs to free.
+ - jbj: re-add it.po (from Sandro Bonazzola <sandro.bonazzola@gmail.com>).
+ - jbj: rescuscitate the splint annotations.
+ - jbj: change sizeof to use the type implicitly, rather than explicitly.
+ - jbj: remove incorrect casts, changing to size_t where needed.
+ - jbj: remove unused STD_VFPRINTF macro.
+ - jbj: reindent (and otherwise diddle) recent patch for popt coding style.
+ - jbj: remove splint bounds/branch annotations, little gain, much pain.
+ - jbj: revert alloca usage again again.
+ - jbj: handle Solaris signed character isspace(3) issues consistently.
+ - bero: read /etc/popt.d/* files.
+ - jbj: don't read /etc/popt twice (#290531).
+ - jbj: isspace(3) has i18n encoding signednesss issues on Solaris (#172393).
+ - jbj: refactor column cursor to a structure, carry maxcols as well.
+ - jbj: use TIOCGWINSZ to determine --help column wrapping.
+ - jbj: help formatting for POPT_ARG_MAINCALL.
+ - jbj: remove N_(...) markings from popt.h, markers in popthelp.c instead.
+ - jbj: add zh_CN.po (Translation Project).
+ - jbj: use PACKAGE_BUGREPORT.
+ - jbj: hotwire POPT_AUTOHELP/POPT_AUTOALIAS lookup in popt i18n domain.
+
+1.11 -> 1.12
+ - jbj: plug a memory leak.
+ - jbj: fix index thinko.
+ - jbj: add vi.po (Translation Project).
+ - jbj: add nl.po (Translation Project).
+
+1.5 -> 1.6
+ - add ability to perform callbacks for every, not just first, match.
+
+1.3 -> 1.5
+ - heavy dose of const's
+ - poptParseArgvString() now NULL terminates the list
+
+1.2.3 -> 1.3
+ - added support for single -
+ - misc bug fixes
+ - portability improvements
+
+1.2.2 -> 1.2.3
+ - fixed memset() in help message generation (Dale Hawkins)
+ - added extern "C" stuff to popt.h for C++ compilers (Dale Hawkins)
+ - const'ified poptParseArgvString (Jeff Garzik)
+
+1.2.1 -> 1.2.2
+ - fixed bug in chaind alias happens which seems to have only
+ affected --triggers in rpm
+ - added POPT_ARG_VAL
+ - popt.3 installed by default
+
+1.2 -> 1.2.1
+ - added POPT_ARG_INTL_DOMAIN (Elliot Lee)
+ - updated Makefile's to be more GNUish (Elliot Lee)
+
+1.1 -> 1.2
+ - added popt.3 man page (Robert Lynch)
+ - don't use mmap anymore (its lack of portability isn't worth the
+ trouble)
+ - added test script
+ - added support for exec
+ - removed support for *_POPT_ALIASES env variable -- it was a bad
+ idea
+ - reorganized into multiple source files
+ - added automatic help generation, POPT_AUTOHELP
+ - added table callbacks
+ - added table inclusion
+ - updated man page for new features
+ - added test scripts
+
+1.0 -> 1.1
+ - moved to autoconf (Fred Fish)
+ - added STRERROR replacement (Norbert Warmuth)
+ - added const keywords (Bruce Perens)
diff --git a/popt-1.16/COPYING b/popt-1.16/COPYING
new file mode 100644
index 0000000..b4c7ca8
--- /dev/null
+++ b/popt-1.16/COPYING
@@ -0,0 +1,22 @@
+Copyright (c) 1998 Red Hat Software
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN
+AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+Except as contained in this notice, the name of the X Consortium shall not be
+used in advertising or otherwise to promote the sale, use or other dealings
+in this Software without prior written authorization from the X Consortium.
diff --git a/popt-1.16/Doxyfile.in b/popt-1.16/Doxyfile.in
new file mode 100644
index 0000000..737a73e
--- /dev/null
+++ b/popt-1.16/Doxyfile.in
@@ -0,0 +1,1246 @@
+# Doxyfile 1.4.6
+
+# This file describes the settings to be used by the documentation system
+# doxygen (www.doxygen.org) for a project
+#
+# All text after a hash (#) is considered a comment and will be ignored
+# The format is:
+# TAG = value [value, ...]
+# For lists items can also be appended using:
+# TAG += value [value, ...]
+# Values that contain spaces should be placed between quotes (" ")
+
+#---------------------------------------------------------------------------
+# Project related configuration options
+#---------------------------------------------------------------------------
+
+# The PROJECT_NAME tag is a single word (or a sequence of words surrounded
+# by quotes) that should identify the project.
+
+PROJECT_NAME = @PACKAGE@
+
+# The PROJECT_NUMBER tag can be used to enter a project or revision number.
+# This could be handy for archiving the generated documentation or
+# if some version control system is used.
+
+PROJECT_NUMBER = @VERSION@
+
+# The OUTPUT_DIRECTORY tag is used to specify the (relative or absolute)
+# base path where the generated documentation will be put.
+# If a relative path is entered, it will be relative to the location
+# where doxygen was started. If left blank the current directory will be used.
+
+OUTPUT_DIRECTORY = doxygen
+
+# If the CREATE_SUBDIRS tag is set to YES, then doxygen will create
+# 4096 sub-directories (in 2 levels) under the output directory of each output
+# format and will distribute the generated files over these directories.
+# Enabling this option can be useful when feeding doxygen a huge amount of
+# source files, where putting all generated files in the same directory would
+# otherwise cause performance problems for the file system.
+
+CREATE_SUBDIRS = NO
+
+# The OUTPUT_LANGUAGE tag is used to specify the language in which all
+# documentation generated by doxygen is written. Doxygen will use this
+# information to generate all constant output in the proper language.
+# The default language is English, other supported languages are:
+# Brazilian, Catalan, Chinese, Chinese-Traditional, Croatian, Czech, Danish,
+# Dutch, Finnish, French, German, Greek, Hungarian, Italian, Japanese,
+# Japanese-en (Japanese with English messages), Korean, Korean-en, Norwegian,
+# Polish, Portuguese, Romanian, Russian, Serbian, Slovak, Slovene, Spanish,
+# Swedish, and Ukrainian.
+
+OUTPUT_LANGUAGE = English
+
+# This tag can be used to specify the encoding used in the generated output.
+# The encoding is not always determined by the language that is chosen,
+# but also whether or not the output is meant for Windows or non-Windows users.
+# In case there is a difference, setting the USE_WINDOWS_ENCODING tag to YES
+# forces the Windows encoding (this is the default for the Windows binary),
+# whereas setting the tag to NO uses a Unix-style encoding (the default for
+# all platforms other than Windows).
+
+USE_WINDOWS_ENCODING = NO
+
+# If the BRIEF_MEMBER_DESC tag is set to YES (the default) Doxygen will
+# include brief member descriptions after the members that are listed in
+# the file and class documentation (similar to JavaDoc).
+# Set to NO to disable this.
+
+BRIEF_MEMBER_DESC = YES
+
+# If the REPEAT_BRIEF tag is set to YES (the default) Doxygen will prepend
+# the brief description of a member or function before the detailed description.
+# Note: if both HIDE_UNDOC_MEMBERS and BRIEF_MEMBER_DESC are set to NO, the
+# brief descriptions will be completely suppressed.
+
+REPEAT_BRIEF = YES
+
+# This tag implements a quasi-intelligent brief description abbreviator
+# that is used to form the text in various listings. Each string
+# in this list, if found as the leading text of the brief description, will be
+# stripped from the text and the result after processing the whole list, is
+# used as the annotated text. Otherwise, the brief description is used as-is.
+# If left blank, the following values are used ("$name" is automatically
+# replaced with the name of the entity): "The $name class" "The $name widget"
+# "The $name file" "is" "provides" "specifies" "contains"
+# "represents" "a" "an" "the"
+
+ABBREVIATE_BRIEF =
+
+# If the ALWAYS_DETAILED_SEC and REPEAT_BRIEF tags are both set to YES then
+# Doxygen will generate a detailed section even if there is only a brief
+# description.
+
+ALWAYS_DETAILED_SEC = NO
+
+# If the INLINE_INHERITED_MEMB tag is set to YES, doxygen will show all
+# inherited members of a class in the documentation of that class as if those
+# members were ordinary class members. Constructors, destructors and assignment
+# operators of the base classes will not be shown.
+
+INLINE_INHERITED_MEMB = NO
+
+# If the FULL_PATH_NAMES tag is set to YES then Doxygen will prepend the full
+# path before files name in the file list and in the header files. If set
+# to NO the shortest path that makes the file name unique will be used.
+
+FULL_PATH_NAMES = YES
+
+# If the FULL_PATH_NAMES tag is set to YES then the STRIP_FROM_PATH tag
+# can be used to strip a user-defined part of the path. Stripping is
+# only done if one of the specified strings matches the left-hand part of
+# the path. The tag can be used to show relative paths in the file list.
+# If left blank the directory from which doxygen is run is used as the
+# path to strip.
+
+STRIP_FROM_PATH = @top_srcdir@/
+
+# The STRIP_FROM_INC_PATH tag can be used to strip a user-defined part of
+# the path mentioned in the documentation of a class, which tells
+# the reader which header file to include in order to use a class.
+# If left blank only the name of the header file containing the class
+# definition is used. Otherwise one should specify the include paths that
+# are normally passed to the compiler using the -I flag.
+
+STRIP_FROM_INC_PATH = @top_srcdir@/
+
+# If the SHORT_NAMES tag is set to YES, doxygen will generate much shorter
+# (but less readable) file names. This can be useful is your file systems
+# doesn't support long names like on DOS, Mac, or CD-ROM.
+
+SHORT_NAMES = NO
+
+# If the JAVADOC_AUTOBRIEF tag is set to YES then Doxygen
+# will interpret the first line (until the first dot) of a JavaDoc-style
+# comment as the brief description. If set to NO, the JavaDoc
+# comments will behave just like the Qt-style comments (thus requiring an
+# explicit @brief command for a brief description.
+
+JAVADOC_AUTOBRIEF = YES
+
+# The MULTILINE_CPP_IS_BRIEF tag can be set to YES to make Doxygen
+# treat a multi-line C++ special comment block (i.e. a block of //! or ///
+# comments) as a brief description. This used to be the default behaviour.
+# The new default is to treat a multi-line C++ comment block as a detailed
+# description. Set this tag to YES if you prefer the old behaviour instead.
+
+MULTILINE_CPP_IS_BRIEF = NO
+
+# If the DETAILS_AT_TOP tag is set to YES then Doxygen
+# will output the detailed description near the top, like JavaDoc.
+# If set to NO, the detailed description appears after the member
+# documentation.
+
+DETAILS_AT_TOP = NO
+
+# If the INHERIT_DOCS tag is set to YES (the default) then an undocumented
+# member inherits the documentation from any documented member that it
+# re-implements.
+
+INHERIT_DOCS = YES
+
+# If the SEPARATE_MEMBER_PAGES tag is set to YES, then doxygen will produce
+# a new page for each member. If set to NO, the documentation of a member will
+# be part of the file/class/namespace that contains it.
+
+SEPARATE_MEMBER_PAGES = NO
+
+# The TAB_SIZE tag can be used to set the number of spaces in a tab.
+# Doxygen uses this value to replace tabs by spaces in code fragments.
+
+TAB_SIZE = 8
+
+# This tag can be used to specify a number of aliases that acts
+# as commands in the documentation. An alias has the form "name=value".
+# For example adding "sideeffect=\par Side Effects:\n" will allow you to
+# put the command \sideeffect (or @sideeffect) in the documentation, which
+# will result in a user-defined paragraph with heading "Side Effects:".
+# You can put \n's in the value part of an alias to insert newlines.
+
+ALIASES =
+
+# Set the OPTIMIZE_OUTPUT_FOR_C tag to YES if your project consists of C
+# sources only. Doxygen will then generate output that is more tailored for C.
+# For instance, some of the names that are used will be different. The list
+# of all members will be omitted, etc.
+
+OPTIMIZE_OUTPUT_FOR_C = YES
+
+# Set the OPTIMIZE_OUTPUT_JAVA tag to YES if your project consists of Java
+# sources only. Doxygen will then generate output that is more tailored for Java.
+# For instance, namespaces will be presented as packages, qualified scopes
+# will look different, etc.
+
+OPTIMIZE_OUTPUT_JAVA = NO
+
+# If you use STL classes (i.e. std::string, std::vector, etc.) but do not want to
+# include (a tag file for) the STL sources as input, then you should
+# set this tag to YES in order to let doxygen match functions declarations and
+# definitions whose arguments contain STL classes (e.g. func(std::string); v.s.
+# func(std::string) {}). This also make the inheritance and collaboration
+# diagrams that involve STL classes more complete and accurate.
+
+BUILTIN_STL_SUPPORT = NO
+
+# If member grouping is used in the documentation and the DISTRIBUTE_GROUP_DOC
+# tag is set to YES, then doxygen will reuse the documentation of the first
+# member in the group (if any) for the other members of the group. By default
+# all members of a group must be documented explicitly.
+
+DISTRIBUTE_GROUP_DOC = NO
+
+# Set the SUBGROUPING tag to YES (the default) to allow class member groups of
+# the same type (for instance a group of public functions) to be put as a
+# subgroup of that type (e.g. under the Public Functions section). Set it to
+# NO to prevent subgrouping. Alternatively, this can be done per class using
+# the \nosubgrouping command.
+
+SUBGROUPING = YES
+
+#---------------------------------------------------------------------------
+# Build related configuration options
+#---------------------------------------------------------------------------
+
+# If the EXTRACT_ALL tag is set to YES doxygen will assume all entities in
+# documentation are documented, even if no documentation was available.
+# Private class members and static file members will be hidden unless
+# the EXTRACT_PRIVATE and EXTRACT_STATIC tags are set to YES
+
+EXTRACT_ALL = YES
+
+# If the EXTRACT_PRIVATE tag is set to YES all private members of a class
+# will be included in the documentation.
+
+EXTRACT_PRIVATE = NO
+
+# If the EXTRACT_STATIC tag is set to YES all static members of a file
+# will be included in the documentation.
+
+EXTRACT_STATIC = YES
+
+# If the EXTRACT_LOCAL_CLASSES tag is set to YES classes (and structs)
+# defined locally in source files will be included in the documentation.
+# If set to NO only classes defined in header files are included.
+
+EXTRACT_LOCAL_CLASSES = YES
+
+# This flag is only useful for Objective-C code. When set to YES local
+# methods, which are defined in the implementation section but not in
+# the interface are included in the documentation.
+# If set to NO (the default) only methods in the interface are included.
+
+EXTRACT_LOCAL_METHODS = NO
+
+# If the HIDE_UNDOC_MEMBERS tag is set to YES, Doxygen will hide all
+# undocumented members of documented classes, files or namespaces.
+# If set to NO (the default) these members will be included in the
+# various overviews, but no documentation section is generated.
+# This option has no effect if EXTRACT_ALL is enabled.
+
+HIDE_UNDOC_MEMBERS = NO
+
+# If the HIDE_UNDOC_CLASSES tag is set to YES, Doxygen will hide all
+# undocumented classes that are normally visible in the class hierarchy.
+# If set to NO (the default) these classes will be included in the various
+# overviews. This option has no effect if EXTRACT_ALL is enabled.
+
+HIDE_UNDOC_CLASSES = NO
+
+# If the HIDE_FRIEND_COMPOUNDS tag is set to YES, Doxygen will hide all
+# friend (class|struct|union) declarations.
+# If set to NO (the default) these declarations will be included in the
+# documentation.
+
+HIDE_FRIEND_COMPOUNDS = NO
+
+# If the HIDE_IN_BODY_DOCS tag is set to YES, Doxygen will hide any
+# documentation blocks found inside the body of a function.
+# If set to NO (the default) these blocks will be appended to the
+# function's detailed documentation block.
+
+HIDE_IN_BODY_DOCS = NO
+
+# The INTERNAL_DOCS tag determines if documentation
+# that is typed after a \internal command is included. If the tag is set
+# to NO (the default) then the documentation will be excluded.
+# Set it to YES to include the internal documentation.
+
+INTERNAL_DOCS = YES
+
+# If the CASE_SENSE_NAMES tag is set to NO then Doxygen will only generate
+# file names in lower-case letters. If set to YES upper-case letters are also
+# allowed. This is useful if you have classes or files whose names only differ
+# in case and if your file system supports case sensitive file names. Windows
+# and Mac users are advised to set this option to NO.
+
+CASE_SENSE_NAMES = YES
+
+# If the HIDE_SCOPE_NAMES tag is set to NO (the default) then Doxygen
+# will show members with their full class and namespace scopes in the
+# documentation. If set to YES the scope will be hidden.
+
+HIDE_SCOPE_NAMES = NO
+
+# If the SHOW_INCLUDE_FILES tag is set to YES (the default) then Doxygen
+# will put a list of the files that are included by a file in the documentation
+# of that file.
+
+SHOW_INCLUDE_FILES = YES
+
+# If the INLINE_INFO tag is set to YES (the default) then a tag [inline]
+# is inserted in the documentation for inline members.
+
+INLINE_INFO = YES
+
+# If the SORT_MEMBER_DOCS tag is set to YES (the default) then doxygen
+# will sort the (detailed) documentation of file and class members
+# alphabetically by member name. If set to NO the members will appear in
+# declaration order.
+
+SORT_MEMBER_DOCS = YES
+
+# If the SORT_BRIEF_DOCS tag is set to YES then doxygen will sort the
+# brief documentation of file, namespace and class members alphabetically
+# by member name. If set to NO (the default) the members will appear in
+# declaration order.
+
+SORT_BRIEF_DOCS = NO
+
+# If the SORT_BY_SCOPE_NAME tag is set to YES, the class list will be
+# sorted by fully-qualified names, including namespaces. If set to
+# NO (the default), the class list will be sorted only by class name,
+# not including the namespace part.
+# Note: This option is not very useful if HIDE_SCOPE_NAMES is set to YES.
+# Note: This option applies only to the class list, not to the
+# alphabetical list.
+
+SORT_BY_SCOPE_NAME = NO
+
+# The GENERATE_TODOLIST tag can be used to enable (YES) or
+# disable (NO) the todo list. This list is created by putting \todo
+# commands in the documentation.
+
+GENERATE_TODOLIST = YES
+
+# The GENERATE_TESTLIST tag can be used to enable (YES) or
+# disable (NO) the test list. This list is created by putting \test
+# commands in the documentation.
+
+GENERATE_TESTLIST = YES
+
+# The GENERATE_BUGLIST tag can be used to enable (YES) or
+# disable (NO) the bug list. This list is created by putting \bug
+# commands in the documentation.
+
+GENERATE_BUGLIST = YES
+
+# The GENERATE_DEPRECATEDLIST tag can be used to enable (YES) or
+# disable (NO) the deprecated list. This list is created by putting
+# \deprecated commands in the documentation.
+
+GENERATE_DEPRECATEDLIST= YES
+
+# The ENABLED_SECTIONS tag can be used to enable conditional
+# documentation sections, marked by \if sectionname ... \endif.
+
+ENABLED_SECTIONS =
+
+# The MAX_INITIALIZER_LINES tag determines the maximum number of lines
+# the initial value of a variable or define consists of for it to appear in
+# the documentation. If the initializer consists of more lines than specified
+# here it will be hidden. Use a value of 0 to hide initializers completely.
+# The appearance of the initializer of individual variables and defines in the
+# documentation can be controlled using \showinitializer or \hideinitializer
+# command in the documentation regardless of this setting.
+
+MAX_INITIALIZER_LINES = 30
+
+# Set the SHOW_USED_FILES tag to NO to disable the list of files generated
+# at the bottom of the documentation of classes and structs. If set to YES the
+# list will mention the files that were used to generate the documentation.
+
+SHOW_USED_FILES = YES
+
+# If the sources in your project are distributed over multiple directories
+# then setting the SHOW_DIRECTORIES tag to YES will show the directory hierarchy
+# in the documentation. The default is NO.
+
+SHOW_DIRECTORIES = NO
+
+# The FILE_VERSION_FILTER tag can be used to specify a program or script that
+# doxygen should invoke to get the current version for each file (typically from the
+# version control system). Doxygen will invoke the program by executing (via
+# popen()) the command <command> <input-file>, where <command> is the value of
+# the FILE_VERSION_FILTER tag, and <input-file> is the name of an input file
+# provided by doxygen. Whatever the program writes to standard output
+# is used as the file version. See the manual for examples.
+
+FILE_VERSION_FILTER =
+
+#---------------------------------------------------------------------------
+# configuration options related to warning and progress messages
+#---------------------------------------------------------------------------
+
+# The QUIET tag can be used to turn on/off the messages that are generated
+# by doxygen. Possible values are YES and NO. If left blank NO is used.
+
+QUIET = NO
+
+# The WARNINGS tag can be used to turn on/off the warning messages that are
+# generated by doxygen. Possible values are YES and NO. If left blank
+# NO is used.
+
+WARNINGS = YES
+
+# If WARN_IF_UNDOCUMENTED is set to YES, then doxygen will generate warnings
+# for undocumented members. If EXTRACT_ALL is set to YES then this flag will
+# automatically be disabled.
+
+WARN_IF_UNDOCUMENTED = YES
+
+# If WARN_IF_DOC_ERROR is set to YES, doxygen will generate warnings for
+# potential errors in the documentation, such as not documenting some
+# parameters in a documented function, or documenting parameters that
+# don't exist or using markup commands wrongly.
+
+WARN_IF_DOC_ERROR = YES
+
+# This WARN_NO_PARAMDOC option can be abled to get warnings for
+# functions that are documented, but have no documentation for their parameters
+# or return value. If set to NO (the default) doxygen will only warn about
+# wrong or incomplete parameter documentation, but not about the absence of
+# documentation.
+
+WARN_NO_PARAMDOC = NO
+
+# The WARN_FORMAT tag determines the format of the warning messages that
+# doxygen can produce. The string should contain the $file, $line, and $text
+# tags, which will be replaced by the file and line number from which the
+# warning originated and the warning text. Optionally the format may contain
+# $version, which will be replaced by the version of the file (if it could
+# be obtained via FILE_VERSION_FILTER)
+
+WARN_FORMAT = "$file:$line: $text"
+
+# The WARN_LOGFILE tag can be used to specify a file to which warning
+# and error messages should be written. If left blank the output is written
+# to stderr.
+
+WARN_LOGFILE =
+
+#---------------------------------------------------------------------------
+# configuration options related to the input files
+#---------------------------------------------------------------------------
+
+# The INPUT tag can be used to specify the files and/or directories that contain
+# documented source files. You may enter file names like "myfile.cpp" or
+# directories like "/usr/src/myproject". Separate the files or directories
+# with spaces.
+
+INPUT = \
+ ./popt.c \
+ ./popt.h \
+ ./poptconfig.c \
+ ./popthelp.c \
+ ./poptint.c \
+ ./poptint.h \
+ ./poptparse.c \
+ ./system.h
+
+# If the value of the INPUT tag contains directories, you can use the
+# FILE_PATTERNS tag to specify one or more wildcard pattern (like *.cpp
+# and *.h) to filter out the source-files in the directories. If left
+# blank the following patterns are tested:
+# *.c *.cc *.cxx *.cpp *.c++ *.java *.ii *.ixx *.ipp *.i++ *.inl *.h *.hh *.hxx
+# *.hpp *.h++ *.idl *.odl *.cs *.php *.php3 *.inc *.m *.mm *.py
+
+FILE_PATTERNS = *.c \
+ *.h
+
+# The RECURSIVE tag can be used to turn specify whether or not subdirectories
+# should be searched for input files as well. Possible values are YES and NO.
+# If left blank NO is used.
+
+RECURSIVE = NO
+
+# The EXCLUDE tag can be used to specify files and/or directories that should
+# excluded from the INPUT source files. This way you can easily exclude a
+# subdirectory from a directory tree whose root is specified with the INPUT tag.
+
+EXCLUDE =
+
+# The EXCLUDE_SYMLINKS tag can be used select whether or not files or
+# directories that are symbolic links (a Unix filesystem feature) are excluded
+# from the input.
+
+EXCLUDE_SYMLINKS = NO
+
+# If the value of the INPUT tag contains directories, you can use the
+# EXCLUDE_PATTERNS tag to specify one or more wildcard patterns to exclude
+# certain files from those directories. Note that the wildcards are matched
+# against the file with absolute path, so to exclude all test directories
+# for example use the pattern */test/*
+
+EXCLUDE_PATTERNS =
+
+# The EXAMPLE_PATH tag can be used to specify one or more files or
+# directories that contain example code fragments that are included (see
+# the \include command).
+
+EXAMPLE_PATH =
+
+# If the value of the EXAMPLE_PATH tag contains directories, you can use the
+# EXAMPLE_PATTERNS tag to specify one or more wildcard pattern (like *.cpp
+# and *.h) to filter out the source-files in the directories. If left
+# blank all files are included.
+
+EXAMPLE_PATTERNS =
+
+# If the EXAMPLE_RECURSIVE tag is set to YES then subdirectories will be
+# searched for input files to be used with the \include or \dontinclude
+# commands irrespective of the value of the RECURSIVE tag.
+# Possible values are YES and NO. If left blank NO is used.
+
+EXAMPLE_RECURSIVE = NO
+
+# The IMAGE_PATH tag can be used to specify one or more files or
+# directories that contain image that are included in the documentation (see
+# the \image command).
+
+IMAGE_PATH =
+
+# The INPUT_FILTER tag can be used to specify a program that doxygen should
+# invoke to filter for each input file. Doxygen will invoke the filter program
+# by executing (via popen()) the command <filter> <input-file>, where <filter>
+# is the value of the INPUT_FILTER tag, and <input-file> is the name of an
+# input file. Doxygen will then use the output that the filter program writes
+# to standard output. If FILTER_PATTERNS is specified, this tag will be
+# ignored.
+
+INPUT_FILTER =
+
+# The FILTER_PATTERNS tag can be used to specify filters on a per file pattern
+# basis. Doxygen will compare the file name with each pattern and apply the
+# filter if there is a match. The filters are a list of the form:
+# pattern=filter (like *.cpp=my_cpp_filter). See INPUT_FILTER for further
+# info on how filters are used. If FILTER_PATTERNS is empty, INPUT_FILTER
+# is applied to all files.
+
+FILTER_PATTERNS =
+
+# If the FILTER_SOURCE_FILES tag is set to YES, the input filter (if set using
+# INPUT_FILTER) will be used to filter the input files when producing source
+# files to browse (i.e. when SOURCE_BROWSER is set to YES).
+
+FILTER_SOURCE_FILES = NO
+
+#---------------------------------------------------------------------------
+# configuration options related to source browsing
+#---------------------------------------------------------------------------
+
+# If the SOURCE_BROWSER tag is set to YES then a list of source files will
+# be generated. Documented entities will be cross-referenced with these sources.
+# Note: To get rid of all source code in the generated output, make sure also
+# VERBATIM_HEADERS is set to NO.
+
+SOURCE_BROWSER = YES
+
+# Setting the INLINE_SOURCES tag to YES will include the body
+# of functions and classes directly in the documentation.
+
+INLINE_SOURCES = NO
+
+# Setting the STRIP_CODE_COMMENTS tag to YES (the default) will instruct
+# doxygen to hide any special comment blocks from generated source code
+# fragments. Normal C and C++ comments will always remain visible.
+
+STRIP_CODE_COMMENTS = YES
+
+# If the REFERENCED_BY_RELATION tag is set to YES (the default)
+# then for each documented function all documented
+# functions referencing it will be listed.
+
+REFERENCED_BY_RELATION = YES
+
+# If the REFERENCES_RELATION tag is set to YES (the default)
+# then for each documented function all documented entities
+# called/used by that function will be listed.
+
+REFERENCES_RELATION = YES
+
+# If the USE_HTAGS tag is set to YES then the references to source code
+# will point to the HTML generated by the htags(1) tool instead of doxygen
+# built-in source browser. The htags tool is part of GNU's global source
+# tagging system (see http://www.gnu.org/software/global/global.html). You
+# will need version 4.8.6 or higher.
+
+USE_HTAGS = NO
+
+# If the VERBATIM_HEADERS tag is set to YES (the default) then Doxygen
+# will generate a verbatim copy of the header file for each class for
+# which an include is specified. Set to NO to disable this.
+
+VERBATIM_HEADERS = YES
+
+#---------------------------------------------------------------------------
+# configuration options related to the alphabetical class index
+#---------------------------------------------------------------------------
+
+# If the ALPHABETICAL_INDEX tag is set to YES, an alphabetical index
+# of all compounds will be generated. Enable this if the project
+# contains a lot of classes, structs, unions or interfaces.
+
+ALPHABETICAL_INDEX = NO
+
+# If the alphabetical index is enabled (see ALPHABETICAL_INDEX) then
+# the COLS_IN_ALPHA_INDEX tag can be used to specify the number of columns
+# in which this list will be split (can be a number in the range [1..20])
+
+COLS_IN_ALPHA_INDEX = 5
+
+# In case all classes in a project start with a common prefix, all
+# classes will be put under the same header in the alphabetical index.
+# The IGNORE_PREFIX tag can be used to specify one or more prefixes that
+# should be ignored while generating the index headers.
+
+IGNORE_PREFIX =
+
+#---------------------------------------------------------------------------
+# configuration options related to the HTML output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_HTML tag is set to YES (the default) Doxygen will
+# generate HTML output.
+
+GENERATE_HTML = YES
+
+# The HTML_OUTPUT tag is used to specify where the HTML docs will be put.
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be
+# put in front of it. If left blank `html' will be used as the default path.
+
+HTML_OUTPUT = html
+
+# The HTML_FILE_EXTENSION tag can be used to specify the file extension for
+# each generated HTML page (for example: .htm,.php,.asp). If it is left blank
+# doxygen will generate files with .html extension.
+
+HTML_FILE_EXTENSION = .html
+
+# The HTML_HEADER tag can be used to specify a personal HTML header for
+# each generated HTML page. If it is left blank doxygen will generate a
+# standard header.
+
+HTML_HEADER =
+
+# The HTML_FOOTER tag can be used to specify a personal HTML footer for
+# each generated HTML page. If it is left blank doxygen will generate a
+# standard footer.
+
+HTML_FOOTER = footer_no_timestamp.html
+
+# The HTML_STYLESHEET tag can be used to specify a user-defined cascading
+# style sheet that is used by each HTML page. It can be used to
+# fine-tune the look of the HTML output. If the tag is left blank doxygen
+# will generate a default style sheet. Note that doxygen will try to copy
+# the style sheet file to the HTML output directory, so don't put your own
+# stylesheet in the HTML output directory as well, or it will be erased!
+
+HTML_STYLESHEET =
+
+# If the HTML_ALIGN_MEMBERS tag is set to YES, the members of classes,
+# files or namespaces will be aligned in HTML using tables. If set to
+# NO a bullet list will be used.
+
+HTML_ALIGN_MEMBERS = YES
+
+# If the GENERATE_HTMLHELP tag is set to YES, additional index files
+# will be generated that can be used as input for tools like the
+# Microsoft HTML help workshop to generate a compressed HTML help file (.chm)
+# of the generated HTML documentation.
+
+GENERATE_HTMLHELP = NO
+
+# If the GENERATE_HTMLHELP tag is set to YES, the CHM_FILE tag can
+# be used to specify the file name of the resulting .chm file. You
+# can add a path in front of the file if the result should not be
+# written to the html output directory.
+
+CHM_FILE =
+
+# If the GENERATE_HTMLHELP tag is set to YES, the HHC_LOCATION tag can
+# be used to specify the location (absolute path including file name) of
+# the HTML help compiler (hhc.exe). If non-empty doxygen will try to run
+# the HTML help compiler on the generated index.hhp.
+
+HHC_LOCATION =
+
+# If the GENERATE_HTMLHELP tag is set to YES, the GENERATE_CHI flag
+# controls if a separate .chi index file is generated (YES) or that
+# it should be included in the master .chm file (NO).
+
+GENERATE_CHI = NO
+
+# If the GENERATE_HTMLHELP tag is set to YES, the BINARY_TOC flag
+# controls whether a binary table of contents is generated (YES) or a
+# normal table of contents (NO) in the .chm file.
+
+BINARY_TOC = NO
+
+# The TOC_EXPAND flag can be set to YES to add extra items for group members
+# to the contents of the HTML help documentation and to the tree view.
+
+TOC_EXPAND = NO
+
+# The DISABLE_INDEX tag can be used to turn on/off the condensed index at
+# top of each HTML page. The value NO (the default) enables the index and
+# the value YES disables it.
+
+DISABLE_INDEX = NO
+
+# This tag can be used to set the number of enum values (range [1..20])
+# that doxygen will group on one line in the generated HTML documentation.
+
+ENUM_VALUES_PER_LINE = 4
+
+# If the GENERATE_TREEVIEW tag is set to YES, a side panel will be
+# generated containing a tree-like index structure (just like the one that
+# is generated for HTML Help). For this to work a browser that supports
+# JavaScript, DHTML, CSS and frames is required (for instance Mozilla 1.0+,
+# Netscape 6.0+, Internet explorer 5.0+, or Konqueror). Windows users are
+# probably better off using the HTML help feature.
+
+GENERATE_TREEVIEW = NO
+
+# If the treeview is enabled (see GENERATE_TREEVIEW) then this tag can be
+# used to set the initial width (in pixels) of the frame in which the tree
+# is shown.
+
+TREEVIEW_WIDTH = 250
+
+#---------------------------------------------------------------------------
+# configuration options related to the LaTeX output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_LATEX tag is set to YES (the default) Doxygen will
+# generate Latex output.
+
+GENERATE_LATEX = NO
+
+# The LATEX_OUTPUT tag is used to specify where the LaTeX docs will be put.
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be
+# put in front of it. If left blank `latex' will be used as the default path.
+
+LATEX_OUTPUT = latex
+
+# The LATEX_CMD_NAME tag can be used to specify the LaTeX command name to be
+# invoked. If left blank `latex' will be used as the default command name.
+
+LATEX_CMD_NAME = latex
+
+# The MAKEINDEX_CMD_NAME tag can be used to specify the command name to
+# generate index for LaTeX. If left blank `makeindex' will be used as the
+# default command name.
+
+MAKEINDEX_CMD_NAME = makeindex
+
+# If the COMPACT_LATEX tag is set to YES Doxygen generates more compact
+# LaTeX documents. This may be useful for small projects and may help to
+# save some trees in general.
+
+COMPACT_LATEX = NO
+
+# The PAPER_TYPE tag can be used to set the paper type that is used
+# by the printer. Possible values are: a4, a4wide, letter, legal and
+# executive. If left blank a4wide will be used.
+
+PAPER_TYPE = letter
+
+# The EXTRA_PACKAGES tag can be to specify one or more names of LaTeX
+# packages that should be included in the LaTeX output.
+
+EXTRA_PACKAGES =
+
+# The LATEX_HEADER tag can be used to specify a personal LaTeX header for
+# the generated latex document. The header should contain everything until
+# the first chapter. If it is left blank doxygen will generate a
+# standard header. Notice: only use this tag if you know what you are doing!
+
+LATEX_HEADER =
+
+# If the PDF_HYPERLINKS tag is set to YES, the LaTeX that is generated
+# is prepared for conversion to pdf (using ps2pdf). The pdf file will
+# contain links (just like the HTML output) instead of page references
+# This makes the output suitable for online browsing using a pdf viewer.
+
+PDF_HYPERLINKS = YES
+
+# If the USE_PDFLATEX tag is set to YES, pdflatex will be used instead of
+# plain latex in the generated Makefile. Set this option to YES to get a
+# higher quality PDF documentation.
+
+USE_PDFLATEX = YES
+
+# If the LATEX_BATCHMODE tag is set to YES, doxygen will add the \\batchmode.
+# command to the generated LaTeX files. This will instruct LaTeX to keep
+# running if errors occur, instead of asking the user for help.
+# This option is also used when generating formulas in HTML.
+
+LATEX_BATCHMODE = NO
+
+# If LATEX_HIDE_INDICES is set to YES then doxygen will not
+# include the index chapters (such as File Index, Compound Index, etc.)
+# in the output.
+
+LATEX_HIDE_INDICES = NO
+
+#---------------------------------------------------------------------------
+# configuration options related to the RTF output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_RTF tag is set to YES Doxygen will generate RTF output
+# The RTF output is optimized for Word 97 and may not look very pretty with
+# other RTF readers or editors.
+
+GENERATE_RTF = NO
+
+# The RTF_OUTPUT tag is used to specify where the RTF docs will be put.
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be
+# put in front of it. If left blank `rtf' will be used as the default path.
+
+RTF_OUTPUT = rtf
+
+# If the COMPACT_RTF tag is set to YES Doxygen generates more compact
+# RTF documents. This may be useful for small projects and may help to
+# save some trees in general.
+
+COMPACT_RTF = NO
+
+# If the RTF_HYPERLINKS tag is set to YES, the RTF that is generated
+# will contain hyperlink fields. The RTF file will
+# contain links (just like the HTML output) instead of page references.
+# This makes the output suitable for online browsing using WORD or other
+# programs which support those fields.
+# Note: wordpad (write) and others do not support links.
+
+RTF_HYPERLINKS = NO
+
+# Load stylesheet definitions from file. Syntax is similar to doxygen's
+# config file, i.e. a series of assignments. You only have to provide
+# replacements, missing definitions are set to their default value.
+
+RTF_STYLESHEET_FILE =
+
+# Set optional variables used in the generation of an rtf document.
+# Syntax is similar to doxygen's config file.
+
+RTF_EXTENSIONS_FILE =
+
+#---------------------------------------------------------------------------
+# configuration options related to the man page output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_MAN tag is set to YES (the default) Doxygen will
+# generate man pages
+
+GENERATE_MAN = YES
+
+# The MAN_OUTPUT tag is used to specify where the man pages will be put.
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be
+# put in front of it. If left blank `man' will be used as the default path.
+
+MAN_OUTPUT = man
+
+# The MAN_EXTENSION tag determines the extension that is added to
+# the generated man pages (default is the subroutine's section .3)
+
+MAN_EXTENSION = .3
+
+# If the MAN_LINKS tag is set to YES and Doxygen generates man output,
+# then it will generate one additional man file for each entity
+# documented in the real man page(s). These additional files
+# only source the real man page, but without them the man command
+# would be unable to find the correct page. The default is NO.
+
+MAN_LINKS = NO
+
+#---------------------------------------------------------------------------
+# configuration options related to the XML output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_XML tag is set to YES Doxygen will
+# generate an XML file that captures the structure of
+# the code including all documentation.
+
+GENERATE_XML = NO
+
+# The XML_OUTPUT tag is used to specify where the XML pages will be put.
+# If a relative path is entered the value of OUTPUT_DIRECTORY will be
+# put in front of it. If left blank `xml' will be used as the default path.
+
+XML_OUTPUT = xml
+
+# The XML_SCHEMA tag can be used to specify an XML schema,
+# which can be used by a validating XML parser to check the
+# syntax of the XML files.
+
+XML_SCHEMA =
+
+# The XML_DTD tag can be used to specify an XML DTD,
+# which can be used by a validating XML parser to check the
+# syntax of the XML files.
+
+XML_DTD =
+
+# If the XML_PROGRAMLISTING tag is set to YES Doxygen will
+# dump the program listings (including syntax highlighting
+# and cross-referencing information) to the XML output. Note that
+# enabling this will significantly increase the size of the XML output.
+
+XML_PROGRAMLISTING = YES
+
+#---------------------------------------------------------------------------
+# configuration options for the AutoGen Definitions output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_AUTOGEN_DEF tag is set to YES Doxygen will
+# generate an AutoGen Definitions (see autogen.sf.net) file
+# that captures the structure of the code including all
+# documentation. Note that this feature is still experimental
+# and incomplete at the moment.
+
+GENERATE_AUTOGEN_DEF = NO
+
+#---------------------------------------------------------------------------
+# configuration options related to the Perl module output
+#---------------------------------------------------------------------------
+
+# If the GENERATE_PERLMOD tag is set to YES Doxygen will
+# generate a Perl module file that captures the structure of
+# the code including all documentation. Note that this
+# feature is still experimental and incomplete at the
+# moment.
+
+GENERATE_PERLMOD = NO
+
+# If the PERLMOD_LATEX tag is set to YES Doxygen will generate
+# the necessary Makefile rules, Perl scripts and LaTeX code to be able
+# to generate PDF and DVI output from the Perl module output.
+
+PERLMOD_LATEX = NO
+
+# If the PERLMOD_PRETTY tag is set to YES the Perl module output will be
+# nicely formatted so it can be parsed by a human reader. This is useful
+# if you want to understand what is going on. On the other hand, if this
+# tag is set to NO the size of the Perl module output will be much smaller
+# and Perl will parse it just the same.
+
+PERLMOD_PRETTY = YES
+
+# The names of the make variables in the generated doxyrules.make file
+# are prefixed with the string contained in PERLMOD_MAKEVAR_PREFIX.
+# This is useful so different doxyrules.make files included by the same
+# Makefile don't overwrite each other's variables.
+
+PERLMOD_MAKEVAR_PREFIX =
+
+#---------------------------------------------------------------------------
+# Configuration options related to the preprocessor
+#---------------------------------------------------------------------------
+
+# If the ENABLE_PREPROCESSING tag is set to YES (the default) Doxygen will
+# evaluate all C-preprocessor directives found in the sources and include
+# files.
+
+ENABLE_PREPROCESSING = YES
+
+# If the MACRO_EXPANSION tag is set to YES Doxygen will expand all macro
+# names in the source code. If set to NO (the default) only conditional
+# compilation will be performed. Macro expansion can be done in a controlled
+# way by setting EXPAND_ONLY_PREDEF to YES.
+
+MACRO_EXPANSION = YES
+
+# If the EXPAND_ONLY_PREDEF and MACRO_EXPANSION tags are both set to YES
+# then the macro expansion is limited to the macros specified with the
+# PREDEFINED and EXPAND_AS_DEFINED tags.
+
+EXPAND_ONLY_PREDEF = NO
+
+# If the SEARCH_INCLUDES tag is set to YES (the default) the includes files
+# in the INCLUDE_PATH (see below) will be search if a #include is found.
+
+SEARCH_INCLUDES = YES
+
+# The INCLUDE_PATH tag can be used to specify one or more directories that
+# contain include files that are not input files but should be processed by
+# the preprocessor.
+
+INCLUDE_PATH =
+
+# You can use the INCLUDE_FILE_PATTERNS tag to specify one or more wildcard
+# patterns (like *.h and *.hpp) to filter out the header-files in the
+# directories. If left blank, the patterns specified with FILE_PATTERNS will
+# be used.
+
+INCLUDE_FILE_PATTERNS =
+
+# The PREDEFINED tag can be used to specify one or more macro names that
+# are defined before the preprocessor is started (similar to the -D option of
+# gcc). The argument of the tag is a list of macros of the form: name
+# or name=definition (no spaces). If the definition and the = are
+# omitted =1 is assumed. To prevent a macro definition from being
+# undefined via #undef or recursively expanded use the := operator
+# instead of the = operator.
+
+PREDEFINED =
+
+# If the MACRO_EXPANSION and EXPAND_ONLY_PREDEF tags are set to YES then
+# this tag can be used to specify a list of macro names that should be expanded.
+# The macro definition that is found in the sources will be used.
+# Use the PREDEFINED tag if you want to use a different macro definition.
+
+EXPAND_AS_DEFINED =
+
+# If the SKIP_FUNCTION_MACROS tag is set to YES (the default) then
+# doxygen's preprocessor will remove all function-like macros that are alone
+# on a line, have an all uppercase name, and do not end with a semicolon. Such
+# function macros are typically used for boiler-plate code, and will confuse
+# the parser if not removed.
+
+SKIP_FUNCTION_MACROS = YES
+
+#---------------------------------------------------------------------------
+# Configuration::additions related to external references
+#---------------------------------------------------------------------------
+
+# The TAGFILES option can be used to specify one or more tagfiles.
+# Optionally an initial location of the external documentation
+# can be added for each tagfile. The format of a tag file without
+# this location is as follows:
+# TAGFILES = file1 file2 ...
+# Adding location for the tag files is done as follows:
+# TAGFILES = file1=loc1 "file2 = loc2" ...
+# where "loc1" and "loc2" can be relative or absolute paths or
+# URLs. If a location is present for each tag, the installdox tool
+# does not have to be run to correct the links.
+# Note that each tag file must have a unique name
+# (where the name does NOT include the path)
+# If a tag file is not located in the directory in which doxygen
+# is run, you must also specify the path to the tagfile here.
+
+TAGFILES =
+
+# When a file name is specified after GENERATE_TAGFILE, doxygen will create
+# a tag file that is based on the input files it reads.
+
+GENERATE_TAGFILE = Doxytags
+
+# If the ALLEXTERNALS tag is set to YES all external classes will be listed
+# in the class index. If set to NO only the inherited external classes
+# will be listed.
+
+ALLEXTERNALS = NO
+
+# If the EXTERNAL_GROUPS tag is set to YES all external groups will be listed
+# in the modules index. If set to NO, only the current project's groups will
+# be listed.
+
+EXTERNAL_GROUPS = YES
+
+# The PERL_PATH should be the absolute path and name of the perl script
+# interpreter (i.e. the result of `which perl').
+
+PERL_PATH = /usr/bin/perl
+
+#---------------------------------------------------------------------------
+# Configuration options related to the dot tool
+#---------------------------------------------------------------------------
+
+# If the CLASS_DIAGRAMS tag is set to YES (the default) Doxygen will
+# generate a inheritance diagram (in HTML, RTF and LaTeX) for classes with base
+# or super classes. Setting the tag to NO turns the diagrams off. Note that
+# this option is superseded by the HAVE_DOT option below. This is only a
+# fallback. It is recommended to install and use dot, since it yields more
+# powerful graphs.
+
+CLASS_DIAGRAMS = YES
+
+# If set to YES, the inheritance and collaboration graphs will hide
+# inheritance and usage relations if the target is undocumented
+# or is not a class.
+
+HIDE_UNDOC_RELATIONS = YES
+
+# If you set the HAVE_DOT tag to YES then doxygen will assume the dot tool is
+# available from the path. This tool is part of Graphviz, a graph visualization
+# toolkit from AT&T and Lucent Bell Labs. The other options in this section
+# have no effect if this option is set to NO (the default)
+
+HAVE_DOT = YES
+
+# If the CLASS_GRAPH and HAVE_DOT tags are set to YES then doxygen
+# will generate a graph for each documented class showing the direct and
+# indirect inheritance relations. Setting this tag to YES will force the
+# the CLASS_DIAGRAMS tag to NO.
+
+CLASS_GRAPH = YES
+
+# If the COLLABORATION_GRAPH and HAVE_DOT tags are set to YES then doxygen
+# will generate a graph for each documented class showing the direct and
+# indirect implementation dependencies (inheritance, containment, and
+# class references variables) of the class with other documented classes.
+
+COLLABORATION_GRAPH = YES
+
+# If the GROUP_GRAPHS and HAVE_DOT tags are set to YES then doxygen
+# will generate a graph for groups, showing the direct groups dependencies
+
+GROUP_GRAPHS = YES
+
+# If the UML_LOOK tag is set to YES doxygen will generate inheritance and
+# collaboration diagrams in a style similar to the OMG's Unified Modeling
+# Language.
+
+UML_LOOK = NO
+
+# If set to YES, the inheritance and collaboration graphs will show the
+# relations between templates and their instances.
+
+TEMPLATE_RELATIONS = YES
+
+# If the ENABLE_PREPROCESSING, SEARCH_INCLUDES, INCLUDE_GRAPH, and HAVE_DOT
+# tags are set to YES then doxygen will generate a graph for each documented
+# file showing the direct and indirect include dependencies of the file with
+# other documented files.
+
+INCLUDE_GRAPH = YES
+
+# If the ENABLE_PREPROCESSING, SEARCH_INCLUDES, INCLUDED_BY_GRAPH, and
+# HAVE_DOT tags are set to YES then doxygen will generate a graph for each
+# documented header file showing the documented files that directly or
+# indirectly include this file.
+
+INCLUDED_BY_GRAPH = YES
+
+# If the CALL_GRAPH and HAVE_DOT tags are set to YES then doxygen will
+# generate a call dependency graph for every global function or class method.
+# Note that enabling this option will significantly increase the time of a run.
+# So in most cases it will be better to enable call graphs for selected
+# functions only using the \callgraph command.
+
+CALL_GRAPH = NO
+
+# If the GRAPHICAL_HIERARCHY and HAVE_DOT tags are set to YES then doxygen
+# will graphical hierarchy of all classes instead of a textual one.
+
+GRAPHICAL_HIERARCHY = YES
+
+# If the DIRECTORY_GRAPH, SHOW_DIRECTORIES and HAVE_DOT tags are set to YES
+# then doxygen will show the dependencies a directory has on other directories
+# in a graphical way. The dependency relations are determined by the #include
+# relations between the files in the directories.
+
+DIRECTORY_GRAPH = YES
+
+# The DOT_IMAGE_FORMAT tag can be used to set the image format of the images
+# generated by dot. Possible values are png, jpg, or gif
+# If left blank png will be used.
+
+DOT_IMAGE_FORMAT = png
+
+# The tag DOT_PATH can be used to specify the path where the dot tool can be
+# found. If left blank, it is assumed the dot tool can be found in the path.
+
+DOT_PATH =
+
+# The DOTFILE_DIRS tag can be used to specify one or more directories that
+# contain dot files that are included in the documentation (see the
+# \dotfile command).
+
+DOTFILE_DIRS =
+
+# The MAX_DOT_GRAPH_WIDTH tag can be used to set the maximum allowed width
+# (in pixels) of the graphs generated by dot. If a graph becomes larger than
+# this value, doxygen will try to truncate the graph, so that it fits within
+# the specified constraint. Beware that most browsers cannot cope with very
+# large images.
+
+MAX_DOT_GRAPH_WIDTH = 1024
+
+# The MAX_DOT_GRAPH_HEIGHT tag can be used to set the maximum allows height
+# (in pixels) of the graphs generated by dot. If a graph becomes larger than
+# this value, doxygen will try to truncate the graph, so that it fits within
+# the specified constraint. Beware that most browsers cannot cope with very
+# large images.
+
+MAX_DOT_GRAPH_HEIGHT = 1024
+
+# The MAX_DOT_GRAPH_DEPTH tag can be used to set the maximum depth of the
+# graphs generated by dot. A depth value of 3 means that only nodes reachable
+# from the root by following a path via at most 3 edges will be shown. Nodes
+# that lay further from the root node will be omitted. Note that setting this
+# option to 1 or 2 may greatly reduce the computation time needed for large
+# code bases. Also note that a graph may be further truncated if the graph's
+# image dimensions are not sufficient to fit the graph (see MAX_DOT_GRAPH_WIDTH
+# and MAX_DOT_GRAPH_HEIGHT). If 0 is used for the depth value (the default),
+# the graph is not depth-constrained.
+
+MAX_DOT_GRAPH_DEPTH = 0
+
+# Set the DOT_TRANSPARENT tag to YES to generate images with a transparent
+# background. This is disabled by default, which results in a white background.
+# Warning: Depending on the platform used, enabling this option may lead to
+# badly anti-aliased labels on the edges of a graph (i.e. they become hard to
+# read).
+
+DOT_TRANSPARENT = NO
+
+# Set the DOT_MULTI_TARGETS tag to YES allow dot to generate multiple output
+# files in one run (i.e. multiple -o and -T options on the command line). This
+# makes dot run faster, but since only newer versions of dot (>1.8.10)
+# support this, this feature is disabled by default.
+
+DOT_MULTI_TARGETS = NO
+
+# If the GENERATE_LEGEND tag is set to YES (the default) Doxygen will
+# generate a legend page explaining the meaning of the various boxes and
+# arrows in the dot generated graphs.
+
+GENERATE_LEGEND = YES
+
+# If the DOT_CLEANUP tag is set to YES (the default) Doxygen will
+# remove the intermediate dot files that are used to generate
+# the various graphs.
+
+DOT_CLEANUP = YES
+
+#---------------------------------------------------------------------------
+# Configuration::additions related to the search engine
+#---------------------------------------------------------------------------
+
+# The SEARCHENGINE tag specifies whether or not a search engine should be
+# used. If set to NO the values of all tags below this one will be ignored.
+
+SEARCHENGINE = NO
diff --git a/popt-1.16/Makefile.am b/popt-1.16/Makefile.am
new file mode 100644
index 0000000..d7aec9e
--- /dev/null
+++ b/popt-1.16/Makefile.am
@@ -0,0 +1,118 @@
+# Makefile for popt library.
+
+AUTOMAKE_OPTIONS = 1.4 foreign
+
+LINT = splint
+MCCABE = pmccabe
+
+EXTRA_DIST = config.rpath lookup3.c autogen.sh CHANGES $(man_MANS) \
+ m4/Makefile.in \
+ footer_no_timestamp.html libpopt.vers \
+ testit.sh test-poptrc \
+ popt.xcodeproj/project.pbxproj \
+ popt.ps
+
+SUBDIRS = po . auto
+
+AM_CPPFLAGS = -I. -I$(top_srcdir)
+
+noinst_HEADERS = poptint.h system.h
+
+noinst_PROGRAMS = test1 test2 tdict # test3
+test1_SOURCES = test1.c
+test1_LDFLAGS =
+test1_LDADD = $(usrlib_LTLIBRARIES)
+test2_SOURCES = test2.c
+test2_LDFLAGS =
+test2_LDADD = $(usrlib_LTLIBRARIES)
+#test3_SOURCES = test3.c
+#test3_LDFLAGS =
+#test3_LDADD = $(usrlib_LTLIBRARIES)
+tdict_SOURCES = tdict.c
+tdict_LDFLAGS =
+tdict_LDADD = $(usrlib_LTLIBRARIES)
+
+noinst_SCRIPTS = testit.sh
+
+TESTS_ENVIRONMENT = \
+test1="$(top_builddir)/test1"
+
+TESTS = $(top_srcdir)/testit.sh
+
+include_HEADERS = popt.h
+
+usrlibdir = $(libdir)
+usrlib_LTLIBRARIES = libpopt.la
+
+libpopt_la_SOURCES = popt.c poptparse.c poptconfig.c popthelp.c poptint.c
+libpopt_la_LDFLAGS = -no-undefined @LTLIBINTL@ @LTLIBICONV@
+
+pkgconfigdir = $(prefix)/lib/pkgconfig
+pkgconfig_DATA = popt.pc
+
+if HAVE_LD_VERSION_SCRIPT
+libpopt_la_LDFLAGS += -Wl,--version-script=$(top_srcdir)/libpopt.vers
+endif
+
+man_MANS = popt.3
+
+BUILT_SOURCES = popt.pc # popt.lcd
+
+distclean-local:
+ rm -rf .ccache
+
+.PHONY: updatepo
+updatepo:
+ rsync -Lrtvz translationproject.org::tp/latest/popt/ po
+
+popt.lcd: Makefile.am ${libpopt_la_SOURCES} ${include_HEADERS} ${noinst_HEADERS}
+ lclint -dump $@ ${libpopt_la_SOURCES}
+
+.PHONY: sources
+sources:
+ @echo $(libpopt_la_SOURCES:%=popt/%)
+
+.PHONY: lint
+lint:
+ $(LINT) ${DEFS} ${INCLUDES} test1.c ${libpopt_la_SOURCES}
+
+.PHONY: mccabe
+mccabe:
+ $(MCCABE) $(libpopt_la_SOURCES) | sort -n -r | head -n 10
+
+.PHONY: doxygen
+doxygen: Doxyfile
+ rm -rf doxygen
+ mkdir -p doxygen
+ doxygen
+
+.PHONY: lcov-reset # run lcov from scratch, always
+lcov-reset:
+ make lcov-run
+ make lcov-report
+
+.PHONY: lcov # run lcov from scratch if the dir is not there
+lcov:
+ make lcov-reset
+
+.PHONY: lcov-run # reset run coverage tests
+lcov-run:
+ @-rm -rf lcov
+ find . -name "*.gcda" -exec rm {} \;
+ make check
+
+.PHONY: lcov-report # generate report based on current coverage data
+lcov-report:
+ mkdir lcov
+ lcov --directory . --capture --output-file lcov/lcov.info
+ lcov -l lcov/lcov.info | grep -v "`cd $(top_srcdir) && pwd`" | cut -d: -f1 > lcov/remove
+ lcov -r lcov/lcov.info `cat lcov/remove` > lcov/lcov.cleaned.info
+ rm lcov/remove
+ mv lcov/lcov.cleaned.info lcov/lcov.info
+ genhtml -t "$(PACKAGE_STRING)" -o lcov lcov/lcov.info
+
+#.PHONY: lcov-upload
+#lcov-upload: lcov
+# rsync -rvz -e ssh --delete lcov/* ???
+
+ACLOCAL_AMFLAGS = -I m4
diff --git a/popt-1.16/Makefile.in b/popt-1.16/Makefile.in
new file mode 100644
index 0000000..2e6890d
--- /dev/null
+++ b/popt-1.16/Makefile.in
@@ -0,0 +1,1234 @@
+# Makefile.in generated by automake 1.11.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002,
+# 2003, 2004, 2005, 2006, 2007, 2008, 2009 Free Software Foundation,
+# Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+# Makefile for popt library.
+
+
+
+
+
+VPATH = @srcdir@
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+target_triplet = @target@
+noinst_PROGRAMS = test1$(EXEEXT) test2$(EXEEXT) tdict$(EXEEXT)
+@HAVE_LD_VERSION_SCRIPT_TRUE@am__append_1 = -Wl,--version-script=$(top_srcdir)/libpopt.vers
+subdir = .
+DIST_COMMON = README $(am__configure_deps) $(include_HEADERS) \
+ $(noinst_HEADERS) $(srcdir)/Doxyfile.in $(srcdir)/Makefile.am \
+ $(srcdir)/Makefile.in $(srcdir)/config.h.in \
+ $(srcdir)/popt.pc.in $(srcdir)/popt.spec.in \
+ $(srcdir)/test-poptrc.in $(top_srcdir)/configure ABOUT-NLS \
+ COPYING config.guess config.rpath config.sub depcomp \
+ install-sh ltmain.sh missing
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/gettext.m4 \
+ $(top_srcdir)/m4/iconv.m4 $(top_srcdir)/m4/lib-ld.m4 \
+ $(top_srcdir)/m4/lib-link.m4 $(top_srcdir)/m4/lib-prefix.m4 \
+ $(top_srcdir)/m4/libtool.m4 $(top_srcdir)/m4/ltoptions.m4 \
+ $(top_srcdir)/m4/ltsugar.m4 $(top_srcdir)/m4/ltversion.m4 \
+ $(top_srcdir)/m4/lt~obsolete.m4 $(top_srcdir)/m4/nls.m4 \
+ $(top_srcdir)/m4/po.m4 $(top_srcdir)/m4/progtest.m4 \
+ $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+am__CONFIG_DISTCLEAN_FILES = config.status config.cache config.log \
+ configure.lineno config.status.lineno
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = config.h
+CONFIG_CLEAN_FILES = Doxyfile popt.pc popt.spec test-poptrc
+CONFIG_CLEAN_VPATH_FILES =
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+ $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+ *) f=$$p;; \
+ esac;
+am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`;
+am__install_max = 40
+am__nobase_strip_setup = \
+ srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'`
+am__nobase_strip = \
+ for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||"
+am__nobase_list = $(am__nobase_strip_setup); \
+ for p in $$list; do echo "$$p $$p"; done | \
+ sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \
+ $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \
+ if (++n[$$2] == $(am__install_max)) \
+ { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \
+ END { for (dir in files) print dir, files[dir] }'
+am__base_list = \
+ sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
+ sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__installdirs = "$(DESTDIR)$(usrlibdir)" "$(DESTDIR)$(man3dir)" \
+ "$(DESTDIR)$(pkgconfigdir)" "$(DESTDIR)$(includedir)"
+LTLIBRARIES = $(usrlib_LTLIBRARIES)
+libpopt_la_LIBADD =
+am_libpopt_la_OBJECTS = popt.lo poptparse.lo poptconfig.lo popthelp.lo \
+ poptint.lo
+libpopt_la_OBJECTS = $(am_libpopt_la_OBJECTS)
+libpopt_la_LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) \
+ $(LIBTOOLFLAGS) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \
+ $(libpopt_la_LDFLAGS) $(LDFLAGS) -o $@
+PROGRAMS = $(noinst_PROGRAMS)
+am_tdict_OBJECTS = tdict.$(OBJEXT)
+tdict_OBJECTS = $(am_tdict_OBJECTS)
+tdict_DEPENDENCIES = $(usrlib_LTLIBRARIES)
+tdict_LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \
+ --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) $(tdict_LDFLAGS) \
+ $(LDFLAGS) -o $@
+am_test1_OBJECTS = test1.$(OBJEXT)
+test1_OBJECTS = $(am_test1_OBJECTS)
+test1_DEPENDENCIES = $(usrlib_LTLIBRARIES)
+test1_LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \
+ --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) $(test1_LDFLAGS) \
+ $(LDFLAGS) -o $@
+am_test2_OBJECTS = test2.$(OBJEXT)
+test2_OBJECTS = $(am_test2_OBJECTS)
+test2_DEPENDENCIES = $(usrlib_LTLIBRARIES)
+test2_LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \
+ --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) $(test2_LDFLAGS) \
+ $(LDFLAGS) -o $@
+SCRIPTS = $(noinst_SCRIPTS)
+DEFAULT_INCLUDES = -I.@am__isrc@
+depcomp = $(SHELL) $(top_srcdir)/depcomp
+am__depfiles_maybe = depfiles
+am__mv = mv -f
+COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \
+ $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \
+ --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) \
+ $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+CCLD = $(CC)
+LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \
+ --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) $(AM_LDFLAGS) \
+ $(LDFLAGS) -o $@
+SOURCES = $(libpopt_la_SOURCES) $(tdict_SOURCES) $(test1_SOURCES) \
+ $(test2_SOURCES)
+DIST_SOURCES = $(libpopt_la_SOURCES) $(tdict_SOURCES) $(test1_SOURCES) \
+ $(test2_SOURCES)
+RECURSIVE_TARGETS = all-recursive check-recursive dvi-recursive \
+ html-recursive info-recursive install-data-recursive \
+ install-dvi-recursive install-exec-recursive \
+ install-html-recursive install-info-recursive \
+ install-pdf-recursive install-ps-recursive install-recursive \
+ installcheck-recursive installdirs-recursive pdf-recursive \
+ ps-recursive uninstall-recursive
+man3dir = $(mandir)/man3
+NROFF = nroff
+MANS = $(man_MANS)
+DATA = $(pkgconfig_DATA)
+HEADERS = $(include_HEADERS) $(noinst_HEADERS)
+RECURSIVE_CLEAN_TARGETS = mostlyclean-recursive clean-recursive \
+ distclean-recursive maintainer-clean-recursive
+AM_RECURSIVE_TARGETS = $(RECURSIVE_TARGETS:-recursive=) \
+ $(RECURSIVE_CLEAN_TARGETS:-recursive=) tags TAGS ctags CTAGS \
+ distdir dist dist-all distcheck
+ETAGS = etags
+CTAGS = ctags
+am__tty_colors = \
+red=; grn=; lgn=; blu=; std=
+DIST_SUBDIRS = $(SUBDIRS)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+distdir = $(PACKAGE)-$(VERSION)
+top_distdir = $(distdir)
+am__remove_distdir = \
+ { test ! -d "$(distdir)" \
+ || { find "$(distdir)" -type d ! -perm -200 -exec chmod u+w {} ';' \
+ && rm -fr "$(distdir)"; }; }
+am__relativize = \
+ dir0=`pwd`; \
+ sed_first='s,^\([^/]*\)/.*$$,\1,'; \
+ sed_rest='s,^[^/]*/*,,'; \
+ sed_last='s,^.*/\([^/]*\)$$,\1,'; \
+ sed_butlast='s,/*[^/]*$$,,'; \
+ while test -n "$$dir1"; do \
+ first=`echo "$$dir1" | sed -e "$$sed_first"`; \
+ if test "$$first" != "."; then \
+ if test "$$first" = ".."; then \
+ dir2=`echo "$$dir0" | sed -e "$$sed_last"`/"$$dir2"; \
+ dir0=`echo "$$dir0" | sed -e "$$sed_butlast"`; \
+ else \
+ first2=`echo "$$dir2" | sed -e "$$sed_first"`; \
+ if test "$$first2" = "$$first"; then \
+ dir2=`echo "$$dir2" | sed -e "$$sed_rest"`; \
+ else \
+ dir2="../$$dir2"; \
+ fi; \
+ dir0="$$dir0"/"$$first"; \
+ fi; \
+ fi; \
+ dir1=`echo "$$dir1" | sed -e "$$sed_rest"`; \
+ done; \
+ reldir="$$dir2"
+DIST_ARCHIVES = $(distdir).tar.gz
+GZIP_ENV = --best
+distuninstallcheck_listfiles = find . -type f -print
+distcleancheck_listfiles = find . -type f -print
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GETTEXT_MACRO_VERSION = @GETTEXT_MACRO_VERSION@
+GMSGFMT = @GMSGFMT@
+GMSGFMT_015 = @GMSGFMT_015@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+INTLLIBS = @INTLLIBS@
+INTL_MACOSX_LIBS = @INTL_MACOSX_LIBS@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBICONV = @LIBICONV@
+LIBINTL = @LIBINTL@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBICONV = @LTLIBICONV@
+LTLIBINTL = @LTLIBINTL@
+LTLIBOBJS = @LTLIBOBJS@
+LT_AGE = @LT_AGE@
+LT_CURRENT = @LT_CURRENT@
+LT_REVISION = @LT_REVISION@
+MAINT = @MAINT@
+MAKEINFO = @MAKEINFO@
+MKDIR_P = @MKDIR_P@
+MSGFMT = @MSGFMT@
+MSGFMT_015 = @MSGFMT_015@
+MSGMERGE = @MSGMERGE@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+POPT_PKGCONFIG_LIBS = @POPT_PKGCONFIG_LIBS@
+POPT_SOURCE_PATH = @POPT_SOURCE_PATH@
+POSUB = @POSUB@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+TARGET = @TARGET@
+U = @U@
+USE_NLS = @USE_NLS@
+VERSION = @VERSION@
+XGETTEXT = @XGETTEXT@
+XGETTEXT_015 = @XGETTEXT_015@
+XGETTEXT_EXTRA_OPTIONS = @XGETTEXT_EXTRA_OPTIONS@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+lt_ECHO = @lt_ECHO@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+subdirs = @subdirs@
+sysconfdir = @sysconfdir@
+target = @target@
+target_alias = @target_alias@
+target_cpu = @target_cpu@
+target_os = @target_os@
+target_vendor = @target_vendor@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+AUTOMAKE_OPTIONS = 1.4 foreign
+LINT = splint
+MCCABE = pmccabe
+EXTRA_DIST = config.rpath lookup3.c autogen.sh CHANGES $(man_MANS) \
+ m4/Makefile.in \
+ footer_no_timestamp.html libpopt.vers \
+ testit.sh test-poptrc \
+ popt.xcodeproj/project.pbxproj \
+ popt.ps
+
+SUBDIRS = po . auto
+AM_CPPFLAGS = -I. -I$(top_srcdir)
+noinst_HEADERS = poptint.h system.h
+test1_SOURCES = test1.c
+test1_LDFLAGS =
+test1_LDADD = $(usrlib_LTLIBRARIES)
+test2_SOURCES = test2.c
+test2_LDFLAGS =
+test2_LDADD = $(usrlib_LTLIBRARIES)
+#test3_SOURCES = test3.c
+#test3_LDFLAGS =
+#test3_LDADD = $(usrlib_LTLIBRARIES)
+tdict_SOURCES = tdict.c
+tdict_LDFLAGS =
+tdict_LDADD = $(usrlib_LTLIBRARIES)
+noinst_SCRIPTS = testit.sh
+TESTS_ENVIRONMENT = \
+test1="$(top_builddir)/test1"
+
+TESTS = $(top_srcdir)/testit.sh
+include_HEADERS = popt.h
+usrlibdir = $(libdir)
+usrlib_LTLIBRARIES = libpopt.la
+libpopt_la_SOURCES = popt.c poptparse.c poptconfig.c popthelp.c poptint.c
+libpopt_la_LDFLAGS = -no-undefined @LTLIBINTL@ @LTLIBICONV@ \
+ $(am__append_1)
+pkgconfigdir = $(prefix)/lib/pkgconfig
+pkgconfig_DATA = popt.pc
+man_MANS = popt.3
+BUILT_SOURCES = popt.pc # popt.lcd
+
+#.PHONY: lcov-upload
+#lcov-upload: lcov
+# rsync -rvz -e ssh --delete lcov/* ???
+ACLOCAL_AMFLAGS = -I m4
+all: $(BUILT_SOURCES) config.h
+ $(MAKE) $(AM_MAKEFLAGS) all-recursive
+
+.SUFFIXES:
+.SUFFIXES: .c .lo .o .obj
+am--refresh:
+ @:
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ echo ' cd $(srcdir) && $(AUTOMAKE) --foreign'; \
+ $(am__cd) $(srcdir) && $(AUTOMAKE) --foreign \
+ && exit 0; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign Makefile'; \
+ $(am__cd) $(top_srcdir) && \
+ $(AUTOMAKE) --foreign Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ echo ' $(SHELL) ./config.status'; \
+ $(SHELL) ./config.status;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ $(SHELL) ./config.status --recheck
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ $(am__cd) $(srcdir) && $(AUTOCONF)
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+ $(am__cd) $(srcdir) && $(ACLOCAL) $(ACLOCAL_AMFLAGS)
+$(am__aclocal_m4_deps):
+
+config.h: stamp-h1
+ @if test ! -f $@; then \
+ rm -f stamp-h1; \
+ $(MAKE) $(AM_MAKEFLAGS) stamp-h1; \
+ else :; fi
+
+stamp-h1: $(srcdir)/config.h.in $(top_builddir)/config.status
+ @rm -f stamp-h1
+ cd $(top_builddir) && $(SHELL) ./config.status config.h
+$(srcdir)/config.h.in: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ ($(am__cd) $(top_srcdir) && $(AUTOHEADER))
+ rm -f stamp-h1
+ touch $@
+
+distclean-hdr:
+ -rm -f config.h stamp-h1
+Doxyfile: $(top_builddir)/config.status $(srcdir)/Doxyfile.in
+ cd $(top_builddir) && $(SHELL) ./config.status $@
+popt.pc: $(top_builddir)/config.status $(srcdir)/popt.pc.in
+ cd $(top_builddir) && $(SHELL) ./config.status $@
+popt.spec: $(top_builddir)/config.status $(srcdir)/popt.spec.in
+ cd $(top_builddir) && $(SHELL) ./config.status $@
+test-poptrc: $(top_builddir)/config.status $(srcdir)/test-poptrc.in
+ cd $(top_builddir) && $(SHELL) ./config.status $@
+install-usrlibLTLIBRARIES: $(usrlib_LTLIBRARIES)
+ @$(NORMAL_INSTALL)
+ test -z "$(usrlibdir)" || $(MKDIR_P) "$(DESTDIR)$(usrlibdir)"
+ @list='$(usrlib_LTLIBRARIES)'; test -n "$(usrlibdir)" || list=; \
+ list2=; for p in $$list; do \
+ if test -f $$p; then \
+ list2="$$list2 $$p"; \
+ else :; fi; \
+ done; \
+ test -z "$$list2" || { \
+ echo " $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL) $(INSTALL_STRIP_FLAG) $$list2 '$(DESTDIR)$(usrlibdir)'"; \
+ $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL) $(INSTALL_STRIP_FLAG) $$list2 "$(DESTDIR)$(usrlibdir)"; \
+ }
+
+uninstall-usrlibLTLIBRARIES:
+ @$(NORMAL_UNINSTALL)
+ @list='$(usrlib_LTLIBRARIES)'; test -n "$(usrlibdir)" || list=; \
+ for p in $$list; do \
+ $(am__strip_dir) \
+ echo " $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=uninstall rm -f '$(DESTDIR)$(usrlibdir)/$$f'"; \
+ $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=uninstall rm -f "$(DESTDIR)$(usrlibdir)/$$f"; \
+ done
+
+clean-usrlibLTLIBRARIES:
+ -test -z "$(usrlib_LTLIBRARIES)" || rm -f $(usrlib_LTLIBRARIES)
+ @list='$(usrlib_LTLIBRARIES)'; for p in $$list; do \
+ dir="`echo $$p | sed -e 's|/[^/]*$$||'`"; \
+ test "$$dir" != "$$p" || dir=.; \
+ echo "rm -f \"$${dir}/so_locations\""; \
+ rm -f "$${dir}/so_locations"; \
+ done
+libpopt.la: $(libpopt_la_OBJECTS) $(libpopt_la_DEPENDENCIES)
+ $(libpopt_la_LINK) -rpath $(usrlibdir) $(libpopt_la_OBJECTS) $(libpopt_la_LIBADD) $(LIBS)
+
+clean-noinstPROGRAMS:
+ @list='$(noinst_PROGRAMS)'; test -n "$$list" || exit 0; \
+ echo " rm -f" $$list; \
+ rm -f $$list || exit $$?; \
+ test -n "$(EXEEXT)" || exit 0; \
+ list=`for p in $$list; do echo "$$p"; done | sed 's/$(EXEEXT)$$//'`; \
+ echo " rm -f" $$list; \
+ rm -f $$list
+tdict$(EXEEXT): $(tdict_OBJECTS) $(tdict_DEPENDENCIES)
+ @rm -f tdict$(EXEEXT)
+ $(tdict_LINK) $(tdict_OBJECTS) $(tdict_LDADD) $(LIBS)
+test1$(EXEEXT): $(test1_OBJECTS) $(test1_DEPENDENCIES)
+ @rm -f test1$(EXEEXT)
+ $(test1_LINK) $(test1_OBJECTS) $(test1_LDADD) $(LIBS)
+test2$(EXEEXT): $(test2_OBJECTS) $(test2_DEPENDENCIES)
+ @rm -f test2$(EXEEXT)
+ $(test2_LINK) $(test2_OBJECTS) $(test2_LDADD) $(LIBS)
+
+mostlyclean-compile:
+ -rm -f *.$(OBJEXT)
+
+distclean-compile:
+ -rm -f *.tab.c
+
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/popt.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/poptconfig.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/popthelp.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/poptint.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/poptparse.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tdict.Po@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/test1.Po@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/test2.Po@am__quote@
+
+.c.o:
+@am__fastdepCC_TRUE@ $(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+@am__fastdepCC_TRUE@ $(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(COMPILE) -c $<
+
+.c.obj:
+@am__fastdepCC_TRUE@ $(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ `$(CYGPATH_W) '$<'`
+@am__fastdepCC_TRUE@ $(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(COMPILE) -c `$(CYGPATH_W) '$<'`
+
+.c.lo:
+@am__fastdepCC_TRUE@ $(LTCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+@am__fastdepCC_TRUE@ $(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Plo
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCC_FALSE@ $(LTCOMPILE) -c -o $@ $<
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+ -rm -f libtool config.lt
+install-man3: $(man_MANS)
+ @$(NORMAL_INSTALL)
+ test -z "$(man3dir)" || $(MKDIR_P) "$(DESTDIR)$(man3dir)"
+ @list=''; test -n "$(man3dir)" || exit 0; \
+ { for i in $$list; do echo "$$i"; done; \
+ l2='$(man_MANS)'; for i in $$l2; do echo "$$i"; done | \
+ sed -n '/\.3[a-z]*$$/p'; \
+ } | while read p; do \
+ if test -f $$p; then d=; else d="$(srcdir)/"; fi; \
+ echo "$$d$$p"; echo "$$p"; \
+ done | \
+ sed -e 'n;s,.*/,,;p;h;s,.*\.,,;s,^[^3][0-9a-z]*$$,3,;x' \
+ -e 's,\.[0-9a-z]*$$,,;$(transform);G;s,\n,.,' | \
+ sed 'N;N;s,\n, ,g' | { \
+ list=; while read file base inst; do \
+ if test "$$base" = "$$inst"; then list="$$list $$file"; else \
+ echo " $(INSTALL_DATA) '$$file' '$(DESTDIR)$(man3dir)/$$inst'"; \
+ $(INSTALL_DATA) "$$file" "$(DESTDIR)$(man3dir)/$$inst" || exit $$?; \
+ fi; \
+ done; \
+ for i in $$list; do echo "$$i"; done | $(am__base_list) | \
+ while read files; do \
+ test -z "$$files" || { \
+ echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(man3dir)'"; \
+ $(INSTALL_DATA) $$files "$(DESTDIR)$(man3dir)" || exit $$?; }; \
+ done; }
+
+uninstall-man3:
+ @$(NORMAL_UNINSTALL)
+ @list=''; test -n "$(man3dir)" || exit 0; \
+ files=`{ for i in $$list; do echo "$$i"; done; \
+ l2='$(man_MANS)'; for i in $$l2; do echo "$$i"; done | \
+ sed -n '/\.3[a-z]*$$/p'; \
+ } | sed -e 's,.*/,,;h;s,.*\.,,;s,^[^3][0-9a-z]*$$,3,;x' \
+ -e 's,\.[0-9a-z]*$$,,;$(transform);G;s,\n,.,'`; \
+ test -z "$$files" || { \
+ echo " ( cd '$(DESTDIR)$(man3dir)' && rm -f" $$files ")"; \
+ cd "$(DESTDIR)$(man3dir)" && rm -f $$files; }
+install-pkgconfigDATA: $(pkgconfig_DATA)
+ @$(NORMAL_INSTALL)
+ test -z "$(pkgconfigdir)" || $(MKDIR_P) "$(DESTDIR)$(pkgconfigdir)"
+ @list='$(pkgconfig_DATA)'; test -n "$(pkgconfigdir)" || list=; \
+ for p in $$list; do \
+ if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+ echo "$$d$$p"; \
+ done | $(am__base_list) | \
+ while read files; do \
+ echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(pkgconfigdir)'"; \
+ $(INSTALL_DATA) $$files "$(DESTDIR)$(pkgconfigdir)" || exit $$?; \
+ done
+
+uninstall-pkgconfigDATA:
+ @$(NORMAL_UNINSTALL)
+ @list='$(pkgconfig_DATA)'; test -n "$(pkgconfigdir)" || list=; \
+ files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \
+ test -n "$$files" || exit 0; \
+ echo " ( cd '$(DESTDIR)$(pkgconfigdir)' && rm -f" $$files ")"; \
+ cd "$(DESTDIR)$(pkgconfigdir)" && rm -f $$files
+install-includeHEADERS: $(include_HEADERS)
+ @$(NORMAL_INSTALL)
+ test -z "$(includedir)" || $(MKDIR_P) "$(DESTDIR)$(includedir)"
+ @list='$(include_HEADERS)'; test -n "$(includedir)" || list=; \
+ for p in $$list; do \
+ if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+ echo "$$d$$p"; \
+ done | $(am__base_list) | \
+ while read files; do \
+ echo " $(INSTALL_HEADER) $$files '$(DESTDIR)$(includedir)'"; \
+ $(INSTALL_HEADER) $$files "$(DESTDIR)$(includedir)" || exit $$?; \
+ done
+
+uninstall-includeHEADERS:
+ @$(NORMAL_UNINSTALL)
+ @list='$(include_HEADERS)'; test -n "$(includedir)" || list=; \
+ files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \
+ test -n "$$files" || exit 0; \
+ echo " ( cd '$(DESTDIR)$(includedir)' && rm -f" $$files ")"; \
+ cd "$(DESTDIR)$(includedir)" && rm -f $$files
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run `make' without going through this Makefile.
+# To change the values of `make' variables: instead of editing Makefiles,
+# (1) if the variable is set in `config.status', edit `config.status'
+# (which will cause the Makefiles to be regenerated when you run `make');
+# (2) otherwise, pass the desired values on the `make' command line.
+$(RECURSIVE_TARGETS):
+ @fail= failcom='exit 1'; \
+ for f in x $$MAKEFLAGS; do \
+ case $$f in \
+ *=* | --[!k]*);; \
+ *k*) failcom='fail=yes';; \
+ esac; \
+ done; \
+ dot_seen=no; \
+ target=`echo $@ | sed s/-recursive//`; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ echo "Making $$target in $$subdir"; \
+ if test "$$subdir" = "."; then \
+ dot_seen=yes; \
+ local_target="$$target-am"; \
+ else \
+ local_target="$$target"; \
+ fi; \
+ ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+ || eval $$failcom; \
+ done; \
+ if test "$$dot_seen" = "no"; then \
+ $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \
+ fi; test -z "$$fail"
+
+$(RECURSIVE_CLEAN_TARGETS):
+ @fail= failcom='exit 1'; \
+ for f in x $$MAKEFLAGS; do \
+ case $$f in \
+ *=* | --[!k]*);; \
+ *k*) failcom='fail=yes';; \
+ esac; \
+ done; \
+ dot_seen=no; \
+ case "$@" in \
+ distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \
+ *) list='$(SUBDIRS)' ;; \
+ esac; \
+ rev=''; for subdir in $$list; do \
+ if test "$$subdir" = "."; then :; else \
+ rev="$$subdir $$rev"; \
+ fi; \
+ done; \
+ rev="$$rev ."; \
+ target=`echo $@ | sed s/-recursive//`; \
+ for subdir in $$rev; do \
+ echo "Making $$target in $$subdir"; \
+ if test "$$subdir" = "."; then \
+ local_target="$$target-am"; \
+ else \
+ local_target="$$target"; \
+ fi; \
+ ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+ || eval $$failcom; \
+ done && test -z "$$fail"
+tags-recursive:
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ test "$$subdir" = . || ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \
+ done
+ctags-recursive:
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ test "$$subdir" = . || ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) ctags); \
+ done
+
+ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES)
+ list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | \
+ $(AWK) '{ files[$$0] = 1; nonempty = 1; } \
+ END { if (nonempty) { for (i in files) print i; }; }'`; \
+ mkid -fID $$unique
+tags: TAGS
+
+TAGS: tags-recursive $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) \
+ $(TAGS_FILES) $(LISP)
+ set x; \
+ here=`pwd`; \
+ if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \
+ include_option=--etags-include; \
+ empty_fix=.; \
+ else \
+ include_option=--include; \
+ empty_fix=; \
+ fi; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ test ! -f $$subdir/TAGS || \
+ set "$$@" "$$include_option=$$here/$$subdir/TAGS"; \
+ fi; \
+ done; \
+ list='$(SOURCES) $(HEADERS) config.h.in $(LISP) $(TAGS_FILES)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | \
+ $(AWK) '{ files[$$0] = 1; nonempty = 1; } \
+ END { if (nonempty) { for (i in files) print i; }; }'`; \
+ shift; \
+ if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+ test -n "$$unique" || unique=$$empty_fix; \
+ if test $$# -gt 0; then \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ "$$@" $$unique; \
+ else \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ $$unique; \
+ fi; \
+ fi
+ctags: CTAGS
+CTAGS: ctags-recursive $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) \
+ $(TAGS_FILES) $(LISP)
+ list='$(SOURCES) $(HEADERS) config.h.in $(LISP) $(TAGS_FILES)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | \
+ $(AWK) '{ files[$$0] = 1; nonempty = 1; } \
+ END { if (nonempty) { for (i in files) print i; }; }'`; \
+ test -z "$(CTAGS_ARGS)$$unique" \
+ || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+ $$unique
+
+GTAGS:
+ here=`$(am__cd) $(top_builddir) && pwd` \
+ && $(am__cd) $(top_srcdir) \
+ && gtags -i $(GTAGS_ARGS) "$$here"
+
+distclean-tags:
+ -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+check-TESTS: $(TESTS)
+ @failed=0; all=0; xfail=0; xpass=0; skip=0; \
+ srcdir=$(srcdir); export srcdir; \
+ list=' $(TESTS) '; \
+ $(am__tty_colors); \
+ if test -n "$$list"; then \
+ for tst in $$list; do \
+ if test -f ./$$tst; then dir=./; \
+ elif test -f $$tst; then dir=; \
+ else dir="$(srcdir)/"; fi; \
+ if $(TESTS_ENVIRONMENT) $${dir}$$tst; then \
+ all=`expr $$all + 1`; \
+ case " $(XFAIL_TESTS) " in \
+ *[\ \ ]$$tst[\ \ ]*) \
+ xpass=`expr $$xpass + 1`; \
+ failed=`expr $$failed + 1`; \
+ col=$$red; res=XPASS; \
+ ;; \
+ *) \
+ col=$$grn; res=PASS; \
+ ;; \
+ esac; \
+ elif test $$? -ne 77; then \
+ all=`expr $$all + 1`; \
+ case " $(XFAIL_TESTS) " in \
+ *[\ \ ]$$tst[\ \ ]*) \
+ xfail=`expr $$xfail + 1`; \
+ col=$$lgn; res=XFAIL; \
+ ;; \
+ *) \
+ failed=`expr $$failed + 1`; \
+ col=$$red; res=FAIL; \
+ ;; \
+ esac; \
+ else \
+ skip=`expr $$skip + 1`; \
+ col=$$blu; res=SKIP; \
+ fi; \
+ echo "$${col}$$res$${std}: $$tst"; \
+ done; \
+ if test "$$all" -eq 1; then \
+ tests="test"; \
+ All=""; \
+ else \
+ tests="tests"; \
+ All="All "; \
+ fi; \
+ if test "$$failed" -eq 0; then \
+ if test "$$xfail" -eq 0; then \
+ banner="$$All$$all $$tests passed"; \
+ else \
+ if test "$$xfail" -eq 1; then failures=failure; else failures=failures; fi; \
+ banner="$$All$$all $$tests behaved as expected ($$xfail expected $$failures)"; \
+ fi; \
+ else \
+ if test "$$xpass" -eq 0; then \
+ banner="$$failed of $$all $$tests failed"; \
+ else \
+ if test "$$xpass" -eq 1; then passes=pass; else passes=passes; fi; \
+ banner="$$failed of $$all $$tests did not behave as expected ($$xpass unexpected $$passes)"; \
+ fi; \
+ fi; \
+ dashes="$$banner"; \
+ skipped=""; \
+ if test "$$skip" -ne 0; then \
+ if test "$$skip" -eq 1; then \
+ skipped="($$skip test was not run)"; \
+ else \
+ skipped="($$skip tests were not run)"; \
+ fi; \
+ test `echo "$$skipped" | wc -c` -le `echo "$$banner" | wc -c` || \
+ dashes="$$skipped"; \
+ fi; \
+ report=""; \
+ if test "$$failed" -ne 0 && test -n "$(PACKAGE_BUGREPORT)"; then \
+ report="Please report to $(PACKAGE_BUGREPORT)"; \
+ test `echo "$$report" | wc -c` -le `echo "$$banner" | wc -c` || \
+ dashes="$$report"; \
+ fi; \
+ dashes=`echo "$$dashes" | sed s/./=/g`; \
+ if test "$$failed" -eq 0; then \
+ echo "$$grn$$dashes"; \
+ else \
+ echo "$$red$$dashes"; \
+ fi; \
+ echo "$$banner"; \
+ test -z "$$skipped" || echo "$$skipped"; \
+ test -z "$$report" || echo "$$report"; \
+ echo "$$dashes$$std"; \
+ test "$$failed" -eq 0; \
+ else :; fi
+
+distdir: $(DISTFILES)
+ @list='$(MANS)'; if test -n "$$list"; then \
+ list=`for p in $$list; do \
+ if test -f $$p; then d=; else d="$(srcdir)/"; fi; \
+ if test -f "$$d$$p"; then echo "$$d$$p"; else :; fi; done`; \
+ if test -n "$$list" && \
+ grep 'ab help2man is required to generate this page' $$list >/dev/null; then \
+ echo "error: found man pages containing the \`missing help2man' replacement text:" >&2; \
+ grep -l 'ab help2man is required to generate this page' $$list | sed 's/^/ /' >&2; \
+ echo " to fix them, install help2man, remove and regenerate the man pages;" >&2; \
+ echo " typically \`make maintainer-clean' will remove them" >&2; \
+ exit 1; \
+ else :; fi; \
+ else :; fi
+ $(am__remove_distdir)
+ test -d "$(distdir)" || mkdir "$(distdir)"
+ @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ list='$(DISTFILES)'; \
+ dist_files=`for file in $$list; do echo $$file; done | \
+ sed -e "s|^$$srcdirstrip/||;t" \
+ -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+ case $$dist_files in \
+ */*) $(MKDIR_P) `echo "$$dist_files" | \
+ sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+ sort -u` ;; \
+ esac; \
+ for file in $$dist_files; do \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ if test -d $$d/$$file; then \
+ dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test -d "$(distdir)/$$file"; then \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+ else \
+ test -f "$(distdir)/$$file" \
+ || cp -p $$d/$$file "$(distdir)/$$file" \
+ || exit 1; \
+ fi; \
+ done
+ @list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ test -d "$(distdir)/$$subdir" \
+ || $(MKDIR_P) "$(distdir)/$$subdir" \
+ || exit 1; \
+ fi; \
+ done
+ @list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ dir1=$$subdir; dir2="$(distdir)/$$subdir"; \
+ $(am__relativize); \
+ new_distdir=$$reldir; \
+ dir1=$$subdir; dir2="$(top_distdir)"; \
+ $(am__relativize); \
+ new_top_distdir=$$reldir; \
+ echo " (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir="$$new_top_distdir" distdir="$$new_distdir" \\"; \
+ echo " am__remove_distdir=: am__skip_length_check=: am__skip_mode_fix=: distdir)"; \
+ ($(am__cd) $$subdir && \
+ $(MAKE) $(AM_MAKEFLAGS) \
+ top_distdir="$$new_top_distdir" \
+ distdir="$$new_distdir" \
+ am__remove_distdir=: \
+ am__skip_length_check=: \
+ am__skip_mode_fix=: \
+ distdir) \
+ || exit 1; \
+ fi; \
+ done
+ -test -n "$(am__skip_mode_fix)" \
+ || find "$(distdir)" -type d ! -perm -755 \
+ -exec chmod u+rwx,go+rx {} \; -o \
+ ! -type d ! -perm -444 -links 1 -exec chmod a+r {} \; -o \
+ ! -type d ! -perm -400 -exec chmod a+r {} \; -o \
+ ! -type d ! -perm -444 -exec $(install_sh) -c -m a+r {} {} \; \
+ || chmod -R a+r "$(distdir)"
+dist-gzip: distdir
+ tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz
+ $(am__remove_distdir)
+
+dist-bzip2: distdir
+ tardir=$(distdir) && $(am__tar) | bzip2 -9 -c >$(distdir).tar.bz2
+ $(am__remove_distdir)
+
+dist-lzma: distdir
+ tardir=$(distdir) && $(am__tar) | lzma -9 -c >$(distdir).tar.lzma
+ $(am__remove_distdir)
+
+dist-xz: distdir
+ tardir=$(distdir) && $(am__tar) | xz -c >$(distdir).tar.xz
+ $(am__remove_distdir)
+
+dist-tarZ: distdir
+ tardir=$(distdir) && $(am__tar) | compress -c >$(distdir).tar.Z
+ $(am__remove_distdir)
+
+dist-shar: distdir
+ shar $(distdir) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).shar.gz
+ $(am__remove_distdir)
+
+dist-zip: distdir
+ -rm -f $(distdir).zip
+ zip -rq $(distdir).zip $(distdir)
+ $(am__remove_distdir)
+
+dist dist-all: distdir
+ tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz
+ $(am__remove_distdir)
+
+# This target untars the dist file and tries a VPATH configuration. Then
+# it guarantees that the distribution is self-contained by making another
+# tarfile.
+distcheck: dist
+ case '$(DIST_ARCHIVES)' in \
+ *.tar.gz*) \
+ GZIP=$(GZIP_ENV) gzip -dc $(distdir).tar.gz | $(am__untar) ;;\
+ *.tar.bz2*) \
+ bzip2 -dc $(distdir).tar.bz2 | $(am__untar) ;;\
+ *.tar.lzma*) \
+ lzma -dc $(distdir).tar.lzma | $(am__untar) ;;\
+ *.tar.xz*) \
+ xz -dc $(distdir).tar.xz | $(am__untar) ;;\
+ *.tar.Z*) \
+ uncompress -c $(distdir).tar.Z | $(am__untar) ;;\
+ *.shar.gz*) \
+ GZIP=$(GZIP_ENV) gzip -dc $(distdir).shar.gz | unshar ;;\
+ *.zip*) \
+ unzip $(distdir).zip ;;\
+ esac
+ chmod -R a-w $(distdir); chmod a+w $(distdir)
+ mkdir $(distdir)/_build
+ mkdir $(distdir)/_inst
+ chmod a-w $(distdir)
+ test -d $(distdir)/_build || exit 0; \
+ dc_install_base=`$(am__cd) $(distdir)/_inst && pwd | sed -e 's,^[^:\\/]:[\\/],/,'` \
+ && dc_destdir="$${TMPDIR-/tmp}/am-dc-$$$$/" \
+ && am__cwd=`pwd` \
+ && $(am__cd) $(distdir)/_build \
+ && ../configure --srcdir=.. --prefix="$$dc_install_base" \
+ $(DISTCHECK_CONFIGURE_FLAGS) \
+ && $(MAKE) $(AM_MAKEFLAGS) \
+ && $(MAKE) $(AM_MAKEFLAGS) dvi \
+ && $(MAKE) $(AM_MAKEFLAGS) check \
+ && $(MAKE) $(AM_MAKEFLAGS) install \
+ && $(MAKE) $(AM_MAKEFLAGS) installcheck \
+ && $(MAKE) $(AM_MAKEFLAGS) uninstall \
+ && $(MAKE) $(AM_MAKEFLAGS) distuninstallcheck_dir="$$dc_install_base" \
+ distuninstallcheck \
+ && chmod -R a-w "$$dc_install_base" \
+ && ({ \
+ (cd ../.. && umask 077 && mkdir "$$dc_destdir") \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" install \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" uninstall \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" \
+ distuninstallcheck_dir="$$dc_destdir" distuninstallcheck; \
+ } || { rm -rf "$$dc_destdir"; exit 1; }) \
+ && rm -rf "$$dc_destdir" \
+ && $(MAKE) $(AM_MAKEFLAGS) dist \
+ && rm -rf $(DIST_ARCHIVES) \
+ && $(MAKE) $(AM_MAKEFLAGS) distcleancheck \
+ && cd "$$am__cwd" \
+ || exit 1
+ $(am__remove_distdir)
+ @(echo "$(distdir) archives ready for distribution: "; \
+ list='$(DIST_ARCHIVES)'; for i in $$list; do echo $$i; done) | \
+ sed -e 1h -e 1s/./=/g -e 1p -e 1x -e '$$p' -e '$$x'
+distuninstallcheck:
+ @$(am__cd) '$(distuninstallcheck_dir)' \
+ && test `$(distuninstallcheck_listfiles) | wc -l` -le 1 \
+ || { echo "ERROR: files left after uninstall:" ; \
+ if test -n "$(DESTDIR)"; then \
+ echo " (check DESTDIR support)"; \
+ fi ; \
+ $(distuninstallcheck_listfiles) ; \
+ exit 1; } >&2
+distcleancheck: distclean
+ @if test '$(srcdir)' = . ; then \
+ echo "ERROR: distcleancheck can only run from a VPATH build" ; \
+ exit 1 ; \
+ fi
+ @test `$(distcleancheck_listfiles) | wc -l` -eq 0 \
+ || { echo "ERROR: files left in build directory after distclean:" ; \
+ $(distcleancheck_listfiles) ; \
+ exit 1; } >&2
+check-am: all-am
+ $(MAKE) $(AM_MAKEFLAGS) check-TESTS
+check: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) check-recursive
+all-am: Makefile $(LTLIBRARIES) $(PROGRAMS) $(SCRIPTS) $(MANS) $(DATA) \
+ $(HEADERS) config.h
+installdirs: installdirs-recursive
+installdirs-am:
+ for dir in "$(DESTDIR)$(usrlibdir)" "$(DESTDIR)$(man3dir)" "$(DESTDIR)$(pkgconfigdir)" "$(DESTDIR)$(includedir)"; do \
+ test -z "$$dir" || $(MKDIR_P) "$$dir"; \
+ done
+install: $(BUILT_SOURCES)
+ $(MAKE) $(AM_MAKEFLAGS) install-recursive
+install-exec: install-exec-recursive
+install-data: install-data-recursive
+uninstall: uninstall-recursive
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-recursive
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ `test -z '$(STRIP)' || \
+ echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+ -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+ -test -z "$(BUILT_SOURCES)" || rm -f $(BUILT_SOURCES)
+clean: clean-recursive
+
+clean-am: clean-generic clean-libtool clean-noinstPROGRAMS \
+ clean-usrlibLTLIBRARIES mostlyclean-am
+
+distclean: distclean-recursive
+ -rm -f $(am__CONFIG_DISTCLEAN_FILES)
+ -rm -rf ./$(DEPDIR)
+ -rm -f Makefile
+distclean-am: clean-am distclean-compile distclean-generic \
+ distclean-hdr distclean-libtool distclean-local distclean-tags
+
+dvi: dvi-recursive
+
+dvi-am:
+
+html: html-recursive
+
+html-am:
+
+info: info-recursive
+
+info-am:
+
+install-data-am: install-includeHEADERS install-man \
+ install-pkgconfigDATA install-usrlibLTLIBRARIES
+
+install-dvi: install-dvi-recursive
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-recursive
+
+install-html-am:
+
+install-info: install-info-recursive
+
+install-info-am:
+
+install-man: install-man3
+
+install-pdf: install-pdf-recursive
+
+install-pdf-am:
+
+install-ps: install-ps-recursive
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-recursive
+ -rm -f $(am__CONFIG_DISTCLEAN_FILES)
+ -rm -rf $(top_srcdir)/autom4te.cache
+ -rm -rf ./$(DEPDIR)
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-recursive
+
+mostlyclean-am: mostlyclean-compile mostlyclean-generic \
+ mostlyclean-libtool
+
+pdf: pdf-recursive
+
+pdf-am:
+
+ps: ps-recursive
+
+ps-am:
+
+uninstall-am: uninstall-includeHEADERS uninstall-man \
+ uninstall-pkgconfigDATA uninstall-usrlibLTLIBRARIES
+
+uninstall-man: uninstall-man3
+
+.MAKE: $(RECURSIVE_CLEAN_TARGETS) $(RECURSIVE_TARGETS) all check \
+ check-am ctags-recursive install install-am install-strip \
+ tags-recursive
+
+.PHONY: $(RECURSIVE_CLEAN_TARGETS) $(RECURSIVE_TARGETS) CTAGS GTAGS \
+ all all-am am--refresh check check-TESTS check-am clean \
+ clean-generic clean-libtool clean-noinstPROGRAMS \
+ clean-usrlibLTLIBRARIES ctags ctags-recursive dist dist-all \
+ dist-bzip2 dist-gzip dist-lzma dist-shar dist-tarZ dist-xz \
+ dist-zip distcheck distclean distclean-compile \
+ distclean-generic distclean-hdr distclean-libtool \
+ distclean-local distclean-tags distcleancheck distdir \
+ distuninstallcheck dvi dvi-am html html-am info info-am \
+ install install-am install-data install-data-am install-dvi \
+ install-dvi-am install-exec install-exec-am install-html \
+ install-html-am install-includeHEADERS install-info \
+ install-info-am install-man install-man3 install-pdf \
+ install-pdf-am install-pkgconfigDATA install-ps install-ps-am \
+ install-strip install-usrlibLTLIBRARIES installcheck \
+ installcheck-am installdirs installdirs-am maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-compile \
+ mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+ tags tags-recursive uninstall uninstall-am \
+ uninstall-includeHEADERS uninstall-man uninstall-man3 \
+ uninstall-pkgconfigDATA uninstall-usrlibLTLIBRARIES
+
+
+distclean-local:
+ rm -rf .ccache
+
+.PHONY: updatepo
+updatepo:
+ rsync -Lrtvz translationproject.org::tp/latest/popt/ po
+
+popt.lcd: Makefile.am ${libpopt_la_SOURCES} ${include_HEADERS} ${noinst_HEADERS}
+ lclint -dump $@ ${libpopt_la_SOURCES}
+
+.PHONY: sources
+sources:
+ @echo $(libpopt_la_SOURCES:%=popt/%)
+
+.PHONY: lint
+lint:
+ $(LINT) ${DEFS} ${INCLUDES} test1.c ${libpopt_la_SOURCES}
+
+.PHONY: mccabe
+mccabe:
+ $(MCCABE) $(libpopt_la_SOURCES) | sort -n -r | head -n 10
+
+.PHONY: doxygen
+doxygen: Doxyfile
+ rm -rf doxygen
+ mkdir -p doxygen
+ doxygen
+
+.PHONY: lcov-reset # run lcov from scratch, always
+lcov-reset:
+ make lcov-run
+ make lcov-report
+
+.PHONY: lcov # run lcov from scratch if the dir is not there
+lcov:
+ make lcov-reset
+
+.PHONY: lcov-run # reset run coverage tests
+lcov-run:
+ @-rm -rf lcov
+ find . -name "*.gcda" -exec rm {} \;
+ make check
+
+.PHONY: lcov-report # generate report based on current coverage data
+lcov-report:
+ mkdir lcov
+ lcov --directory . --capture --output-file lcov/lcov.info
+ lcov -l lcov/lcov.info | grep -v "`cd $(top_srcdir) && pwd`" | cut -d: -f1 > lcov/remove
+ lcov -r lcov/lcov.info `cat lcov/remove` > lcov/lcov.cleaned.info
+ rm lcov/remove
+ mv lcov/lcov.cleaned.info lcov/lcov.info
+ genhtml -t "$(PACKAGE_STRING)" -o lcov lcov/lcov.info
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/popt-1.16/README b/popt-1.16/README
new file mode 100644
index 0000000..c66432d
--- /dev/null
+++ b/popt-1.16/README
@@ -0,0 +1,16 @@
+This is the popt(3) command line option parsing library. While it is similiar
+to getopt(3), it contains a number of enhancements, including:
+
+ 1) popt is fully reentrant
+ 2) popt can parse arbitrary argv[] style arrays while
+ getopt(3) makes this quite difficult
+ 3) popt allows users to alias command line arguments
+ 4) popt provides convience functions for parsing strings
+ into argv[] style arrays
+
+Complete documentation on popt(3) is available in popt.ps (included in this
+tarball), which is excerpted with permission from the book "Linux
+Application Development" by Michael K. Johnson and Erik Troan (available
+from Addison Wesley in May, 1998).
+
+Comments on popt should be addressed to popt-devel@rpm5.org.
diff --git a/popt-1.16/aclocal.m4 b/popt-1.16/aclocal.m4
new file mode 100644
index 0000000..185a208
--- /dev/null
+++ b/popt-1.16/aclocal.m4
@@ -0,0 +1,1082 @@
+# generated automatically by aclocal 1.11.1 -*- Autoconf -*-
+
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004,
+# 2005, 2006, 2007, 2008, 2009 Free Software Foundation, Inc.
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+m4_ifndef([AC_AUTOCONF_VERSION],
+ [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
+m4_if(m4_defn([AC_AUTOCONF_VERSION]), [2.63],,
+[m4_warning([this file was generated for autoconf 2.63.
+You have another version of autoconf. It may work, but is not guaranteed to.
+If you have problems, you may need to regenerate the build system entirely.
+To do so, use the procedure documented by the package, typically `autoreconf'.])])
+
+# intlmacosx.m4 serial 1 (gettext-0.17)
+dnl Copyright (C) 2004-2007 Free Software Foundation, Inc.
+dnl This file is free software; the Free Software Foundation
+dnl gives unlimited permission to copy and/or distribute it,
+dnl with or without modifications, as long as this notice is preserved.
+dnl
+dnl This file can can be used in projects which are not available under
+dnl the GNU General Public License or the GNU Library General Public
+dnl License but which still want to provide support for the GNU gettext
+dnl functionality.
+dnl Please note that the actual code of the GNU gettext library is covered
+dnl by the GNU Library General Public License, and the rest of the GNU
+dnl gettext package package is covered by the GNU General Public License.
+dnl They are *not* in the public domain.
+
+dnl Checks for special options needed on MacOS X.
+dnl Defines INTL_MACOSX_LIBS.
+AC_DEFUN([gt_INTL_MACOSX],
+[
+ dnl Check for API introduced in MacOS X 10.2.
+ AC_CACHE_CHECK([for CFPreferencesCopyAppValue],
+ gt_cv_func_CFPreferencesCopyAppValue,
+ [gt_save_LIBS="$LIBS"
+ LIBS="$LIBS -Wl,-framework -Wl,CoreFoundation"
+ AC_TRY_LINK([#include <CoreFoundation/CFPreferences.h>],
+ [CFPreferencesCopyAppValue(NULL, NULL)],
+ [gt_cv_func_CFPreferencesCopyAppValue=yes],
+ [gt_cv_func_CFPreferencesCopyAppValue=no])
+ LIBS="$gt_save_LIBS"])
+ if test $gt_cv_func_CFPreferencesCopyAppValue = yes; then
+ AC_DEFINE([HAVE_CFPREFERENCESCOPYAPPVALUE], 1,
+ [Define to 1 if you have the MacOS X function CFPreferencesCopyAppValue in the CoreFoundation framework.])
+ fi
+ dnl Check for API introduced in MacOS X 10.3.
+ AC_CACHE_CHECK([for CFLocaleCopyCurrent], gt_cv_func_CFLocaleCopyCurrent,
+ [gt_save_LIBS="$LIBS"
+ LIBS="$LIBS -Wl,-framework -Wl,CoreFoundation"
+ AC_TRY_LINK([#include <CoreFoundation/CFLocale.h>], [CFLocaleCopyCurrent();],
+ [gt_cv_func_CFLocaleCopyCurrent=yes],
+ [gt_cv_func_CFLocaleCopyCurrent=no])
+ LIBS="$gt_save_LIBS"])
+ if test $gt_cv_func_CFLocaleCopyCurrent = yes; then
+ AC_DEFINE([HAVE_CFLOCALECOPYCURRENT], 1,
+ [Define to 1 if you have the MacOS X function CFLocaleCopyCurrent in the CoreFoundation framework.])
+ fi
+ INTL_MACOSX_LIBS=
+ if test $gt_cv_func_CFPreferencesCopyAppValue = yes || test $gt_cv_func_CFLocaleCopyCurrent = yes; then
+ INTL_MACOSX_LIBS="-Wl,-framework -Wl,CoreFoundation"
+ fi
+ AC_SUBST([INTL_MACOSX_LIBS])
+])
+
+# Copyright (C) 2002, 2003, 2005, 2006, 2007, 2008 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_AUTOMAKE_VERSION(VERSION)
+# ----------------------------
+# Automake X.Y traces this macro to ensure aclocal.m4 has been
+# generated from the m4 files accompanying Automake X.Y.
+# (This private macro should not be called outside this file.)
+AC_DEFUN([AM_AUTOMAKE_VERSION],
+[am__api_version='1.11'
+dnl Some users find AM_AUTOMAKE_VERSION and mistake it for a way to
+dnl require some minimum version. Point them to the right macro.
+m4_if([$1], [1.11.1], [],
+ [AC_FATAL([Do not call $0, use AM_INIT_AUTOMAKE([$1]).])])dnl
+])
+
+# _AM_AUTOCONF_VERSION(VERSION)
+# -----------------------------
+# aclocal traces this macro to find the Autoconf version.
+# This is a private macro too. Using m4_define simplifies
+# the logic in aclocal, which can simply ignore this definition.
+m4_define([_AM_AUTOCONF_VERSION], [])
+
+# AM_SET_CURRENT_AUTOMAKE_VERSION
+# -------------------------------
+# Call AM_AUTOMAKE_VERSION and AM_AUTOMAKE_VERSION so they can be traced.
+# This function is AC_REQUIREd by AM_INIT_AUTOMAKE.
+AC_DEFUN([AM_SET_CURRENT_AUTOMAKE_VERSION],
+[AM_AUTOMAKE_VERSION([1.11.1])dnl
+m4_ifndef([AC_AUTOCONF_VERSION],
+ [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
+_AM_AUTOCONF_VERSION(m4_defn([AC_AUTOCONF_VERSION]))])
+
+# AM_AUX_DIR_EXPAND -*- Autoconf -*-
+
+# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# For projects using AC_CONFIG_AUX_DIR([foo]), Autoconf sets
+# $ac_aux_dir to `$srcdir/foo'. In other projects, it is set to
+# `$srcdir', `$srcdir/..', or `$srcdir/../..'.
+#
+# Of course, Automake must honor this variable whenever it calls a
+# tool from the auxiliary directory. The problem is that $srcdir (and
+# therefore $ac_aux_dir as well) can be either absolute or relative,
+# depending on how configure is run. This is pretty annoying, since
+# it makes $ac_aux_dir quite unusable in subdirectories: in the top
+# source directory, any form will work fine, but in subdirectories a
+# relative path needs to be adjusted first.
+#
+# $ac_aux_dir/missing
+# fails when called from a subdirectory if $ac_aux_dir is relative
+# $top_srcdir/$ac_aux_dir/missing
+# fails if $ac_aux_dir is absolute,
+# fails when called from a subdirectory in a VPATH build with
+# a relative $ac_aux_dir
+#
+# The reason of the latter failure is that $top_srcdir and $ac_aux_dir
+# are both prefixed by $srcdir. In an in-source build this is usually
+# harmless because $srcdir is `.', but things will broke when you
+# start a VPATH build or use an absolute $srcdir.
+#
+# So we could use something similar to $top_srcdir/$ac_aux_dir/missing,
+# iff we strip the leading $srcdir from $ac_aux_dir. That would be:
+# am_aux_dir='\$(top_srcdir)/'`expr "$ac_aux_dir" : "$srcdir//*\(.*\)"`
+# and then we would define $MISSING as
+# MISSING="\${SHELL} $am_aux_dir/missing"
+# This will work as long as MISSING is not called from configure, because
+# unfortunately $(top_srcdir) has no meaning in configure.
+# However there are other variables, like CC, which are often used in
+# configure, and could therefore not use this "fixed" $ac_aux_dir.
+#
+# Another solution, used here, is to always expand $ac_aux_dir to an
+# absolute PATH. The drawback is that using absolute paths prevent a
+# configured tree to be moved without reconfiguration.
+
+AC_DEFUN([AM_AUX_DIR_EXPAND],
+[dnl Rely on autoconf to set up CDPATH properly.
+AC_PREREQ([2.50])dnl
+# expand $ac_aux_dir to an absolute path
+am_aux_dir=`cd $ac_aux_dir && pwd`
+])
+
+# AM_CONDITIONAL -*- Autoconf -*-
+
+# Copyright (C) 1997, 2000, 2001, 2003, 2004, 2005, 2006, 2008
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 9
+
+# AM_CONDITIONAL(NAME, SHELL-CONDITION)
+# -------------------------------------
+# Define a conditional.
+AC_DEFUN([AM_CONDITIONAL],
+[AC_PREREQ(2.52)dnl
+ ifelse([$1], [TRUE], [AC_FATAL([$0: invalid condition: $1])],
+ [$1], [FALSE], [AC_FATAL([$0: invalid condition: $1])])dnl
+AC_SUBST([$1_TRUE])dnl
+AC_SUBST([$1_FALSE])dnl
+_AM_SUBST_NOTMAKE([$1_TRUE])dnl
+_AM_SUBST_NOTMAKE([$1_FALSE])dnl
+m4_define([_AM_COND_VALUE_$1], [$2])dnl
+if $2; then
+ $1_TRUE=
+ $1_FALSE='#'
+else
+ $1_TRUE='#'
+ $1_FALSE=
+fi
+AC_CONFIG_COMMANDS_PRE(
+[if test -z "${$1_TRUE}" && test -z "${$1_FALSE}"; then
+ AC_MSG_ERROR([[conditional "$1" was never defined.
+Usually this means the macro was only invoked conditionally.]])
+fi])])
+
+# Copyright (C) 1999, 2000, 2001, 2002, 2003, 2004, 2005, 2006, 2009
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 10
+
+# There are a few dirty hacks below to avoid letting `AC_PROG_CC' be
+# written in clear, in which case automake, when reading aclocal.m4,
+# will think it sees a *use*, and therefore will trigger all it's
+# C support machinery. Also note that it means that autoscan, seeing
+# CC etc. in the Makefile, will ask for an AC_PROG_CC use...
+
+
+# _AM_DEPENDENCIES(NAME)
+# ----------------------
+# See how the compiler implements dependency checking.
+# NAME is "CC", "CXX", "GCJ", or "OBJC".
+# We try a few techniques and use that to set a single cache variable.
+#
+# We don't AC_REQUIRE the corresponding AC_PROG_CC since the latter was
+# modified to invoke _AM_DEPENDENCIES(CC); we would have a circular
+# dependency, and given that the user is not expected to run this macro,
+# just rely on AC_PROG_CC.
+AC_DEFUN([_AM_DEPENDENCIES],
+[AC_REQUIRE([AM_SET_DEPDIR])dnl
+AC_REQUIRE([AM_OUTPUT_DEPENDENCY_COMMANDS])dnl
+AC_REQUIRE([AM_MAKE_INCLUDE])dnl
+AC_REQUIRE([AM_DEP_TRACK])dnl
+
+ifelse([$1], CC, [depcc="$CC" am_compiler_list=],
+ [$1], CXX, [depcc="$CXX" am_compiler_list=],
+ [$1], OBJC, [depcc="$OBJC" am_compiler_list='gcc3 gcc'],
+ [$1], UPC, [depcc="$UPC" am_compiler_list=],
+ [$1], GCJ, [depcc="$GCJ" am_compiler_list='gcc3 gcc'],
+ [depcc="$$1" am_compiler_list=])
+
+AC_CACHE_CHECK([dependency style of $depcc],
+ [am_cv_$1_dependencies_compiler_type],
+[if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+ # We make a subdir and do the tests there. Otherwise we can end up
+ # making bogus files that we don't know about and never remove. For
+ # instance it was reported that on HP-UX the gcc test will end up
+ # making a dummy file named `D' -- because `-MD' means `put the output
+ # in D'.
+ mkdir conftest.dir
+ # Copy depcomp to subdir because otherwise we won't find it if we're
+ # using a relative directory.
+ cp "$am_depcomp" conftest.dir
+ cd conftest.dir
+ # We will build objects and dependencies in a subdirectory because
+ # it helps to detect inapplicable dependency modes. For instance
+ # both Tru64's cc and ICC support -MD to output dependencies as a
+ # side effect of compilation, but ICC will put the dependencies in
+ # the current directory while Tru64 will put them in the object
+ # directory.
+ mkdir sub
+
+ am_cv_$1_dependencies_compiler_type=none
+ if test "$am_compiler_list" = ""; then
+ am_compiler_list=`sed -n ['s/^#*\([a-zA-Z0-9]*\))$/\1/p'] < ./depcomp`
+ fi
+ am__universal=false
+ m4_case([$1], [CC],
+ [case " $depcc " in #(
+ *\ -arch\ *\ -arch\ *) am__universal=true ;;
+ esac],
+ [CXX],
+ [case " $depcc " in #(
+ *\ -arch\ *\ -arch\ *) am__universal=true ;;
+ esac])
+
+ for depmode in $am_compiler_list; do
+ # Setup a source with many dependencies, because some compilers
+ # like to wrap large dependency lists on column 80 (with \), and
+ # we should not choose a depcomp mode which is confused by this.
+ #
+ # We need to recreate these files for each test, as the compiler may
+ # overwrite some of them when testing with obscure command lines.
+ # This happens at least with the AIX C compiler.
+ : > sub/conftest.c
+ for i in 1 2 3 4 5 6; do
+ echo '#include "conftst'$i'.h"' >> sub/conftest.c
+ # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with
+ # Solaris 8's {/usr,}/bin/sh.
+ touch sub/conftst$i.h
+ done
+ echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+ # We check with `-c' and `-o' for the sake of the "dashmstdout"
+ # mode. It turns out that the SunPro C++ compiler does not properly
+ # handle `-M -o', and we need to detect this. Also, some Intel
+ # versions had trouble with output in subdirs
+ am__obj=sub/conftest.${OBJEXT-o}
+ am__minus_obj="-o $am__obj"
+ case $depmode in
+ gcc)
+ # This depmode causes a compiler race in universal mode.
+ test "$am__universal" = false || continue
+ ;;
+ nosideeffect)
+ # after this tag, mechanisms are not by side-effect, so they'll
+ # only be used when explicitly requested
+ if test "x$enable_dependency_tracking" = xyes; then
+ continue
+ else
+ break
+ fi
+ ;;
+ msvisualcpp | msvcmsys)
+ # This compiler won't grok `-c -o', but also, the minuso test has
+ # not run yet. These depmodes are late enough in the game, and
+ # so weak that their functioning should not be impacted.
+ am__obj=conftest.${OBJEXT-o}
+ am__minus_obj=
+ ;;
+ none) break ;;
+ esac
+ if depmode=$depmode \
+ source=sub/conftest.c object=$am__obj \
+ depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+ $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \
+ >/dev/null 2>conftest.err &&
+ grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep $am__obj sub/conftest.Po > /dev/null 2>&1 &&
+ ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+ # icc doesn't choke on unknown options, it will just issue warnings
+ # or remarks (even with -Werror). So we grep stderr for any message
+ # that says an option was ignored or not supported.
+ # When given -MP, icc 7.0 and 7.1 complain thusly:
+ # icc: Command line warning: ignoring option '-M'; no argument required
+ # The diagnosis changed in icc 8.0:
+ # icc: Command line remark: option '-MP' not supported
+ if (grep 'ignoring option' conftest.err ||
+ grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+ am_cv_$1_dependencies_compiler_type=$depmode
+ break
+ fi
+ fi
+ done
+
+ cd ..
+ rm -rf conftest.dir
+else
+ am_cv_$1_dependencies_compiler_type=none
+fi
+])
+AC_SUBST([$1DEPMODE], [depmode=$am_cv_$1_dependencies_compiler_type])
+AM_CONDITIONAL([am__fastdep$1], [
+ test "x$enable_dependency_tracking" != xno \
+ && test "$am_cv_$1_dependencies_compiler_type" = gcc3])
+])
+
+
+# AM_SET_DEPDIR
+# -------------
+# Choose a directory name for dependency files.
+# This macro is AC_REQUIREd in _AM_DEPENDENCIES
+AC_DEFUN([AM_SET_DEPDIR],
+[AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+AC_SUBST([DEPDIR], ["${am__leading_dot}deps"])dnl
+])
+
+
+# AM_DEP_TRACK
+# ------------
+AC_DEFUN([AM_DEP_TRACK],
+[AC_ARG_ENABLE(dependency-tracking,
+[ --disable-dependency-tracking speeds up one-time build
+ --enable-dependency-tracking do not reject slow dependency extractors])
+if test "x$enable_dependency_tracking" != xno; then
+ am_depcomp="$ac_aux_dir/depcomp"
+ AMDEPBACKSLASH='\'
+fi
+AM_CONDITIONAL([AMDEP], [test "x$enable_dependency_tracking" != xno])
+AC_SUBST([AMDEPBACKSLASH])dnl
+_AM_SUBST_NOTMAKE([AMDEPBACKSLASH])dnl
+])
+
+# Generate code to set up dependency tracking. -*- Autoconf -*-
+
+# Copyright (C) 1999, 2000, 2001, 2002, 2003, 2004, 2005, 2008
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+#serial 5
+
+# _AM_OUTPUT_DEPENDENCY_COMMANDS
+# ------------------------------
+AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS],
+[{
+ # Autoconf 2.62 quotes --file arguments for eval, but not when files
+ # are listed without --file. Let's play safe and only enable the eval
+ # if we detect the quoting.
+ case $CONFIG_FILES in
+ *\'*) eval set x "$CONFIG_FILES" ;;
+ *) set x $CONFIG_FILES ;;
+ esac
+ shift
+ for mf
+ do
+ # Strip MF so we end up with the name of the file.
+ mf=`echo "$mf" | sed -e 's/:.*$//'`
+ # Check whether this is an Automake generated Makefile or not.
+ # We used to match only the files named `Makefile.in', but
+ # some people rename them; so instead we look at the file content.
+ # Grep'ing the first line is not enough: some people post-process
+ # each Makefile.in and add a new line on top of each file to say so.
+ # Grep'ing the whole file is not good either: AIX grep has a line
+ # limit of 2048, but all sed's we know have understand at least 4000.
+ if sed -n 's,^#.*generated by automake.*,X,p' "$mf" | grep X >/dev/null 2>&1; then
+ dirpart=`AS_DIRNAME("$mf")`
+ else
+ continue
+ fi
+ # Extract the definition of DEPDIR, am__include, and am__quote
+ # from the Makefile without running `make'.
+ DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"`
+ test -z "$DEPDIR" && continue
+ am__include=`sed -n 's/^am__include = //p' < "$mf"`
+ test -z "am__include" && continue
+ am__quote=`sed -n 's/^am__quote = //p' < "$mf"`
+ # When using ansi2knr, U may be empty or an underscore; expand it
+ U=`sed -n 's/^U = //p' < "$mf"`
+ # Find all dependency output files, they are included files with
+ # $(DEPDIR) in their names. We invoke sed twice because it is the
+ # simplest approach to changing $(DEPDIR) to its actual value in the
+ # expansion.
+ for file in `sed -n "
+ s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \
+ sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g' -e 's/\$U/'"$U"'/g'`; do
+ # Make sure the directory exists.
+ test -f "$dirpart/$file" && continue
+ fdir=`AS_DIRNAME(["$file"])`
+ AS_MKDIR_P([$dirpart/$fdir])
+ # echo "creating $dirpart/$file"
+ echo '# dummy' > "$dirpart/$file"
+ done
+ done
+}
+])# _AM_OUTPUT_DEPENDENCY_COMMANDS
+
+
+# AM_OUTPUT_DEPENDENCY_COMMANDS
+# -----------------------------
+# This macro should only be invoked once -- use via AC_REQUIRE.
+#
+# This code is only required when automatic dependency tracking
+# is enabled. FIXME. This creates each `.P' file that we will
+# need in order to bootstrap the dependency handling code.
+AC_DEFUN([AM_OUTPUT_DEPENDENCY_COMMANDS],
+[AC_CONFIG_COMMANDS([depfiles],
+ [test x"$AMDEP_TRUE" != x"" || _AM_OUTPUT_DEPENDENCY_COMMANDS],
+ [AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"])
+])
+
+# Do all the work for Automake. -*- Autoconf -*-
+
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004,
+# 2005, 2006, 2008, 2009 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 16
+
+# This macro actually does too much. Some checks are only needed if
+# your package does certain things. But this isn't really a big deal.
+
+# AM_INIT_AUTOMAKE(PACKAGE, VERSION, [NO-DEFINE])
+# AM_INIT_AUTOMAKE([OPTIONS])
+# -----------------------------------------------
+# The call with PACKAGE and VERSION arguments is the old style
+# call (pre autoconf-2.50), which is being phased out. PACKAGE
+# and VERSION should now be passed to AC_INIT and removed from
+# the call to AM_INIT_AUTOMAKE.
+# We support both call styles for the transition. After
+# the next Automake release, Autoconf can make the AC_INIT
+# arguments mandatory, and then we can depend on a new Autoconf
+# release and drop the old call support.
+AC_DEFUN([AM_INIT_AUTOMAKE],
+[AC_PREREQ([2.62])dnl
+dnl Autoconf wants to disallow AM_ names. We explicitly allow
+dnl the ones we care about.
+m4_pattern_allow([^AM_[A-Z]+FLAGS$])dnl
+AC_REQUIRE([AM_SET_CURRENT_AUTOMAKE_VERSION])dnl
+AC_REQUIRE([AC_PROG_INSTALL])dnl
+if test "`cd $srcdir && pwd`" != "`pwd`"; then
+ # Use -I$(srcdir) only when $(srcdir) != ., so that make's output
+ # is not polluted with repeated "-I."
+ AC_SUBST([am__isrc], [' -I$(srcdir)'])_AM_SUBST_NOTMAKE([am__isrc])dnl
+ # test to see if srcdir already configured
+ if test -f $srcdir/config.status; then
+ AC_MSG_ERROR([source directory already configured; run "make distclean" there first])
+ fi
+fi
+
+# test whether we have cygpath
+if test -z "$CYGPATH_W"; then
+ if (cygpath --version) >/dev/null 2>/dev/null; then
+ CYGPATH_W='cygpath -w'
+ else
+ CYGPATH_W=echo
+ fi
+fi
+AC_SUBST([CYGPATH_W])
+
+# Define the identity of the package.
+dnl Distinguish between old-style and new-style calls.
+m4_ifval([$2],
+[m4_ifval([$3], [_AM_SET_OPTION([no-define])])dnl
+ AC_SUBST([PACKAGE], [$1])dnl
+ AC_SUBST([VERSION], [$2])],
+[_AM_SET_OPTIONS([$1])dnl
+dnl Diagnose old-style AC_INIT with new-style AM_AUTOMAKE_INIT.
+m4_if(m4_ifdef([AC_PACKAGE_NAME], 1)m4_ifdef([AC_PACKAGE_VERSION], 1), 11,,
+ [m4_fatal([AC_INIT should be called with package and version arguments])])dnl
+ AC_SUBST([PACKAGE], ['AC_PACKAGE_TARNAME'])dnl
+ AC_SUBST([VERSION], ['AC_PACKAGE_VERSION'])])dnl
+
+_AM_IF_OPTION([no-define],,
+[AC_DEFINE_UNQUOTED(PACKAGE, "$PACKAGE", [Name of package])
+ AC_DEFINE_UNQUOTED(VERSION, "$VERSION", [Version number of package])])dnl
+
+# Some tools Automake needs.
+AC_REQUIRE([AM_SANITY_CHECK])dnl
+AC_REQUIRE([AC_ARG_PROGRAM])dnl
+AM_MISSING_PROG(ACLOCAL, aclocal-${am__api_version})
+AM_MISSING_PROG(AUTOCONF, autoconf)
+AM_MISSING_PROG(AUTOMAKE, automake-${am__api_version})
+AM_MISSING_PROG(AUTOHEADER, autoheader)
+AM_MISSING_PROG(MAKEINFO, makeinfo)
+AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+AC_REQUIRE([AM_PROG_INSTALL_STRIP])dnl
+AC_REQUIRE([AM_PROG_MKDIR_P])dnl
+# We need awk for the "check" target. The system "awk" is bad on
+# some platforms.
+AC_REQUIRE([AC_PROG_AWK])dnl
+AC_REQUIRE([AC_PROG_MAKE_SET])dnl
+AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+_AM_IF_OPTION([tar-ustar], [_AM_PROG_TAR([ustar])],
+ [_AM_IF_OPTION([tar-pax], [_AM_PROG_TAR([pax])],
+ [_AM_PROG_TAR([v7])])])
+_AM_IF_OPTION([no-dependencies],,
+[AC_PROVIDE_IFELSE([AC_PROG_CC],
+ [_AM_DEPENDENCIES(CC)],
+ [define([AC_PROG_CC],
+ defn([AC_PROG_CC])[_AM_DEPENDENCIES(CC)])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_CXX],
+ [_AM_DEPENDENCIES(CXX)],
+ [define([AC_PROG_CXX],
+ defn([AC_PROG_CXX])[_AM_DEPENDENCIES(CXX)])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_OBJC],
+ [_AM_DEPENDENCIES(OBJC)],
+ [define([AC_PROG_OBJC],
+ defn([AC_PROG_OBJC])[_AM_DEPENDENCIES(OBJC)])])dnl
+])
+_AM_IF_OPTION([silent-rules], [AC_REQUIRE([AM_SILENT_RULES])])dnl
+dnl The `parallel-tests' driver may need to know about EXEEXT, so add the
+dnl `am__EXEEXT' conditional if _AM_COMPILER_EXEEXT was seen. This macro
+dnl is hooked onto _AC_COMPILER_EXEEXT early, see below.
+AC_CONFIG_COMMANDS_PRE(dnl
+[m4_provide_if([_AM_COMPILER_EXEEXT],
+ [AM_CONDITIONAL([am__EXEEXT], [test -n "$EXEEXT"])])])dnl
+])
+
+dnl Hook into `_AC_COMPILER_EXEEXT' early to learn its expansion. Do not
+dnl add the conditional right here, as _AC_COMPILER_EXEEXT may be further
+dnl mangled by Autoconf and run in a shell conditional statement.
+m4_define([_AC_COMPILER_EXEEXT],
+m4_defn([_AC_COMPILER_EXEEXT])[m4_provide([_AM_COMPILER_EXEEXT])])
+
+
+# When config.status generates a header, we must update the stamp-h file.
+# This file resides in the same directory as the config header
+# that is generated. The stamp files are numbered to have different names.
+
+# Autoconf calls _AC_AM_CONFIG_HEADER_HOOK (when defined) in the
+# loop where config.status creates the headers, so we can generate
+# our stamp files there.
+AC_DEFUN([_AC_AM_CONFIG_HEADER_HOOK],
+[# Compute $1's index in $config_headers.
+_am_arg=$1
+_am_stamp_count=1
+for _am_header in $config_headers :; do
+ case $_am_header in
+ $_am_arg | $_am_arg:* )
+ break ;;
+ * )
+ _am_stamp_count=`expr $_am_stamp_count + 1` ;;
+ esac
+done
+echo "timestamp for $_am_arg" >`AS_DIRNAME(["$_am_arg"])`/stamp-h[]$_am_stamp_count])
+
+# Copyright (C) 2001, 2003, 2005, 2008 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_SH
+# ------------------
+# Define $install_sh.
+AC_DEFUN([AM_PROG_INSTALL_SH],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+if test x"${install_sh}" != xset; then
+ case $am_aux_dir in
+ *\ * | *\ *)
+ install_sh="\${SHELL} '$am_aux_dir/install-sh'" ;;
+ *)
+ install_sh="\${SHELL} $am_aux_dir/install-sh"
+ esac
+fi
+AC_SUBST(install_sh)])
+
+# Copyright (C) 2003, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 2
+
+# Check whether the underlying file-system supports filenames
+# with a leading dot. For instance MS-DOS doesn't.
+AC_DEFUN([AM_SET_LEADING_DOT],
+[rm -rf .tst 2>/dev/null
+mkdir .tst 2>/dev/null
+if test -d .tst; then
+ am__leading_dot=.
+else
+ am__leading_dot=_
+fi
+rmdir .tst 2>/dev/null
+AC_SUBST([am__leading_dot])])
+
+# Add --enable-maintainer-mode option to configure. -*- Autoconf -*-
+# From Jim Meyering
+
+# Copyright (C) 1996, 1998, 2000, 2001, 2002, 2003, 2004, 2005, 2008
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 5
+
+# AM_MAINTAINER_MODE([DEFAULT-MODE])
+# ----------------------------------
+# Control maintainer-specific portions of Makefiles.
+# Default is to disable them, unless `enable' is passed literally.
+# For symmetry, `disable' may be passed as well. Anyway, the user
+# can override the default with the --enable/--disable switch.
+AC_DEFUN([AM_MAINTAINER_MODE],
+[m4_case(m4_default([$1], [disable]),
+ [enable], [m4_define([am_maintainer_other], [disable])],
+ [disable], [m4_define([am_maintainer_other], [enable])],
+ [m4_define([am_maintainer_other], [enable])
+ m4_warn([syntax], [unexpected argument to AM@&t@_MAINTAINER_MODE: $1])])
+AC_MSG_CHECKING([whether to am_maintainer_other maintainer-specific portions of Makefiles])
+ dnl maintainer-mode's default is 'disable' unless 'enable' is passed
+ AC_ARG_ENABLE([maintainer-mode],
+[ --][am_maintainer_other][-maintainer-mode am_maintainer_other make rules and dependencies not useful
+ (and sometimes confusing) to the casual installer],
+ [USE_MAINTAINER_MODE=$enableval],
+ [USE_MAINTAINER_MODE=]m4_if(am_maintainer_other, [enable], [no], [yes]))
+ AC_MSG_RESULT([$USE_MAINTAINER_MODE])
+ AM_CONDITIONAL([MAINTAINER_MODE], [test $USE_MAINTAINER_MODE = yes])
+ MAINT=$MAINTAINER_MODE_TRUE
+ AC_SUBST([MAINT])dnl
+]
+)
+
+AU_DEFUN([jm_MAINTAINER_MODE], [AM_MAINTAINER_MODE])
+
+# Check to see how 'make' treats includes. -*- Autoconf -*-
+
+# Copyright (C) 2001, 2002, 2003, 2005, 2009 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 4
+
+# AM_MAKE_INCLUDE()
+# -----------------
+# Check to see how make treats includes.
+AC_DEFUN([AM_MAKE_INCLUDE],
+[am_make=${MAKE-make}
+cat > confinc << 'END'
+am__doit:
+ @echo this is the am__doit target
+.PHONY: am__doit
+END
+# If we don't find an include directive, just comment out the code.
+AC_MSG_CHECKING([for style of include used by $am_make])
+am__include="#"
+am__quote=
+_am_result=none
+# First try GNU make style include.
+echo "include confinc" > confmf
+# Ignore all kinds of additional output from `make'.
+case `$am_make -s -f confmf 2> /dev/null` in #(
+*the\ am__doit\ target*)
+ am__include=include
+ am__quote=
+ _am_result=GNU
+ ;;
+esac
+# Now try BSD make style include.
+if test "$am__include" = "#"; then
+ echo '.include "confinc"' > confmf
+ case `$am_make -s -f confmf 2> /dev/null` in #(
+ *the\ am__doit\ target*)
+ am__include=.include
+ am__quote="\""
+ _am_result=BSD
+ ;;
+ esac
+fi
+AC_SUBST([am__include])
+AC_SUBST([am__quote])
+AC_MSG_RESULT([$_am_result])
+rm -f confinc confmf
+])
+
+# Fake the existence of programs that GNU maintainers use. -*- Autoconf -*-
+
+# Copyright (C) 1997, 1999, 2000, 2001, 2003, 2004, 2005, 2008
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 6
+
+# AM_MISSING_PROG(NAME, PROGRAM)
+# ------------------------------
+AC_DEFUN([AM_MISSING_PROG],
+[AC_REQUIRE([AM_MISSING_HAS_RUN])
+$1=${$1-"${am_missing_run}$2"}
+AC_SUBST($1)])
+
+
+# AM_MISSING_HAS_RUN
+# ------------------
+# Define MISSING if not defined so far and test if it supports --run.
+# If it does, set am_missing_run to use it, otherwise, to nothing.
+AC_DEFUN([AM_MISSING_HAS_RUN],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+AC_REQUIRE_AUX_FILE([missing])dnl
+if test x"${MISSING+set}" != xset; then
+ case $am_aux_dir in
+ *\ * | *\ *)
+ MISSING="\${SHELL} \"$am_aux_dir/missing\"" ;;
+ *)
+ MISSING="\${SHELL} $am_aux_dir/missing" ;;
+ esac
+fi
+# Use eval to expand $SHELL
+if eval "$MISSING --run true"; then
+ am_missing_run="$MISSING --run "
+else
+ am_missing_run=
+ AC_MSG_WARN([`missing' script is too old or missing])
+fi
+])
+
+# Copyright (C) 2003, 2004, 2005, 2006 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_MKDIR_P
+# ---------------
+# Check for `mkdir -p'.
+AC_DEFUN([AM_PROG_MKDIR_P],
+[AC_PREREQ([2.60])dnl
+AC_REQUIRE([AC_PROG_MKDIR_P])dnl
+dnl Automake 1.8 to 1.9.6 used to define mkdir_p. We now use MKDIR_P,
+dnl while keeping a definition of mkdir_p for backward compatibility.
+dnl @MKDIR_P@ is magic: AC_OUTPUT adjusts its value for each Makefile.
+dnl However we cannot define mkdir_p as $(MKDIR_P) for the sake of
+dnl Makefile.ins that do not define MKDIR_P, so we do our own
+dnl adjustment using top_builddir (which is defined more often than
+dnl MKDIR_P).
+AC_SUBST([mkdir_p], ["$MKDIR_P"])dnl
+case $mkdir_p in
+ [[\\/$]]* | ?:[[\\/]]*) ;;
+ */*) mkdir_p="\$(top_builddir)/$mkdir_p" ;;
+esac
+])
+
+# Helper functions for option handling. -*- Autoconf -*-
+
+# Copyright (C) 2001, 2002, 2003, 2005, 2008 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 4
+
+# _AM_MANGLE_OPTION(NAME)
+# -----------------------
+AC_DEFUN([_AM_MANGLE_OPTION],
+[[_AM_OPTION_]m4_bpatsubst($1, [[^a-zA-Z0-9_]], [_])])
+
+# _AM_SET_OPTION(NAME)
+# ------------------------------
+# Set option NAME. Presently that only means defining a flag for this option.
+AC_DEFUN([_AM_SET_OPTION],
+[m4_define(_AM_MANGLE_OPTION([$1]), 1)])
+
+# _AM_SET_OPTIONS(OPTIONS)
+# ----------------------------------
+# OPTIONS is a space-separated list of Automake options.
+AC_DEFUN([_AM_SET_OPTIONS],
+[m4_foreach_w([_AM_Option], [$1], [_AM_SET_OPTION(_AM_Option)])])
+
+# _AM_IF_OPTION(OPTION, IF-SET, [IF-NOT-SET])
+# -------------------------------------------
+# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise.
+AC_DEFUN([_AM_IF_OPTION],
+[m4_ifset(_AM_MANGLE_OPTION([$1]), [$2], [$3])])
+
+# Copyright (C) 1996, 1997, 1998, 2000, 2001, 2002, 2003, 2005, 2006
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 5
+
+AC_DEFUN([AM_C_PROTOTYPES],
+[AC_REQUIRE([AC_C_PROTOTYPES])
+if test "$ac_cv_prog_cc_stdc" != no; then
+ U= ANSI2KNR=
+else
+ U=_ ANSI2KNR=./ansi2knr
+fi
+# Ensure some checks needed by ansi2knr itself.
+AC_REQUIRE([AC_HEADER_STDC])
+AC_CHECK_HEADERS([string.h])
+AC_SUBST([U])dnl
+AC_SUBST([ANSI2KNR])dnl
+_AM_SUBST_NOTMAKE([ANSI2KNR])dnl
+])
+
+AU_DEFUN([fp_C_PROTOTYPES], [AM_C_PROTOTYPES])
+
+# Check to make sure that the build environment is sane. -*- Autoconf -*-
+
+# Copyright (C) 1996, 1997, 2000, 2001, 2003, 2005, 2008
+# Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 5
+
+# AM_SANITY_CHECK
+# ---------------
+AC_DEFUN([AM_SANITY_CHECK],
+[AC_MSG_CHECKING([whether build environment is sane])
+# Just in case
+sleep 1
+echo timestamp > conftest.file
+# Reject unsafe characters in $srcdir or the absolute working directory
+# name. Accept space and tab only in the latter.
+am_lf='
+'
+case `pwd` in
+ *[[\\\"\#\$\&\'\`$am_lf]]*)
+ AC_MSG_ERROR([unsafe absolute working directory name]);;
+esac
+case $srcdir in
+ *[[\\\"\#\$\&\'\`$am_lf\ \ ]]*)
+ AC_MSG_ERROR([unsafe srcdir value: `$srcdir']);;
+esac
+
+# Do `set' in a subshell so we don't clobber the current shell's
+# arguments. Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+ set X `ls -Lt "$srcdir/configure" conftest.file 2> /dev/null`
+ if test "$[*]" = "X"; then
+ # -L didn't work.
+ set X `ls -t "$srcdir/configure" conftest.file`
+ fi
+ rm -f conftest.file
+ if test "$[*]" != "X $srcdir/configure conftest.file" \
+ && test "$[*]" != "X conftest.file $srcdir/configure"; then
+
+ # If neither matched, then we have a broken ls. This can happen
+ # if, for instance, CONFIG_SHELL is bash and it inherits a
+ # broken ls alias from the environment. This has actually
+ # happened. Such a system could not be considered "sane".
+ AC_MSG_ERROR([ls -t appears to fail. Make sure there is not a broken
+alias in your environment])
+ fi
+
+ test "$[2]" = conftest.file
+ )
+then
+ # Ok.
+ :
+else
+ AC_MSG_ERROR([newly created file is older than distributed files!
+Check your system clock])
+fi
+AC_MSG_RESULT(yes)])
+
+# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_STRIP
+# ---------------------
+# One issue with vendor `install' (even GNU) is that you can't
+# specify the program used to strip binaries. This is especially
+# annoying in cross-compiling environments, where the build's strip
+# is unlikely to handle the host's binaries.
+# Fortunately install-sh will honor a STRIPPROG variable, so we
+# always use install-sh in `make install-strip', and initialize
+# STRIPPROG with the value of the STRIP variable (set by the user).
+AC_DEFUN([AM_PROG_INSTALL_STRIP],
+[AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+# Installed binaries are usually stripped using `strip' when the user
+# run `make install-strip'. However `strip' might not be the right
+# tool to use in cross-compilation environments, therefore Automake
+# will honor the `STRIP' environment variable to overrule this program.
+dnl Don't test for $cross_compiling = yes, because it might be `maybe'.
+if test "$cross_compiling" != no; then
+ AC_CHECK_TOOL([STRIP], [strip], :)
+fi
+INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s"
+AC_SUBST([INSTALL_STRIP_PROGRAM])])
+
+# Copyright (C) 2006, 2008 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 2
+
+# _AM_SUBST_NOTMAKE(VARIABLE)
+# ---------------------------
+# Prevent Automake from outputting VARIABLE = @VARIABLE@ in Makefile.in.
+# This macro is traced by Automake.
+AC_DEFUN([_AM_SUBST_NOTMAKE])
+
+# AM_SUBST_NOTMAKE(VARIABLE)
+# ---------------------------
+# Public sister of _AM_SUBST_NOTMAKE.
+AC_DEFUN([AM_SUBST_NOTMAKE], [_AM_SUBST_NOTMAKE($@)])
+
+# Check how to create a tarball. -*- Autoconf -*-
+
+# Copyright (C) 2004, 2005 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# serial 2
+
+# _AM_PROG_TAR(FORMAT)
+# --------------------
+# Check how to create a tarball in format FORMAT.
+# FORMAT should be one of `v7', `ustar', or `pax'.
+#
+# Substitute a variable $(am__tar) that is a command
+# writing to stdout a FORMAT-tarball containing the directory
+# $tardir.
+# tardir=directory && $(am__tar) > result.tar
+#
+# Substitute a variable $(am__untar) that extract such
+# a tarball read from stdin.
+# $(am__untar) < result.tar
+AC_DEFUN([_AM_PROG_TAR],
+[# Always define AMTAR for backward compatibility.
+AM_MISSING_PROG([AMTAR], [tar])
+m4_if([$1], [v7],
+ [am__tar='${AMTAR} chof - "$$tardir"'; am__untar='${AMTAR} xf -'],
+ [m4_case([$1], [ustar],, [pax],,
+ [m4_fatal([Unknown tar format])])
+AC_MSG_CHECKING([how to create a $1 tar archive])
+# Loop over all known methods to create a tar archive until one works.
+_am_tools='gnutar m4_if([$1], [ustar], [plaintar]) pax cpio none'
+_am_tools=${am_cv_prog_tar_$1-$_am_tools}
+# Do not fold the above two line into one, because Tru64 sh and
+# Solaris sh will not grok spaces in the rhs of `-'.
+for _am_tool in $_am_tools
+do
+ case $_am_tool in
+ gnutar)
+ for _am_tar in tar gnutar gtar;
+ do
+ AM_RUN_LOG([$_am_tar --version]) && break
+ done
+ am__tar="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$$tardir"'
+ am__tar_="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$tardir"'
+ am__untar="$_am_tar -xf -"
+ ;;
+ plaintar)
+ # Must skip GNU tar: if it does not support --format= it doesn't create
+ # ustar tarball either.
+ (tar --version) >/dev/null 2>&1 && continue
+ am__tar='tar chf - "$$tardir"'
+ am__tar_='tar chf - "$tardir"'
+ am__untar='tar xf -'
+ ;;
+ pax)
+ am__tar='pax -L -x $1 -w "$$tardir"'
+ am__tar_='pax -L -x $1 -w "$tardir"'
+ am__untar='pax -r'
+ ;;
+ cpio)
+ am__tar='find "$$tardir" -print | cpio -o -H $1 -L'
+ am__tar_='find "$tardir" -print | cpio -o -H $1 -L'
+ am__untar='cpio -i -H $1 -d'
+ ;;
+ none)
+ am__tar=false
+ am__tar_=false
+ am__untar=false
+ ;;
+ esac
+
+ # If the value was cached, stop now. We just wanted to have am__tar
+ # and am__untar set.
+ test -n "${am_cv_prog_tar_$1}" && break
+
+ # tar/untar a dummy directory, and stop if the command works
+ rm -rf conftest.dir
+ mkdir conftest.dir
+ echo GrepMe > conftest.dir/file
+ AM_RUN_LOG([tardir=conftest.dir && eval $am__tar_ >conftest.tar])
+ rm -rf conftest.dir
+ if test -s conftest.tar; then
+ AM_RUN_LOG([$am__untar <conftest.tar])
+ grep GrepMe conftest.dir/file >/dev/null 2>&1 && break
+ fi
+done
+rm -rf conftest.dir
+
+AC_CACHE_VAL([am_cv_prog_tar_$1], [am_cv_prog_tar_$1=$_am_tool])
+AC_MSG_RESULT([$am_cv_prog_tar_$1])])
+AC_SUBST([am__tar])
+AC_SUBST([am__untar])
+]) # _AM_PROG_TAR
+
+m4_include([m4/gettext.m4])
+m4_include([m4/iconv.m4])
+m4_include([m4/lib-ld.m4])
+m4_include([m4/lib-link.m4])
+m4_include([m4/lib-prefix.m4])
+m4_include([m4/libtool.m4])
+m4_include([m4/ltoptions.m4])
+m4_include([m4/ltsugar.m4])
+m4_include([m4/ltversion.m4])
+m4_include([m4/lt~obsolete.m4])
+m4_include([m4/nls.m4])
+m4_include([m4/po.m4])
+m4_include([m4/progtest.m4])
diff --git a/popt-1.16/auto/Makefile.am b/popt-1.16/auto/Makefile.am
new file mode 100644
index 0000000..56bb292
--- /dev/null
+++ b/popt-1.16/auto/Makefile.am
@@ -0,0 +1,12 @@
+AUTOMAKE_OPTIONS = 1.4 foreign
+
+AUTOTEST = api-sanity-autotest.pl
+
+TDIRS = descriptors_storage header_compile_errors test_results tests
+
+clean-local:
+ rm -rf $(TDIRS)
+
+check-local:
+ -[ -d tests ] && ${AUTOTEST} -l popt -d desc -clean
+ -${AUTOTEST} -l popt -d desc -st types -gen -build -run
diff --git a/popt-1.16/auto/Makefile.in b/popt-1.16/auto/Makefile.in
new file mode 100644
index 0000000..193fc56
--- /dev/null
+++ b/popt-1.16/auto/Makefile.in
@@ -0,0 +1,401 @@
+# Makefile.in generated by automake 1.11.1 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002,
+# 2003, 2004, 2005, 2006, 2007, 2008, 2009 Free Software Foundation,
+# Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+VPATH = @srcdir@
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+target_triplet = @target@
+subdir = auto
+DIST_COMMON = $(srcdir)/Makefile.am $(srcdir)/Makefile.in \
+ $(srcdir)/desc.in $(srcdir)/types.in
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/gettext.m4 \
+ $(top_srcdir)/m4/iconv.m4 $(top_srcdir)/m4/lib-ld.m4 \
+ $(top_srcdir)/m4/lib-link.m4 $(top_srcdir)/m4/lib-prefix.m4 \
+ $(top_srcdir)/m4/libtool.m4 $(top_srcdir)/m4/ltoptions.m4 \
+ $(top_srcdir)/m4/ltsugar.m4 $(top_srcdir)/m4/ltversion.m4 \
+ $(top_srcdir)/m4/lt~obsolete.m4 $(top_srcdir)/m4/nls.m4 \
+ $(top_srcdir)/m4/po.m4 $(top_srcdir)/m4/progtest.m4 \
+ $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_HEADER = $(top_builddir)/config.h
+CONFIG_CLEAN_FILES = desc types
+CONFIG_CLEAN_VPATH_FILES =
+SOURCES =
+DIST_SOURCES =
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GETTEXT_MACRO_VERSION = @GETTEXT_MACRO_VERSION@
+GMSGFMT = @GMSGFMT@
+GMSGFMT_015 = @GMSGFMT_015@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+INTLLIBS = @INTLLIBS@
+INTL_MACOSX_LIBS = @INTL_MACOSX_LIBS@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBICONV = @LIBICONV@
+LIBINTL = @LIBINTL@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBICONV = @LTLIBICONV@
+LTLIBINTL = @LTLIBINTL@
+LTLIBOBJS = @LTLIBOBJS@
+LT_AGE = @LT_AGE@
+LT_CURRENT = @LT_CURRENT@
+LT_REVISION = @LT_REVISION@
+MAINT = @MAINT@
+MAKEINFO = @MAKEINFO@
+MKDIR_P = @MKDIR_P@
+MSGFMT = @MSGFMT@
+MSGFMT_015 = @MSGFMT_015@
+MSGMERGE = @MSGMERGE@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+POPT_PKGCONFIG_LIBS = @POPT_PKGCONFIG_LIBS@
+POPT_SOURCE_PATH = @POPT_SOURCE_PATH@
+POSUB = @POSUB@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+STRIP = @STRIP@
+TARGET = @TARGET@
+U = @U@
+USE_NLS = @USE_NLS@
+VERSION = @VERSION@
+XGETTEXT = @XGETTEXT@
+XGETTEXT_015 = @XGETTEXT_015@
+XGETTEXT_EXTRA_OPTIONS = @XGETTEXT_EXTRA_OPTIONS@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+lt_ECHO = @lt_ECHO@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+subdirs = @subdirs@
+sysconfdir = @sysconfdir@
+target = @target@
+target_alias = @target_alias@
+target_cpu = @target_cpu@
+target_os = @target_os@
+target_vendor = @target_vendor@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+AUTOMAKE_OPTIONS = 1.4 foreign
+AUTOTEST = api-sanity-autotest.pl
+TDIRS = descriptors_storage header_compile_errors test_results tests
+all: all-am
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+ && { if test -f $@; then exit 0; else break; fi; }; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign auto/Makefile'; \
+ $(am__cd) $(top_srcdir) && \
+ $(AUTOMAKE) --foreign auto/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+desc: $(top_builddir)/config.status $(srcdir)/desc.in
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@
+types: $(top_builddir)/config.status $(srcdir)/types.in
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+tags: TAGS
+TAGS:
+
+ctags: CTAGS
+CTAGS:
+
+
+distdir: $(DISTFILES)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ list='$(DISTFILES)'; \
+ dist_files=`for file in $$list; do echo $$file; done | \
+ sed -e "s|^$$srcdirstrip/||;t" \
+ -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+ case $$dist_files in \
+ */*) $(MKDIR_P) `echo "$$dist_files" | \
+ sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+ sort -u` ;; \
+ esac; \
+ for file in $$dist_files; do \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ if test -d $$d/$$file; then \
+ dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test -d "$(distdir)/$$file"; then \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+ else \
+ test -f "$(distdir)/$$file" \
+ || cp -p $$d/$$file "$(distdir)/$$file" \
+ || exit 1; \
+ fi; \
+ done
+check-am: all-am
+ $(MAKE) $(AM_MAKEFLAGS) check-local
+check: check-am
+all-am: Makefile
+installdirs:
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ `test -z '$(STRIP)' || \
+ echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+ -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-generic clean-libtool clean-local mostlyclean-am
+
+distclean: distclean-am
+ -rm -f Makefile
+distclean-am: clean-am distclean-generic
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+html-am:
+
+info: info-am
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-am
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-am
+
+install-html-am:
+
+install-info: install-info-am
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-am
+
+install-pdf-am:
+
+install-ps: install-ps-am
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am:
+
+.MAKE: check-am install-am install-strip
+
+.PHONY: all all-am check check-am check-local clean clean-generic \
+ clean-libtool clean-local distclean distclean-generic \
+ distclean-libtool distdir dvi dvi-am html html-am info info-am \
+ install install-am install-data install-data-am install-dvi \
+ install-dvi-am install-exec install-exec-am install-html \
+ install-html-am install-info install-info-am install-man \
+ install-pdf install-pdf-am install-ps install-ps-am \
+ install-strip installcheck installcheck-am installdirs \
+ maintainer-clean maintainer-clean-generic mostlyclean \
+ mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+ uninstall uninstall-am
+
+
+clean-local:
+ rm -rf $(TDIRS)
+
+check-local:
+ -[ -d tests ] && ${AUTOTEST} -l popt -d desc -clean
+ -${AUTOTEST} -l popt -d desc -st types -gen -build -run
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/popt-1.16/auto/desc.in b/popt-1.16/auto/desc.in
new file mode 100644
index 0000000..32bdc3b
--- /dev/null
+++ b/popt-1.16/auto/desc.in
@@ -0,0 +1,28 @@
+<version>
+ 1.15
+</version>
+
+<headers>
+ popt.h
+</headers>
+
+<libs>
+ @abs_top_builddir@/.libs/libpopt.so
+</libs>
+
+<include_paths>
+ @abs_top_srcdir@
+</include_paths>
+
+<gcc_options>
+ @CFLAGS@
+</gcc_options>
+
+<opaque_types>
+</opaque_types>
+<skip_interfaces>
+</skip_interfaces>
+<include_preamble>
+</include_preamble>
+<libs_depend>
+</libs_depend>
diff --git a/popt-1.16/auto/types.in b/popt-1.16/auto/types.in
new file mode 100644
index 0000000..74a6c33
--- /dev/null
+++ b/popt-1.16/auto/types.in
@@ -0,0 +1,147 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<collection>
+
+<spec_type>
+ <kind> common_env </kind>
+ <global_code>
+ static int aVal = 141421;
+ static unsigned int aFlag = 0x8aceU;
+
+ static short aShort = (short)4523;
+ static int aInt = 271828;
+ static long aLong = 738905609L;
+ static long long aLongLong = 738905609LL;
+ static float aFloat = 3.1415926535;
+ static double aDouble = 9.86960440108935861883;
+ static const char ** aArgv = NULL;
+
+ static struct poptOption optionsTable[] = {
+ { "val", '\0', POPT_ARG_VAL | POPT_ARGFLAG_SHOW_DEFAULT, &aVal, 125992,
+ "POPT_ARG_VAL: 125992 141421", 0},
+ { "int", 'i', POPT_ARG_INT | POPT_ARGFLAG_SHOW_DEFAULT, &aInt, 0,
+ "POPT_ARG_INT: 271828", NULL },
+ { "short", 's', POPT_ARG_SHORT | POPT_ARGFLAG_SHOW_DEFAULT, &aShort, 0,
+ "POPT_ARG_SHORT: 4523", NULL },
+ { "long", 'l', POPT_ARG_LONG | POPT_ARGFLAG_SHOW_DEFAULT, &aLong, 0,
+ "POPT_ARG_LONG: 738905609", NULL },
+ { "longlong", 'L', POPT_ARG_LONGLONG | POPT_ARGFLAG_SHOW_DEFAULT, &aLongLong, 0,
+ "POPT_ARG_LONGLONG: 738905609", NULL },
+ { "float", 'f', POPT_ARG_FLOAT | POPT_ARGFLAG_SHOW_DEFAULT, &aFloat, 0,
+ "POPT_ARG_FLOAT: 3.14159", NULL },
+ { "double", 'd', POPT_ARG_DOUBLE | POPT_ARGFLAG_SHOW_DEFAULT, &aDouble, 0,
+ "POPT_ARG_DOUBLE: 9.8696", NULL },
+ { "argv", '\0', POPT_ARG_ARGV, &aArgv, 0,
+ "POPT_ARG_ARGV: append string to argv array (can be used multiple times)","STRING"},
+ POPT_AUTOALIAS
+ POPT_AUTOHELP
+ POPT_TABLEEND
+ };
+ </global_code>
+</spec_type>
+
+<spec_type>
+ <kind> common_param </kind>
+ <data_type> poptContext </data_type>
+ <value> poptGetContext(argv[0], argc, argv, optionsTable, 0) </value>
+ <final_code>
+ $0 = poptFreeContext($0);
+ </final_code>
+ <associating>
+ <except>
+ poptAddItem <!-- FIXME -->
+ </except>
+ </associating>
+</spec_type>
+<spec_type>
+ <kind> normal </kind>
+ <data_type> poptContext </data_type>
+ <value> poptGetContext(argv[0], argc, argv, optionsTable, 0) </value>
+ <associating>
+ <interfaces>
+ poptFreeContext
+ poptFini
+ </interfaces>
+ <links> param1 </links>
+ </associating>
+</spec_type>
+<spec_type>
+ <kind> normal </kind>
+ <data_type> poptItem </data_type>
+ <value> NULL </value>
+ <global_code>
+ #include <malloc.h>
+ </global_code>
+ <init_code>
+ $0 = calloc(1, sizeof(*$0));
+ $0->option = *poptHelpOptionsI18N;
+ $0->argc = 1;
+ $0->argv = calloc(2, sizeof(*$0->argv));
+ $0->argv[0] = strdup("arg1");
+ </init_code>
+ <associating>
+ <interfaces> poptAddItem </interfaces>
+ <links> param2 </links>
+ </associating>
+</spec_type>
+
+<spec_type>
+ <kind> common_param </kind>
+ <data_type> struct poptAlias </data_type>
+ <value> _alias </value>
+ <global_code>
+ #include <malloc.h>
+ static struct poptAlias _alias = {
+ .longName = "longName",
+ .shortName = 'l',
+ .argc = 0,
+ .argv = NULL
+ };
+ </global_code>
+ <init_code>
+ $0.argc = 1;
+ $0.argv = calloc($0.argc + 1, sizeof(*$0.argv));
+ $0.argv[0] = strdup("arg1");
+ </init_code>
+</spec_type>
+
+<spec_type>
+ <kind> common_param </kind>
+ <name> poptBits </name>
+ <data_type> poptBits </data_type>
+ <value>
+ create_poptBits()
+ </value>
+ <global_code>
+ poptBits create_poptBits()
+ {
+ poptBits a = NULL;
+ (void) poptSaveBits(&a, 0, "foo");
+ (void) poptSaveBits(&a, 0, "bar");
+ (void) poptSaveBits(&a, 0, "baz");
+ return a;
+ }
+ </global_code>
+</spec_type>
+
+<spec_type>
+ <kind> normal </kind>
+ <data_type> const char *** </data_type>
+ <value> &av </value>
+ <global_code>
+ #include <malloc.h>
+ </global_code>
+ <init_code>
+ const char ** av = NULL;
+ </init_code>
+ <final_code>
+ free(av[0]);
+ free(av);
+ </final_code>
+ <associating>
+ <interfaces> poptSaveString </interfaces>
+ <links> param1 </links>
+ </associating>
+</spec_type>
+
+</collection>
+
diff --git a/popt-1.16/autogen.sh b/popt-1.16/autogen.sh
new file mode 100755
index 0000000..63d786c
--- /dev/null
+++ b/popt-1.16/autogen.sh
@@ -0,0 +1,38 @@
+#!/bin/sh
+
+srcdir="`dirname $0`"
+test -z "$srcdir" && srcdir=.
+
+THEDIR="`pwd`"
+
+libtoolize=`which glibtoolize 2>/dev/null`
+case $libtoolize in
+/*) ;;
+*) libtoolize=`which libtoolize 2>/dev/null`
+ case $libtoolize in
+ /*) ;;
+ *) libtoolize=libtoolize
+ esac
+esac
+
+cd "$srcdir"
+$libtoolize --copy --force
+gettextize --copy --force --no-changelog
+perl -p -i~ -e 's/(po\/Makefile\.in)\s+po\/Makefile\.in/$1/' configure.ac
+perl -p -i~ -e 's/(SUBDIRS\s+=\s+po)\s+po/$1/' Makefile.am
+aclocal -I m4
+autoheader
+automake -Wall -Wno-override -a -c
+autoconf
+
+if [ "$1" = "--noconfigure" ]; then
+ exit 0;
+fi
+
+cd "$THEDIR"
+
+if [ X"$@" = X -a "X`uname -s`" = "XLinux" ]; then
+ $srcdir/configure --prefix=/usr --libdir=/lib "$@"
+else
+ $srcdir/configure "$@"
+fi
diff --git a/popt-1.16/config.guess b/popt-1.16/config.guess
new file mode 100755
index 0000000..dc84c68
--- /dev/null
+++ b/popt-1.16/config.guess
@@ -0,0 +1,1501 @@
+#! /bin/sh
+# Attempt to guess a canonical system name.
+# Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999,
+# 2000, 2001, 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009
+# Free Software Foundation, Inc.
+
+timestamp='2009-11-20'
+
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin Street - Fifth Floor, Boston, MA
+# 02110-1301, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+
+# Originally written by Per Bothner. Please send patches (context
+# diff format) to <config-patches@gnu.org> and include a ChangeLog
+# entry.
+#
+# This script attempts to guess a canonical system name similar to
+# config.sub. If it succeeds, it prints the system name on stdout, and
+# exits with 0. Otherwise, it exits with 1.
+#
+# You can get the latest version of this script from:
+# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess;hb=HEAD
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION]
+
+Output the configuration name of the system \`$me' is run on.
+
+Operation modes:
+ -h, --help print this help, then exit
+ -t, --time-stamp print date of last modification, then exit
+ -v, --version print version number, then exit
+
+Report bugs and patches to <config-patches@gnu.org>."
+
+version="\
+GNU config.guess ($timestamp)
+
+Originally written by Per Bothner.
+Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001,
+2002, 2003, 2004, 2005, 2006, 2007, 2008 Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions. There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+ case $1 in
+ --time-stamp | --time* | -t )
+ echo "$timestamp" ; exit ;;
+ --version | -v )
+ echo "$version" ; exit ;;
+ --help | --h* | -h )
+ echo "$usage"; exit ;;
+ -- ) # Stop option processing
+ shift; break ;;
+ - ) # Use stdin as input.
+ break ;;
+ -* )
+ echo "$me: invalid option $1$help" >&2
+ exit 1 ;;
+ * )
+ break ;;
+ esac
+done
+
+if test $# != 0; then
+ echo "$me: too many arguments$help" >&2
+ exit 1
+fi
+
+trap 'exit 1' 1 2 15
+
+# CC_FOR_BUILD -- compiler used by this script. Note that the use of a
+# compiler to aid in system detection is discouraged as it requires
+# temporary files to be created and, as you can see below, it is a
+# headache to deal with in a portable fashion.
+
+# Historically, `CC_FOR_BUILD' used to be named `HOST_CC'. We still
+# use `HOST_CC' if defined, but it is deprecated.
+
+# Portable tmp directory creation inspired by the Autoconf team.
+
+set_cc_for_build='
+trap "exitcode=\$?; (rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null) && exit \$exitcode" 0 ;
+trap "rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null; exit 1" 1 2 13 15 ;
+: ${TMPDIR=/tmp} ;
+ { tmp=`(umask 077 && mktemp -d "$TMPDIR/cgXXXXXX") 2>/dev/null` && test -n "$tmp" && test -d "$tmp" ; } ||
+ { test -n "$RANDOM" && tmp=$TMPDIR/cg$$-$RANDOM && (umask 077 && mkdir $tmp) ; } ||
+ { tmp=$TMPDIR/cg-$$ && (umask 077 && mkdir $tmp) && echo "Warning: creating insecure temp directory" >&2 ; } ||
+ { echo "$me: cannot create a temporary directory in $TMPDIR" >&2 ; exit 1 ; } ;
+dummy=$tmp/dummy ;
+tmpfiles="$dummy.c $dummy.o $dummy.rel $dummy" ;
+case $CC_FOR_BUILD,$HOST_CC,$CC in
+ ,,) echo "int x;" > $dummy.c ;
+ for c in cc gcc c89 c99 ; do
+ if ($c -c -o $dummy.o $dummy.c) >/dev/null 2>&1 ; then
+ CC_FOR_BUILD="$c"; break ;
+ fi ;
+ done ;
+ if test x"$CC_FOR_BUILD" = x ; then
+ CC_FOR_BUILD=no_compiler_found ;
+ fi
+ ;;
+ ,,*) CC_FOR_BUILD=$CC ;;
+ ,*,*) CC_FOR_BUILD=$HOST_CC ;;
+esac ; set_cc_for_build= ;'
+
+# This is needed to find uname on a Pyramid OSx when run in the BSD universe.
+# (ghazi@noc.rutgers.edu 1994-08-24)
+if (test -f /.attbin/uname) >/dev/null 2>&1 ; then
+ PATH=$PATH:/.attbin ; export PATH
+fi
+
+UNAME_MACHINE=`(uname -m) 2>/dev/null` || UNAME_MACHINE=unknown
+UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown
+UNAME_SYSTEM=`(uname -s) 2>/dev/null` || UNAME_SYSTEM=unknown
+UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown
+
+# Note: order is significant - the case branches are not exclusive.
+
+case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
+ *:NetBSD:*:*)
+ # NetBSD (nbsd) targets should (where applicable) match one or
+ # more of the tupples: *-*-netbsdelf*, *-*-netbsdaout*,
+ # *-*-netbsdecoff* and *-*-netbsd*. For targets that recently
+ # switched to ELF, *-*-netbsd* would select the old
+ # object file format. This provides both forward
+ # compatibility and a consistent mechanism for selecting the
+ # object file format.
+ #
+ # Note: NetBSD doesn't particularly care about the vendor
+ # portion of the name. We always set it to "unknown".
+ sysctl="sysctl -n hw.machine_arch"
+ UNAME_MACHINE_ARCH=`(/sbin/$sysctl 2>/dev/null || \
+ /usr/sbin/$sysctl 2>/dev/null || echo unknown)`
+ case "${UNAME_MACHINE_ARCH}" in
+ armeb) machine=armeb-unknown ;;
+ arm*) machine=arm-unknown ;;
+ sh3el) machine=shl-unknown ;;
+ sh3eb) machine=sh-unknown ;;
+ sh5el) machine=sh5le-unknown ;;
+ *) machine=${UNAME_MACHINE_ARCH}-unknown ;;
+ esac
+ # The Operating System including object format, if it has switched
+ # to ELF recently, or will in the future.
+ case "${UNAME_MACHINE_ARCH}" in
+ arm*|i386|m68k|ns32k|sh3*|sparc|vax)
+ eval $set_cc_for_build
+ if echo __ELF__ | $CC_FOR_BUILD -E - 2>/dev/null \
+ | grep -q __ELF__
+ then
+ # Once all utilities can be ECOFF (netbsdecoff) or a.out (netbsdaout).
+ # Return netbsd for either. FIX?
+ os=netbsd
+ else
+ os=netbsdelf
+ fi
+ ;;
+ *)
+ os=netbsd
+ ;;
+ esac
+ # The OS release
+ # Debian GNU/NetBSD machines have a different userland, and
+ # thus, need a distinct triplet. However, they do not need
+ # kernel version information, so it can be replaced with a
+ # suitable tag, in the style of linux-gnu.
+ case "${UNAME_VERSION}" in
+ Debian*)
+ release='-gnu'
+ ;;
+ *)
+ release=`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+ ;;
+ esac
+ # Since CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM:
+ # contains redundant information, the shorter form:
+ # CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM is used.
+ echo "${machine}-${os}${release}"
+ exit ;;
+ *:OpenBSD:*:*)
+ UNAME_MACHINE_ARCH=`arch | sed 's/OpenBSD.//'`
+ echo ${UNAME_MACHINE_ARCH}-unknown-openbsd${UNAME_RELEASE}
+ exit ;;
+ *:ekkoBSD:*:*)
+ echo ${UNAME_MACHINE}-unknown-ekkobsd${UNAME_RELEASE}
+ exit ;;
+ *:SolidBSD:*:*)
+ echo ${UNAME_MACHINE}-unknown-solidbsd${UNAME_RELEASE}
+ exit ;;
+ macppc:MirBSD:*:*)
+ echo powerpc-unknown-mirbsd${UNAME_RELEASE}
+ exit ;;
+ *:MirBSD:*:*)
+ echo ${UNAME_MACHINE}-unknown-mirbsd${UNAME_RELEASE}
+ exit ;;
+ alpha:OSF1:*:*)
+ case $UNAME_RELEASE in
+ *4.0)
+ UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'`
+ ;;
+ *5.*)
+ UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $4}'`
+ ;;
+ esac
+ # According to Compaq, /usr/sbin/psrinfo has been available on
+ # OSF/1 and Tru64 systems produced since 1995. I hope that
+ # covers most systems running today. This code pipes the CPU
+ # types through head -n 1, so we only detect the type of CPU 0.
+ ALPHA_CPU_TYPE=`/usr/sbin/psrinfo -v | sed -n -e 's/^ The alpha \(.*\) processor.*$/\1/p' | head -n 1`
+ case "$ALPHA_CPU_TYPE" in
+ "EV4 (21064)")
+ UNAME_MACHINE="alpha" ;;
+ "EV4.5 (21064)")
+ UNAME_MACHINE="alpha" ;;
+ "LCA4 (21066/21068)")
+ UNAME_MACHINE="alpha" ;;
+ "EV5 (21164)")
+ UNAME_MACHINE="alphaev5" ;;
+ "EV5.6 (21164A)")
+ UNAME_MACHINE="alphaev56" ;;
+ "EV5.6 (21164PC)")
+ UNAME_MACHINE="alphapca56" ;;
+ "EV5.7 (21164PC)")
+ UNAME_MACHINE="alphapca57" ;;
+ "EV6 (21264)")
+ UNAME_MACHINE="alphaev6" ;;
+ "EV6.7 (21264A)")
+ UNAME_MACHINE="alphaev67" ;;
+ "EV6.8CB (21264C)")
+ UNAME_MACHINE="alphaev68" ;;
+ "EV6.8AL (21264B)")
+ UNAME_MACHINE="alphaev68" ;;
+ "EV6.8CX (21264D)")
+ UNAME_MACHINE="alphaev68" ;;
+ "EV6.9A (21264/EV69A)")
+ UNAME_MACHINE="alphaev69" ;;
+ "EV7 (21364)")
+ UNAME_MACHINE="alphaev7" ;;
+ "EV7.9 (21364A)")
+ UNAME_MACHINE="alphaev79" ;;
+ esac
+ # A Pn.n version is a patched version.
+ # A Vn.n version is a released version.
+ # A Tn.n version is a released field test version.
+ # A Xn.n version is an unreleased experimental baselevel.
+ # 1.2 uses "1.2" for uname -r.
+ echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[PVTX]//' | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+ exit ;;
+ Alpha\ *:Windows_NT*:*)
+ # How do we know it's Interix rather than the generic POSIX subsystem?
+ # Should we change UNAME_MACHINE based on the output of uname instead
+ # of the specific Alpha model?
+ echo alpha-pc-interix
+ exit ;;
+ 21064:Windows_NT:50:3)
+ echo alpha-dec-winnt3.5
+ exit ;;
+ Amiga*:UNIX_System_V:4.0:*)
+ echo m68k-unknown-sysv4
+ exit ;;
+ *:[Aa]miga[Oo][Ss]:*:*)
+ echo ${UNAME_MACHINE}-unknown-amigaos
+ exit ;;
+ *:[Mm]orph[Oo][Ss]:*:*)
+ echo ${UNAME_MACHINE}-unknown-morphos
+ exit ;;
+ *:OS/390:*:*)
+ echo i370-ibm-openedition
+ exit ;;
+ *:z/VM:*:*)
+ echo s390-ibm-zvmoe
+ exit ;;
+ *:OS400:*:*)
+ echo powerpc-ibm-os400
+ exit ;;
+ arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*)
+ echo arm-acorn-riscix${UNAME_RELEASE}
+ exit ;;
+ arm:riscos:*:*|arm:RISCOS:*:*)
+ echo arm-unknown-riscos
+ exit ;;
+ SR2?01:HI-UX/MPP:*:* | SR8000:HI-UX/MPP:*:*)
+ echo hppa1.1-hitachi-hiuxmpp
+ exit ;;
+ Pyramid*:OSx*:*:* | MIS*:OSx*:*:* | MIS*:SMP_DC-OSx*:*:*)
+ # akee@wpdis03.wpafb.af.mil (Earle F. Ake) contributed MIS and NILE.
+ if test "`(/bin/universe) 2>/dev/null`" = att ; then
+ echo pyramid-pyramid-sysv3
+ else
+ echo pyramid-pyramid-bsd
+ fi
+ exit ;;
+ NILE*:*:*:dcosx)
+ echo pyramid-pyramid-svr4
+ exit ;;
+ DRS?6000:unix:4.0:6*)
+ echo sparc-icl-nx6
+ exit ;;
+ DRS?6000:UNIX_SV:4.2*:7* | DRS?6000:isis:4.2*:7*)
+ case `/usr/bin/uname -p` in
+ sparc) echo sparc-icl-nx7; exit ;;
+ esac ;;
+ s390x:SunOS:*:*)
+ echo ${UNAME_MACHINE}-ibm-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ sun4H:SunOS:5.*:*)
+ echo sparc-hal-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*)
+ echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ i86pc:AuroraUX:5.*:* | i86xen:AuroraUX:5.*:*)
+ echo i386-pc-auroraux${UNAME_RELEASE}
+ exit ;;
+ i86pc:SunOS:5.*:* | i86xen:SunOS:5.*:*)
+ eval $set_cc_for_build
+ SUN_ARCH="i386"
+ # If there is a compiler, see if it is configured for 64-bit objects.
+ # Note that the Sun cc does not turn __LP64__ into 1 like gcc does.
+ # This test works for both compilers.
+ if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then
+ if (echo '#ifdef __amd64'; echo IS_64BIT_ARCH; echo '#endif') | \
+ (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \
+ grep IS_64BIT_ARCH >/dev/null
+ then
+ SUN_ARCH="x86_64"
+ fi
+ fi
+ echo ${SUN_ARCH}-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ sun4*:SunOS:6*:*)
+ # According to config.sub, this is the proper way to canonicalize
+ # SunOS6. Hard to guess exactly what SunOS6 will be like, but
+ # it's likely to be more like Solaris than SunOS4.
+ echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ sun4*:SunOS:*:*)
+ case "`/usr/bin/arch -k`" in
+ Series*|S4*)
+ UNAME_RELEASE=`uname -v`
+ ;;
+ esac
+ # Japanese Language versions have a version number like `4.1.3-JL'.
+ echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'`
+ exit ;;
+ sun3*:SunOS:*:*)
+ echo m68k-sun-sunos${UNAME_RELEASE}
+ exit ;;
+ sun*:*:4.2BSD:*)
+ UNAME_RELEASE=`(sed 1q /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null`
+ test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3
+ case "`/bin/arch`" in
+ sun3)
+ echo m68k-sun-sunos${UNAME_RELEASE}
+ ;;
+ sun4)
+ echo sparc-sun-sunos${UNAME_RELEASE}
+ ;;
+ esac
+ exit ;;
+ aushp:SunOS:*:*)
+ echo sparc-auspex-sunos${UNAME_RELEASE}
+ exit ;;
+ # The situation for MiNT is a little confusing. The machine name
+ # can be virtually everything (everything which is not
+ # "atarist" or "atariste" at least should have a processor
+ # > m68000). The system name ranges from "MiNT" over "FreeMiNT"
+ # to the lowercase version "mint" (or "freemint"). Finally
+ # the system name "TOS" denotes a system which is actually not
+ # MiNT. But MiNT is downward compatible to TOS, so this should
+ # be no problem.
+ atarist[e]:*MiNT:*:* | atarist[e]:*mint:*:* | atarist[e]:*TOS:*:*)
+ echo m68k-atari-mint${UNAME_RELEASE}
+ exit ;;
+ atari*:*MiNT:*:* | atari*:*mint:*:* | atarist[e]:*TOS:*:*)
+ echo m68k-atari-mint${UNAME_RELEASE}
+ exit ;;
+ *falcon*:*MiNT:*:* | *falcon*:*mint:*:* | *falcon*:*TOS:*:*)
+ echo m68k-atari-mint${UNAME_RELEASE}
+ exit ;;
+ milan*:*MiNT:*:* | milan*:*mint:*:* | *milan*:*TOS:*:*)
+ echo m68k-milan-mint${UNAME_RELEASE}
+ exit ;;
+ hades*:*MiNT:*:* | hades*:*mint:*:* | *hades*:*TOS:*:*)
+ echo m68k-hades-mint${UNAME_RELEASE}
+ exit ;;
+ *:*MiNT:*:* | *:*mint:*:* | *:*TOS:*:*)
+ echo m68k-unknown-mint${UNAME_RELEASE}
+ exit ;;
+ m68k:machten:*:*)
+ echo m68k-apple-machten${UNAME_RELEASE}
+ exit ;;
+ powerpc:machten:*:*)
+ echo powerpc-apple-machten${UNAME_RELEASE}
+ exit ;;
+ RISC*:Mach:*:*)
+ echo mips-dec-mach_bsd4.3
+ exit ;;
+ RISC*:ULTRIX:*:*)
+ echo mips-dec-ultrix${UNAME_RELEASE}
+ exit ;;
+ VAX*:ULTRIX*:*:*)
+ echo vax-dec-ultrix${UNAME_RELEASE}
+ exit ;;
+ 2020:CLIX:*:* | 2430:CLIX:*:*)
+ echo clipper-intergraph-clix${UNAME_RELEASE}
+ exit ;;
+ mips:*:*:UMIPS | mips:*:*:RISCos)
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+#ifdef __cplusplus
+#include <stdio.h> /* for printf() prototype */
+ int main (int argc, char *argv[]) {
+#else
+ int main (argc, argv) int argc; char *argv[]; {
+#endif
+ #if defined (host_mips) && defined (MIPSEB)
+ #if defined (SYSTYPE_SYSV)
+ printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0);
+ #endif
+ #if defined (SYSTYPE_SVR4)
+ printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0);
+ #endif
+ #if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD)
+ printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0);
+ #endif
+ #endif
+ exit (-1);
+ }
+EOF
+ $CC_FOR_BUILD -o $dummy $dummy.c &&
+ dummyarg=`echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` &&
+ SYSTEM_NAME=`$dummy $dummyarg` &&
+ { echo "$SYSTEM_NAME"; exit; }
+ echo mips-mips-riscos${UNAME_RELEASE}
+ exit ;;
+ Motorola:PowerMAX_OS:*:*)
+ echo powerpc-motorola-powermax
+ exit ;;
+ Motorola:*:4.3:PL8-*)
+ echo powerpc-harris-powermax
+ exit ;;
+ Night_Hawk:*:*:PowerMAX_OS | Synergy:PowerMAX_OS:*:*)
+ echo powerpc-harris-powermax
+ exit ;;
+ Night_Hawk:Power_UNIX:*:*)
+ echo powerpc-harris-powerunix
+ exit ;;
+ m88k:CX/UX:7*:*)
+ echo m88k-harris-cxux7
+ exit ;;
+ m88k:*:4*:R4*)
+ echo m88k-motorola-sysv4
+ exit ;;
+ m88k:*:3*:R3*)
+ echo m88k-motorola-sysv3
+ exit ;;
+ AViiON:dgux:*:*)
+ # DG/UX returns AViiON for all architectures
+ UNAME_PROCESSOR=`/usr/bin/uname -p`
+ if [ $UNAME_PROCESSOR = mc88100 ] || [ $UNAME_PROCESSOR = mc88110 ]
+ then
+ if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx ] || \
+ [ ${TARGET_BINARY_INTERFACE}x = x ]
+ then
+ echo m88k-dg-dgux${UNAME_RELEASE}
+ else
+ echo m88k-dg-dguxbcs${UNAME_RELEASE}
+ fi
+ else
+ echo i586-dg-dgux${UNAME_RELEASE}
+ fi
+ exit ;;
+ M88*:DolphinOS:*:*) # DolphinOS (SVR3)
+ echo m88k-dolphin-sysv3
+ exit ;;
+ M88*:*:R3*:*)
+ # Delta 88k system running SVR3
+ echo m88k-motorola-sysv3
+ exit ;;
+ XD88*:*:*:*) # Tektronix XD88 system running UTekV (SVR3)
+ echo m88k-tektronix-sysv3
+ exit ;;
+ Tek43[0-9][0-9]:UTek:*:*) # Tektronix 4300 system running UTek (BSD)
+ echo m68k-tektronix-bsd
+ exit ;;
+ *:IRIX*:*:*)
+ echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'`
+ exit ;;
+ ????????:AIX?:[12].1:2) # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX.
+ echo romp-ibm-aix # uname -m gives an 8 hex-code CPU id
+ exit ;; # Note that: echo "'`uname -s`'" gives 'AIX '
+ i*86:AIX:*:*)
+ echo i386-ibm-aix
+ exit ;;
+ ia64:AIX:*:*)
+ if [ -x /usr/bin/oslevel ] ; then
+ IBM_REV=`/usr/bin/oslevel`
+ else
+ IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+ fi
+ echo ${UNAME_MACHINE}-ibm-aix${IBM_REV}
+ exit ;;
+ *:AIX:2:3)
+ if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #include <sys/systemcfg.h>
+
+ main()
+ {
+ if (!__power_pc())
+ exit(1);
+ puts("powerpc-ibm-aix3.2.5");
+ exit(0);
+ }
+EOF
+ if $CC_FOR_BUILD -o $dummy $dummy.c && SYSTEM_NAME=`$dummy`
+ then
+ echo "$SYSTEM_NAME"
+ else
+ echo rs6000-ibm-aix3.2.5
+ fi
+ elif grep bos324 /usr/include/stdio.h >/dev/null 2>&1; then
+ echo rs6000-ibm-aix3.2.4
+ else
+ echo rs6000-ibm-aix3.2
+ fi
+ exit ;;
+ *:AIX:*:[456])
+ IBM_CPU_ID=`/usr/sbin/lsdev -C -c processor -S available | sed 1q | awk '{ print $1 }'`
+ if /usr/sbin/lsattr -El ${IBM_CPU_ID} | grep ' POWER' >/dev/null 2>&1; then
+ IBM_ARCH=rs6000
+ else
+ IBM_ARCH=powerpc
+ fi
+ if [ -x /usr/bin/oslevel ] ; then
+ IBM_REV=`/usr/bin/oslevel`
+ else
+ IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+ fi
+ echo ${IBM_ARCH}-ibm-aix${IBM_REV}
+ exit ;;
+ *:AIX:*:*)
+ echo rs6000-ibm-aix
+ exit ;;
+ ibmrt:4.4BSD:*|romp-ibm:BSD:*)
+ echo romp-ibm-bsd4.4
+ exit ;;
+ ibmrt:*BSD:*|romp-ibm:BSD:*) # covers RT/PC BSD and
+ echo romp-ibm-bsd${UNAME_RELEASE} # 4.3 with uname added to
+ exit ;; # report: romp-ibm BSD 4.3
+ *:BOSX:*:*)
+ echo rs6000-bull-bosx
+ exit ;;
+ DPX/2?00:B.O.S.:*:*)
+ echo m68k-bull-sysv3
+ exit ;;
+ 9000/[34]??:4.3bsd:1.*:*)
+ echo m68k-hp-bsd
+ exit ;;
+ hp300:4.4BSD:*:* | 9000/[34]??:4.3bsd:2.*:*)
+ echo m68k-hp-bsd4.4
+ exit ;;
+ 9000/[34678]??:HP-UX:*:*)
+ HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+ case "${UNAME_MACHINE}" in
+ 9000/31? ) HP_ARCH=m68000 ;;
+ 9000/[34]?? ) HP_ARCH=m68k ;;
+ 9000/[678][0-9][0-9])
+ if [ -x /usr/bin/getconf ]; then
+ sc_cpu_version=`/usr/bin/getconf SC_CPU_VERSION 2>/dev/null`
+ sc_kernel_bits=`/usr/bin/getconf SC_KERNEL_BITS 2>/dev/null`
+ case "${sc_cpu_version}" in
+ 523) HP_ARCH="hppa1.0" ;; # CPU_PA_RISC1_0
+ 528) HP_ARCH="hppa1.1" ;; # CPU_PA_RISC1_1
+ 532) # CPU_PA_RISC2_0
+ case "${sc_kernel_bits}" in
+ 32) HP_ARCH="hppa2.0n" ;;
+ 64) HP_ARCH="hppa2.0w" ;;
+ '') HP_ARCH="hppa2.0" ;; # HP-UX 10.20
+ esac ;;
+ esac
+ fi
+ if [ "${HP_ARCH}" = "" ]; then
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+
+ #define _HPUX_SOURCE
+ #include <stdlib.h>
+ #include <unistd.h>
+
+ int main ()
+ {
+ #if defined(_SC_KERNEL_BITS)
+ long bits = sysconf(_SC_KERNEL_BITS);
+ #endif
+ long cpu = sysconf (_SC_CPU_VERSION);
+
+ switch (cpu)
+ {
+ case CPU_PA_RISC1_0: puts ("hppa1.0"); break;
+ case CPU_PA_RISC1_1: puts ("hppa1.1"); break;
+ case CPU_PA_RISC2_0:
+ #if defined(_SC_KERNEL_BITS)
+ switch (bits)
+ {
+ case 64: puts ("hppa2.0w"); break;
+ case 32: puts ("hppa2.0n"); break;
+ default: puts ("hppa2.0"); break;
+ } break;
+ #else /* !defined(_SC_KERNEL_BITS) */
+ puts ("hppa2.0"); break;
+ #endif
+ default: puts ("hppa1.0"); break;
+ }
+ exit (0);
+ }
+EOF
+ (CCOPTS= $CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null) && HP_ARCH=`$dummy`
+ test -z "$HP_ARCH" && HP_ARCH=hppa
+ fi ;;
+ esac
+ if [ ${HP_ARCH} = "hppa2.0w" ]
+ then
+ eval $set_cc_for_build
+
+ # hppa2.0w-hp-hpux* has a 64-bit kernel and a compiler generating
+ # 32-bit code. hppa64-hp-hpux* has the same kernel and a compiler
+ # generating 64-bit code. GNU and HP use different nomenclature:
+ #
+ # $ CC_FOR_BUILD=cc ./config.guess
+ # => hppa2.0w-hp-hpux11.23
+ # $ CC_FOR_BUILD="cc +DA2.0w" ./config.guess
+ # => hppa64-hp-hpux11.23
+
+ if echo __LP64__ | (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) |
+ grep -q __LP64__
+ then
+ HP_ARCH="hppa2.0w"
+ else
+ HP_ARCH="hppa64"
+ fi
+ fi
+ echo ${HP_ARCH}-hp-hpux${HPUX_REV}
+ exit ;;
+ ia64:HP-UX:*:*)
+ HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+ echo ia64-hp-hpux${HPUX_REV}
+ exit ;;
+ 3050*:HI-UX:*:*)
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #include <unistd.h>
+ int
+ main ()
+ {
+ long cpu = sysconf (_SC_CPU_VERSION);
+ /* The order matters, because CPU_IS_HP_MC68K erroneously returns
+ true for CPU_PA_RISC1_0. CPU_IS_PA_RISC returns correct
+ results, however. */
+ if (CPU_IS_PA_RISC (cpu))
+ {
+ switch (cpu)
+ {
+ case CPU_PA_RISC1_0: puts ("hppa1.0-hitachi-hiuxwe2"); break;
+ case CPU_PA_RISC1_1: puts ("hppa1.1-hitachi-hiuxwe2"); break;
+ case CPU_PA_RISC2_0: puts ("hppa2.0-hitachi-hiuxwe2"); break;
+ default: puts ("hppa-hitachi-hiuxwe2"); break;
+ }
+ }
+ else if (CPU_IS_HP_MC68K (cpu))
+ puts ("m68k-hitachi-hiuxwe2");
+ else puts ("unknown-hitachi-hiuxwe2");
+ exit (0);
+ }
+EOF
+ $CC_FOR_BUILD -o $dummy $dummy.c && SYSTEM_NAME=`$dummy` &&
+ { echo "$SYSTEM_NAME"; exit; }
+ echo unknown-hitachi-hiuxwe2
+ exit ;;
+ 9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* )
+ echo hppa1.1-hp-bsd
+ exit ;;
+ 9000/8??:4.3bsd:*:*)
+ echo hppa1.0-hp-bsd
+ exit ;;
+ *9??*:MPE/iX:*:* | *3000*:MPE/iX:*:*)
+ echo hppa1.0-hp-mpeix
+ exit ;;
+ hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* )
+ echo hppa1.1-hp-osf
+ exit ;;
+ hp8??:OSF1:*:*)
+ echo hppa1.0-hp-osf
+ exit ;;
+ i*86:OSF1:*:*)
+ if [ -x /usr/sbin/sysversion ] ; then
+ echo ${UNAME_MACHINE}-unknown-osf1mk
+ else
+ echo ${UNAME_MACHINE}-unknown-osf1
+ fi
+ exit ;;
+ parisc*:Lites*:*:*)
+ echo hppa1.1-hp-lites
+ exit ;;
+ C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*)
+ echo c1-convex-bsd
+ exit ;;
+ C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*)
+ if getsysinfo -f scalar_acc
+ then echo c32-convex-bsd
+ else echo c2-convex-bsd
+ fi
+ exit ;;
+ C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*)
+ echo c34-convex-bsd
+ exit ;;
+ C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*)
+ echo c38-convex-bsd
+ exit ;;
+ C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*)
+ echo c4-convex-bsd
+ exit ;;
+ CRAY*Y-MP:*:*:*)
+ echo ymp-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit ;;
+ CRAY*[A-Z]90:*:*:*)
+ echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \
+ | sed -e 's/CRAY.*\([A-Z]90\)/\1/' \
+ -e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/ \
+ -e 's/\.[^.]*$/.X/'
+ exit ;;
+ CRAY*TS:*:*:*)
+ echo t90-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit ;;
+ CRAY*T3E:*:*:*)
+ echo alphaev5-cray-unicosmk${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit ;;
+ CRAY*SV1:*:*:*)
+ echo sv1-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit ;;
+ *:UNICOS/mp:*:*)
+ echo craynv-cray-unicosmp${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit ;;
+ F30[01]:UNIX_System_V:*:* | F700:UNIX_System_V:*:*)
+ FUJITSU_PROC=`uname -m | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+ FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
+ FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'`
+ echo "${FUJITSU_PROC}-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+ exit ;;
+ 5000:UNIX_System_V:4.*:*)
+ FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
+ FUJITSU_REL=`echo ${UNAME_RELEASE} | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/ /_/'`
+ echo "sparc-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+ exit ;;
+ i*86:BSD/386:*:* | i*86:BSD/OS:*:* | *:Ascend\ Embedded/OS:*:*)
+ echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE}
+ exit ;;
+ sparc*:BSD/OS:*:*)
+ echo sparc-unknown-bsdi${UNAME_RELEASE}
+ exit ;;
+ *:BSD/OS:*:*)
+ echo ${UNAME_MACHINE}-unknown-bsdi${UNAME_RELEASE}
+ exit ;;
+ *:FreeBSD:*:*)
+ case ${UNAME_MACHINE} in
+ pc98)
+ echo i386-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+ amd64)
+ echo x86_64-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+ *)
+ echo ${UNAME_MACHINE}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+ esac
+ exit ;;
+ i*:CYGWIN*:*)
+ echo ${UNAME_MACHINE}-pc-cygwin
+ exit ;;
+ *:MINGW*:*)
+ echo ${UNAME_MACHINE}-pc-mingw32
+ exit ;;
+ i*:windows32*:*)
+ # uname -m includes "-pc" on this system.
+ echo ${UNAME_MACHINE}-mingw32
+ exit ;;
+ i*:PW*:*)
+ echo ${UNAME_MACHINE}-pc-pw32
+ exit ;;
+ *:Interix*:*)
+ case ${UNAME_MACHINE} in
+ x86)
+ echo i586-pc-interix${UNAME_RELEASE}
+ exit ;;
+ authenticamd | genuineintel | EM64T)
+ echo x86_64-unknown-interix${UNAME_RELEASE}
+ exit ;;
+ IA64)
+ echo ia64-unknown-interix${UNAME_RELEASE}
+ exit ;;
+ esac ;;
+ [345]86:Windows_95:* | [345]86:Windows_98:* | [345]86:Windows_NT:*)
+ echo i${UNAME_MACHINE}-pc-mks
+ exit ;;
+ 8664:Windows_NT:*)
+ echo x86_64-pc-mks
+ exit ;;
+ i*:Windows_NT*:* | Pentium*:Windows_NT*:*)
+ # How do we know it's Interix rather than the generic POSIX subsystem?
+ # It also conflicts with pre-2.0 versions of AT&T UWIN. Should we
+ # UNAME_MACHINE based on the output of uname instead of i386?
+ echo i586-pc-interix
+ exit ;;
+ i*:UWIN*:*)
+ echo ${UNAME_MACHINE}-pc-uwin
+ exit ;;
+ amd64:CYGWIN*:*:* | x86_64:CYGWIN*:*:*)
+ echo x86_64-unknown-cygwin
+ exit ;;
+ p*:CYGWIN*:*)
+ echo powerpcle-unknown-cygwin
+ exit ;;
+ prep*:SunOS:5.*:*)
+ echo powerpcle-unknown-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ *:GNU:*:*)
+ # the GNU system
+ echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-unknown-gnu`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'`
+ exit ;;
+ *:GNU/*:*:*)
+ # other systems with GNU libc and userland
+ echo ${UNAME_MACHINE}-unknown-`echo ${UNAME_SYSTEM} | sed 's,^[^/]*/,,' | tr '[A-Z]' '[a-z]'``echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`-gnu
+ exit ;;
+ i*86:Minix:*:*)
+ echo ${UNAME_MACHINE}-pc-minix
+ exit ;;
+ alpha:Linux:*:*)
+ case `sed -n '/^cpu model/s/^.*: \(.*\)/\1/p' < /proc/cpuinfo` in
+ EV5) UNAME_MACHINE=alphaev5 ;;
+ EV56) UNAME_MACHINE=alphaev56 ;;
+ PCA56) UNAME_MACHINE=alphapca56 ;;
+ PCA57) UNAME_MACHINE=alphapca56 ;;
+ EV6) UNAME_MACHINE=alphaev6 ;;
+ EV67) UNAME_MACHINE=alphaev67 ;;
+ EV68*) UNAME_MACHINE=alphaev68 ;;
+ esac
+ objdump --private-headers /bin/sh | grep -q ld.so.1
+ if test "$?" = 0 ; then LIBC="libc1" ; else LIBC="" ; fi
+ echo ${UNAME_MACHINE}-unknown-linux-gnu${LIBC}
+ exit ;;
+ arm*:Linux:*:*)
+ eval $set_cc_for_build
+ if echo __ARM_EABI__ | $CC_FOR_BUILD -E - 2>/dev/null \
+ | grep -q __ARM_EABI__
+ then
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ else
+ echo ${UNAME_MACHINE}-unknown-linux-gnueabi
+ fi
+ exit ;;
+ avr32*:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit ;;
+ cris:Linux:*:*)
+ echo cris-axis-linux-gnu
+ exit ;;
+ crisv32:Linux:*:*)
+ echo crisv32-axis-linux-gnu
+ exit ;;
+ frv:Linux:*:*)
+ echo frv-unknown-linux-gnu
+ exit ;;
+ i*86:Linux:*:*)
+ LIBC=gnu
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #ifdef __dietlibc__
+ LIBC=dietlibc
+ #endif
+EOF
+ eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^LIBC'`
+ echo "${UNAME_MACHINE}-pc-linux-${LIBC}"
+ exit ;;
+ ia64:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit ;;
+ m32r*:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit ;;
+ m68*:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit ;;
+ mips:Linux:*:* | mips64:Linux:*:*)
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #undef CPU
+ #undef ${UNAME_MACHINE}
+ #undef ${UNAME_MACHINE}el
+ #if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL)
+ CPU=${UNAME_MACHINE}el
+ #else
+ #if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB)
+ CPU=${UNAME_MACHINE}
+ #else
+ CPU=
+ #endif
+ #endif
+EOF
+ eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^CPU'`
+ test x"${CPU}" != x && { echo "${CPU}-unknown-linux-gnu"; exit; }
+ ;;
+ or32:Linux:*:*)
+ echo or32-unknown-linux-gnu
+ exit ;;
+ padre:Linux:*:*)
+ echo sparc-unknown-linux-gnu
+ exit ;;
+ parisc64:Linux:*:* | hppa64:Linux:*:*)
+ echo hppa64-unknown-linux-gnu
+ exit ;;
+ parisc:Linux:*:* | hppa:Linux:*:*)
+ # Look for CPU level
+ case `grep '^cpu[^a-z]*:' /proc/cpuinfo 2>/dev/null | cut -d' ' -f2` in
+ PA7*) echo hppa1.1-unknown-linux-gnu ;;
+ PA8*) echo hppa2.0-unknown-linux-gnu ;;
+ *) echo hppa-unknown-linux-gnu ;;
+ esac
+ exit ;;
+ ppc64:Linux:*:*)
+ echo powerpc64-unknown-linux-gnu
+ exit ;;
+ ppc:Linux:*:*)
+ echo powerpc-unknown-linux-gnu
+ exit ;;
+ s390:Linux:*:* | s390x:Linux:*:*)
+ echo ${UNAME_MACHINE}-ibm-linux
+ exit ;;
+ sh64*:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit ;;
+ sh*:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit ;;
+ sparc:Linux:*:* | sparc64:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit ;;
+ vax:Linux:*:*)
+ echo ${UNAME_MACHINE}-dec-linux-gnu
+ exit ;;
+ x86_64:Linux:*:*)
+ echo x86_64-unknown-linux-gnu
+ exit ;;
+ xtensa*:Linux:*:*)
+ echo ${UNAME_MACHINE}-unknown-linux-gnu
+ exit ;;
+ i*86:DYNIX/ptx:4*:*)
+ # ptx 4.0 does uname -s correctly, with DYNIX/ptx in there.
+ # earlier versions are messed up and put the nodename in both
+ # sysname and nodename.
+ echo i386-sequent-sysv4
+ exit ;;
+ i*86:UNIX_SV:4.2MP:2.*)
+ # Unixware is an offshoot of SVR4, but it has its own version
+ # number series starting with 2...
+ # I am not positive that other SVR4 systems won't match this,
+ # I just have to hope. -- rms.
+ # Use sysv4.2uw... so that sysv4* matches it.
+ echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION}
+ exit ;;
+ i*86:OS/2:*:*)
+ # If we were able to find `uname', then EMX Unix compatibility
+ # is probably installed.
+ echo ${UNAME_MACHINE}-pc-os2-emx
+ exit ;;
+ i*86:XTS-300:*:STOP)
+ echo ${UNAME_MACHINE}-unknown-stop
+ exit ;;
+ i*86:atheos:*:*)
+ echo ${UNAME_MACHINE}-unknown-atheos
+ exit ;;
+ i*86:syllable:*:*)
+ echo ${UNAME_MACHINE}-pc-syllable
+ exit ;;
+ i*86:LynxOS:2.*:* | i*86:LynxOS:3.[01]*:* | i*86:LynxOS:4.[02]*:*)
+ echo i386-unknown-lynxos${UNAME_RELEASE}
+ exit ;;
+ i*86:*DOS:*:*)
+ echo ${UNAME_MACHINE}-pc-msdosdjgpp
+ exit ;;
+ i*86:*:4.*:* | i*86:SYSTEM_V:4.*:*)
+ UNAME_REL=`echo ${UNAME_RELEASE} | sed 's/\/MP$//'`
+ if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then
+ echo ${UNAME_MACHINE}-univel-sysv${UNAME_REL}
+ else
+ echo ${UNAME_MACHINE}-pc-sysv${UNAME_REL}
+ fi
+ exit ;;
+ i*86:*:5:[678]*)
+ # UnixWare 7.x, OpenUNIX and OpenServer 6.
+ case `/bin/uname -X | grep "^Machine"` in
+ *486*) UNAME_MACHINE=i486 ;;
+ *Pentium) UNAME_MACHINE=i586 ;;
+ *Pent*|*Celeron) UNAME_MACHINE=i686 ;;
+ esac
+ echo ${UNAME_MACHINE}-unknown-sysv${UNAME_RELEASE}${UNAME_SYSTEM}${UNAME_VERSION}
+ exit ;;
+ i*86:*:3.2:*)
+ if test -f /usr/options/cb.name; then
+ UNAME_REL=`sed -n 's/.*Version //p' </usr/options/cb.name`
+ echo ${UNAME_MACHINE}-pc-isc$UNAME_REL
+ elif /bin/uname -X 2>/dev/null >/dev/null ; then
+ UNAME_REL=`(/bin/uname -X|grep Release|sed -e 's/.*= //')`
+ (/bin/uname -X|grep i80486 >/dev/null) && UNAME_MACHINE=i486
+ (/bin/uname -X|grep '^Machine.*Pentium' >/dev/null) \
+ && UNAME_MACHINE=i586
+ (/bin/uname -X|grep '^Machine.*Pent *II' >/dev/null) \
+ && UNAME_MACHINE=i686
+ (/bin/uname -X|grep '^Machine.*Pentium Pro' >/dev/null) \
+ && UNAME_MACHINE=i686
+ echo ${UNAME_MACHINE}-pc-sco$UNAME_REL
+ else
+ echo ${UNAME_MACHINE}-pc-sysv32
+ fi
+ exit ;;
+ pc:*:*:*)
+ # Left here for compatibility:
+ # uname -m prints for DJGPP always 'pc', but it prints nothing about
+ # the processor, so we play safe by assuming i586.
+ # Note: whatever this is, it MUST be the same as what config.sub
+ # prints for the "djgpp" host, or else GDB configury will decide that
+ # this is a cross-build.
+ echo i586-pc-msdosdjgpp
+ exit ;;
+ Intel:Mach:3*:*)
+ echo i386-pc-mach3
+ exit ;;
+ paragon:*:*:*)
+ echo i860-intel-osf1
+ exit ;;
+ i860:*:4.*:*) # i860-SVR4
+ if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then
+ echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4
+ else # Add other i860-SVR4 vendors below as they are discovered.
+ echo i860-unknown-sysv${UNAME_RELEASE} # Unknown i860-SVR4
+ fi
+ exit ;;
+ mini*:CTIX:SYS*5:*)
+ # "miniframe"
+ echo m68010-convergent-sysv
+ exit ;;
+ mc68k:UNIX:SYSTEM5:3.51m)
+ echo m68k-convergent-sysv
+ exit ;;
+ M680?0:D-NIX:5.3:*)
+ echo m68k-diab-dnix
+ exit ;;
+ M68*:*:R3V[5678]*:*)
+ test -r /sysV68 && { echo 'm68k-motorola-sysv'; exit; } ;;
+ 3[345]??:*:4.0:3.0 | 3[34]??A:*:4.0:3.0 | 3[34]??,*:*:4.0:3.0 | 3[34]??/*:*:4.0:3.0 | 4400:*:4.0:3.0 | 4850:*:4.0:3.0 | SKA40:*:4.0:3.0 | SDS2:*:4.0:3.0 | SHG2:*:4.0:3.0 | S7501*:*:4.0:3.0)
+ OS_REL=''
+ test -r /etc/.relid \
+ && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+ /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+ && { echo i486-ncr-sysv4.3${OS_REL}; exit; }
+ /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+ && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;;
+ 3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*)
+ /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+ && { echo i486-ncr-sysv4; exit; } ;;
+ NCR*:*:4.2:* | MPRAS*:*:4.2:*)
+ OS_REL='.3'
+ test -r /etc/.relid \
+ && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+ /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+ && { echo i486-ncr-sysv4.3${OS_REL}; exit; }
+ /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+ && { echo i586-ncr-sysv4.3${OS_REL}; exit; }
+ /bin/uname -p 2>/dev/null | /bin/grep pteron >/dev/null \
+ && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;;
+ m68*:LynxOS:2.*:* | m68*:LynxOS:3.0*:*)
+ echo m68k-unknown-lynxos${UNAME_RELEASE}
+ exit ;;
+ mc68030:UNIX_System_V:4.*:*)
+ echo m68k-atari-sysv4
+ exit ;;
+ TSUNAMI:LynxOS:2.*:*)
+ echo sparc-unknown-lynxos${UNAME_RELEASE}
+ exit ;;
+ rs6000:LynxOS:2.*:*)
+ echo rs6000-unknown-lynxos${UNAME_RELEASE}
+ exit ;;
+ PowerPC:LynxOS:2.*:* | PowerPC:LynxOS:3.[01]*:* | PowerPC:LynxOS:4.[02]*:*)
+ echo powerpc-unknown-lynxos${UNAME_RELEASE}
+ exit ;;
+ SM[BE]S:UNIX_SV:*:*)
+ echo mips-dde-sysv${UNAME_RELEASE}
+ exit ;;
+ RM*:ReliantUNIX-*:*:*)
+ echo mips-sni-sysv4
+ exit ;;
+ RM*:SINIX-*:*:*)
+ echo mips-sni-sysv4
+ exit ;;
+ *:SINIX-*:*:*)
+ if uname -p 2>/dev/null >/dev/null ; then
+ UNAME_MACHINE=`(uname -p) 2>/dev/null`
+ echo ${UNAME_MACHINE}-sni-sysv4
+ else
+ echo ns32k-sni-sysv
+ fi
+ exit ;;
+ PENTIUM:*:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort
+ # says <Richard.M.Bartel@ccMail.Census.GOV>
+ echo i586-unisys-sysv4
+ exit ;;
+ *:UNIX_System_V:4*:FTX*)
+ # From Gerald Hewes <hewes@openmarket.com>.
+ # How about differentiating between stratus architectures? -djm
+ echo hppa1.1-stratus-sysv4
+ exit ;;
+ *:*:*:FTX*)
+ # From seanf@swdc.stratus.com.
+ echo i860-stratus-sysv4
+ exit ;;
+ i*86:VOS:*:*)
+ # From Paul.Green@stratus.com.
+ echo ${UNAME_MACHINE}-stratus-vos
+ exit ;;
+ *:VOS:*:*)
+ # From Paul.Green@stratus.com.
+ echo hppa1.1-stratus-vos
+ exit ;;
+ mc68*:A/UX:*:*)
+ echo m68k-apple-aux${UNAME_RELEASE}
+ exit ;;
+ news*:NEWS-OS:6*:*)
+ echo mips-sony-newsos6
+ exit ;;
+ R[34]000:*System_V*:*:* | R4000:UNIX_SYSV:*:* | R*000:UNIX_SV:*:*)
+ if [ -d /usr/nec ]; then
+ echo mips-nec-sysv${UNAME_RELEASE}
+ else
+ echo mips-unknown-sysv${UNAME_RELEASE}
+ fi
+ exit ;;
+ BeBox:BeOS:*:*) # BeOS running on hardware made by Be, PPC only.
+ echo powerpc-be-beos
+ exit ;;
+ BeMac:BeOS:*:*) # BeOS running on Mac or Mac clone, PPC only.
+ echo powerpc-apple-beos
+ exit ;;
+ BePC:BeOS:*:*) # BeOS running on Intel PC compatible.
+ echo i586-pc-beos
+ exit ;;
+ BePC:Haiku:*:*) # Haiku running on Intel PC compatible.
+ echo i586-pc-haiku
+ exit ;;
+ SX-4:SUPER-UX:*:*)
+ echo sx4-nec-superux${UNAME_RELEASE}
+ exit ;;
+ SX-5:SUPER-UX:*:*)
+ echo sx5-nec-superux${UNAME_RELEASE}
+ exit ;;
+ SX-6:SUPER-UX:*:*)
+ echo sx6-nec-superux${UNAME_RELEASE}
+ exit ;;
+ SX-7:SUPER-UX:*:*)
+ echo sx7-nec-superux${UNAME_RELEASE}
+ exit ;;
+ SX-8:SUPER-UX:*:*)
+ echo sx8-nec-superux${UNAME_RELEASE}
+ exit ;;
+ SX-8R:SUPER-UX:*:*)
+ echo sx8r-nec-superux${UNAME_RELEASE}
+ exit ;;
+ Power*:Rhapsody:*:*)
+ echo powerpc-apple-rhapsody${UNAME_RELEASE}
+ exit ;;
+ *:Rhapsody:*:*)
+ echo ${UNAME_MACHINE}-apple-rhapsody${UNAME_RELEASE}
+ exit ;;
+ *:Darwin:*:*)
+ UNAME_PROCESSOR=`uname -p` || UNAME_PROCESSOR=unknown
+ case $UNAME_PROCESSOR in
+ i386)
+ eval $set_cc_for_build
+ if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then
+ if (echo '#ifdef __LP64__'; echo IS_64BIT_ARCH; echo '#endif') | \
+ (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \
+ grep IS_64BIT_ARCH >/dev/null
+ then
+ UNAME_PROCESSOR="x86_64"
+ fi
+ fi ;;
+ unknown) UNAME_PROCESSOR=powerpc ;;
+ esac
+ echo ${UNAME_PROCESSOR}-apple-darwin${UNAME_RELEASE}
+ exit ;;
+ *:procnto*:*:* | *:QNX:[0123456789]*:*)
+ UNAME_PROCESSOR=`uname -p`
+ if test "$UNAME_PROCESSOR" = "x86"; then
+ UNAME_PROCESSOR=i386
+ UNAME_MACHINE=pc
+ fi
+ echo ${UNAME_PROCESSOR}-${UNAME_MACHINE}-nto-qnx${UNAME_RELEASE}
+ exit ;;
+ *:QNX:*:4*)
+ echo i386-pc-qnx
+ exit ;;
+ NSE-?:NONSTOP_KERNEL:*:*)
+ echo nse-tandem-nsk${UNAME_RELEASE}
+ exit ;;
+ NSR-?:NONSTOP_KERNEL:*:*)
+ echo nsr-tandem-nsk${UNAME_RELEASE}
+ exit ;;
+ *:NonStop-UX:*:*)
+ echo mips-compaq-nonstopux
+ exit ;;
+ BS2000:POSIX*:*:*)
+ echo bs2000-siemens-sysv
+ exit ;;
+ DS/*:UNIX_System_V:*:*)
+ echo ${UNAME_MACHINE}-${UNAME_SYSTEM}-${UNAME_RELEASE}
+ exit ;;
+ *:Plan9:*:*)
+ # "uname -m" is not consistent, so use $cputype instead. 386
+ # is converted to i386 for consistency with other x86
+ # operating systems.
+ if test "$cputype" = "386"; then
+ UNAME_MACHINE=i386
+ else
+ UNAME_MACHINE="$cputype"
+ fi
+ echo ${UNAME_MACHINE}-unknown-plan9
+ exit ;;
+ *:TOPS-10:*:*)
+ echo pdp10-unknown-tops10
+ exit ;;
+ *:TENEX:*:*)
+ echo pdp10-unknown-tenex
+ exit ;;
+ KS10:TOPS-20:*:* | KL10:TOPS-20:*:* | TYPE4:TOPS-20:*:*)
+ echo pdp10-dec-tops20
+ exit ;;
+ XKL-1:TOPS-20:*:* | TYPE5:TOPS-20:*:*)
+ echo pdp10-xkl-tops20
+ exit ;;
+ *:TOPS-20:*:*)
+ echo pdp10-unknown-tops20
+ exit ;;
+ *:ITS:*:*)
+ echo pdp10-unknown-its
+ exit ;;
+ SEI:*:*:SEIUX)
+ echo mips-sei-seiux${UNAME_RELEASE}
+ exit ;;
+ *:DragonFly:*:*)
+ echo ${UNAME_MACHINE}-unknown-dragonfly`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`
+ exit ;;
+ *:*VMS:*:*)
+ UNAME_MACHINE=`(uname -p) 2>/dev/null`
+ case "${UNAME_MACHINE}" in
+ A*) echo alpha-dec-vms ; exit ;;
+ I*) echo ia64-dec-vms ; exit ;;
+ V*) echo vax-dec-vms ; exit ;;
+ esac ;;
+ *:XENIX:*:SysV)
+ echo i386-pc-xenix
+ exit ;;
+ i*86:skyos:*:*)
+ echo ${UNAME_MACHINE}-pc-skyos`echo ${UNAME_RELEASE}` | sed -e 's/ .*$//'
+ exit ;;
+ i*86:rdos:*:*)
+ echo ${UNAME_MACHINE}-pc-rdos
+ exit ;;
+ i*86:AROS:*:*)
+ echo ${UNAME_MACHINE}-pc-aros
+ exit ;;
+esac
+
+#echo '(No uname command or uname output not recognized.)' 1>&2
+#echo "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" 1>&2
+
+eval $set_cc_for_build
+cat >$dummy.c <<EOF
+#ifdef _SEQUENT_
+# include <sys/types.h>
+# include <sys/utsname.h>
+#endif
+main ()
+{
+#if defined (sony)
+#if defined (MIPSEB)
+ /* BFD wants "bsd" instead of "newsos". Perhaps BFD should be changed,
+ I don't know.... */
+ printf ("mips-sony-bsd\n"); exit (0);
+#else
+#include <sys/param.h>
+ printf ("m68k-sony-newsos%s\n",
+#ifdef NEWSOS4
+ "4"
+#else
+ ""
+#endif
+ ); exit (0);
+#endif
+#endif
+
+#if defined (__arm) && defined (__acorn) && defined (__unix)
+ printf ("arm-acorn-riscix\n"); exit (0);
+#endif
+
+#if defined (hp300) && !defined (hpux)
+ printf ("m68k-hp-bsd\n"); exit (0);
+#endif
+
+#if defined (NeXT)
+#if !defined (__ARCHITECTURE__)
+#define __ARCHITECTURE__ "m68k"
+#endif
+ int version;
+ version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`;
+ if (version < 4)
+ printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version);
+ else
+ printf ("%s-next-openstep%d\n", __ARCHITECTURE__, version);
+ exit (0);
+#endif
+
+#if defined (MULTIMAX) || defined (n16)
+#if defined (UMAXV)
+ printf ("ns32k-encore-sysv\n"); exit (0);
+#else
+#if defined (CMU)
+ printf ("ns32k-encore-mach\n"); exit (0);
+#else
+ printf ("ns32k-encore-bsd\n"); exit (0);
+#endif
+#endif
+#endif
+
+#if defined (__386BSD__)
+ printf ("i386-pc-bsd\n"); exit (0);
+#endif
+
+#if defined (sequent)
+#if defined (i386)
+ printf ("i386-sequent-dynix\n"); exit (0);
+#endif
+#if defined (ns32000)
+ printf ("ns32k-sequent-dynix\n"); exit (0);
+#endif
+#endif
+
+#if defined (_SEQUENT_)
+ struct utsname un;
+
+ uname(&un);
+
+ if (strncmp(un.version, "V2", 2) == 0) {
+ printf ("i386-sequent-ptx2\n"); exit (0);
+ }
+ if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */
+ printf ("i386-sequent-ptx1\n"); exit (0);
+ }
+ printf ("i386-sequent-ptx\n"); exit (0);
+
+#endif
+
+#if defined (vax)
+# if !defined (ultrix)
+# include <sys/param.h>
+# if defined (BSD)
+# if BSD == 43
+ printf ("vax-dec-bsd4.3\n"); exit (0);
+# else
+# if BSD == 199006
+ printf ("vax-dec-bsd4.3reno\n"); exit (0);
+# else
+ printf ("vax-dec-bsd\n"); exit (0);
+# endif
+# endif
+# else
+ printf ("vax-dec-bsd\n"); exit (0);
+# endif
+# else
+ printf ("vax-dec-ultrix\n"); exit (0);
+# endif
+#endif
+
+#if defined (alliant) && defined (i860)
+ printf ("i860-alliant-bsd\n"); exit (0);
+#endif
+
+ exit (1);
+}
+EOF
+
+$CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null && SYSTEM_NAME=`$dummy` &&
+ { echo "$SYSTEM_NAME"; exit; }
+
+# Apollos put the system type in the environment.
+
+test -d /usr/apollo && { echo ${ISP}-apollo-${SYSTYPE}; exit; }
+
+# Convex versions that predate uname can use getsysinfo(1)
+
+if [ -x /usr/convex/getsysinfo ]
+then
+ case `getsysinfo -f cpu_type` in
+ c1*)
+ echo c1-convex-bsd
+ exit ;;
+ c2*)
+ if getsysinfo -f scalar_acc
+ then echo c32-convex-bsd
+ else echo c2-convex-bsd
+ fi
+ exit ;;
+ c34*)
+ echo c34-convex-bsd
+ exit ;;
+ c38*)
+ echo c38-convex-bsd
+ exit ;;
+ c4*)
+ echo c4-convex-bsd
+ exit ;;
+ esac
+fi
+
+cat >&2 <<EOF
+$0: unable to guess system type
+
+This script, last modified $timestamp, has failed to recognize
+the operating system you are using. It is advised that you
+download the most up to date version of the config scripts from
+
+ http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess;hb=HEAD
+and
+ http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub;hb=HEAD
+
+If the version you run ($0) is already up to date, please
+send the following data and any information you think might be
+pertinent to <config-patches@gnu.org> in order to provide the needed
+information to handle your system.
+
+config.guess timestamp = $timestamp
+
+uname -m = `(uname -m) 2>/dev/null || echo unknown`
+uname -r = `(uname -r) 2>/dev/null || echo unknown`
+uname -s = `(uname -s) 2>/dev/null || echo unknown`
+uname -v = `(uname -v) 2>/dev/null || echo unknown`
+
+/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null`
+/bin/uname -X = `(/bin/uname -X) 2>/dev/null`
+
+hostinfo = `(hostinfo) 2>/dev/null`
+/bin/universe = `(/bin/universe) 2>/dev/null`
+/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null`
+/bin/arch = `(/bin/arch) 2>/dev/null`
+/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null`
+/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null`
+
+UNAME_MACHINE = ${UNAME_MACHINE}
+UNAME_RELEASE = ${UNAME_RELEASE}
+UNAME_SYSTEM = ${UNAME_SYSTEM}
+UNAME_VERSION = ${UNAME_VERSION}
+EOF
+
+exit 1
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:
diff --git a/popt-1.16/config.h.in b/popt-1.16/config.h.in
new file mode 100644
index 0000000..d77075d
--- /dev/null
+++ b/popt-1.16/config.h.in
@@ -0,0 +1,144 @@
+/* config.h.in. Generated from configure.ac by autoheader. */
+
+/* Define to 1 if translation of program messages to the user's native
+ language is requested. */
+#undef ENABLE_NLS
+
+/* Define to 1 if you have the MacOS X function CFLocaleCopyCurrent in the
+ CoreFoundation framework. */
+#undef HAVE_CFLOCALECOPYCURRENT
+
+/* Define to 1 if you have the MacOS X function CFPreferencesCopyAppValue in
+ the CoreFoundation framework. */
+#undef HAVE_CFPREFERENCESCOPYAPPVALUE
+
+/* Define if the GNU dcgettext() function is already present or preinstalled.
+ */
+#undef HAVE_DCGETTEXT
+
+/* Define to 1 if you have the <dlfcn.h> header file. */
+#undef HAVE_DLFCN_H
+
+/* Define to 1 if you have the <float.h> header file. */
+#undef HAVE_FLOAT_H
+
+/* Define to 1 if you have the <fnmatch.h> header file. */
+#undef HAVE_FNMATCH_H
+
+/* Define to 1 if you have the `geteuid' function. */
+#undef HAVE_GETEUID
+
+/* Define if the GNU gettext() function is already present or preinstalled. */
+#undef HAVE_GETTEXT
+
+/* Define to 1 if you have the `getuid' function. */
+#undef HAVE_GETUID
+
+/* Define to 1 if you have the <glob.h> header file. */
+#undef HAVE_GLOB_H
+
+/* Define if you have the iconv() function and it works. */
+#undef HAVE_ICONV
+
+/* Define to 1 if you have the <inttypes.h> header file. */
+#undef HAVE_INTTYPES_H
+
+/* Define to 1 if you have the <langinfo.h> header file. */
+#undef HAVE_LANGINFO_H
+
+/* Define to 1 if you have the <libintl.h> header file. */
+#undef HAVE_LIBINTL_H
+
+/* Define to 1 if you have the <mcheck.h> header file. */
+#undef HAVE_MCHECK_H
+
+/* Define to 1 if you have the <memory.h> header file. */
+#undef HAVE_MEMORY_H
+
+/* Define to 1 if you have the `mtrace' function. */
+#undef HAVE_MTRACE
+
+/* Define to 1 if you have the `setregid' function. */
+#undef HAVE_SETREGID
+
+/* Define to 1 if you have the `srandom' function. */
+#undef HAVE_SRANDOM
+
+/* Define to 1 if you have the <stdint.h> header file. */
+#undef HAVE_STDINT_H
+
+/* Define to 1 if you have the <stdlib.h> header file. */
+#undef HAVE_STDLIB_H
+
+/* Define to 1 if you have the `stpcpy' function. */
+#undef HAVE_STPCPY
+
+/* Define to 1 if you have the `strerror' function. */
+#undef HAVE_STRERROR
+
+/* Define to 1 if you have the <strings.h> header file. */
+#undef HAVE_STRINGS_H
+
+/* Define to 1 if you have the <string.h> header file. */
+#undef HAVE_STRING_H
+
+/* Define to 1 if you have the <sys/stat.h> header file. */
+#undef HAVE_SYS_STAT_H
+
+/* Define to 1 if you have the <sys/types.h> header file. */
+#undef HAVE_SYS_TYPES_H
+
+/* Define to 1 if you have the <unistd.h> header file. */
+#undef HAVE_UNISTD_H
+
+/* Define to 1 if you have the `vasprintf' function. */
+#undef HAVE_VASPRINTF
+
+/* Define to 1 if you have the `__secure_getenv' function. */
+#undef HAVE___SECURE_GETENV
+
+/* Define to the sub-directory in which libtool stores uninstalled libraries.
+ */
+#undef LT_OBJDIR
+
+/* Name of package */
+#undef PACKAGE
+
+/* Define to the address where bug reports for this package should be sent. */
+#undef PACKAGE_BUGREPORT
+
+/* Define to the full name of this package. */
+#undef PACKAGE_NAME
+
+/* Define to the full name and version of this package. */
+#undef PACKAGE_STRING
+
+/* Define to the one symbol short name of this package. */
+#undef PACKAGE_TARNAME
+
+/* Define to the version of this package. */
+#undef PACKAGE_VERSION
+
+/* Full path to popt top_srcdir. */
+#undef POPT_SOURCE_PATH
+
+/* Full path to default POPT configuration directory */
+#undef POPT_SYSCONFDIR
+
+/* Define to 1 if the C compiler supports function prototypes. */
+#undef PROTOTYPES
+
+/* Define to 1 if you have the ANSI C header files. */
+#undef STDC_HEADERS
+
+/* Version number of package */
+#undef VERSION
+
+/* Number of bits in a file offset, on hosts where this is settable. */
+#undef _FILE_OFFSET_BITS
+
+/* Define for large files, on AIX-style hosts. */
+#undef _LARGE_FILES
+
+/* Define like PROTOTYPES; this can be used by system headers. */
+#undef __PROTOTYPES
diff --git a/popt-1.16/config.rpath b/popt-1.16/config.rpath
new file mode 100755
index 0000000..c547c68
--- /dev/null
+++ b/popt-1.16/config.rpath
@@ -0,0 +1,666 @@
+#! /bin/sh
+# Output a system dependent set of variables, describing how to set the
+# run time search path of shared libraries in an executable.
+#
+# Copyright 1996-2007 Free Software Foundation, Inc.
+# Taken from GNU libtool, 2001
+# Originally by Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+#
+# The first argument passed to this file is the canonical host specification,
+# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
+# or
+# CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
+# The environment variables CC, GCC, LDFLAGS, LD, with_gnu_ld
+# should be set by the caller.
+#
+# The set of defined variables is at the end of this script.
+
+# Known limitations:
+# - On IRIX 6.5 with CC="cc", the run time search patch must not be longer
+# than 256 bytes, otherwise the compiler driver will dump core. The only
+# known workaround is to choose shorter directory names for the build
+# directory and/or the installation directory.
+
+# All known linkers require a `.a' archive for static linking (except MSVC,
+# which needs '.lib').
+libext=a
+shrext=.so
+
+host="$1"
+host_cpu=`echo "$host" | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'`
+host_vendor=`echo "$host" | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'`
+host_os=`echo "$host" | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'`
+
+# Code taken from libtool.m4's _LT_CC_BASENAME.
+
+for cc_temp in $CC""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`echo "$cc_temp" | sed -e 's%^.*/%%'`
+
+# Code taken from libtool.m4's AC_LIBTOOL_PROG_COMPILER_PIC.
+
+wl=
+if test "$GCC" = yes; then
+ wl='-Wl,'
+else
+ case "$host_os" in
+ aix*)
+ wl='-Wl,'
+ ;;
+ darwin*)
+ case $cc_basename in
+ xlc*)
+ wl='-Wl,'
+ ;;
+ esac
+ ;;
+ mingw* | cygwin* | pw32* | os2*)
+ ;;
+ hpux9* | hpux10* | hpux11*)
+ wl='-Wl,'
+ ;;
+ irix5* | irix6* | nonstopux*)
+ wl='-Wl,'
+ ;;
+ newsos6)
+ ;;
+ linux* | k*bsd*-gnu)
+ case $cc_basename in
+ icc* | ecc*)
+ wl='-Wl,'
+ ;;
+ pgcc | pgf77 | pgf90)
+ wl='-Wl,'
+ ;;
+ ccc*)
+ wl='-Wl,'
+ ;;
+ como)
+ wl='-lopt='
+ ;;
+ *)
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ C*)
+ wl='-Wl,'
+ ;;
+ esac
+ ;;
+ esac
+ ;;
+ osf3* | osf4* | osf5*)
+ wl='-Wl,'
+ ;;
+ rdos*)
+ ;;
+ solaris*)
+ wl='-Wl,'
+ ;;
+ sunos4*)
+ wl='-Qoption ld '
+ ;;
+ sysv4 | sysv4.2uw2* | sysv4.3*)
+ wl='-Wl,'
+ ;;
+ sysv4*MP*)
+ ;;
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ wl='-Wl,'
+ ;;
+ unicos*)
+ wl='-Wl,'
+ ;;
+ uts4*)
+ ;;
+ esac
+fi
+
+# Code taken from libtool.m4's AC_LIBTOOL_PROG_LD_SHLIBS.
+
+hardcode_libdir_flag_spec=
+hardcode_libdir_separator=
+hardcode_direct=no
+hardcode_minus_L=no
+
+case "$host_os" in
+ cygwin* | mingw* | pw32*)
+ # FIXME: the MSVC++ port hasn't been tested in a loooong time
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ if test "$GCC" != yes; then
+ with_gnu_ld=no
+ fi
+ ;;
+ interix*)
+ # we just hope/assume this is gcc and not c89 (= MSVC++)
+ with_gnu_ld=yes
+ ;;
+ openbsd*)
+ with_gnu_ld=no
+ ;;
+esac
+
+ld_shlibs=yes
+if test "$with_gnu_ld" = yes; then
+ # Set some defaults for GNU ld with shared library support. These
+ # are reset later if shared libraries are not supported. Putting them
+ # here allows them to be overridden if necessary.
+ # Unlike libtool, we use -rpath here, not --rpath, since the documented
+ # option of GNU ld is called -rpath, not --rpath.
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ case "$host_os" in
+ aix3* | aix4* | aix5*)
+ # On AIX/PPC, the GNU linker is very broken
+ if test "$host_cpu" != ia64; then
+ ld_shlibs=no
+ fi
+ ;;
+ amigaos*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ # Samuel A. Falvo II <kc5tja@dolphin.openprojects.net> reports
+ # that the semantics of dynamic libraries on AmigaOS, at least up
+ # to version 4, is to share data among multiple programs linked
+ # with the same dynamic library. Since this doesn't match the
+ # behavior of shared libraries on other platforms, we cannot use
+ # them.
+ ld_shlibs=no
+ ;;
+ beos*)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ :
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ cygwin* | mingw* | pw32*)
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ hardcode_libdir_flag_spec='-L$libdir'
+ if $LD --help 2>&1 | grep 'auto-import' > /dev/null; then
+ :
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ interix[3-9]*)
+ hardcode_direct=no
+ hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+ ;;
+ gnu* | linux* | k*bsd*-gnu)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ :
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ netbsd*)
+ ;;
+ solaris*)
+ if $LD -v 2>&1 | grep 'BFD 2\.8' > /dev/null; then
+ ld_shlibs=no
+ elif $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ :
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+ case `$LD -v 2>&1` in
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*)
+ ld_shlibs=no
+ ;;
+ *)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ hardcode_libdir_flag_spec='`test -z "$SCOABSPATH" && echo ${wl}-rpath,$libdir`'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ esac
+ ;;
+ sunos4*)
+ hardcode_direct=yes
+ ;;
+ *)
+ if $LD --help 2>&1 | grep ': supported targets:.* elf' > /dev/null; then
+ :
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ esac
+ if test "$ld_shlibs" = no; then
+ hardcode_libdir_flag_spec=
+ fi
+else
+ case "$host_os" in
+ aix3*)
+ # Note: this linker hardcodes the directories in LIBPATH if there
+ # are no directories specified by -L.
+ hardcode_minus_L=yes
+ if test "$GCC" = yes; then
+ # Neither direct hardcoding nor static linking is supported with a
+ # broken collect2.
+ hardcode_direct=unsupported
+ fi
+ ;;
+ aix4* | aix5*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ else
+ aix_use_runtimelinking=no
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[23]|aix4.[23].*|aix5*)
+ for ld_flag in $LDFLAGS; do
+ if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then
+ aix_use_runtimelinking=yes
+ break
+ fi
+ done
+ ;;
+ esac
+ fi
+ hardcode_direct=yes
+ hardcode_libdir_separator=':'
+ if test "$GCC" = yes; then
+ case $host_os in aix4.[012]|aix4.[012].*)
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" && \
+ strings "$collect2name" | grep resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ :
+ else
+ # We have old collect2
+ hardcode_direct=unsupported
+ hardcode_minus_L=yes
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_libdir_separator=
+ fi
+ ;;
+ esac
+ fi
+ # Begin _LT_AC_SYS_LIBPATH_AIX.
+ echo 'int main () { return 0; }' > conftest.c
+ ${CC} ${LDFLAGS} conftest.c -o conftest
+ aix_libpath=`dump -H conftest 2>/dev/null | sed -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+ if test -z "$aix_libpath"; then
+ aix_libpath=`dump -HX64 conftest 2>/dev/null | sed -n -e '/Import File Strings/,/^$/ { /^0/ { s/^0 *\(.*\)$/\1/; p; }
+}'`
+ fi
+ if test -z "$aix_libpath"; then
+ aix_libpath="/usr/lib:/lib"
+ fi
+ rm -f conftest.c conftest
+ # End _LT_AC_SYS_LIBPATH_AIX.
+ if test "$aix_use_runtimelinking" = yes; then
+ hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath"
+ else
+ if test "$host_cpu" = ia64; then
+ hardcode_libdir_flag_spec='${wl}-R $libdir:/usr/lib:/lib'
+ else
+ hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath"
+ fi
+ fi
+ ;;
+ amigaos*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ # see comment about different semantics on the GNU ld section
+ ld_shlibs=no
+ ;;
+ bsdi[45]*)
+ ;;
+ cygwin* | mingw* | pw32*)
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ hardcode_libdir_flag_spec=' '
+ libext=lib
+ ;;
+ darwin* | rhapsody*)
+ hardcode_direct=no
+ if test "$GCC" = yes ; then
+ :
+ else
+ case $cc_basename in
+ xlc*)
+ ;;
+ *)
+ ld_shlibs=no
+ ;;
+ esac
+ fi
+ ;;
+ dgux*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ ;;
+ freebsd1*)
+ ld_shlibs=no
+ ;;
+ freebsd2.2*)
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ ;;
+ freebsd2*)
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ ;;
+ freebsd* | dragonfly*)
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ ;;
+ hpux9*)
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator=:
+ hardcode_direct=yes
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ ;;
+ hpux10*)
+ if test "$with_gnu_ld" = no; then
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator=:
+ hardcode_direct=yes
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ fi
+ ;;
+ hpux11*)
+ if test "$with_gnu_ld" = no; then
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator=:
+ case $host_cpu in
+ hppa*64*|ia64*)
+ hardcode_direct=no
+ ;;
+ *)
+ hardcode_direct=yes
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ ;;
+ esac
+ fi
+ ;;
+ irix5* | irix6* | nonstopux*)
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator=:
+ ;;
+ netbsd*)
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ ;;
+ newsos6)
+ hardcode_direct=yes
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator=:
+ ;;
+ openbsd*)
+ if test -f /usr/libexec/ld.so; then
+ hardcode_direct=yes
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+ else
+ case "$host_os" in
+ openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*)
+ hardcode_libdir_flag_spec='-R$libdir'
+ ;;
+ *)
+ hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+ ;;
+ esac
+ fi
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ os2*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ ;;
+ osf3*)
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator=:
+ ;;
+ osf4* | osf5*)
+ if test "$GCC" = yes; then
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ else
+ # Both cc and cxx compiler support -rpath directly
+ hardcode_libdir_flag_spec='-rpath $libdir'
+ fi
+ hardcode_libdir_separator=:
+ ;;
+ solaris*)
+ hardcode_libdir_flag_spec='-R$libdir'
+ ;;
+ sunos4*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ ;;
+ sysv4)
+ case $host_vendor in
+ sni)
+ hardcode_direct=yes # is this really true???
+ ;;
+ siemens)
+ hardcode_direct=no
+ ;;
+ motorola)
+ hardcode_direct=no #Motorola manual says yes, but my tests say they lie
+ ;;
+ esac
+ ;;
+ sysv4.3*)
+ ;;
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ ld_shlibs=yes
+ fi
+ ;;
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7* | sco3.2v5.0.[024]*)
+ ;;
+ sysv5* | sco3.2v5* | sco5v6*)
+ hardcode_libdir_flag_spec='`test -z "$SCOABSPATH" && echo ${wl}-R,$libdir`'
+ hardcode_libdir_separator=':'
+ ;;
+ uts4*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ ;;
+ *)
+ ld_shlibs=no
+ ;;
+ esac
+fi
+
+# Check dynamic linker characteristics
+# Code taken from libtool.m4's AC_LIBTOOL_SYS_DYNAMIC_LINKER.
+# Unlike libtool.m4, here we don't care about _all_ names of the library, but
+# only about the one the linker finds when passed -lNAME. This is the last
+# element of library_names_spec in libtool.m4, or possibly two of them if the
+# linker has special search rules.
+library_names_spec= # the last element of library_names_spec in libtool.m4
+libname_spec='lib$name'
+case "$host_os" in
+ aix3*)
+ library_names_spec='$libname.a'
+ ;;
+ aix4* | aix5*)
+ library_names_spec='$libname$shrext'
+ ;;
+ amigaos*)
+ library_names_spec='$libname.a'
+ ;;
+ beos*)
+ library_names_spec='$libname$shrext'
+ ;;
+ bsdi[45]*)
+ library_names_spec='$libname$shrext'
+ ;;
+ cygwin* | mingw* | pw32*)
+ shrext=.dll
+ library_names_spec='$libname.dll.a $libname.lib'
+ ;;
+ darwin* | rhapsody*)
+ shrext=.dylib
+ library_names_spec='$libname$shrext'
+ ;;
+ dgux*)
+ library_names_spec='$libname$shrext'
+ ;;
+ freebsd1*)
+ ;;
+ freebsd* | dragonfly*)
+ case "$host_os" in
+ freebsd[123]*)
+ library_names_spec='$libname$shrext$versuffix' ;;
+ *)
+ library_names_spec='$libname$shrext' ;;
+ esac
+ ;;
+ gnu*)
+ library_names_spec='$libname$shrext'
+ ;;
+ hpux9* | hpux10* | hpux11*)
+ case $host_cpu in
+ ia64*)
+ shrext=.so
+ ;;
+ hppa*64*)
+ shrext=.sl
+ ;;
+ *)
+ shrext=.sl
+ ;;
+ esac
+ library_names_spec='$libname$shrext'
+ ;;
+ interix[3-9]*)
+ library_names_spec='$libname$shrext'
+ ;;
+ irix5* | irix6* | nonstopux*)
+ library_names_spec='$libname$shrext'
+ case "$host_os" in
+ irix5* | nonstopux*)
+ libsuff= shlibsuff=
+ ;;
+ *)
+ case $LD in
+ *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ") libsuff= shlibsuff= ;;
+ *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ") libsuff=32 shlibsuff=N32 ;;
+ *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ") libsuff=64 shlibsuff=64 ;;
+ *) libsuff= shlibsuff= ;;
+ esac
+ ;;
+ esac
+ ;;
+ linux*oldld* | linux*aout* | linux*coff*)
+ ;;
+ linux* | k*bsd*-gnu)
+ library_names_spec='$libname$shrext'
+ ;;
+ knetbsd*-gnu)
+ library_names_spec='$libname$shrext'
+ ;;
+ netbsd*)
+ library_names_spec='$libname$shrext'
+ ;;
+ newsos6)
+ library_names_spec='$libname$shrext'
+ ;;
+ nto-qnx*)
+ library_names_spec='$libname$shrext'
+ ;;
+ openbsd*)
+ library_names_spec='$libname$shrext$versuffix'
+ ;;
+ os2*)
+ libname_spec='$name'
+ shrext=.dll
+ library_names_spec='$libname.a'
+ ;;
+ osf3* | osf4* | osf5*)
+ library_names_spec='$libname$shrext'
+ ;;
+ rdos*)
+ ;;
+ solaris*)
+ library_names_spec='$libname$shrext'
+ ;;
+ sunos4*)
+ library_names_spec='$libname$shrext$versuffix'
+ ;;
+ sysv4 | sysv4.3*)
+ library_names_spec='$libname$shrext'
+ ;;
+ sysv4*MP*)
+ library_names_spec='$libname$shrext'
+ ;;
+ sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ library_names_spec='$libname$shrext'
+ ;;
+ uts4*)
+ library_names_spec='$libname$shrext'
+ ;;
+esac
+
+sed_quote_subst='s/\(["`$\\]\)/\\\1/g'
+escaped_wl=`echo "X$wl" | sed -e 's/^X//' -e "$sed_quote_subst"`
+shlibext=`echo "$shrext" | sed -e 's,^\.,,'`
+escaped_libname_spec=`echo "X$libname_spec" | sed -e 's/^X//' -e "$sed_quote_subst"`
+escaped_library_names_spec=`echo "X$library_names_spec" | sed -e 's/^X//' -e "$sed_quote_subst"`
+escaped_hardcode_libdir_flag_spec=`echo "X$hardcode_libdir_flag_spec" | sed -e 's/^X//' -e "$sed_quote_subst"`
+
+LC_ALL=C sed -e 's/^\([a-zA-Z0-9_]*\)=/acl_cv_\1=/' <<EOF
+
+# How to pass a linker flag through the compiler.
+wl="$escaped_wl"
+
+# Static library suffix (normally "a").
+libext="$libext"
+
+# Shared library suffix (normally "so").
+shlibext="$shlibext"
+
+# Format of library name prefix.
+libname_spec="$escaped_libname_spec"
+
+# Library names that the linker finds when passed -lNAME.
+library_names_spec="$escaped_library_names_spec"
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist.
+hardcode_libdir_flag_spec="$escaped_hardcode_libdir_flag_spec"
+
+# Whether we need a single -rpath flag with a separated argument.
+hardcode_libdir_separator="$hardcode_libdir_separator"
+
+# Set to yes if using DIR/libNAME.so during linking hardcodes DIR into the
+# resulting binary.
+hardcode_direct="$hardcode_direct"
+
+# Set to yes if using the -LDIR flag during linking hardcodes DIR into the
+# resulting binary.
+hardcode_minus_L="$hardcode_minus_L"
+
+EOF
diff --git a/popt-1.16/config.sub b/popt-1.16/config.sub
new file mode 100755
index 0000000..2a55a50
--- /dev/null
+++ b/popt-1.16/config.sub
@@ -0,0 +1,1705 @@
+#! /bin/sh
+# Configuration validation subroutine script.
+# Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999,
+# 2000, 2001, 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009
+# Free Software Foundation, Inc.
+
+timestamp='2009-11-20'
+
+# This file is (in principle) common to ALL GNU software.
+# The presence of a machine in this file suggests that SOME GNU software
+# can handle that machine. It does not imply ALL GNU software can.
+#
+# This file is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 51 Franklin Street - Fifth Floor, Boston, MA
+# 02110-1301, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+
+# Please send patches to <config-patches@gnu.org>. Submit a context
+# diff and a properly formatted GNU ChangeLog entry.
+#
+# Configuration subroutine to validate and canonicalize a configuration type.
+# Supply the specified configuration type as an argument.
+# If it is invalid, we print an error message on stderr and exit with code 1.
+# Otherwise, we print the canonical config type on stdout and succeed.
+
+# You can get the latest version of this script from:
+# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub;hb=HEAD
+
+# This file is supposed to be the same for all GNU packages
+# and recognize all the CPU types, system types and aliases
+# that are meaningful with *any* GNU software.
+# Each package is responsible for reporting which valid configurations
+# it does not support. The user should be able to distinguish
+# a failure to support a valid configuration from a meaningless
+# configuration.
+
+# The goal of this file is to map all the various variations of a given
+# machine specification into a single specification in the form:
+# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
+# or in some cases, the newer four-part form:
+# CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
+# It is wrong to echo any other type of specification.
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION] CPU-MFR-OPSYS
+ $0 [OPTION] ALIAS
+
+Canonicalize a configuration name.
+
+Operation modes:
+ -h, --help print this help, then exit
+ -t, --time-stamp print date of last modification, then exit
+ -v, --version print version number, then exit
+
+Report bugs and patches to <config-patches@gnu.org>."
+
+version="\
+GNU config.sub ($timestamp)
+
+Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001,
+2002, 2003, 2004, 2005, 2006, 2007, 2008 Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions. There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+ case $1 in
+ --time-stamp | --time* | -t )
+ echo "$timestamp" ; exit ;;
+ --version | -v )
+ echo "$version" ; exit ;;
+ --help | --h* | -h )
+ echo "$usage"; exit ;;
+ -- ) # Stop option processing
+ shift; break ;;
+ - ) # Use stdin as input.
+ break ;;
+ -* )
+ echo "$me: invalid option $1$help"
+ exit 1 ;;
+
+ *local*)
+ # First pass through any local machine types.
+ echo $1
+ exit ;;
+
+ * )
+ break ;;
+ esac
+done
+
+case $# in
+ 0) echo "$me: missing argument$help" >&2
+ exit 1;;
+ 1) ;;
+ *) echo "$me: too many arguments$help" >&2
+ exit 1;;
+esac
+
+# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any).
+# Here we must recognize all the valid KERNEL-OS combinations.
+maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'`
+case $maybe_os in
+ nto-qnx* | linux-gnu* | linux-dietlibc | linux-newlib* | linux-uclibc* | \
+ uclinux-uclibc* | uclinux-gnu* | kfreebsd*-gnu* | knetbsd*-gnu* | netbsd*-gnu* | \
+ kopensolaris*-gnu* | \
+ storm-chaos* | os2-emx* | rtmk-nova*)
+ os=-$maybe_os
+ basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`
+ ;;
+ *)
+ basic_machine=`echo $1 | sed 's/-[^-]*$//'`
+ if [ $basic_machine != $1 ]
+ then os=`echo $1 | sed 's/.*-/-/'`
+ else os=; fi
+ ;;
+esac
+
+### Let's recognize common machines as not being operating systems so
+### that things like config.sub decstation-3100 work. We also
+### recognize some manufacturers as not being operating systems, so we
+### can provide default operating systems below.
+case $os in
+ -sun*os*)
+ # Prevent following clause from handling this invalid input.
+ ;;
+ -dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \
+ -att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \
+ -unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \
+ -convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\
+ -c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \
+ -harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \
+ -apple | -axis | -knuth | -cray | -microblaze)
+ os=
+ basic_machine=$1
+ ;;
+ -bluegene*)
+ os=-cnk
+ ;;
+ -sim | -cisco | -oki | -wec | -winbond)
+ os=
+ basic_machine=$1
+ ;;
+ -scout)
+ ;;
+ -wrs)
+ os=-vxworks
+ basic_machine=$1
+ ;;
+ -chorusos*)
+ os=-chorusos
+ basic_machine=$1
+ ;;
+ -chorusrdb)
+ os=-chorusrdb
+ basic_machine=$1
+ ;;
+ -hiux*)
+ os=-hiuxwe2
+ ;;
+ -sco6)
+ os=-sco5v6
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco5)
+ os=-sco3.2v5
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco4)
+ os=-sco3.2v4
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco3.2.[4-9]*)
+ os=`echo $os | sed -e 's/sco3.2./sco3.2v/'`
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco3.2v[4-9]*)
+ # Don't forget version if it is 3.2v4 or newer.
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco5v6*)
+ # Don't forget version if it is 3.2v4 or newer.
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco*)
+ os=-sco3.2v2
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -udk*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -isc)
+ os=-isc2.2
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -clix*)
+ basic_machine=clipper-intergraph
+ ;;
+ -isc*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -lynx*)
+ os=-lynxos
+ ;;
+ -ptx*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'`
+ ;;
+ -windowsnt*)
+ os=`echo $os | sed -e 's/windowsnt/winnt/'`
+ ;;
+ -psos*)
+ os=-psos
+ ;;
+ -mint | -mint[0-9]*)
+ basic_machine=m68k-atari
+ os=-mint
+ ;;
+esac
+
+# Decode aliases for certain CPU-COMPANY combinations.
+case $basic_machine in
+ # Recognize the basic CPU types without company name.
+ # Some are omitted here because they have special meanings below.
+ 1750a | 580 \
+ | a29k \
+ | alpha | alphaev[4-8] | alphaev56 | alphaev6[78] | alphapca5[67] \
+ | alpha64 | alpha64ev[4-8] | alpha64ev56 | alpha64ev6[78] | alpha64pca5[67] \
+ | am33_2.0 \
+ | arc | arm | arm[bl]e | arme[lb] | armv[2345] | armv[345][lb] | avr | avr32 \
+ | bfin \
+ | c4x | clipper \
+ | d10v | d30v | dlx | dsp16xx \
+ | fido | fr30 | frv \
+ | h8300 | h8500 | hppa | hppa1.[01] | hppa2.0 | hppa2.0[nw] | hppa64 \
+ | i370 | i860 | i960 | ia64 \
+ | ip2k | iq2000 \
+ | lm32 \
+ | m32c | m32r | m32rle | m68000 | m68k | m88k \
+ | maxq | mb | microblaze | mcore | mep | metag \
+ | mips | mipsbe | mipseb | mipsel | mipsle \
+ | mips16 \
+ | mips64 | mips64el \
+ | mips64octeon | mips64octeonel \
+ | mips64orion | mips64orionel \
+ | mips64r5900 | mips64r5900el \
+ | mips64vr | mips64vrel \
+ | mips64vr4100 | mips64vr4100el \
+ | mips64vr4300 | mips64vr4300el \
+ | mips64vr5000 | mips64vr5000el \
+ | mips64vr5900 | mips64vr5900el \
+ | mipsisa32 | mipsisa32el \
+ | mipsisa32r2 | mipsisa32r2el \
+ | mipsisa64 | mipsisa64el \
+ | mipsisa64r2 | mipsisa64r2el \
+ | mipsisa64sb1 | mipsisa64sb1el \
+ | mipsisa64sr71k | mipsisa64sr71kel \
+ | mipstx39 | mipstx39el \
+ | mn10200 | mn10300 \
+ | moxie \
+ | mt \
+ | msp430 \
+ | nios | nios2 \
+ | ns16k | ns32k \
+ | or32 \
+ | pdp10 | pdp11 | pj | pjl \
+ | powerpc | powerpc64 | powerpc64le | powerpcle | ppcbe \
+ | pyramid \
+ | rx \
+ | score \
+ | sh | sh[1234] | sh[24]a | sh[24]aeb | sh[23]e | sh[34]eb | sheb | shbe | shle | sh[1234]le | sh3ele \
+ | sh64 | sh64le \
+ | sparc | sparc64 | sparc64b | sparc64v | sparc86x | sparclet | sparclite \
+ | sparcv8 | sparcv9 | sparcv9b | sparcv9v \
+ | spu | strongarm \
+ | tahoe | thumb | tic4x | tic80 | tron \
+ | ubicom32 \
+ | v850 | v850e \
+ | we32k \
+ | x86 | xc16x | xscale | xscalee[bl] | xstormy16 | xtensa \
+ | z8k | z80)
+ basic_machine=$basic_machine-unknown
+ ;;
+ m6811 | m68hc11 | m6812 | m68hc12 | picochip)
+ # Motorola 68HC11/12.
+ basic_machine=$basic_machine-unknown
+ os=-none
+ ;;
+ m88110 | m680[12346]0 | m683?2 | m68360 | m5200 | v70 | w65 | z8k)
+ ;;
+ ms1)
+ basic_machine=mt-unknown
+ ;;
+
+ # We use `pc' rather than `unknown'
+ # because (1) that's what they normally are, and
+ # (2) the word "unknown" tends to confuse beginning users.
+ i*86 | x86_64)
+ basic_machine=$basic_machine-pc
+ ;;
+ # Object if more than one company name word.
+ *-*-*)
+ echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+ exit 1
+ ;;
+ # Recognize the basic CPU types with company name.
+ 580-* \
+ | a29k-* \
+ | alpha-* | alphaev[4-8]-* | alphaev56-* | alphaev6[78]-* \
+ | alpha64-* | alpha64ev[4-8]-* | alpha64ev56-* | alpha64ev6[78]-* \
+ | alphapca5[67]-* | alpha64pca5[67]-* | arc-* \
+ | arm-* | armbe-* | armle-* | armeb-* | armv*-* \
+ | avr-* | avr32-* \
+ | bfin-* | bs2000-* \
+ | c[123]* | c30-* | [cjt]90-* | c4x-* | c54x-* | c55x-* | c6x-* \
+ | clipper-* | craynv-* | cydra-* \
+ | d10v-* | d30v-* | dlx-* \
+ | elxsi-* \
+ | f30[01]-* | f700-* | fido-* | fr30-* | frv-* | fx80-* \
+ | h8300-* | h8500-* \
+ | hppa-* | hppa1.[01]-* | hppa2.0-* | hppa2.0[nw]-* | hppa64-* \
+ | i*86-* | i860-* | i960-* | ia64-* \
+ | ip2k-* | iq2000-* \
+ | lm32-* \
+ | m32c-* | m32r-* | m32rle-* \
+ | m68000-* | m680[012346]0-* | m68360-* | m683?2-* | m68k-* \
+ | m88110-* | m88k-* | maxq-* | mcore-* | metag-* | microblaze-* \
+ | mips-* | mipsbe-* | mipseb-* | mipsel-* | mipsle-* \
+ | mips16-* \
+ | mips64-* | mips64el-* \
+ | mips64octeon-* | mips64octeonel-* \
+ | mips64orion-* | mips64orionel-* \
+ | mips64r5900-* | mips64r5900el-* \
+ | mips64vr-* | mips64vrel-* \
+ | mips64vr4100-* | mips64vr4100el-* \
+ | mips64vr4300-* | mips64vr4300el-* \
+ | mips64vr5000-* | mips64vr5000el-* \
+ | mips64vr5900-* | mips64vr5900el-* \
+ | mipsisa32-* | mipsisa32el-* \
+ | mipsisa32r2-* | mipsisa32r2el-* \
+ | mipsisa64-* | mipsisa64el-* \
+ | mipsisa64r2-* | mipsisa64r2el-* \
+ | mipsisa64sb1-* | mipsisa64sb1el-* \
+ | mipsisa64sr71k-* | mipsisa64sr71kel-* \
+ | mipstx39-* | mipstx39el-* \
+ | mmix-* \
+ | mt-* \
+ | msp430-* \
+ | nios-* | nios2-* \
+ | none-* | np1-* | ns16k-* | ns32k-* \
+ | orion-* \
+ | pdp10-* | pdp11-* | pj-* | pjl-* | pn-* | power-* \
+ | powerpc-* | powerpc64-* | powerpc64le-* | powerpcle-* | ppcbe-* \
+ | pyramid-* \
+ | romp-* | rs6000-* | rx-* \
+ | sh-* | sh[1234]-* | sh[24]a-* | sh[24]aeb-* | sh[23]e-* | sh[34]eb-* | sheb-* | shbe-* \
+ | shle-* | sh[1234]le-* | sh3ele-* | sh64-* | sh64le-* \
+ | sparc-* | sparc64-* | sparc64b-* | sparc64v-* | sparc86x-* | sparclet-* \
+ | sparclite-* \
+ | sparcv8-* | sparcv9-* | sparcv9b-* | sparcv9v-* | strongarm-* | sv1-* | sx?-* \
+ | tahoe-* | thumb-* \
+ | tic30-* | tic4x-* | tic54x-* | tic55x-* | tic6x-* | tic80-* | tile-* \
+ | tron-* \
+ | ubicom32-* \
+ | v850-* | v850e-* | vax-* \
+ | we32k-* \
+ | x86-* | x86_64-* | xc16x-* | xps100-* | xscale-* | xscalee[bl]-* \
+ | xstormy16-* | xtensa*-* \
+ | ymp-* \
+ | z8k-* | z80-*)
+ ;;
+ # Recognize the basic CPU types without company name, with glob match.
+ xtensa*)
+ basic_machine=$basic_machine-unknown
+ ;;
+ # Recognize the various machine names and aliases which stand
+ # for a CPU type and a company and sometimes even an OS.
+ 386bsd)
+ basic_machine=i386-unknown
+ os=-bsd
+ ;;
+ 3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc)
+ basic_machine=m68000-att
+ ;;
+ 3b*)
+ basic_machine=we32k-att
+ ;;
+ a29khif)
+ basic_machine=a29k-amd
+ os=-udi
+ ;;
+ abacus)
+ basic_machine=abacus-unknown
+ ;;
+ adobe68k)
+ basic_machine=m68010-adobe
+ os=-scout
+ ;;
+ alliant | fx80)
+ basic_machine=fx80-alliant
+ ;;
+ altos | altos3068)
+ basic_machine=m68k-altos
+ ;;
+ am29k)
+ basic_machine=a29k-none
+ os=-bsd
+ ;;
+ amd64)
+ basic_machine=x86_64-pc
+ ;;
+ amd64-*)
+ basic_machine=x86_64-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ amdahl)
+ basic_machine=580-amdahl
+ os=-sysv
+ ;;
+ amiga | amiga-*)
+ basic_machine=m68k-unknown
+ ;;
+ amigaos | amigados)
+ basic_machine=m68k-unknown
+ os=-amigaos
+ ;;
+ amigaunix | amix)
+ basic_machine=m68k-unknown
+ os=-sysv4
+ ;;
+ apollo68)
+ basic_machine=m68k-apollo
+ os=-sysv
+ ;;
+ apollo68bsd)
+ basic_machine=m68k-apollo
+ os=-bsd
+ ;;
+ aros)
+ basic_machine=i386-pc
+ os=-aros
+ ;;
+ aux)
+ basic_machine=m68k-apple
+ os=-aux
+ ;;
+ balance)
+ basic_machine=ns32k-sequent
+ os=-dynix
+ ;;
+ blackfin)
+ basic_machine=bfin-unknown
+ os=-linux
+ ;;
+ blackfin-*)
+ basic_machine=bfin-`echo $basic_machine | sed 's/^[^-]*-//'`
+ os=-linux
+ ;;
+ bluegene*)
+ basic_machine=powerpc-ibm
+ os=-cnk
+ ;;
+ c90)
+ basic_machine=c90-cray
+ os=-unicos
+ ;;
+ cegcc)
+ basic_machine=arm-unknown
+ os=-cegcc
+ ;;
+ convex-c1)
+ basic_machine=c1-convex
+ os=-bsd
+ ;;
+ convex-c2)
+ basic_machine=c2-convex
+ os=-bsd
+ ;;
+ convex-c32)
+ basic_machine=c32-convex
+ os=-bsd
+ ;;
+ convex-c34)
+ basic_machine=c34-convex
+ os=-bsd
+ ;;
+ convex-c38)
+ basic_machine=c38-convex
+ os=-bsd
+ ;;
+ cray | j90)
+ basic_machine=j90-cray
+ os=-unicos
+ ;;
+ craynv)
+ basic_machine=craynv-cray
+ os=-unicosmp
+ ;;
+ cr16)
+ basic_machine=cr16-unknown
+ os=-elf
+ ;;
+ crds | unos)
+ basic_machine=m68k-crds
+ ;;
+ crisv32 | crisv32-* | etraxfs*)
+ basic_machine=crisv32-axis
+ ;;
+ cris | cris-* | etrax*)
+ basic_machine=cris-axis
+ ;;
+ crx)
+ basic_machine=crx-unknown
+ os=-elf
+ ;;
+ da30 | da30-*)
+ basic_machine=m68k-da30
+ ;;
+ decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn)
+ basic_machine=mips-dec
+ ;;
+ decsystem10* | dec10*)
+ basic_machine=pdp10-dec
+ os=-tops10
+ ;;
+ decsystem20* | dec20*)
+ basic_machine=pdp10-dec
+ os=-tops20
+ ;;
+ delta | 3300 | motorola-3300 | motorola-delta \
+ | 3300-motorola | delta-motorola)
+ basic_machine=m68k-motorola
+ ;;
+ delta88)
+ basic_machine=m88k-motorola
+ os=-sysv3
+ ;;
+ dicos)
+ basic_machine=i686-pc
+ os=-dicos
+ ;;
+ djgpp)
+ basic_machine=i586-pc
+ os=-msdosdjgpp
+ ;;
+ dpx20 | dpx20-*)
+ basic_machine=rs6000-bull
+ os=-bosx
+ ;;
+ dpx2* | dpx2*-bull)
+ basic_machine=m68k-bull
+ os=-sysv3
+ ;;
+ ebmon29k)
+ basic_machine=a29k-amd
+ os=-ebmon
+ ;;
+ elxsi)
+ basic_machine=elxsi-elxsi
+ os=-bsd
+ ;;
+ encore | umax | mmax)
+ basic_machine=ns32k-encore
+ ;;
+ es1800 | OSE68k | ose68k | ose | OSE)
+ basic_machine=m68k-ericsson
+ os=-ose
+ ;;
+ fx2800)
+ basic_machine=i860-alliant
+ ;;
+ genix)
+ basic_machine=ns32k-ns
+ ;;
+ gmicro)
+ basic_machine=tron-gmicro
+ os=-sysv
+ ;;
+ go32)
+ basic_machine=i386-pc
+ os=-go32
+ ;;
+ h3050r* | hiux*)
+ basic_machine=hppa1.1-hitachi
+ os=-hiuxwe2
+ ;;
+ h8300hms)
+ basic_machine=h8300-hitachi
+ os=-hms
+ ;;
+ h8300xray)
+ basic_machine=h8300-hitachi
+ os=-xray
+ ;;
+ h8500hms)
+ basic_machine=h8500-hitachi
+ os=-hms
+ ;;
+ harris)
+ basic_machine=m88k-harris
+ os=-sysv3
+ ;;
+ hp300-*)
+ basic_machine=m68k-hp
+ ;;
+ hp300bsd)
+ basic_machine=m68k-hp
+ os=-bsd
+ ;;
+ hp300hpux)
+ basic_machine=m68k-hp
+ os=-hpux
+ ;;
+ hp3k9[0-9][0-9] | hp9[0-9][0-9])
+ basic_machine=hppa1.0-hp
+ ;;
+ hp9k2[0-9][0-9] | hp9k31[0-9])
+ basic_machine=m68000-hp
+ ;;
+ hp9k3[2-9][0-9])
+ basic_machine=m68k-hp
+ ;;
+ hp9k6[0-9][0-9] | hp6[0-9][0-9])
+ basic_machine=hppa1.0-hp
+ ;;
+ hp9k7[0-79][0-9] | hp7[0-79][0-9])
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k78[0-9] | hp78[0-9])
+ # FIXME: really hppa2.0-hp
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k8[67]1 | hp8[67]1 | hp9k80[24] | hp80[24] | hp9k8[78]9 | hp8[78]9 | hp9k893 | hp893)
+ # FIXME: really hppa2.0-hp
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k8[0-9][13679] | hp8[0-9][13679])
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k8[0-9][0-9] | hp8[0-9][0-9])
+ basic_machine=hppa1.0-hp
+ ;;
+ hppa-next)
+ os=-nextstep3
+ ;;
+ hppaosf)
+ basic_machine=hppa1.1-hp
+ os=-osf
+ ;;
+ hppro)
+ basic_machine=hppa1.1-hp
+ os=-proelf
+ ;;
+ i370-ibm* | ibm*)
+ basic_machine=i370-ibm
+ ;;
+# I'm not sure what "Sysv32" means. Should this be sysv3.2?
+ i*86v32)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv32
+ ;;
+ i*86v4*)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv4
+ ;;
+ i*86v)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv
+ ;;
+ i*86sol2)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-solaris2
+ ;;
+ i386mach)
+ basic_machine=i386-mach
+ os=-mach
+ ;;
+ i386-vsta | vsta)
+ basic_machine=i386-unknown
+ os=-vsta
+ ;;
+ iris | iris4d)
+ basic_machine=mips-sgi
+ case $os in
+ -irix*)
+ ;;
+ *)
+ os=-irix4
+ ;;
+ esac
+ ;;
+ isi68 | isi)
+ basic_machine=m68k-isi
+ os=-sysv
+ ;;
+ m68knommu)
+ basic_machine=m68k-unknown
+ os=-linux
+ ;;
+ m68knommu-*)
+ basic_machine=m68k-`echo $basic_machine | sed 's/^[^-]*-//'`
+ os=-linux
+ ;;
+ m88k-omron*)
+ basic_machine=m88k-omron
+ ;;
+ magnum | m3230)
+ basic_machine=mips-mips
+ os=-sysv
+ ;;
+ merlin)
+ basic_machine=ns32k-utek
+ os=-sysv
+ ;;
+ microblaze)
+ basic_machine=microblaze-xilinx
+ ;;
+ mingw32)
+ basic_machine=i386-pc
+ os=-mingw32
+ ;;
+ mingw32ce)
+ basic_machine=arm-unknown
+ os=-mingw32ce
+ ;;
+ miniframe)
+ basic_machine=m68000-convergent
+ ;;
+ *mint | -mint[0-9]* | *MiNT | *MiNT[0-9]*)
+ basic_machine=m68k-atari
+ os=-mint
+ ;;
+ mips3*-*)
+ basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`
+ ;;
+ mips3*)
+ basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown
+ ;;
+ monitor)
+ basic_machine=m68k-rom68k
+ os=-coff
+ ;;
+ morphos)
+ basic_machine=powerpc-unknown
+ os=-morphos
+ ;;
+ msdos)
+ basic_machine=i386-pc
+ os=-msdos
+ ;;
+ ms1-*)
+ basic_machine=`echo $basic_machine | sed -e 's/ms1-/mt-/'`
+ ;;
+ mvs)
+ basic_machine=i370-ibm
+ os=-mvs
+ ;;
+ ncr3000)
+ basic_machine=i486-ncr
+ os=-sysv4
+ ;;
+ netbsd386)
+ basic_machine=i386-unknown
+ os=-netbsd
+ ;;
+ netwinder)
+ basic_machine=armv4l-rebel
+ os=-linux
+ ;;
+ news | news700 | news800 | news900)
+ basic_machine=m68k-sony
+ os=-newsos
+ ;;
+ news1000)
+ basic_machine=m68030-sony
+ os=-newsos
+ ;;
+ news-3600 | risc-news)
+ basic_machine=mips-sony
+ os=-newsos
+ ;;
+ necv70)
+ basic_machine=v70-nec
+ os=-sysv
+ ;;
+ next | m*-next )
+ basic_machine=m68k-next
+ case $os in
+ -nextstep* )
+ ;;
+ -ns2*)
+ os=-nextstep2
+ ;;
+ *)
+ os=-nextstep3
+ ;;
+ esac
+ ;;
+ nh3000)
+ basic_machine=m68k-harris
+ os=-cxux
+ ;;
+ nh[45]000)
+ basic_machine=m88k-harris
+ os=-cxux
+ ;;
+ nindy960)
+ basic_machine=i960-intel
+ os=-nindy
+ ;;
+ mon960)
+ basic_machine=i960-intel
+ os=-mon960
+ ;;
+ nonstopux)
+ basic_machine=mips-compaq
+ os=-nonstopux
+ ;;
+ np1)
+ basic_machine=np1-gould
+ ;;
+ nsr-tandem)
+ basic_machine=nsr-tandem
+ ;;
+ op50n-* | op60c-*)
+ basic_machine=hppa1.1-oki
+ os=-proelf
+ ;;
+ openrisc | openrisc-*)
+ basic_machine=or32-unknown
+ ;;
+ os400)
+ basic_machine=powerpc-ibm
+ os=-os400
+ ;;
+ OSE68000 | ose68000)
+ basic_machine=m68000-ericsson
+ os=-ose
+ ;;
+ os68k)
+ basic_machine=m68k-none
+ os=-os68k
+ ;;
+ pa-hitachi)
+ basic_machine=hppa1.1-hitachi
+ os=-hiuxwe2
+ ;;
+ paragon)
+ basic_machine=i860-intel
+ os=-osf
+ ;;
+ parisc)
+ basic_machine=hppa-unknown
+ os=-linux
+ ;;
+ parisc-*)
+ basic_machine=hppa-`echo $basic_machine | sed 's/^[^-]*-//'`
+ os=-linux
+ ;;
+ pbd)
+ basic_machine=sparc-tti
+ ;;
+ pbb)
+ basic_machine=m68k-tti
+ ;;
+ pc532 | pc532-*)
+ basic_machine=ns32k-pc532
+ ;;
+ pc98)
+ basic_machine=i386-pc
+ ;;
+ pc98-*)
+ basic_machine=i386-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentium | p5 | k5 | k6 | nexgen | viac3)
+ basic_machine=i586-pc
+ ;;
+ pentiumpro | p6 | 6x86 | athlon | athlon_*)
+ basic_machine=i686-pc
+ ;;
+ pentiumii | pentium2 | pentiumiii | pentium3)
+ basic_machine=i686-pc
+ ;;
+ pentium4)
+ basic_machine=i786-pc
+ ;;
+ pentium-* | p5-* | k5-* | k6-* | nexgen-* | viac3-*)
+ basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentiumpro-* | p6-* | 6x86-* | athlon-*)
+ basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentiumii-* | pentium2-* | pentiumiii-* | pentium3-*)
+ basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentium4-*)
+ basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pn)
+ basic_machine=pn-gould
+ ;;
+ power) basic_machine=power-ibm
+ ;;
+ ppc) basic_machine=powerpc-unknown
+ ;;
+ ppc-*) basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ppcle | powerpclittle | ppc-le | powerpc-little)
+ basic_machine=powerpcle-unknown
+ ;;
+ ppcle-* | powerpclittle-*)
+ basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ppc64) basic_machine=powerpc64-unknown
+ ;;
+ ppc64-*) basic_machine=powerpc64-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ppc64le | powerpc64little | ppc64-le | powerpc64-little)
+ basic_machine=powerpc64le-unknown
+ ;;
+ ppc64le-* | powerpc64little-*)
+ basic_machine=powerpc64le-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ps2)
+ basic_machine=i386-ibm
+ ;;
+ pw32)
+ basic_machine=i586-unknown
+ os=-pw32
+ ;;
+ rdos)
+ basic_machine=i386-pc
+ os=-rdos
+ ;;
+ rom68k)
+ basic_machine=m68k-rom68k
+ os=-coff
+ ;;
+ rm[46]00)
+ basic_machine=mips-siemens
+ ;;
+ rtpc | rtpc-*)
+ basic_machine=romp-ibm
+ ;;
+ s390 | s390-*)
+ basic_machine=s390-ibm
+ ;;
+ s390x | s390x-*)
+ basic_machine=s390x-ibm
+ ;;
+ sa29200)
+ basic_machine=a29k-amd
+ os=-udi
+ ;;
+ sb1)
+ basic_machine=mipsisa64sb1-unknown
+ ;;
+ sb1el)
+ basic_machine=mipsisa64sb1el-unknown
+ ;;
+ sde)
+ basic_machine=mipsisa32-sde
+ os=-elf
+ ;;
+ sei)
+ basic_machine=mips-sei
+ os=-seiux
+ ;;
+ sequent)
+ basic_machine=i386-sequent
+ ;;
+ sh)
+ basic_machine=sh-hitachi
+ os=-hms
+ ;;
+ sh5el)
+ basic_machine=sh5le-unknown
+ ;;
+ sh64)
+ basic_machine=sh64-unknown
+ ;;
+ sparclite-wrs | simso-wrs)
+ basic_machine=sparclite-wrs
+ os=-vxworks
+ ;;
+ sps7)
+ basic_machine=m68k-bull
+ os=-sysv2
+ ;;
+ spur)
+ basic_machine=spur-unknown
+ ;;
+ st2000)
+ basic_machine=m68k-tandem
+ ;;
+ stratus)
+ basic_machine=i860-stratus
+ os=-sysv4
+ ;;
+ sun2)
+ basic_machine=m68000-sun
+ ;;
+ sun2os3)
+ basic_machine=m68000-sun
+ os=-sunos3
+ ;;
+ sun2os4)
+ basic_machine=m68000-sun
+ os=-sunos4
+ ;;
+ sun3os3)
+ basic_machine=m68k-sun
+ os=-sunos3
+ ;;
+ sun3os4)
+ basic_machine=m68k-sun
+ os=-sunos4
+ ;;
+ sun4os3)
+ basic_machine=sparc-sun
+ os=-sunos3
+ ;;
+ sun4os4)
+ basic_machine=sparc-sun
+ os=-sunos4
+ ;;
+ sun4sol2)
+ basic_machine=sparc-sun
+ os=-solaris2
+ ;;
+ sun3 | sun3-*)
+ basic_machine=m68k-sun
+ ;;
+ sun4)
+ basic_machine=sparc-sun
+ ;;
+ sun386 | sun386i | roadrunner)
+ basic_machine=i386-sun
+ ;;
+ sv1)
+ basic_machine=sv1-cray
+ os=-unicos
+ ;;
+ symmetry)
+ basic_machine=i386-sequent
+ os=-dynix
+ ;;
+ t3e)
+ basic_machine=alphaev5-cray
+ os=-unicos
+ ;;
+ t90)
+ basic_machine=t90-cray
+ os=-unicos
+ ;;
+ tic54x | c54x*)
+ basic_machine=tic54x-unknown
+ os=-coff
+ ;;
+ tic55x | c55x*)
+ basic_machine=tic55x-unknown
+ os=-coff
+ ;;
+ tic6x | c6x*)
+ basic_machine=tic6x-unknown
+ os=-coff
+ ;;
+ tile*)
+ basic_machine=tile-unknown
+ os=-linux-gnu
+ ;;
+ tx39)
+ basic_machine=mipstx39-unknown
+ ;;
+ tx39el)
+ basic_machine=mipstx39el-unknown
+ ;;
+ toad1)
+ basic_machine=pdp10-xkl
+ os=-tops20
+ ;;
+ tower | tower-32)
+ basic_machine=m68k-ncr
+ ;;
+ tpf)
+ basic_machine=s390x-ibm
+ os=-tpf
+ ;;
+ udi29k)
+ basic_machine=a29k-amd
+ os=-udi
+ ;;
+ ultra3)
+ basic_machine=a29k-nyu
+ os=-sym1
+ ;;
+ v810 | necv810)
+ basic_machine=v810-nec
+ os=-none
+ ;;
+ vaxv)
+ basic_machine=vax-dec
+ os=-sysv
+ ;;
+ vms)
+ basic_machine=vax-dec
+ os=-vms
+ ;;
+ vpp*|vx|vx-*)
+ basic_machine=f301-fujitsu
+ ;;
+ vxworks960)
+ basic_machine=i960-wrs
+ os=-vxworks
+ ;;
+ vxworks68)
+ basic_machine=m68k-wrs
+ os=-vxworks
+ ;;
+ vxworks29k)
+ basic_machine=a29k-wrs
+ os=-vxworks
+ ;;
+ w65*)
+ basic_machine=w65-wdc
+ os=-none
+ ;;
+ w89k-*)
+ basic_machine=hppa1.1-winbond
+ os=-proelf
+ ;;
+ xbox)
+ basic_machine=i686-pc
+ os=-mingw32
+ ;;
+ xps | xps100)
+ basic_machine=xps100-honeywell
+ ;;
+ ymp)
+ basic_machine=ymp-cray
+ os=-unicos
+ ;;
+ z8k-*-coff)
+ basic_machine=z8k-unknown
+ os=-sim
+ ;;
+ z80-*-coff)
+ basic_machine=z80-unknown
+ os=-sim
+ ;;
+ none)
+ basic_machine=none-none
+ os=-none
+ ;;
+
+# Here we handle the default manufacturer of certain CPU types. It is in
+# some cases the only manufacturer, in others, it is the most popular.
+ w89k)
+ basic_machine=hppa1.1-winbond
+ ;;
+ op50n)
+ basic_machine=hppa1.1-oki
+ ;;
+ op60c)
+ basic_machine=hppa1.1-oki
+ ;;
+ romp)
+ basic_machine=romp-ibm
+ ;;
+ mmix)
+ basic_machine=mmix-knuth
+ ;;
+ rs6000)
+ basic_machine=rs6000-ibm
+ ;;
+ vax)
+ basic_machine=vax-dec
+ ;;
+ pdp10)
+ # there are many clones, so DEC is not a safe bet
+ basic_machine=pdp10-unknown
+ ;;
+ pdp11)
+ basic_machine=pdp11-dec
+ ;;
+ we32k)
+ basic_machine=we32k-att
+ ;;
+ sh[1234] | sh[24]a | sh[24]aeb | sh[34]eb | sh[1234]le | sh[23]ele)
+ basic_machine=sh-unknown
+ ;;
+ sparc | sparcv8 | sparcv9 | sparcv9b | sparcv9v)
+ basic_machine=sparc-sun
+ ;;
+ cydra)
+ basic_machine=cydra-cydrome
+ ;;
+ orion)
+ basic_machine=orion-highlevel
+ ;;
+ orion105)
+ basic_machine=clipper-highlevel
+ ;;
+ mac | mpw | mac-mpw)
+ basic_machine=m68k-apple
+ ;;
+ pmac | pmac-mpw)
+ basic_machine=powerpc-apple
+ ;;
+ *-unknown)
+ # Make sure to match an already-canonicalized machine name.
+ ;;
+ *)
+ echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+ exit 1
+ ;;
+esac
+
+# Here we canonicalize certain aliases for manufacturers.
+case $basic_machine in
+ *-digital*)
+ basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'`
+ ;;
+ *-commodore*)
+ basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'`
+ ;;
+ *)
+ ;;
+esac
+
+# Decode manufacturer-specific aliases for certain operating systems.
+
+if [ x"$os" != x"" ]
+then
+case $os in
+ # First match some system type aliases
+ # that might get confused with valid system types.
+ # -solaris* is a basic system type, with this one exception.
+ -auroraux)
+ os=-auroraux
+ ;;
+ -solaris1 | -solaris1.*)
+ os=`echo $os | sed -e 's|solaris1|sunos4|'`
+ ;;
+ -solaris)
+ os=-solaris2
+ ;;
+ -svr4*)
+ os=-sysv4
+ ;;
+ -unixware*)
+ os=-sysv4.2uw
+ ;;
+ -gnu/linux*)
+ os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'`
+ ;;
+ # First accept the basic system types.
+ # The portable systems comes first.
+ # Each alternative MUST END IN A *, to match a version number.
+ # -sysv* is not here because it comes later, after sysvr4.
+ -gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \
+ | -*vms* | -sco* | -esix* | -isc* | -aix* | -cnk* | -sunos | -sunos[34]*\
+ | -hpux* | -unos* | -osf* | -luna* | -dgux* | -auroraux* | -solaris* \
+ | -sym* | -kopensolaris* \
+ | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \
+ | -aos* | -aros* \
+ | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \
+ | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \
+ | -hiux* | -386bsd* | -knetbsd* | -mirbsd* | -netbsd* \
+ | -openbsd* | -solidbsd* \
+ | -ekkobsd* | -kfreebsd* | -freebsd* | -riscix* | -lynxos* \
+ | -bosx* | -nextstep* | -cxux* | -aout* | -elf* | -oabi* \
+ | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \
+ | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \
+ | -chorusos* | -chorusrdb* | -cegcc* \
+ | -cygwin* | -pe* | -psos* | -moss* | -proelf* | -rtems* \
+ | -mingw32* | -linux-gnu* | -linux-newlib* | -linux-uclibc* \
+ | -uxpv* | -beos* | -mpeix* | -udk* \
+ | -interix* | -uwin* | -mks* | -rhapsody* | -darwin* | -opened* \
+ | -openstep* | -oskit* | -conix* | -pw32* | -nonstopux* \
+ | -storm-chaos* | -tops10* | -tenex* | -tops20* | -its* \
+ | -os2* | -vos* | -palmos* | -uclinux* | -nucleus* \
+ | -morphos* | -superux* | -rtmk* | -rtmk-nova* | -windiss* \
+ | -powermax* | -dnix* | -nx6 | -nx7 | -sei* | -dragonfly* \
+ | -skyos* | -haiku* | -rdos* | -toppers* | -drops* | -es*)
+ # Remember, each alternative MUST END IN *, to match a version number.
+ ;;
+ -qnx*)
+ case $basic_machine in
+ x86-* | i*86-*)
+ ;;
+ *)
+ os=-nto$os
+ ;;
+ esac
+ ;;
+ -nto-qnx*)
+ ;;
+ -nto*)
+ os=`echo $os | sed -e 's|nto|nto-qnx|'`
+ ;;
+ -sim | -es1800* | -hms* | -xray | -os68k* | -none* | -v88r* \
+ | -windows* | -osx | -abug | -netware* | -os9* | -beos* | -haiku* \
+ | -macos* | -mpw* | -magic* | -mmixware* | -mon960* | -lnews*)
+ ;;
+ -mac*)
+ os=`echo $os | sed -e 's|mac|macos|'`
+ ;;
+ -linux-dietlibc)
+ os=-linux-dietlibc
+ ;;
+ -linux*)
+ os=`echo $os | sed -e 's|linux|linux-gnu|'`
+ ;;
+ -sunos5*)
+ os=`echo $os | sed -e 's|sunos5|solaris2|'`
+ ;;
+ -sunos6*)
+ os=`echo $os | sed -e 's|sunos6|solaris3|'`
+ ;;
+ -opened*)
+ os=-openedition
+ ;;
+ -os400*)
+ os=-os400
+ ;;
+ -wince*)
+ os=-wince
+ ;;
+ -osfrose*)
+ os=-osfrose
+ ;;
+ -osf*)
+ os=-osf
+ ;;
+ -utek*)
+ os=-bsd
+ ;;
+ -dynix*)
+ os=-bsd
+ ;;
+ -acis*)
+ os=-aos
+ ;;
+ -atheos*)
+ os=-atheos
+ ;;
+ -syllable*)
+ os=-syllable
+ ;;
+ -386bsd)
+ os=-bsd
+ ;;
+ -ctix* | -uts*)
+ os=-sysv
+ ;;
+ -nova*)
+ os=-rtmk-nova
+ ;;
+ -ns2 )
+ os=-nextstep2
+ ;;
+ -nsk*)
+ os=-nsk
+ ;;
+ # Preserve the version number of sinix5.
+ -sinix5.*)
+ os=`echo $os | sed -e 's|sinix|sysv|'`
+ ;;
+ -sinix*)
+ os=-sysv4
+ ;;
+ -tpf*)
+ os=-tpf
+ ;;
+ -triton*)
+ os=-sysv3
+ ;;
+ -oss*)
+ os=-sysv3
+ ;;
+ -svr4)
+ os=-sysv4
+ ;;
+ -svr3)
+ os=-sysv3
+ ;;
+ -sysvr4)
+ os=-sysv4
+ ;;
+ # This must come after -sysvr4.
+ -sysv*)
+ ;;
+ -ose*)
+ os=-ose
+ ;;
+ -es1800*)
+ os=-ose
+ ;;
+ -xenix)
+ os=-xenix
+ ;;
+ -*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
+ os=-mint
+ ;;
+ -aros*)
+ os=-aros
+ ;;
+ -kaos*)
+ os=-kaos
+ ;;
+ -zvmoe)
+ os=-zvmoe
+ ;;
+ -dicos*)
+ os=-dicos
+ ;;
+ -none)
+ ;;
+ *)
+ # Get rid of the `-' at the beginning of $os.
+ os=`echo $os | sed 's/[^-]*-//'`
+ echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2
+ exit 1
+ ;;
+esac
+else
+
+# Here we handle the default operating systems that come with various machines.
+# The value should be what the vendor currently ships out the door with their
+# machine or put another way, the most popular os provided with the machine.
+
+# Note that if you're going to try to match "-MANUFACTURER" here (say,
+# "-sun"), then you have to tell the case statement up towards the top
+# that MANUFACTURER isn't an operating system. Otherwise, code above
+# will signal an error saying that MANUFACTURER isn't an operating
+# system, and we'll never get to this point.
+
+case $basic_machine in
+ score-*)
+ os=-elf
+ ;;
+ spu-*)
+ os=-elf
+ ;;
+ *-acorn)
+ os=-riscix1.2
+ ;;
+ arm*-rebel)
+ os=-linux
+ ;;
+ arm*-semi)
+ os=-aout
+ ;;
+ c4x-* | tic4x-*)
+ os=-coff
+ ;;
+ # This must come before the *-dec entry.
+ pdp10-*)
+ os=-tops20
+ ;;
+ pdp11-*)
+ os=-none
+ ;;
+ *-dec | vax-*)
+ os=-ultrix4.2
+ ;;
+ m68*-apollo)
+ os=-domain
+ ;;
+ i386-sun)
+ os=-sunos4.0.2
+ ;;
+ m68000-sun)
+ os=-sunos3
+ # This also exists in the configure program, but was not the
+ # default.
+ # os=-sunos4
+ ;;
+ m68*-cisco)
+ os=-aout
+ ;;
+ mep-*)
+ os=-elf
+ ;;
+ mips*-cisco)
+ os=-elf
+ ;;
+ mips*-*)
+ os=-elf
+ ;;
+ or32-*)
+ os=-coff
+ ;;
+ *-tti) # must be before sparc entry or we get the wrong os.
+ os=-sysv3
+ ;;
+ sparc-* | *-sun)
+ os=-sunos4.1.1
+ ;;
+ *-be)
+ os=-beos
+ ;;
+ *-haiku)
+ os=-haiku
+ ;;
+ *-ibm)
+ os=-aix
+ ;;
+ *-knuth)
+ os=-mmixware
+ ;;
+ *-wec)
+ os=-proelf
+ ;;
+ *-winbond)
+ os=-proelf
+ ;;
+ *-oki)
+ os=-proelf
+ ;;
+ *-hp)
+ os=-hpux
+ ;;
+ *-hitachi)
+ os=-hiux
+ ;;
+ i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent)
+ os=-sysv
+ ;;
+ *-cbm)
+ os=-amigaos
+ ;;
+ *-dg)
+ os=-dgux
+ ;;
+ *-dolphin)
+ os=-sysv3
+ ;;
+ m68k-ccur)
+ os=-rtu
+ ;;
+ m88k-omron*)
+ os=-luna
+ ;;
+ *-next )
+ os=-nextstep
+ ;;
+ *-sequent)
+ os=-ptx
+ ;;
+ *-crds)
+ os=-unos
+ ;;
+ *-ns)
+ os=-genix
+ ;;
+ i370-*)
+ os=-mvs
+ ;;
+ *-next)
+ os=-nextstep3
+ ;;
+ *-gould)
+ os=-sysv
+ ;;
+ *-highlevel)
+ os=-bsd
+ ;;
+ *-encore)
+ os=-bsd
+ ;;
+ *-sgi)
+ os=-irix
+ ;;
+ *-siemens)
+ os=-sysv4
+ ;;
+ *-masscomp)
+ os=-rtu
+ ;;
+ f30[01]-fujitsu | f700-fujitsu)
+ os=-uxpv
+ ;;
+ *-rom68k)
+ os=-coff
+ ;;
+ *-*bug)
+ os=-coff
+ ;;
+ *-apple)
+ os=-macos
+ ;;
+ *-atari*)
+ os=-mint
+ ;;
+ *)
+ os=-none
+ ;;
+esac
+fi
+
+# Here we handle the case where we know the os, and the CPU type, but not the
+# manufacturer. We pick the logical manufacturer.
+vendor=unknown
+case $basic_machine in
+ *-unknown)
+ case $os in
+ -riscix*)
+ vendor=acorn
+ ;;
+ -sunos*)
+ vendor=sun
+ ;;
+ -cnk*|-aix*)
+ vendor=ibm
+ ;;
+ -beos*)
+ vendor=be
+ ;;
+ -hpux*)
+ vendor=hp
+ ;;
+ -mpeix*)
+ vendor=hp
+ ;;
+ -hiux*)
+ vendor=hitachi
+ ;;
+ -unos*)
+ vendor=crds
+ ;;
+ -dgux*)
+ vendor=dg
+ ;;
+ -luna*)
+ vendor=omron
+ ;;
+ -genix*)
+ vendor=ns
+ ;;
+ -mvs* | -opened*)
+ vendor=ibm
+ ;;
+ -os400*)
+ vendor=ibm
+ ;;
+ -ptx*)
+ vendor=sequent
+ ;;
+ -tpf*)
+ vendor=ibm
+ ;;
+ -vxsim* | -vxworks* | -windiss*)
+ vendor=wrs
+ ;;
+ -aux*)
+ vendor=apple
+ ;;
+ -hms*)
+ vendor=hitachi
+ ;;
+ -mpw* | -macos*)
+ vendor=apple
+ ;;
+ -*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
+ vendor=atari
+ ;;
+ -vos*)
+ vendor=stratus
+ ;;
+ esac
+ basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"`
+ ;;
+esac
+
+echo $basic_machine$os
+exit
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:
diff --git a/popt-1.16/configure b/popt-1.16/configure
new file mode 100755
index 0000000..ef45bd7
--- /dev/null
+++ b/popt-1.16/configure
Binary files differ
diff --git a/popt-1.16/configure.ac b/popt-1.16/configure.ac
new file mode 100644
index 0000000..22f8bfc
--- /dev/null
+++ b/popt-1.16/configure.ac
@@ -0,0 +1,135 @@
+AC_PREREQ(2.57)
+AC_INIT(popt, 1.16, popt-devel@rpm5.org)
+AC_CONFIG_SRCDIR([popt.h])
+AC_CONFIG_HEADERS([config.h])
+AC_CANONICAL_TARGET
+
+dnl Must come before AM_INIT_AUTOMAKE.
+dnl AC_CONFIG_AUX_DIR([build-aux])
+AC_CONFIG_MACRO_DIR([m4])
+AM_INIT_AUTOMAKE([foreign -Wall])
+AM_MAINTAINER_MODE
+
+# Library code modified: REVISION++
+# Interfaces changed/added/removed: CURRENT++ REVISION=0
+# Interfaces added: AGE++
+# Interfaces removed: AGE=0
+AC_SUBST(LT_CURRENT, 0)
+AC_SUBST(LT_REVISION, 0)
+AC_SUBST(LT_AGE, 8)
+
+ALL_LINGUAS="cs da de eo es fi fr ga gl hu id is it ja ko lv nb nl pl pt ro ru sk sl sv th tr uk vi wa zh_TW zh_CN"
+
+AC_PROG_CC_STDC
+AC_PROG_CC
+
+AC_PROG_INSTALL
+AC_PROG_LIBTOOL
+
+dnl if CC is gcc, we can rebuild the dependencies (since the depend rule
+dnl requires gcc). If it's not, don't rebuild dependencies -- use what was
+dnl shipped with RPM.
+if test X"$GCC" = "Xyes"; then
+ CFLAGS="$CFLAGS -Wall -W"
+ TARGET="depend allprogs"
+else
+ TARGET="everything"
+ dnl let the Makefile know that we're done with `depend', since we don't
+ dnl have gcc we're not going to rebuild our dependencies at all.
+ echo >.depend-done
+fi
+AC_SUBST(TARGET)
+
+CFLAGS="$CFLAGS -D_GNU_SOURCE -D_REENTRANT"
+
+AC_GCC_TRADITIONAL
+AC_SYS_LARGEFILE
+
+AC_ISC_POSIX
+AM_C_PROTOTYPES
+
+AC_CHECK_HEADERS(float.h fnmatch.h glob.h langinfo.h libintl.h mcheck.h unistd.h)
+
+# For some systems we know that we have ld_version scripts.
+# Use it then as default.
+have_ld_version_script=no
+case "${host}" in
+ *-*-linux*)
+ have_ld_version_script=yes
+ ;;
+ *-*-gnu*)
+ have_ld_version_script=yes
+ ;;
+esac
+AC_ARG_ENABLE([ld-version-script],
+ AC_HELP_STRING([--enable-ld-version-script],
+ [enable/disable use of linker version script.
+ (default is system dependent)]),
+ [have_ld_version_script=$enableval],
+ [ : ] )
+AM_CONDITIONAL(HAVE_LD_VERSION_SCRIPT, test "$have_ld_version_script" = "yes")
+
+AC_ARG_ENABLE(build-gcov,
+ AS_HELP_STRING([--enable-build-gcov], [build POPT instrumented for gcov]), [dnl
+ if test ".$enableval" = .yes; then
+ if test ".`$CC --version 2>&1 | grep 'GCC'`" != .; then
+ dnl # GNU GCC (usually "gcc")
+ CFLAGS="$CFLAGS -fprofile-arcs -ftest-coverage"
+ fi
+ fi
+])
+
+AC_CHECK_FUNC(setreuid, [], [
+ AC_CHECK_LIB(ucb, setreuid, [if echo $LIBS | grep -- -lucb >/dev/null ;then :; else LIBS="$LIBS -lc -lucb" USEUCB=y;fi])
+])
+AC_CHECK_FUNCS(getuid geteuid iconv mtrace __secure_getenv setregid stpcpy strerror vasprintf srandom)
+
+AM_GNU_GETTEXT([external])
+AM_ICONV_LINK
+
+popt_sysconfdir="${sysconfdir}"
+eval "popt_sysconfdir=\"${popt_sysconfdir}\"" # expand contained ${prefix}
+AC_DEFINE_UNQUOTED([POPT_SYSCONFDIR], ["$popt_sysconfdir"], [Full path to default POPT configuration directory])
+
+
+# Define a (hope) portable Libs pkgconfig directive that
+# - Don't harm if the default library search path include ${libdir}
+# (https://bugzilla.novell.com/show_bug.cgi?id=529921)
+# - Don't require a not upstream patch to pkgconfig
+# (https://bugs.freedesktop.org/show_bug.cgi?id=16095)
+popt_pkgconfig_libs='-L${libdir} -lpopt'
+case "${host}" in
+ *-*-linux*)
+ case "${libdir}" in
+ /usr/lib|/usr/lib64|/lib|/lib64)
+ popt_pkgconfig_libs='-lpopt'
+ ;;
+ *)
+ popt_pkgconfig_libs='-L${libdir} -lpopt'
+ ;;
+ esac
+ ;;
+ *-*-gnu*)
+ case "${libdir}" in
+ /usr/lib|/usr/lib64|/lib|/lib64)
+ popt_pkgconfig_libs='-lpopt'
+ ;;
+ *)
+ popt_pkgconfig_libs='-L${libdir} -lpopt'
+ ;;
+ esac
+ ;;
+esac
+AC_SUBST([POPT_PKGCONFIG_LIBS],"$popt_pkgconfig_libs")
+
+POPT_SOURCE_PATH="`pwd`"
+AC_DEFINE_UNQUOTED(POPT_SOURCE_PATH, "$POPT_SOURCE_PATH",
+ [Full path to popt top_srcdir.])
+AC_SUBST(POPT_SOURCE_PATH)
+
+AC_CONFIG_SUBDIRS()
+AC_CONFIG_FILES([ po/Makefile.in m4/Makefile
+ Doxyfile Makefile popt.pc popt.spec test-poptrc
+ auto/Makefile auto/desc auto/types
+])
+AC_OUTPUT
diff --git a/popt-1.16/depcomp b/popt-1.16/depcomp
new file mode 100755
index 0000000..df8eea7
--- /dev/null
+++ b/popt-1.16/depcomp
@@ -0,0 +1,630 @@
+#! /bin/sh
+# depcomp - compile a program generating dependencies as side-effects
+
+scriptversion=2009-04-28.21; # UTC
+
+# Copyright (C) 1999, 2000, 2003, 2004, 2005, 2006, 2007, 2009 Free
+# Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program. If not, see <http://www.gnu.org/licenses/>.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Originally written by Alexandre Oliva <oliva@dcc.unicamp.br>.
+
+case $1 in
+ '')
+ echo "$0: No command. Try \`$0 --help' for more information." 1>&2
+ exit 1;
+ ;;
+ -h | --h*)
+ cat <<\EOF
+Usage: depcomp [--help] [--version] PROGRAM [ARGS]
+
+Run PROGRAMS ARGS to compile a file, generating dependencies
+as side-effects.
+
+Environment variables:
+ depmode Dependency tracking mode.
+ source Source file read by `PROGRAMS ARGS'.
+ object Object file output by `PROGRAMS ARGS'.
+ DEPDIR directory where to store dependencies.
+ depfile Dependency file to output.
+ tmpdepfile Temporary file to use when outputing dependencies.
+ libtool Whether libtool is used (yes/no).
+
+Report bugs to <bug-automake@gnu.org>.
+EOF
+ exit $?
+ ;;
+ -v | --v*)
+ echo "depcomp $scriptversion"
+ exit $?
+ ;;
+esac
+
+if test -z "$depmode" || test -z "$source" || test -z "$object"; then
+ echo "depcomp: Variables source, object and depmode must be set" 1>&2
+ exit 1
+fi
+
+# Dependencies for sub/bar.o or sub/bar.obj go into sub/.deps/bar.Po.
+depfile=${depfile-`echo "$object" |
+ sed 's|[^\\/]*$|'${DEPDIR-.deps}'/&|;s|\.\([^.]*\)$|.P\1|;s|Pobj$|Po|'`}
+tmpdepfile=${tmpdepfile-`echo "$depfile" | sed 's/\.\([^.]*\)$/.T\1/'`}
+
+rm -f "$tmpdepfile"
+
+# Some modes work just like other modes, but use different flags. We
+# parameterize here, but still list the modes in the big case below,
+# to make depend.m4 easier to write. Note that we *cannot* use a case
+# here, because this file can only contain one case statement.
+if test "$depmode" = hp; then
+ # HP compiler uses -M and no extra arg.
+ gccflag=-M
+ depmode=gcc
+fi
+
+if test "$depmode" = dashXmstdout; then
+ # This is just like dashmstdout with a different argument.
+ dashmflag=-xM
+ depmode=dashmstdout
+fi
+
+cygpath_u="cygpath -u -f -"
+if test "$depmode" = msvcmsys; then
+ # This is just like msvisualcpp but w/o cygpath translation.
+ # Just convert the backslash-escaped backslashes to single forward
+ # slashes to satisfy depend.m4
+ cygpath_u="sed s,\\\\\\\\,/,g"
+ depmode=msvisualcpp
+fi
+
+case "$depmode" in
+gcc3)
+## gcc 3 implements dependency tracking that does exactly what
+## we want. Yay! Note: for some reason libtool 1.4 doesn't like
+## it if -MD -MP comes after the -MF stuff. Hmm.
+## Unfortunately, FreeBSD c89 acceptance of flags depends upon
+## the command line argument order; so add the flags where they
+## appear in depend2.am. Note that the slowdown incurred here
+## affects only configure: in makefiles, %FASTDEP% shortcuts this.
+ for arg
+ do
+ case $arg in
+ -c) set fnord "$@" -MT "$object" -MD -MP -MF "$tmpdepfile" "$arg" ;;
+ *) set fnord "$@" "$arg" ;;
+ esac
+ shift # fnord
+ shift # $arg
+ done
+ "$@"
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ mv "$tmpdepfile" "$depfile"
+ ;;
+
+gcc)
+## There are various ways to get dependency output from gcc. Here's
+## why we pick this rather obscure method:
+## - Don't want to use -MD because we'd like the dependencies to end
+## up in a subdir. Having to rename by hand is ugly.
+## (We might end up doing this anyway to support other compilers.)
+## - The DEPENDENCIES_OUTPUT environment variable makes gcc act like
+## -MM, not -M (despite what the docs say).
+## - Using -M directly means running the compiler twice (even worse
+## than renaming).
+ if test -z "$gccflag"; then
+ gccflag=-MD,
+ fi
+ "$@" -Wp,"$gccflag$tmpdepfile"
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+ echo "$object : \\" > "$depfile"
+ alpha=ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz
+## The second -e expression handles DOS-style file names with drive letters.
+ sed -e 's/^[^:]*: / /' \
+ -e 's/^['$alpha']:\/[^:]*: / /' < "$tmpdepfile" >> "$depfile"
+## This next piece of magic avoids the `deleted header file' problem.
+## The problem is that when a header file which appears in a .P file
+## is deleted, the dependency causes make to die (because there is
+## typically no way to rebuild the header). We avoid this by adding
+## dummy dependencies for each header file. Too bad gcc doesn't do
+## this for us directly.
+ tr ' ' '
+' < "$tmpdepfile" |
+## Some versions of gcc put a space before the `:'. On the theory
+## that the space means something, we add a space to the output as
+## well.
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly. Breaking it into two sed invocations is a workaround.
+ sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+hp)
+ # This case exists only to let depend.m4 do its work. It works by
+ # looking at the text of this script. This case will never be run,
+ # since it is checked for above.
+ exit 1
+ ;;
+
+sgi)
+ if test "$libtool" = yes; then
+ "$@" "-Wp,-MDupdate,$tmpdepfile"
+ else
+ "$@" -MDupdate "$tmpdepfile"
+ fi
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+
+ if test -f "$tmpdepfile"; then # yes, the sourcefile depend on other files
+ echo "$object : \\" > "$depfile"
+
+ # Clip off the initial element (the dependent). Don't try to be
+ # clever and replace this with sed code, as IRIX sed won't handle
+ # lines with more than a fixed number of characters (4096 in
+ # IRIX 6.2 sed, 8192 in IRIX 6.5). We also remove comment lines;
+ # the IRIX cc adds comments like `#:fec' to the end of the
+ # dependency line.
+ tr ' ' '
+' < "$tmpdepfile" \
+ | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' | \
+ tr '
+' ' ' >> "$depfile"
+ echo >> "$depfile"
+
+ # The second pass generates a dummy entry for each header file.
+ tr ' ' '
+' < "$tmpdepfile" \
+ | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' -e 's/$/:/' \
+ >> "$depfile"
+ else
+ # The sourcefile does not contain any dependencies, so just
+ # store a dummy comment line, to avoid errors with the Makefile
+ # "include basename.Plo" scheme.
+ echo "#dummy" > "$depfile"
+ fi
+ rm -f "$tmpdepfile"
+ ;;
+
+aix)
+ # The C for AIX Compiler uses -M and outputs the dependencies
+ # in a .u file. In older versions, this file always lives in the
+ # current directory. Also, the AIX compiler puts `$object:' at the
+ # start of each line; $object doesn't have directory information.
+ # Version 6 uses the directory in both cases.
+ dir=`echo "$object" | sed -e 's|/[^/]*$|/|'`
+ test "x$dir" = "x$object" && dir=
+ base=`echo "$object" | sed -e 's|^.*/||' -e 's/\.o$//' -e 's/\.lo$//'`
+ if test "$libtool" = yes; then
+ tmpdepfile1=$dir$base.u
+ tmpdepfile2=$base.u
+ tmpdepfile3=$dir.libs/$base.u
+ "$@" -Wc,-M
+ else
+ tmpdepfile1=$dir$base.u
+ tmpdepfile2=$dir$base.u
+ tmpdepfile3=$dir$base.u
+ "$@" -M
+ fi
+ stat=$?
+
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+ exit $stat
+ fi
+
+ for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+ do
+ test -f "$tmpdepfile" && break
+ done
+ if test -f "$tmpdepfile"; then
+ # Each line is of the form `foo.o: dependent.h'.
+ # Do two passes, one to just change these to
+ # `$object: dependent.h' and one to simply `dependent.h:'.
+ sed -e "s,^.*\.[a-z]*:,$object:," < "$tmpdepfile" > "$depfile"
+ # That's a tab and a space in the [].
+ sed -e 's,^.*\.[a-z]*:[ ]*,,' -e 's,$,:,' < "$tmpdepfile" >> "$depfile"
+ else
+ # The sourcefile does not contain any dependencies, so just
+ # store a dummy comment line, to avoid errors with the Makefile
+ # "include basename.Plo" scheme.
+ echo "#dummy" > "$depfile"
+ fi
+ rm -f "$tmpdepfile"
+ ;;
+
+icc)
+ # Intel's C compiler understands `-MD -MF file'. However on
+ # icc -MD -MF foo.d -c -o sub/foo.o sub/foo.c
+ # ICC 7.0 will fill foo.d with something like
+ # foo.o: sub/foo.c
+ # foo.o: sub/foo.h
+ # which is wrong. We want:
+ # sub/foo.o: sub/foo.c
+ # sub/foo.o: sub/foo.h
+ # sub/foo.c:
+ # sub/foo.h:
+ # ICC 7.1 will output
+ # foo.o: sub/foo.c sub/foo.h
+ # and will wrap long lines using \ :
+ # foo.o: sub/foo.c ... \
+ # sub/foo.h ... \
+ # ...
+
+ "$@" -MD -MF "$tmpdepfile"
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+ # Each line is of the form `foo.o: dependent.h',
+ # or `foo.o: dep1.h dep2.h \', or ` dep3.h dep4.h \'.
+ # Do two passes, one to just change these to
+ # `$object: dependent.h' and one to simply `dependent.h:'.
+ sed "s,^[^:]*:,$object :," < "$tmpdepfile" > "$depfile"
+ # Some versions of the HPUX 10.20 sed can't process this invocation
+ # correctly. Breaking it into two sed invocations is a workaround.
+ sed 's,^[^:]*: \(.*\)$,\1,;s/^\\$//;/^$/d;/:$/d' < "$tmpdepfile" |
+ sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+hp2)
+ # The "hp" stanza above does not work with aCC (C++) and HP's ia64
+ # compilers, which have integrated preprocessors. The correct option
+ # to use with these is +Maked; it writes dependencies to a file named
+ # 'foo.d', which lands next to the object file, wherever that
+ # happens to be.
+ # Much of this is similar to the tru64 case; see comments there.
+ dir=`echo "$object" | sed -e 's|/[^/]*$|/|'`
+ test "x$dir" = "x$object" && dir=
+ base=`echo "$object" | sed -e 's|^.*/||' -e 's/\.o$//' -e 's/\.lo$//'`
+ if test "$libtool" = yes; then
+ tmpdepfile1=$dir$base.d
+ tmpdepfile2=$dir.libs/$base.d
+ "$@" -Wc,+Maked
+ else
+ tmpdepfile1=$dir$base.d
+ tmpdepfile2=$dir$base.d
+ "$@" +Maked
+ fi
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile1" "$tmpdepfile2"
+ exit $stat
+ fi
+
+ for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2"
+ do
+ test -f "$tmpdepfile" && break
+ done
+ if test -f "$tmpdepfile"; then
+ sed -e "s,^.*\.[a-z]*:,$object:," "$tmpdepfile" > "$depfile"
+ # Add `dependent.h:' lines.
+ sed -ne '2,${
+ s/^ *//
+ s/ \\*$//
+ s/$/:/
+ p
+ }' "$tmpdepfile" >> "$depfile"
+ else
+ echo "#dummy" > "$depfile"
+ fi
+ rm -f "$tmpdepfile" "$tmpdepfile2"
+ ;;
+
+tru64)
+ # The Tru64 compiler uses -MD to generate dependencies as a side
+ # effect. `cc -MD -o foo.o ...' puts the dependencies into `foo.o.d'.
+ # At least on Alpha/Redhat 6.1, Compaq CCC V6.2-504 seems to put
+ # dependencies in `foo.d' instead, so we check for that too.
+ # Subdirectories are respected.
+ dir=`echo "$object" | sed -e 's|/[^/]*$|/|'`
+ test "x$dir" = "x$object" && dir=
+ base=`echo "$object" | sed -e 's|^.*/||' -e 's/\.o$//' -e 's/\.lo$//'`
+
+ if test "$libtool" = yes; then
+ # With Tru64 cc, shared objects can also be used to make a
+ # static library. This mechanism is used in libtool 1.4 series to
+ # handle both shared and static libraries in a single compilation.
+ # With libtool 1.4, dependencies were output in $dir.libs/$base.lo.d.
+ #
+ # With libtool 1.5 this exception was removed, and libtool now
+ # generates 2 separate objects for the 2 libraries. These two
+ # compilations output dependencies in $dir.libs/$base.o.d and
+ # in $dir$base.o.d. We have to check for both files, because
+ # one of the two compilations can be disabled. We should prefer
+ # $dir$base.o.d over $dir.libs/$base.o.d because the latter is
+ # automatically cleaned when .libs/ is deleted, while ignoring
+ # the former would cause a distcleancheck panic.
+ tmpdepfile1=$dir.libs/$base.lo.d # libtool 1.4
+ tmpdepfile2=$dir$base.o.d # libtool 1.5
+ tmpdepfile3=$dir.libs/$base.o.d # libtool 1.5
+ tmpdepfile4=$dir.libs/$base.d # Compaq CCC V6.2-504
+ "$@" -Wc,-MD
+ else
+ tmpdepfile1=$dir$base.o.d
+ tmpdepfile2=$dir$base.d
+ tmpdepfile3=$dir$base.d
+ tmpdepfile4=$dir$base.d
+ "$@" -MD
+ fi
+
+ stat=$?
+ if test $stat -eq 0; then :
+ else
+ rm -f "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3" "$tmpdepfile4"
+ exit $stat
+ fi
+
+ for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3" "$tmpdepfile4"
+ do
+ test -f "$tmpdepfile" && break
+ done
+ if test -f "$tmpdepfile"; then
+ sed -e "s,^.*\.[a-z]*:,$object:," < "$tmpdepfile" > "$depfile"
+ # That's a tab and a space in the [].
+ sed -e 's,^.*\.[a-z]*:[ ]*,,' -e 's,$,:,' < "$tmpdepfile" >> "$depfile"
+ else
+ echo "#dummy" > "$depfile"
+ fi
+ rm -f "$tmpdepfile"
+ ;;
+
+#nosideeffect)
+ # This comment above is used by automake to tell side-effect
+ # dependency tracking mechanisms from slower ones.
+
+dashmstdout)
+ # Important note: in order to support this mode, a compiler *must*
+ # always write the preprocessed file to stdout, regardless of -o.
+ "$@" || exit $?
+
+ # Remove the call to Libtool.
+ if test "$libtool" = yes; then
+ while test "X$1" != 'X--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+
+ # Remove `-o $object'.
+ IFS=" "
+ for arg
+ do
+ case $arg in
+ -o)
+ shift
+ ;;
+ $object)
+ shift
+ ;;
+ *)
+ set fnord "$@" "$arg"
+ shift # fnord
+ shift # $arg
+ ;;
+ esac
+ done
+
+ test -z "$dashmflag" && dashmflag=-M
+ # Require at least two characters before searching for `:'
+ # in the target name. This is to cope with DOS-style filenames:
+ # a dependency such as `c:/foo/bar' could be seen as target `c' otherwise.
+ "$@" $dashmflag |
+ sed 's:^[ ]*[^: ][^:][^:]*\:[ ]*:'"$object"'\: :' > "$tmpdepfile"
+ rm -f "$depfile"
+ cat < "$tmpdepfile" > "$depfile"
+ tr ' ' '
+' < "$tmpdepfile" | \
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly. Breaking it into two sed invocations is a workaround.
+ sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+dashXmstdout)
+ # This case only exists to satisfy depend.m4. It is never actually
+ # run, as this mode is specially recognized in the preamble.
+ exit 1
+ ;;
+
+makedepend)
+ "$@" || exit $?
+ # Remove any Libtool call
+ if test "$libtool" = yes; then
+ while test "X$1" != 'X--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+ # X makedepend
+ shift
+ cleared=no eat=no
+ for arg
+ do
+ case $cleared in
+ no)
+ set ""; shift
+ cleared=yes ;;
+ esac
+ if test $eat = yes; then
+ eat=no
+ continue
+ fi
+ case "$arg" in
+ -D*|-I*)
+ set fnord "$@" "$arg"; shift ;;
+ # Strip any option that makedepend may not understand. Remove
+ # the object too, otherwise makedepend will parse it as a source file.
+ -arch)
+ eat=yes ;;
+ -*|$object)
+ ;;
+ *)
+ set fnord "$@" "$arg"; shift ;;
+ esac
+ done
+ obj_suffix=`echo "$object" | sed 's/^.*\././'`
+ touch "$tmpdepfile"
+ ${MAKEDEPEND-makedepend} -o"$obj_suffix" -f"$tmpdepfile" "$@"
+ rm -f "$depfile"
+ cat < "$tmpdepfile" > "$depfile"
+ sed '1,2d' "$tmpdepfile" | tr ' ' '
+' | \
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly. Breaking it into two sed invocations is a workaround.
+ sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' | sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile" "$tmpdepfile".bak
+ ;;
+
+cpp)
+ # Important note: in order to support this mode, a compiler *must*
+ # always write the preprocessed file to stdout.
+ "$@" || exit $?
+
+ # Remove the call to Libtool.
+ if test "$libtool" = yes; then
+ while test "X$1" != 'X--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+
+ # Remove `-o $object'.
+ IFS=" "
+ for arg
+ do
+ case $arg in
+ -o)
+ shift
+ ;;
+ $object)
+ shift
+ ;;
+ *)
+ set fnord "$@" "$arg"
+ shift # fnord
+ shift # $arg
+ ;;
+ esac
+ done
+
+ "$@" -E |
+ sed -n -e '/^# [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' \
+ -e '/^#line [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' |
+ sed '$ s: \\$::' > "$tmpdepfile"
+ rm -f "$depfile"
+ echo "$object : \\" > "$depfile"
+ cat < "$tmpdepfile" >> "$depfile"
+ sed < "$tmpdepfile" '/^$/d;s/^ //;s/ \\$//;s/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+msvisualcpp)
+ # Important note: in order to support this mode, a compiler *must*
+ # always write the preprocessed file to stdout.
+ "$@" || exit $?
+
+ # Remove the call to Libtool.
+ if test "$libtool" = yes; then
+ while test "X$1" != 'X--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+
+ IFS=" "
+ for arg
+ do
+ case "$arg" in
+ -o)
+ shift
+ ;;
+ $object)
+ shift
+ ;;
+ "-Gm"|"/Gm"|"-Gi"|"/Gi"|"-ZI"|"/ZI")
+ set fnord "$@"
+ shift
+ shift
+ ;;
+ *)
+ set fnord "$@" "$arg"
+ shift
+ shift
+ ;;
+ esac
+ done
+ "$@" -E 2>/dev/null |
+ sed -n '/^#line [0-9][0-9]* "\([^"]*\)"/ s::\1:p' | $cygpath_u | sort -u > "$tmpdepfile"
+ rm -f "$depfile"
+ echo "$object : \\" > "$depfile"
+ sed < "$tmpdepfile" -n -e 's% %\\ %g' -e '/^\(.*\)$/ s:: \1 \\:p' >> "$depfile"
+ echo " " >> "$depfile"
+ sed < "$tmpdepfile" -n -e 's% %\\ %g' -e '/^\(.*\)$/ s::\1\::p' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+msvcmsys)
+ # This case exists only to let depend.m4 do its work. It works by
+ # looking at the text of this script. This case will never be run,
+ # since it is checked for above.
+ exit 1
+ ;;
+
+none)
+ exec "$@"
+ ;;
+
+*)
+ echo "Unknown depmode $depmode" 1>&2
+ exit 1
+ ;;
+esac
+
+exit 0
+
+# Local Variables:
+# mode: shell-script
+# sh-indentation: 2
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:
diff --git a/popt-1.16/footer_no_timestamp.html b/popt-1.16/footer_no_timestamp.html
new file mode 100644
index 0000000..d32d210
--- /dev/null
+++ b/popt-1.16/footer_no_timestamp.html
@@ -0,0 +1,5 @@
+<hr size="1"><address style="text-align: right;"><small>Generated for $projectname by
+<a href="http://www.doxygen.org/index.html">
+<img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> $doxygenversion </small></address>
+</body>
+</html>
diff --git a/popt-1.16/install-sh b/popt-1.16/install-sh
new file mode 100755
index 0000000..6781b98
--- /dev/null
+++ b/popt-1.16/install-sh
@@ -0,0 +1,520 @@
+#!/bin/sh
+# install - install a program, script, or datafile
+
+scriptversion=2009-04-28.21; # UTC
+
+# This originates from X11R5 (mit/util/scripts/install.sh), which was
+# later released in X11R6 (xc/config/util/install.sh) with the
+# following copyright and license.
+#
+# Copyright (C) 1994 X Consortium
+#
+# Permission is hereby granted, free of charge, to any person obtaining a copy
+# of this software and associated documentation files (the "Software"), to
+# deal in the Software without restriction, including without limitation the
+# rights to use, copy, modify, merge, publish, distribute, sublicense, and/or
+# sell copies of the Software, and to permit persons to whom the Software is
+# furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice shall be included in
+# all copies or substantial portions of the Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+# X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN
+# AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNEC-
+# TION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+#
+# Except as contained in this notice, the name of the X Consortium shall not
+# be used in advertising or otherwise to promote the sale, use or other deal-
+# ings in this Software without prior written authorization from the X Consor-
+# tium.
+#
+#
+# FSF changes to this file are in the public domain.
+#
+# Calling this script install-sh is preferred over install.sh, to prevent
+# `make' implicit rules from creating a file called install from it
+# when there is no Makefile.
+#
+# This script is compatible with the BSD install script, but was written
+# from scratch.
+
+nl='
+'
+IFS=" "" $nl"
+
+# set DOITPROG to echo to test this script
+
+# Don't use :- since 4.3BSD and earlier shells don't like it.
+doit=${DOITPROG-}
+if test -z "$doit"; then
+ doit_exec=exec
+else
+ doit_exec=$doit
+fi
+
+# Put in absolute file names if you don't have them in your path;
+# or use environment vars.
+
+chgrpprog=${CHGRPPROG-chgrp}
+chmodprog=${CHMODPROG-chmod}
+chownprog=${CHOWNPROG-chown}
+cmpprog=${CMPPROG-cmp}
+cpprog=${CPPROG-cp}
+mkdirprog=${MKDIRPROG-mkdir}
+mvprog=${MVPROG-mv}
+rmprog=${RMPROG-rm}
+stripprog=${STRIPPROG-strip}
+
+posix_glob='?'
+initialize_posix_glob='
+ test "$posix_glob" != "?" || {
+ if (set -f) 2>/dev/null; then
+ posix_glob=
+ else
+ posix_glob=:
+ fi
+ }
+'
+
+posix_mkdir=
+
+# Desired mode of installed file.
+mode=0755
+
+chgrpcmd=
+chmodcmd=$chmodprog
+chowncmd=
+mvcmd=$mvprog
+rmcmd="$rmprog -f"
+stripcmd=
+
+src=
+dst=
+dir_arg=
+dst_arg=
+
+copy_on_change=false
+no_target_directory=
+
+usage="\
+Usage: $0 [OPTION]... [-T] SRCFILE DSTFILE
+ or: $0 [OPTION]... SRCFILES... DIRECTORY
+ or: $0 [OPTION]... -t DIRECTORY SRCFILES...
+ or: $0 [OPTION]... -d DIRECTORIES...
+
+In the 1st form, copy SRCFILE to DSTFILE.
+In the 2nd and 3rd, copy all SRCFILES to DIRECTORY.
+In the 4th, create DIRECTORIES.
+
+Options:
+ --help display this help and exit.
+ --version display version info and exit.
+
+ -c (ignored)
+ -C install only if different (preserve the last data modification time)
+ -d create directories instead of installing files.
+ -g GROUP $chgrpprog installed files to GROUP.
+ -m MODE $chmodprog installed files to MODE.
+ -o USER $chownprog installed files to USER.
+ -s $stripprog installed files.
+ -t DIRECTORY install into DIRECTORY.
+ -T report an error if DSTFILE is a directory.
+
+Environment variables override the default commands:
+ CHGRPPROG CHMODPROG CHOWNPROG CMPPROG CPPROG MKDIRPROG MVPROG
+ RMPROG STRIPPROG
+"
+
+while test $# -ne 0; do
+ case $1 in
+ -c) ;;
+
+ -C) copy_on_change=true;;
+
+ -d) dir_arg=true;;
+
+ -g) chgrpcmd="$chgrpprog $2"
+ shift;;
+
+ --help) echo "$usage"; exit $?;;
+
+ -m) mode=$2
+ case $mode in
+ *' '* | *' '* | *'
+'* | *'*'* | *'?'* | *'['*)
+ echo "$0: invalid mode: $mode" >&2
+ exit 1;;
+ esac
+ shift;;
+
+ -o) chowncmd="$chownprog $2"
+ shift;;
+
+ -s) stripcmd=$stripprog;;
+
+ -t) dst_arg=$2
+ shift;;
+
+ -T) no_target_directory=true;;
+
+ --version) echo "$0 $scriptversion"; exit $?;;
+
+ --) shift
+ break;;
+
+ -*) echo "$0: invalid option: $1" >&2
+ exit 1;;
+
+ *) break;;
+ esac
+ shift
+done
+
+if test $# -ne 0 && test -z "$dir_arg$dst_arg"; then
+ # When -d is used, all remaining arguments are directories to create.
+ # When -t is used, the destination is already specified.
+ # Otherwise, the last argument is the destination. Remove it from $@.
+ for arg
+ do
+ if test -n "$dst_arg"; then
+ # $@ is not empty: it contains at least $arg.
+ set fnord "$@" "$dst_arg"
+ shift # fnord
+ fi
+ shift # arg
+ dst_arg=$arg
+ done
+fi
+
+if test $# -eq 0; then
+ if test -z "$dir_arg"; then
+ echo "$0: no input file specified." >&2
+ exit 1
+ fi
+ # It's OK to call `install-sh -d' without argument.
+ # This can happen when creating conditional directories.
+ exit 0
+fi
+
+if test -z "$dir_arg"; then
+ trap '(exit $?); exit' 1 2 13 15
+
+ # Set umask so as not to create temps with too-generous modes.
+ # However, 'strip' requires both read and write access to temps.
+ case $mode in
+ # Optimize common cases.
+ *644) cp_umask=133;;
+ *755) cp_umask=22;;
+
+ *[0-7])
+ if test -z "$stripcmd"; then
+ u_plus_rw=
+ else
+ u_plus_rw='% 200'
+ fi
+ cp_umask=`expr '(' 777 - $mode % 1000 ')' $u_plus_rw`;;
+ *)
+ if test -z "$stripcmd"; then
+ u_plus_rw=
+ else
+ u_plus_rw=,u+rw
+ fi
+ cp_umask=$mode$u_plus_rw;;
+ esac
+fi
+
+for src
+do
+ # Protect names starting with `-'.
+ case $src in
+ -*) src=./$src;;
+ esac
+
+ if test -n "$dir_arg"; then
+ dst=$src
+ dstdir=$dst
+ test -d "$dstdir"
+ dstdir_status=$?
+ else
+
+ # Waiting for this to be detected by the "$cpprog $src $dsttmp" command
+ # might cause directories to be created, which would be especially bad
+ # if $src (and thus $dsttmp) contains '*'.
+ if test ! -f "$src" && test ! -d "$src"; then
+ echo "$0: $src does not exist." >&2
+ exit 1
+ fi
+
+ if test -z "$dst_arg"; then
+ echo "$0: no destination specified." >&2
+ exit 1
+ fi
+
+ dst=$dst_arg
+ # Protect names starting with `-'.
+ case $dst in
+ -*) dst=./$dst;;
+ esac
+
+ # If destination is a directory, append the input filename; won't work
+ # if double slashes aren't ignored.
+ if test -d "$dst"; then
+ if test -n "$no_target_directory"; then
+ echo "$0: $dst_arg: Is a directory" >&2
+ exit 1
+ fi
+ dstdir=$dst
+ dst=$dstdir/`basename "$src"`
+ dstdir_status=0
+ else
+ # Prefer dirname, but fall back on a substitute if dirname fails.
+ dstdir=`
+ (dirname "$dst") 2>/dev/null ||
+ expr X"$dst" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$dst" : 'X\(//\)[^/]' \| \
+ X"$dst" : 'X\(//\)$' \| \
+ X"$dst" : 'X\(/\)' \| . 2>/dev/null ||
+ echo X"$dst" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'
+ `
+
+ test -d "$dstdir"
+ dstdir_status=$?
+ fi
+ fi
+
+ obsolete_mkdir_used=false
+
+ if test $dstdir_status != 0; then
+ case $posix_mkdir in
+ '')
+ # Create intermediate dirs using mode 755 as modified by the umask.
+ # This is like FreeBSD 'install' as of 1997-10-28.
+ umask=`umask`
+ case $stripcmd.$umask in
+ # Optimize common cases.
+ *[2367][2367]) mkdir_umask=$umask;;
+ .*0[02][02] | .[02][02] | .[02]) mkdir_umask=22;;
+
+ *[0-7])
+ mkdir_umask=`expr $umask + 22 \
+ - $umask % 100 % 40 + $umask % 20 \
+ - $umask % 10 % 4 + $umask % 2
+ `;;
+ *) mkdir_umask=$umask,go-w;;
+ esac
+
+ # With -d, create the new directory with the user-specified mode.
+ # Otherwise, rely on $mkdir_umask.
+ if test -n "$dir_arg"; then
+ mkdir_mode=-m$mode
+ else
+ mkdir_mode=
+ fi
+
+ posix_mkdir=false
+ case $umask in
+ *[123567][0-7][0-7])
+ # POSIX mkdir -p sets u+wx bits regardless of umask, which
+ # is incompatible with FreeBSD 'install' when (umask & 300) != 0.
+ ;;
+ *)
+ tmpdir=${TMPDIR-/tmp}/ins$RANDOM-$$
+ trap 'ret=$?; rmdir "$tmpdir/d" "$tmpdir" 2>/dev/null; exit $ret' 0
+
+ if (umask $mkdir_umask &&
+ exec $mkdirprog $mkdir_mode -p -- "$tmpdir/d") >/dev/null 2>&1
+ then
+ if test -z "$dir_arg" || {
+ # Check for POSIX incompatibilities with -m.
+ # HP-UX 11.23 and IRIX 6.5 mkdir -m -p sets group- or
+ # other-writeable bit of parent directory when it shouldn't.
+ # FreeBSD 6.1 mkdir -m -p sets mode of existing directory.
+ ls_ld_tmpdir=`ls -ld "$tmpdir"`
+ case $ls_ld_tmpdir in
+ d????-?r-*) different_mode=700;;
+ d????-?--*) different_mode=755;;
+ *) false;;
+ esac &&
+ $mkdirprog -m$different_mode -p -- "$tmpdir" && {
+ ls_ld_tmpdir_1=`ls -ld "$tmpdir"`
+ test "$ls_ld_tmpdir" = "$ls_ld_tmpdir_1"
+ }
+ }
+ then posix_mkdir=:
+ fi
+ rmdir "$tmpdir/d" "$tmpdir"
+ else
+ # Remove any dirs left behind by ancient mkdir implementations.
+ rmdir ./$mkdir_mode ./-p ./-- 2>/dev/null
+ fi
+ trap '' 0;;
+ esac;;
+ esac
+
+ if
+ $posix_mkdir && (
+ umask $mkdir_umask &&
+ $doit_exec $mkdirprog $mkdir_mode -p -- "$dstdir"
+ )
+ then :
+ else
+
+ # The umask is ridiculous, or mkdir does not conform to POSIX,
+ # or it failed possibly due to a race condition. Create the
+ # directory the slow way, step by step, checking for races as we go.
+
+ case $dstdir in
+ /*) prefix='/';;
+ -*) prefix='./';;
+ *) prefix='';;
+ esac
+
+ eval "$initialize_posix_glob"
+
+ oIFS=$IFS
+ IFS=/
+ $posix_glob set -f
+ set fnord $dstdir
+ shift
+ $posix_glob set +f
+ IFS=$oIFS
+
+ prefixes=
+
+ for d
+ do
+ test -z "$d" && continue
+
+ prefix=$prefix$d
+ if test -d "$prefix"; then
+ prefixes=
+ else
+ if $posix_mkdir; then
+ (umask=$mkdir_umask &&
+ $doit_exec $mkdirprog $mkdir_mode -p -- "$dstdir") && break
+ # Don't fail if two instances are running concurrently.
+ test -d "$prefix" || exit 1
+ else
+ case $prefix in
+ *\'*) qprefix=`echo "$prefix" | sed "s/'/'\\\\\\\\''/g"`;;
+ *) qprefix=$prefix;;
+ esac
+ prefixes="$prefixes '$qprefix'"
+ fi
+ fi
+ prefix=$prefix/
+ done
+
+ if test -n "$prefixes"; then
+ # Don't fail if two instances are running concurrently.
+ (umask $mkdir_umask &&
+ eval "\$doit_exec \$mkdirprog $prefixes") ||
+ test -d "$dstdir" || exit 1
+ obsolete_mkdir_used=true
+ fi
+ fi
+ fi
+
+ if test -n "$dir_arg"; then
+ { test -z "$chowncmd" || $doit $chowncmd "$dst"; } &&
+ { test -z "$chgrpcmd" || $doit $chgrpcmd "$dst"; } &&
+ { test "$obsolete_mkdir_used$chowncmd$chgrpcmd" = false ||
+ test -z "$chmodcmd" || $doit $chmodcmd $mode "$dst"; } || exit 1
+ else
+
+ # Make a couple of temp file names in the proper directory.
+ dsttmp=$dstdir/_inst.$$_
+ rmtmp=$dstdir/_rm.$$_
+
+ # Trap to clean up those temp files at exit.
+ trap 'ret=$?; rm -f "$dsttmp" "$rmtmp" && exit $ret' 0
+
+ # Copy the file name to the temp name.
+ (umask $cp_umask && $doit_exec $cpprog "$src" "$dsttmp") &&
+
+ # and set any options; do chmod last to preserve setuid bits.
+ #
+ # If any of these fail, we abort the whole thing. If we want to
+ # ignore errors from any of these, just make sure not to ignore
+ # errors from the above "$doit $cpprog $src $dsttmp" command.
+ #
+ { test -z "$chowncmd" || $doit $chowncmd "$dsttmp"; } &&
+ { test -z "$chgrpcmd" || $doit $chgrpcmd "$dsttmp"; } &&
+ { test -z "$stripcmd" || $doit $stripcmd "$dsttmp"; } &&
+ { test -z "$chmodcmd" || $doit $chmodcmd $mode "$dsttmp"; } &&
+
+ # If -C, don't bother to copy if it wouldn't change the file.
+ if $copy_on_change &&
+ old=`LC_ALL=C ls -dlL "$dst" 2>/dev/null` &&
+ new=`LC_ALL=C ls -dlL "$dsttmp" 2>/dev/null` &&
+
+ eval "$initialize_posix_glob" &&
+ $posix_glob set -f &&
+ set X $old && old=:$2:$4:$5:$6 &&
+ set X $new && new=:$2:$4:$5:$6 &&
+ $posix_glob set +f &&
+
+ test "$old" = "$new" &&
+ $cmpprog "$dst" "$dsttmp" >/dev/null 2>&1
+ then
+ rm -f "$dsttmp"
+ else
+ # Rename the file to the real destination.
+ $doit $mvcmd -f "$dsttmp" "$dst" 2>/dev/null ||
+
+ # The rename failed, perhaps because mv can't rename something else
+ # to itself, or perhaps because mv is so ancient that it does not
+ # support -f.
+ {
+ # Now remove or move aside any old file at destination location.
+ # We try this two ways since rm can't unlink itself on some
+ # systems and the destination file might be busy for other
+ # reasons. In this case, the final cleanup might fail but the new
+ # file should still install successfully.
+ {
+ test ! -f "$dst" ||
+ $doit $rmcmd -f "$dst" 2>/dev/null ||
+ { $doit $mvcmd -f "$dst" "$rmtmp" 2>/dev/null &&
+ { $doit $rmcmd -f "$rmtmp" 2>/dev/null; :; }
+ } ||
+ { echo "$0: cannot unlink or rename $dst" >&2
+ (exit 1); exit 1
+ }
+ } &&
+
+ # Now rename the file to the real destination.
+ $doit $mvcmd "$dsttmp" "$dst"
+ }
+ fi || exit 1
+
+ trap '' 0
+ fi
+done
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:
diff --git a/popt-1.16/libpopt.vers b/popt-1.16/libpopt.vers
new file mode 100644
index 0000000..3ac5e52
--- /dev/null
+++ b/popt-1.16/libpopt.vers
@@ -0,0 +1,58 @@
+LIBPOPT_0
+{
+ global:
+ _fini;
+ _init;
+ _poptArgMask;
+ _poptGroupMask;
+ poptAddAlias;
+ poptAddItem;
+ poptAliasOptions;
+ poptBadOption;
+ _poptBitsN;
+ _poptBitsM;
+ _poptBitsK;
+ poptBitsAdd;
+ poptBitsArgs;
+ poptBitsChk;
+ poptBitsClr;
+ poptBitsDel;
+ poptBitsIntersect;
+ poptBitsUnion;
+ poptConfigFileToString;
+ poptDupArgv;
+ poptFini;
+ poptFreeContext;
+ poptGetArg;
+ poptGetArgs;
+ poptGetContext;
+ poptGetInvocationName;
+ poptGetNextOpt;
+ poptGetOptArg;
+ poptHelpOptions;
+ poptHelpOptionsI18N;
+ poptInit;
+ poptParseArgvString;
+ poptPeekArg;
+ poptPrintHelp;
+ poptPrintUsage;
+ poptReadFile;
+ poptReadConfigFile;
+ poptReadConfigFiles;
+ poptReadDefaultConfig;
+ poptResetContext;
+ poptSaneFile;
+ poptSaveBits;
+ poptSaveInt;
+ poptSaveLong;
+ poptSaveLongLong;
+ poptSaveShort;
+ poptSaveString;
+ poptSetExecPath;
+ poptSetOtherOptionHelp;
+ poptStrerror;
+ poptStrippedArgv;
+ poptStuffArgs;
+ local:
+ *;
+};
diff --git a/popt-1.16/lookup3.c b/popt-1.16/lookup3.c
new file mode 100644
index 0000000..0584c39
--- /dev/null
+++ b/popt-1.16/lookup3.c
@@ -0,0 +1,969 @@
+/* -------------------------------------------------------------------- */
+/*
+ * lookup3.c, by Bob Jenkins, May 2006, Public Domain.
+ *
+ * These are functions for producing 32-bit hashes for hash table lookup.
+ * jlu32w(), jlu32l(), jlu32lpair(), jlu32b(), _JLU3_MIX(), and _JLU3_FINAL()
+ * are externally useful functions. Routines to test the hash are included
+ * if SELF_TEST is defined. You can use this free for any purpose. It's in
+ * the public domain. It has no warranty.
+ *
+ * You probably want to use jlu32l(). jlu32l() and jlu32b()
+ * hash byte arrays. jlu32l() is is faster than jlu32b() on
+ * little-endian machines. Intel and AMD are little-endian machines.
+ * On second thought, you probably want jlu32lpair(), which is identical to
+ * jlu32l() except it returns two 32-bit hashes for the price of one.
+ * You could implement jlu32bpair() if you wanted but I haven't bothered here.
+ *
+ * If you want to find a hash of, say, exactly 7 integers, do
+ * a = i1; b = i2; c = i3;
+ * _JLU3_MIX(a,b,c);
+ * a += i4; b += i5; c += i6;
+ * _JLU3_MIX(a,b,c);
+ * a += i7;
+ * _JLU3_FINAL(a,b,c);
+ * then use c as the hash value. If you have a variable size array of
+ * 4-byte integers to hash, use jlu32w(). If you have a byte array (like
+ * a character string), use jlu32l(). If you have several byte arrays, or
+ * a mix of things, see the comments above jlu32l().
+ *
+ * Why is this so big? I read 12 bytes at a time into 3 4-byte integers,
+ * then mix those integers. This is fast (you can do a lot more thorough
+ * mixing with 12*3 instructions on 3 integers than you can with 3 instructions
+ * on 1 byte), but shoehorning those bytes into integers efficiently is messy.
+*/
+/* -------------------------------------------------------------------- */
+
+#include <stdint.h>
+
+#if defined(_JLU3_SELFTEST)
+# define _JLU3_jlu32w 1
+# define _JLU3_jlu32l 1
+# define _JLU3_jlu32lpair 1
+# define _JLU3_jlu32b 1
+#endif
+
+/*@-redef@*/
+/*@unchecked@*/
+static const union _dbswap {
+ const uint32_t ui;
+ const unsigned char uc[4];
+} endian = { .ui = 0x11223344 };
+# define HASH_LITTLE_ENDIAN (endian.uc[0] == (unsigned char) 0x44)
+# define HASH_BIG_ENDIAN (endian.uc[0] == (unsigned char) 0x11)
+/*@=redef@*/
+
+#ifndef ROTL32
+# define ROTL32(x, s) (((x) << (s)) | ((x) >> (32 - (s))))
+#endif
+
+/* NOTE: The _size parameter should be in bytes. */
+#define _JLU3_INIT(_h, _size) (0xdeadbeef + ((uint32_t)(_size)) + (_h))
+
+/* -------------------------------------------------------------------- */
+/*
+ * _JLU3_MIX -- mix 3 32-bit values reversibly.
+ *
+ * This is reversible, so any information in (a,b,c) before _JLU3_MIX() is
+ * still in (a,b,c) after _JLU3_MIX().
+ *
+ * If four pairs of (a,b,c) inputs are run through _JLU3_MIX(), or through
+ * _JLU3_MIX() in reverse, there are at least 32 bits of the output that
+ * are sometimes the same for one pair and different for another pair.
+ * This was tested for:
+ * * pairs that differed by one bit, by two bits, in any combination
+ * of top bits of (a,b,c), or in any combination of bottom bits of
+ * (a,b,c).
+ * * "differ" is defined as +, -, ^, or ~^. For + and -, I transformed
+ * the output delta to a Gray code (a^(a>>1)) so a string of 1's (as
+ * is commonly produced by subtraction) look like a single 1-bit
+ * difference.
+ * * the base values were pseudorandom, all zero but one bit set, or
+ * all zero plus a counter that starts at zero.
+ *
+ * Some k values for my "a-=c; a^=ROTL32(c,k); c+=b;" arrangement that
+ * satisfy this are
+ * 4 6 8 16 19 4
+ * 9 15 3 18 27 15
+ * 14 9 3 7 17 3
+ * Well, "9 15 3 18 27 15" didn't quite get 32 bits diffing
+ * for "differ" defined as + with a one-bit base and a two-bit delta. I
+ * used http://burtleburtle.net/bob/hash/avalanche.html to choose
+ * the operations, constants, and arrangements of the variables.
+ *
+ * This does not achieve avalanche. There are input bits of (a,b,c)
+ * that fail to affect some output bits of (a,b,c), especially of a. The
+ * most thoroughly mixed value is c, but it doesn't really even achieve
+ * avalanche in c.
+ *
+ * This allows some parallelism. Read-after-writes are good at doubling
+ * the number of bits affected, so the goal of mixing pulls in the opposite
+ * direction as the goal of parallelism. I did what I could. Rotates
+ * seem to cost as much as shifts on every machine I could lay my hands
+ * on, and rotates are much kinder to the top and bottom bits, so I used
+ * rotates.
+ */
+/* -------------------------------------------------------------------- */
+#define _JLU3_MIX(a,b,c) \
+{ \
+ a -= c; a ^= ROTL32(c, 4); c += b; \
+ b -= a; b ^= ROTL32(a, 6); a += c; \
+ c -= b; c ^= ROTL32(b, 8); b += a; \
+ a -= c; a ^= ROTL32(c,16); c += b; \
+ b -= a; b ^= ROTL32(a,19); a += c; \
+ c -= b; c ^= ROTL32(b, 4); b += a; \
+}
+
+/* -------------------------------------------------------------------- */
+/**
+ * _JLU3_FINAL -- final mixing of 3 32-bit values (a,b,c) into c
+ *
+ * Pairs of (a,b,c) values differing in only a few bits will usually
+ * produce values of c that look totally different. This was tested for
+ * * pairs that differed by one bit, by two bits, in any combination
+ * of top bits of (a,b,c), or in any combination of bottom bits of
+ * (a,b,c).
+ * * "differ" is defined as +, -, ^, or ~^. For + and -, I transformed
+ * the output delta to a Gray code (a^(a>>1)) so a string of 1's (as
+ * is commonly produced by subtraction) look like a single 1-bit
+ * difference.
+ * * the base values were pseudorandom, all zero but one bit set, or
+ * all zero plus a counter that starts at zero.
+ *
+ * These constants passed:
+ * 14 11 25 16 4 14 24
+ * 12 14 25 16 4 14 24
+ * and these came close:
+ * 4 8 15 26 3 22 24
+ * 10 8 15 26 3 22 24
+ * 11 8 15 26 3 22 24
+ */
+/* -------------------------------------------------------------------- */
+#define _JLU3_FINAL(a,b,c) \
+{ \
+ c ^= b; c -= ROTL32(b,14); \
+ a ^= c; a -= ROTL32(c,11); \
+ b ^= a; b -= ROTL32(a,25); \
+ c ^= b; c -= ROTL32(b,16); \
+ a ^= c; a -= ROTL32(c,4); \
+ b ^= a; b -= ROTL32(a,14); \
+ c ^= b; c -= ROTL32(b,24); \
+}
+
+#if defined(_JLU3_jlu32w)
+uint32_t jlu32w(uint32_t h, /*@null@*/ const uint32_t *k, size_t size)
+ /*@*/;
+/* -------------------------------------------------------------------- */
+/**
+ * This works on all machines. To be useful, it requires
+ * -- that the key be an array of uint32_t's, and
+ * -- that the size be the number of uint32_t's in the key
+ *
+ * The function jlu32w() is identical to jlu32l() on little-endian
+ * machines, and identical to jlu32b() on big-endian machines,
+ * except that the size has to be measured in uint32_ts rather than in
+ * bytes. jlu32l() is more complicated than jlu32w() only because
+ * jlu32l() has to dance around fitting the key bytes into registers.
+ *
+ * @param h the previous hash, or an arbitrary value
+ * @param *k the key, an array of uint32_t values
+ * @param size the size of the key, in uint32_ts
+ * @return the lookup3 hash
+ */
+/* -------------------------------------------------------------------- */
+uint32_t jlu32w(uint32_t h, const uint32_t *k, size_t size)
+{
+ uint32_t a = _JLU3_INIT(h, (size * sizeof(*k)));
+ uint32_t b = a;
+ uint32_t c = a;
+
+ if (k == NULL)
+ goto exit;
+
+ /*----------------------------------------------- handle most of the key */
+ while (size > 3) {
+ a += k[0];
+ b += k[1];
+ c += k[2];
+ _JLU3_MIX(a,b,c);
+ size -= 3;
+ k += 3;
+ }
+
+ /*----------------------------------------- handle the last 3 uint32_t's */
+ switch (size) {
+ case 3 : c+=k[2];
+ case 2 : b+=k[1];
+ case 1 : a+=k[0];
+ _JLU3_FINAL(a,b,c);
+ /*@fallthrough@*/
+ case 0:
+ break;
+ }
+ /*---------------------------------------------------- report the result */
+exit:
+ return c;
+}
+#endif /* defined(_JLU3_jlu32w) */
+
+#if defined(_JLU3_jlu32l)
+uint32_t jlu32l(uint32_t h, const void *key, size_t size)
+ /*@*/;
+/* -------------------------------------------------------------------- */
+/*
+ * jlu32l() -- hash a variable-length key into a 32-bit value
+ * h : can be any 4-byte value
+ * k : the key (the unaligned variable-length array of bytes)
+ * size : the size of the key, counting by bytes
+ * Returns a 32-bit value. Every bit of the key affects every bit of
+ * the return value. Two keys differing by one or two bits will have
+ * totally different hash values.
+ *
+ * The best hash table sizes are powers of 2. There is no need to do
+ * mod a prime (mod is sooo slow!). If you need less than 32 bits,
+ * use a bitmask. For example, if you need only 10 bits, do
+ * h = (h & hashmask(10));
+ * In which case, the hash table should have hashsize(10) elements.
+ *
+ * If you are hashing n strings (uint8_t **)k, do it like this:
+ * for (i=0, h=0; i<n; ++i) h = jlu32l(h, k[i], len[i]);
+ *
+ * By Bob Jenkins, 2006. bob_jenkins@burtleburtle.net. You may use this
+ * code any way you wish, private, educational, or commercial. It's free.
+ *
+ * Use for hash table lookup, or anything where one collision in 2^^32 is
+ * acceptable. Do NOT use for cryptographic purposes.
+ *
+ * @param h the previous hash, or an arbitrary value
+ * @param *k the key, an array of uint8_t values
+ * @param size the size of the key
+ * @return the lookup3 hash
+ */
+/* -------------------------------------------------------------------- */
+uint32_t jlu32l(uint32_t h, const void *key, size_t size)
+{
+ union { const void *ptr; size_t i; } u;
+ uint32_t a = _JLU3_INIT(h, size);
+ uint32_t b = a;
+ uint32_t c = a;
+
+ if (key == NULL)
+ goto exit;
+
+ u.ptr = key;
+ if (HASH_LITTLE_ENDIAN && ((u.i & 0x3) == 0)) {
+ const uint32_t *k = (const uint32_t *)key; /* read 32-bit chunks */
+#ifdef VALGRIND
+ const uint8_t *k8;
+#endif
+
+ /*------ all but last block: aligned reads and affect 32 bits of (a,b,c) */
+ while (size > 12) {
+ a += k[0];
+ b += k[1];
+ c += k[2];
+ _JLU3_MIX(a,b,c);
+ size -= 12;
+ k += 3;
+ }
+
+ /*------------------------- handle the last (probably partial) block */
+ /*
+ * "k[2]&0xffffff" actually reads beyond the end of the string, but
+ * then masks off the part it's not allowed to read. Because the
+ * string is aligned, the masked-off tail is in the same word as the
+ * rest of the string. Every machine with memory protection I've seen
+ * does it on word boundaries, so is OK with this. But VALGRIND will
+ * still catch it and complain. The masking trick does make the hash
+ * noticably faster for short strings (like English words).
+ */
+#ifndef VALGRIND
+
+ switch (size) {
+ case 12: c += k[2]; b+=k[1]; a+=k[0]; break;
+ case 11: c += k[2]&0xffffff; b+=k[1]; a+=k[0]; break;
+ case 10: c += k[2]&0xffff; b+=k[1]; a+=k[0]; break;
+ case 9: c += k[2]&0xff; b+=k[1]; a+=k[0]; break;
+ case 8: b += k[1]; a+=k[0]; break;
+ case 7: b += k[1]&0xffffff; a+=k[0]; break;
+ case 6: b += k[1]&0xffff; a+=k[0]; break;
+ case 5: b += k[1]&0xff; a+=k[0]; break;
+ case 4: a += k[0]; break;
+ case 3: a += k[0]&0xffffff; break;
+ case 2: a += k[0]&0xffff; break;
+ case 1: a += k[0]&0xff; break;
+ case 0: goto exit;
+ }
+
+#else /* make valgrind happy */
+
+ k8 = (const uint8_t *)k;
+ switch (size) {
+ case 12: c += k[2]; b+=k[1]; a+=k[0] break;
+ case 11: c += ((uint32_t)k8[10])<<16; /*@fallthrough@*/
+ case 10: c += ((uint32_t)k8[9])<<8; /*@fallthrough@*/
+ case 9: c += k8[8]; /*@fallthrough@*/
+ case 8: b += k[1]; a+=k[0]; break;
+ case 7: b += ((uint32_t)k8[6])<<16; /*@fallthrough@*/
+ case 6: b += ((uint32_t)k8[5])<<8; /*@fallthrough@*/
+ case 5: b += k8[4]; /*@fallthrough@*/
+ case 4: a += k[0]; break;
+ case 3: a += ((uint32_t)k8[2])<<16; /*@fallthrough@*/
+ case 2: a += ((uint32_t)k8[1])<<8; /*@fallthrough@*/
+ case 1: a += k8[0]; break;
+ case 0: goto exit;
+ }
+
+#endif /* !valgrind */
+
+ } else if (HASH_LITTLE_ENDIAN && ((u.i & 0x1) == 0)) {
+ const uint16_t *k = (const uint16_t *)key; /* read 16-bit chunks */
+ const uint8_t *k8;
+
+ /*----------- all but last block: aligned reads and different mixing */
+ while (size > 12) {
+ a += k[0] + (((uint32_t)k[1])<<16);
+ b += k[2] + (((uint32_t)k[3])<<16);
+ c += k[4] + (((uint32_t)k[5])<<16);
+ _JLU3_MIX(a,b,c);
+ size -= 12;
+ k += 6;
+ }
+
+ /*------------------------- handle the last (probably partial) block */
+ k8 = (const uint8_t *)k;
+ switch (size) {
+ case 12:
+ c += k[4]+(((uint32_t)k[5])<<16);
+ b += k[2]+(((uint32_t)k[3])<<16);
+ a += k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 11:
+ c += ((uint32_t)k8[10])<<16;
+ /*@fallthrough@*/
+ case 10:
+ c += (uint32_t)k[4];
+ b += k[2]+(((uint32_t)k[3])<<16);
+ a += k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 9:
+ c += (uint32_t)k8[8];
+ /*@fallthrough@*/
+ case 8:
+ b += k[2]+(((uint32_t)k[3])<<16);
+ a += k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 7:
+ b += ((uint32_t)k8[6])<<16;
+ /*@fallthrough@*/
+ case 6:
+ b += (uint32_t)k[2];
+ a += k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 5:
+ b += (uint32_t)k8[4];
+ /*@fallthrough@*/
+ case 4:
+ a += k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 3:
+ a += ((uint32_t)k8[2])<<16;
+ /*@fallthrough@*/
+ case 2:
+ a += (uint32_t)k[0];
+ break;
+ case 1:
+ a += (uint32_t)k8[0];
+ break;
+ case 0:
+ goto exit;
+ }
+
+ } else { /* need to read the key one byte at a time */
+ const uint8_t *k = (const uint8_t *)key;
+
+ /*----------- all but the last block: affect some 32 bits of (a,b,c) */
+ while (size > 12) {
+ a += (uint32_t)k[0];
+ a += ((uint32_t)k[1])<<8;
+ a += ((uint32_t)k[2])<<16;
+ a += ((uint32_t)k[3])<<24;
+ b += (uint32_t)k[4];
+ b += ((uint32_t)k[5])<<8;
+ b += ((uint32_t)k[6])<<16;
+ b += ((uint32_t)k[7])<<24;
+ c += (uint32_t)k[8];
+ c += ((uint32_t)k[9])<<8;
+ c += ((uint32_t)k[10])<<16;
+ c += ((uint32_t)k[11])<<24;
+ _JLU3_MIX(a,b,c);
+ size -= 12;
+ k += 12;
+ }
+
+ /*---------------------------- last block: affect all 32 bits of (c) */
+ switch (size) {
+ case 12: c += ((uint32_t)k[11])<<24; /*@fallthrough@*/
+ case 11: c += ((uint32_t)k[10])<<16; /*@fallthrough@*/
+ case 10: c += ((uint32_t)k[9])<<8; /*@fallthrough@*/
+ case 9: c += (uint32_t)k[8]; /*@fallthrough@*/
+ case 8: b += ((uint32_t)k[7])<<24; /*@fallthrough@*/
+ case 7: b += ((uint32_t)k[6])<<16; /*@fallthrough@*/
+ case 6: b += ((uint32_t)k[5])<<8; /*@fallthrough@*/
+ case 5: b += (uint32_t)k[4]; /*@fallthrough@*/
+ case 4: a += ((uint32_t)k[3])<<24; /*@fallthrough@*/
+ case 3: a += ((uint32_t)k[2])<<16; /*@fallthrough@*/
+ case 2: a += ((uint32_t)k[1])<<8; /*@fallthrough@*/
+ case 1: a += (uint32_t)k[0];
+ break;
+ case 0:
+ goto exit;
+ }
+ }
+
+ _JLU3_FINAL(a,b,c);
+
+exit:
+ return c;
+}
+#endif /* defined(_JLU3_jlu32l) */
+
+#if defined(_JLU3_jlu32lpair)
+/**
+ * jlu32lpair: return 2 32-bit hash values.
+ *
+ * This is identical to jlu32l(), except it returns two 32-bit hash
+ * values instead of just one. This is good enough for hash table
+ * lookup with 2^^64 buckets, or if you want a second hash if you're not
+ * happy with the first, or if you want a probably-unique 64-bit ID for
+ * the key. *pc is better mixed than *pb, so use *pc first. If you want
+ * a 64-bit value do something like "*pc + (((uint64_t)*pb)<<32)".
+ *
+ * @param h the previous hash, or an arbitrary value
+ * @param *key the key, an array of uint8_t values
+ * @param size the size of the key in bytes
+ * @retval *pc, IN: primary initval, OUT: primary hash
+ * *retval *pb IN: secondary initval, OUT: secondary hash
+ */
+void jlu32lpair(const void *key, size_t size, uint32_t *pc, uint32_t *pb)
+{
+ union { const void *ptr; size_t i; } u;
+ uint32_t a = _JLU3_INIT(*pc, size);
+ uint32_t b = a;
+ uint32_t c = a;
+
+ if (key == NULL)
+ goto exit;
+
+ c += *pb; /* Add the secondary hash. */
+
+ u.ptr = key;
+ if (HASH_LITTLE_ENDIAN && ((u.i & 0x3) == 0)) {
+ const uint32_t *k = (const uint32_t *)key; /* read 32-bit chunks */
+#ifdef VALGRIND
+ const uint8_t *k8;
+#endif
+
+ /*-- all but last block: aligned reads and affect 32 bits of (a,b,c) */
+ while (size > (size_t)12) {
+ a += k[0];
+ b += k[1];
+ c += k[2];
+ _JLU3_MIX(a,b,c);
+ size -= 12;
+ k += 3;
+ }
+ /*------------------------- handle the last (probably partial) block */
+ /*
+ * "k[2]&0xffffff" actually reads beyond the end of the string, but
+ * then masks off the part it's not allowed to read. Because the
+ * string is aligned, the masked-off tail is in the same word as the
+ * rest of the string. Every machine with memory protection I've seen
+ * does it on word boundaries, so is OK with this. But VALGRIND will
+ * still catch it and complain. The masking trick does make the hash
+ * noticably faster for short strings (like English words).
+ */
+#ifndef VALGRIND
+
+ switch (size) {
+ case 12: c += k[2]; b+=k[1]; a+=k[0]; break;
+ case 11: c += k[2]&0xffffff; b+=k[1]; a+=k[0]; break;
+ case 10: c += k[2]&0xffff; b+=k[1]; a+=k[0]; break;
+ case 9: c += k[2]&0xff; b+=k[1]; a+=k[0]; break;
+ case 8: b += k[1]; a+=k[0]; break;
+ case 7: b += k[1]&0xffffff; a+=k[0]; break;
+ case 6: b += k[1]&0xffff; a+=k[0]; break;
+ case 5: b += k[1]&0xff; a+=k[0]; break;
+ case 4: a += k[0]; break;
+ case 3: a += k[0]&0xffffff; break;
+ case 2: a += k[0]&0xffff; break;
+ case 1: a += k[0]&0xff; break;
+ case 0: goto exit;
+ }
+
+#else /* make valgrind happy */
+
+ k8 = (const uint8_t *)k;
+ switch (size) {
+ case 12: c += k[2]; b+=k[1]; a+=k[0]; break;
+ case 11: c += ((uint32_t)k8[10])<<16; /*@fallthrough@*/
+ case 10: c += ((uint32_t)k8[9])<<8; /*@fallthrough@*/
+ case 9: c += k8[8]; /*@fallthrough@*/
+ case 8: b += k[1]; a+=k[0]; break;
+ case 7: b += ((uint32_t)k8[6])<<16; /*@fallthrough@*/
+ case 6: b += ((uint32_t)k8[5])<<8; /*@fallthrough@*/
+ case 5: b += k8[4]; /*@fallthrough@*/
+ case 4: a += k[0]; break;
+ case 3: a += ((uint32_t)k8[2])<<16; /*@fallthrough@*/
+ case 2: a += ((uint32_t)k8[1])<<8; /*@fallthrough@*/
+ case 1: a += k8[0]; break;
+ case 0: goto exit;
+ }
+
+#endif /* !valgrind */
+
+ } else if (HASH_LITTLE_ENDIAN && ((u.i & 0x1) == 0)) {
+ const uint16_t *k = (const uint16_t *)key; /* read 16-bit chunks */
+ const uint8_t *k8;
+
+ /*----------- all but last block: aligned reads and different mixing */
+ while (size > (size_t)12) {
+ a += k[0] + (((uint32_t)k[1])<<16);
+ b += k[2] + (((uint32_t)k[3])<<16);
+ c += k[4] + (((uint32_t)k[5])<<16);
+ _JLU3_MIX(a,b,c);
+ size -= 12;
+ k += 6;
+ }
+
+ /*------------------------- handle the last (probably partial) block */
+ k8 = (const uint8_t *)k;
+ switch (size) {
+ case 12:
+ c += k[4]+(((uint32_t)k[5])<<16);
+ b += k[2]+(((uint32_t)k[3])<<16);
+ a += k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 11:
+ c += ((uint32_t)k8[10])<<16;
+ /*@fallthrough@*/
+ case 10:
+ c += k[4];
+ b += k[2]+(((uint32_t)k[3])<<16);
+ a += k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 9:
+ c += k8[8];
+ /*@fallthrough@*/
+ case 8:
+ b += k[2]+(((uint32_t)k[3])<<16);
+ a += k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 7:
+ b += ((uint32_t)k8[6])<<16;
+ /*@fallthrough@*/
+ case 6:
+ b += k[2];
+ a += k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 5:
+ b += k8[4];
+ /*@fallthrough@*/
+ case 4:
+ a += k[0]+(((uint32_t)k[1])<<16);
+ break;
+ case 3:
+ a += ((uint32_t)k8[2])<<16;
+ /*@fallthrough@*/
+ case 2:
+ a += k[0];
+ break;
+ case 1:
+ a += k8[0];
+ break;
+ case 0:
+ goto exit;
+ }
+
+ } else { /* need to read the key one byte at a time */
+ const uint8_t *k = (const uint8_t *)key;
+
+ /*----------- all but the last block: affect some 32 bits of (a,b,c) */
+ while (size > (size_t)12) {
+ a += k[0];
+ a += ((uint32_t)k[1])<<8;
+ a += ((uint32_t)k[2])<<16;
+ a += ((uint32_t)k[3])<<24;
+ b += k[4];
+ b += ((uint32_t)k[5])<<8;
+ b += ((uint32_t)k[6])<<16;
+ b += ((uint32_t)k[7])<<24;
+ c += k[8];
+ c += ((uint32_t)k[9])<<8;
+ c += ((uint32_t)k[10])<<16;
+ c += ((uint32_t)k[11])<<24;
+ _JLU3_MIX(a,b,c);
+ size -= 12;
+ k += 12;
+ }
+
+ /*---------------------------- last block: affect all 32 bits of (c) */
+ switch (size) {
+ case 12: c += ((uint32_t)k[11])<<24; /*@fallthrough@*/
+ case 11: c += ((uint32_t)k[10])<<16; /*@fallthrough@*/
+ case 10: c += ((uint32_t)k[9])<<8; /*@fallthrough@*/
+ case 9: c += k[8]; /*@fallthrough@*/
+ case 8: b += ((uint32_t)k[7])<<24; /*@fallthrough@*/
+ case 7: b += ((uint32_t)k[6])<<16; /*@fallthrough@*/
+ case 6: b += ((uint32_t)k[5])<<8; /*@fallthrough@*/
+ case 5: b += k[4]; /*@fallthrough@*/
+ case 4: a += ((uint32_t)k[3])<<24; /*@fallthrough@*/
+ case 3: a += ((uint32_t)k[2])<<16; /*@fallthrough@*/
+ case 2: a += ((uint32_t)k[1])<<8; /*@fallthrough@*/
+ case 1: a += k[0];
+ break;
+ case 0:
+ goto exit;
+ }
+ }
+
+ _JLU3_FINAL(a,b,c);
+
+exit:
+ *pc = c;
+ *pb = b;
+ return;
+}
+#endif /* defined(_JLU3_jlu32lpair) */
+
+#if defined(_JLU3_jlu32b)
+uint32_t jlu32b(uint32_t h, /*@null@*/ const void *key, size_t size)
+ /*@*/;
+/*
+ * jlu32b():
+ * This is the same as jlu32w() on big-endian machines. It is different
+ * from jlu32l() on all machines. jlu32b() takes advantage of
+ * big-endian byte ordering.
+ *
+ * @param h the previous hash, or an arbitrary value
+ * @param *k the key, an array of uint8_t values
+ * @param size the size of the key
+ * @return the lookup3 hash
+ */
+uint32_t jlu32b(uint32_t h, const void *key, size_t size)
+{
+ union { const void *ptr; size_t i; } u;
+ uint32_t a = _JLU3_INIT(h, size);
+ uint32_t b = a;
+ uint32_t c = a;
+
+ if (key == NULL)
+ return h;
+
+ u.ptr = key;
+ if (HASH_BIG_ENDIAN && ((u.i & 0x3) == 0)) {
+ const uint32_t *k = (const uint32_t *)key; /* read 32-bit chunks */
+#ifdef VALGRIND
+ const uint8_t *k8;
+#endif
+
+ /*-- all but last block: aligned reads and affect 32 bits of (a,b,c) */
+ while (size > 12) {
+ a += k[0];
+ b += k[1];
+ c += k[2];
+ _JLU3_MIX(a,b,c);
+ size -= 12;
+ k += 3;
+ }
+
+ /*------------------------- handle the last (probably partial) block */
+ /*
+ * "k[2]<<8" actually reads beyond the end of the string, but
+ * then shifts out the part it's not allowed to read. Because the
+ * string is aligned, the illegal read is in the same word as the
+ * rest of the string. Every machine with memory protection I've seen
+ * does it on word boundaries, so is OK with this. But VALGRIND will
+ * still catch it and complain. The masking trick does make the hash
+ * noticably faster for short strings (like English words).
+ */
+#ifndef VALGRIND
+
+ switch (size) {
+ case 12: c += k[2]; b+=k[1]; a+=k[0]; break;
+ case 11: c += k[2]&0xffffff00; b+=k[1]; a+=k[0]; break;
+ case 10: c += k[2]&0xffff0000; b+=k[1]; a+=k[0]; break;
+ case 9: c += k[2]&0xff000000; b+=k[1]; a+=k[0]; break;
+ case 8: b += k[1]; a+=k[0]; break;
+ case 7: b += k[1]&0xffffff00; a+=k[0]; break;
+ case 6: b += k[1]&0xffff0000; a+=k[0]; break;
+ case 5: b += k[1]&0xff000000; a+=k[0]; break;
+ case 4: a += k[0]; break;
+ case 3: a += k[0]&0xffffff00; break;
+ case 2: a += k[0]&0xffff0000; break;
+ case 1: a += k[0]&0xff000000; break;
+ case 0: goto exit;
+ }
+
+#else /* make valgrind happy */
+
+ k8 = (const uint8_t *)k;
+ switch (size) { /* all the case statements fall through */
+ case 12: c += k[2]; b+=k[1]; a+=k[0]; break;
+ case 11: c += ((uint32_t)k8[10])<<8; /*@fallthrough@*/
+ case 10: c += ((uint32_t)k8[9])<<16; /*@fallthrough@*/
+ case 9: c += ((uint32_t)k8[8])<<24; /*@fallthrough@*/
+ case 8: b += k[1]; a+=k[0]; break;
+ case 7: b += ((uint32_t)k8[6])<<8; /*@fallthrough@*/
+ case 6: b += ((uint32_t)k8[5])<<16; /*@fallthrough@*/
+ case 5: b += ((uint32_t)k8[4])<<24; /*@fallthrough@*/
+ case 4: a += k[0]; break;
+ case 3: a += ((uint32_t)k8[2])<<8; /*@fallthrough@*/
+ case 2: a += ((uint32_t)k8[1])<<16; /*@fallthrough@*/
+ case 1: a += ((uint32_t)k8[0])<<24; break;
+ case 0: goto exit;
+ }
+
+#endif /* !VALGRIND */
+
+ } else { /* need to read the key one byte at a time */
+ const uint8_t *k = (const uint8_t *)key;
+
+ /*----------- all but the last block: affect some 32 bits of (a,b,c) */
+ while (size > 12) {
+ a += ((uint32_t)k[0])<<24;
+ a += ((uint32_t)k[1])<<16;
+ a += ((uint32_t)k[2])<<8;
+ a += ((uint32_t)k[3]);
+ b += ((uint32_t)k[4])<<24;
+ b += ((uint32_t)k[5])<<16;
+ b += ((uint32_t)k[6])<<8;
+ b += ((uint32_t)k[7]);
+ c += ((uint32_t)k[8])<<24;
+ c += ((uint32_t)k[9])<<16;
+ c += ((uint32_t)k[10])<<8;
+ c += ((uint32_t)k[11]);
+ _JLU3_MIX(a,b,c);
+ size -= 12;
+ k += 12;
+ }
+
+ /*---------------------------- last block: affect all 32 bits of (c) */
+ switch (size) { /* all the case statements fall through */
+ case 12: c += k[11]; /*@fallthrough@*/
+ case 11: c += ((uint32_t)k[10])<<8; /*@fallthrough@*/
+ case 10: c += ((uint32_t)k[9])<<16; /*@fallthrough@*/
+ case 9: c += ((uint32_t)k[8])<<24; /*@fallthrough@*/
+ case 8: b += k[7]; /*@fallthrough@*/
+ case 7: b += ((uint32_t)k[6])<<8; /*@fallthrough@*/
+ case 6: b += ((uint32_t)k[5])<<16; /*@fallthrough@*/
+ case 5: b += ((uint32_t)k[4])<<24; /*@fallthrough@*/
+ case 4: a += k[3]; /*@fallthrough@*/
+ case 3: a += ((uint32_t)k[2])<<8; /*@fallthrough@*/
+ case 2: a += ((uint32_t)k[1])<<16; /*@fallthrough@*/
+ case 1: a += ((uint32_t)k[0])<<24; /*@fallthrough@*/
+ break;
+ case 0:
+ goto exit;
+ }
+ }
+
+ _JLU3_FINAL(a,b,c);
+
+exit:
+ return c;
+}
+#endif /* defined(_JLU3_jlu32b) */
+
+#if defined(_JLU3_SELFTEST)
+
+/* used for timings */
+static void driver1(void)
+ /*@*/
+{
+ uint8_t buf[256];
+ uint32_t i;
+ uint32_t h=0;
+ time_t a,z;
+
+ time(&a);
+ for (i=0; i<256; ++i) buf[i] = 'x';
+ for (i=0; i<1; ++i) {
+ h = jlu32l(h, &buf[0], sizeof(buf[0]));
+ }
+ time(&z);
+ if (z-a > 0) printf("time %d %.8x\n", (int)(z-a), h);
+}
+
+/* check that every input bit changes every output bit half the time */
+#define HASHSTATE 1
+#define HASHLEN 1
+#define MAXPAIR 60
+#define MAXLEN 70
+static void driver2(void)
+ /*@*/
+{
+ uint8_t qa[MAXLEN+1], qb[MAXLEN+2], *a = &qa[0], *b = &qb[1];
+ uint32_t c[HASHSTATE], d[HASHSTATE], i=0, j=0, k, l, m=0, z;
+ uint32_t e[HASHSTATE],f[HASHSTATE],g[HASHSTATE],h[HASHSTATE];
+ uint32_t x[HASHSTATE],y[HASHSTATE];
+ uint32_t hlen;
+
+ printf("No more than %d trials should ever be needed \n",MAXPAIR/2);
+ for (hlen=0; hlen < MAXLEN; ++hlen) {
+ z=0;
+ for (i=0; i<hlen; ++i) { /*-------------- for each input byte, */
+ for (j=0; j<8; ++j) { /*--------------- for each input bit, */
+ for (m=1; m<8; ++m) { /*--- for serveral possible initvals, */
+ for (l=0; l<HASHSTATE; ++l)
+ e[l]=f[l]=g[l]=h[l]=x[l]=y[l]=~((uint32_t)0);
+
+ /* check that every output bit is affected by that input bit */
+ for (k=0; k<MAXPAIR; k+=2) {
+ uint32_t finished=1;
+ /* keys have one bit different */
+ for (l=0; l<hlen+1; ++l) {a[l] = b[l] = (uint8_t)0;}
+ /* have a and b be two keys differing in only one bit */
+ a[i] ^= (k<<j);
+ a[i] ^= (k>>(8-j));
+ c[0] = jlu32l(m, a, hlen);
+ b[i] ^= ((k+1)<<j);
+ b[i] ^= ((k+1)>>(8-j));
+ d[0] = jlu32l(m, b, hlen);
+ /* check every bit is 1, 0, set, and not set at least once */
+ for (l=0; l<HASHSTATE; ++l) {
+ e[l] &= (c[l]^d[l]);
+ f[l] &= ~(c[l]^d[l]);
+ g[l] &= c[l];
+ h[l] &= ~c[l];
+ x[l] &= d[l];
+ y[l] &= ~d[l];
+ if (e[l]|f[l]|g[l]|h[l]|x[l]|y[l]) finished=0;
+ }
+ if (finished) break;
+ }
+ if (k>z) z=k;
+ if (k == MAXPAIR) {
+ printf("Some bit didn't change: ");
+ printf("%.8x %.8x %.8x %.8x %.8x %.8x ",
+ e[0],f[0],g[0],h[0],x[0],y[0]);
+ printf("i %d j %d m %d len %d\n", i, j, m, hlen);
+ }
+ if (z == MAXPAIR) goto done;
+ }
+ }
+ }
+ done:
+ if (z < MAXPAIR) {
+ printf("Mix success %2d bytes %2d initvals ",i,m);
+ printf("required %d trials\n", z/2);
+ }
+ }
+ printf("\n");
+}
+
+/* Check for reading beyond the end of the buffer and alignment problems */
+static void driver3(void)
+ /*@*/
+{
+ uint8_t buf[MAXLEN+20], *b;
+ uint32_t len;
+ uint8_t q[] = "This is the time for all good men to come to the aid of their country...";
+ uint32_t h;
+ uint8_t qq[] = "xThis is the time for all good men to come to the aid of their country...";
+ uint32_t i;
+ uint8_t qqq[] = "xxThis is the time for all good men to come to the aid of their country...";
+ uint32_t j;
+ uint8_t qqqq[] = "xxxThis is the time for all good men to come to the aid of their country...";
+ uint32_t ref,x,y;
+ uint8_t *p;
+ uint32_t m = 13;
+
+ printf("Endianness. These lines should all be the same (for values filled in):\n");
+ printf("%.8x %.8x %.8x\n",
+ jlu32w(m, (const uint32_t *)q, (sizeof(q)-1)/4),
+ jlu32w(m, (const uint32_t *)q, (sizeof(q)-5)/4),
+ jlu32w(m, (const uint32_t *)q, (sizeof(q)-9)/4));
+ p = q;
+ printf("%.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x\n",
+ jlu32l(m, p, sizeof(q)-1), jlu32l(m, p, sizeof(q)-2),
+ jlu32l(m, p, sizeof(q)-3), jlu32l(m, p, sizeof(q)-4),
+ jlu32l(m, p, sizeof(q)-5), jlu32l(m, p, sizeof(q)-6),
+ jlu32l(m, p, sizeof(q)-7), jlu32l(m, p, sizeof(q)-8),
+ jlu32l(m, p, sizeof(q)-9), jlu32l(m, p, sizeof(q)-10),
+ jlu32l(m, p, sizeof(q)-11), jlu32l(m, p, sizeof(q)-12));
+ p = &qq[1];
+ printf("%.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x\n",
+ jlu32l(m, p, sizeof(q)-1), jlu32l(m, p, sizeof(q)-2),
+ jlu32l(m, p, sizeof(q)-3), jlu32l(m, p, sizeof(q)-4),
+ jlu32l(m, p, sizeof(q)-5), jlu32l(m, p, sizeof(q)-6),
+ jlu32l(m, p, sizeof(q)-7), jlu32l(m, p, sizeof(q)-8),
+ jlu32l(m, p, sizeof(q)-9), jlu32l(m, p, sizeof(q)-10),
+ jlu32l(m, p, sizeof(q)-11), jlu32l(m, p, sizeof(q)-12));
+ p = &qqq[2];
+ printf("%.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x\n",
+ jlu32l(m, p, sizeof(q)-1), jlu32l(m, p, sizeof(q)-2),
+ jlu32l(m, p, sizeof(q)-3), jlu32l(m, p, sizeof(q)-4),
+ jlu32l(m, p, sizeof(q)-5), jlu32l(m, p, sizeof(q)-6),
+ jlu32l(m, p, sizeof(q)-7), jlu32l(m, p, sizeof(q)-8),
+ jlu32l(m, p, sizeof(q)-9), jlu32l(m, p, sizeof(q)-10),
+ jlu32l(m, p, sizeof(q)-11), jlu32l(m, p, sizeof(q)-12));
+ p = &qqqq[3];
+ printf("%.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x %.8x\n",
+ jlu32l(m, p, sizeof(q)-1), jlu32l(m, p, sizeof(q)-2),
+ jlu32l(m, p, sizeof(q)-3), jlu32l(m, p, sizeof(q)-4),
+ jlu32l(m, p, sizeof(q)-5), jlu32l(m, p, sizeof(q)-6),
+ jlu32l(m, p, sizeof(q)-7), jlu32l(m, p, sizeof(q)-8),
+ jlu32l(m, p, sizeof(q)-9), jlu32l(m, p, sizeof(q)-10),
+ jlu32l(m, p, sizeof(q)-11), jlu32l(m, p, sizeof(q)-12));
+ printf("\n");
+ for (h=0, b=buf+1; h<8; ++h, ++b) {
+ for (i=0; i<MAXLEN; ++i) {
+ len = i;
+ for (j=0; j<i; ++j)
+ *(b+j)=0;
+
+ /* these should all be equal */
+ m = 1;
+ ref = jlu32l(m, b, len);
+ *(b+i)=(uint8_t)~0;
+ *(b-1)=(uint8_t)~0;
+ x = jlu32l(m, b, len);
+ y = jlu32l(m, b, len);
+ if ((ref != x) || (ref != y))
+ printf("alignment error: %.8x %.8x %.8x %d %d\n",ref,x,y, h, i);
+ }
+ }
+}
+
+/* check for problems with nulls */
+static void driver4(void)
+ /*@*/
+{
+ uint8_t buf[1];
+ uint32_t h;
+ uint32_t i;
+ uint32_t state[HASHSTATE];
+
+ buf[0] = ~0;
+ for (i=0; i<HASHSTATE; ++i)
+ state[i] = 1;
+ printf("These should all be different\n");
+ h = 0;
+ for (i=0; i<8; ++i) {
+ h = jlu32l(h, buf, 0);
+ printf("%2ld 0-byte strings, hash is %.8x\n", (long)i, h);
+ }
+}
+
+
+int main(int argc, char ** argv)
+{
+ driver1(); /* test that the key is hashed: used for timings */
+ driver2(); /* test that whole key is hashed thoroughly */
+ driver3(); /* test that nothing but the key is hashed */
+ driver4(); /* test hashing multiple buffers (all buffers are null) */
+ return 1;
+}
+
+#endif /* _JLU3_SELFTEST */
diff --git a/popt-1.16/ltmain.sh b/popt-1.16/ltmain.sh
new file mode 100755
index 0000000..6939dcc
--- /dev/null
+++ b/popt-1.16/ltmain.sh
@@ -0,0 +1,8406 @@
+# Generated from ltmain.m4sh.
+
+# ltmain.sh (GNU libtool) 2.2.6
+# Written by Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005, 2006, 2007 2008 Free Software Foundation, Inc.
+# This is free software; see the source for copying conditions. There is NO
+# warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
+
+# GNU Libtool is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# As a special exception to the GNU General Public License,
+# if you distribute this file as part of a program or library that
+# is built using GNU Libtool, you may include this file under the
+# same distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with GNU Libtool; see the file COPYING. If not, a copy
+# can be downloaded from http://www.gnu.org/licenses/gpl.html,
+# or obtained by writing to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+# Usage: $progname [OPTION]... [MODE-ARG]...
+#
+# Provide generalized library-building support services.
+#
+# --config show all configuration variables
+# --debug enable verbose shell tracing
+# -n, --dry-run display commands without modifying any files
+# --features display basic configuration information and exit
+# --mode=MODE use operation mode MODE
+# --preserve-dup-deps don't remove duplicate dependency libraries
+# --quiet, --silent don't print informational messages
+# --tag=TAG use configuration variables from tag TAG
+# -v, --verbose print informational messages (default)
+# --version print version information
+# -h, --help print short or long help message
+#
+# MODE must be one of the following:
+#
+# clean remove files from the build directory
+# compile compile a source file into a libtool object
+# execute automatically set library path, then run a program
+# finish complete the installation of libtool libraries
+# install install libraries or executables
+# link create a library or an executable
+# uninstall remove libraries from an installed directory
+#
+# MODE-ARGS vary depending on the MODE.
+# Try `$progname --help --mode=MODE' for a more detailed description of MODE.
+#
+# When reporting a bug, please describe a test case to reproduce it and
+# include the following information:
+#
+# host-triplet: $host
+# shell: $SHELL
+# compiler: $LTCC
+# compiler flags: $LTCFLAGS
+# linker: $LD (gnu? $with_gnu_ld)
+# $progname: (GNU libtool) 2.2.6
+# automake: $automake_version
+# autoconf: $autoconf_version
+#
+# Report bugs to <bug-libtool@gnu.org>.
+
+PROGRAM=ltmain.sh
+PACKAGE=libtool
+VERSION=2.2.6
+TIMESTAMP=""
+package_revision=1.3012
+
+# Be Bourne compatible
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then
+ emulate sh
+ NULLCMD=:
+ # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+ setopt NO_GLOB_SUBST
+else
+ case `(set -o) 2>/dev/null` in *posix*) set -o posix;; esac
+fi
+BIN_SH=xpg4; export BIN_SH # for Tru64
+DUALCASE=1; export DUALCASE # for MKS sh
+
+# NLS nuisances: We save the old values to restore during execute mode.
+# Only set LANG and LC_ALL to C if already set.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+lt_user_locale=
+lt_safe_locale=
+for lt_var in LANG LANGUAGE LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES
+do
+ eval "if test \"\${$lt_var+set}\" = set; then
+ save_$lt_var=\$$lt_var
+ $lt_var=C
+ export $lt_var
+ lt_user_locale=\"$lt_var=\\\$save_\$lt_var; \$lt_user_locale\"
+ lt_safe_locale=\"$lt_var=C; \$lt_safe_locale\"
+ fi"
+done
+
+$lt_unset CDPATH
+
+
+
+
+
+: ${CP="cp -f"}
+: ${ECHO="echo"}
+: ${EGREP="/bin/grep -E"}
+: ${FGREP="/bin/grep -F"}
+: ${GREP="/bin/grep"}
+: ${LN_S="ln -s"}
+: ${MAKE="make"}
+: ${MKDIR="mkdir"}
+: ${MV="mv -f"}
+: ${RM="rm -f"}
+: ${SED="/bin/sed"}
+: ${SHELL="${CONFIG_SHELL-/bin/sh}"}
+: ${Xsed="$SED -e 1s/^X//"}
+
+# Global variables:
+EXIT_SUCCESS=0
+EXIT_FAILURE=1
+EXIT_MISMATCH=63 # $? = 63 is used to indicate version mismatch to missing.
+EXIT_SKIP=77 # $? = 77 is used to indicate a skipped test to automake.
+
+exit_status=$EXIT_SUCCESS
+
+# Make sure IFS has a sensible default
+lt_nl='
+'
+IFS=" $lt_nl"
+
+dirname="s,/[^/]*$,,"
+basename="s,^.*/,,"
+
+# func_dirname_and_basename file append nondir_replacement
+# perform func_basename and func_dirname in a single function
+# call:
+# dirname: Compute the dirname of FILE. If nonempty,
+# add APPEND to the result, otherwise set result
+# to NONDIR_REPLACEMENT.
+# value returned in "$func_dirname_result"
+# basename: Compute filename of FILE.
+# value retuned in "$func_basename_result"
+# Implementation must be kept synchronized with func_dirname
+# and func_basename. For efficiency, we do not delegate to
+# those functions but instead duplicate the functionality here.
+func_dirname_and_basename ()
+{
+ # Extract subdirectory from the argument.
+ func_dirname_result=`$ECHO "X${1}" | $Xsed -e "$dirname"`
+ if test "X$func_dirname_result" = "X${1}"; then
+ func_dirname_result="${3}"
+ else
+ func_dirname_result="$func_dirname_result${2}"
+ fi
+ func_basename_result=`$ECHO "X${1}" | $Xsed -e "$basename"`
+}
+
+# Generated shell functions inserted here.
+
+# Work around backward compatibility issue on IRIX 6.5. On IRIX 6.4+, sh
+# is ksh but when the shell is invoked as "sh" and the current value of
+# the _XPG environment variable is not equal to 1 (one), the special
+# positional parameter $0, within a function call, is the name of the
+# function.
+progpath="$0"
+
+# The name of this program:
+# In the unlikely event $progname began with a '-', it would play havoc with
+# func_echo (imagine progname=-n), so we prepend ./ in that case:
+func_dirname_and_basename "$progpath"
+progname=$func_basename_result
+case $progname in
+ -*) progname=./$progname ;;
+esac
+
+# Make sure we have an absolute path for reexecution:
+case $progpath in
+ [\\/]*|[A-Za-z]:\\*) ;;
+ *[\\/]*)
+ progdir=$func_dirname_result
+ progdir=`cd "$progdir" && pwd`
+ progpath="$progdir/$progname"
+ ;;
+ *)
+ save_IFS="$IFS"
+ IFS=:
+ for progdir in $PATH; do
+ IFS="$save_IFS"
+ test -x "$progdir/$progname" && break
+ done
+ IFS="$save_IFS"
+ test -n "$progdir" || progdir=`pwd`
+ progpath="$progdir/$progname"
+ ;;
+esac
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed="${SED}"' -e 1s/^X//'
+sed_quote_subst='s/\([`"$\\]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\(["`\\]\)/\\\1/g'
+
+# Re-`\' parameter expansions in output of double_quote_subst that were
+# `\'-ed in input to the same. If an odd number of `\' preceded a '$'
+# in input to double_quote_subst, that '$' was protected from expansion.
+# Since each input `\' is now two `\'s, look for any number of runs of
+# four `\'s followed by two `\'s and then a '$'. `\' that '$'.
+bs='\\'
+bs2='\\\\'
+bs4='\\\\\\\\'
+dollar='\$'
+sed_double_backslash="\
+ s/$bs4/&\\
+/g
+ s/^$bs2$dollar/$bs&/
+ s/\\([^$bs]\\)$bs2$dollar/\\1$bs2$bs$dollar/g
+ s/\n//g"
+
+# Standard options:
+opt_dry_run=false
+opt_help=false
+opt_quiet=false
+opt_verbose=false
+opt_warning=:
+
+# func_echo arg...
+# Echo program name prefixed message, along with the current mode
+# name if it has been set yet.
+func_echo ()
+{
+ $ECHO "$progname${mode+: }$mode: $*"
+}
+
+# func_verbose arg...
+# Echo program name prefixed message in verbose mode only.
+func_verbose ()
+{
+ $opt_verbose && func_echo ${1+"$@"}
+
+ # A bug in bash halts the script if the last line of a function
+ # fails when set -e is in force, so we need another command to
+ # work around that:
+ :
+}
+
+# func_error arg...
+# Echo program name prefixed message to standard error.
+func_error ()
+{
+ $ECHO "$progname${mode+: }$mode: "${1+"$@"} 1>&2
+}
+
+# func_warning arg...
+# Echo program name prefixed warning message to standard error.
+func_warning ()
+{
+ $opt_warning && $ECHO "$progname${mode+: }$mode: warning: "${1+"$@"} 1>&2
+
+ # bash bug again:
+ :
+}
+
+# func_fatal_error arg...
+# Echo program name prefixed message to standard error, and exit.
+func_fatal_error ()
+{
+ func_error ${1+"$@"}
+ exit $EXIT_FAILURE
+}
+
+# func_fatal_help arg...
+# Echo program name prefixed message to standard error, followed by
+# a help hint, and exit.
+func_fatal_help ()
+{
+ func_error ${1+"$@"}
+ func_fatal_error "$help"
+}
+help="Try \`$progname --help' for more information." ## default
+
+
+# func_grep expression filename
+# Check whether EXPRESSION matches any line of FILENAME, without output.
+func_grep ()
+{
+ $GREP "$1" "$2" >/dev/null 2>&1
+}
+
+
+# func_mkdir_p directory-path
+# Make sure the entire path to DIRECTORY-PATH is available.
+func_mkdir_p ()
+{
+ my_directory_path="$1"
+ my_dir_list=
+
+ if test -n "$my_directory_path" && test "$opt_dry_run" != ":"; then
+
+ # Protect directory names starting with `-'
+ case $my_directory_path in
+ -*) my_directory_path="./$my_directory_path" ;;
+ esac
+
+ # While some portion of DIR does not yet exist...
+ while test ! -d "$my_directory_path"; do
+ # ...make a list in topmost first order. Use a colon delimited
+ # list incase some portion of path contains whitespace.
+ my_dir_list="$my_directory_path:$my_dir_list"
+
+ # If the last portion added has no slash in it, the list is done
+ case $my_directory_path in */*) ;; *) break ;; esac
+
+ # ...otherwise throw away the child directory and loop
+ my_directory_path=`$ECHO "X$my_directory_path" | $Xsed -e "$dirname"`
+ done
+ my_dir_list=`$ECHO "X$my_dir_list" | $Xsed -e 's,:*$,,'`
+
+ save_mkdir_p_IFS="$IFS"; IFS=':'
+ for my_dir in $my_dir_list; do
+ IFS="$save_mkdir_p_IFS"
+ # mkdir can fail with a `File exist' error if two processes
+ # try to create one of the directories concurrently. Don't
+ # stop in that case!
+ $MKDIR "$my_dir" 2>/dev/null || :
+ done
+ IFS="$save_mkdir_p_IFS"
+
+ # Bail out if we (or some other process) failed to create a directory.
+ test -d "$my_directory_path" || \
+ func_fatal_error "Failed to create \`$1'"
+ fi
+}
+
+
+# func_mktempdir [string]
+# Make a temporary directory that won't clash with other running
+# libtool processes, and avoids race conditions if possible. If
+# given, STRING is the basename for that directory.
+func_mktempdir ()
+{
+ my_template="${TMPDIR-/tmp}/${1-$progname}"
+
+ if test "$opt_dry_run" = ":"; then
+ # Return a directory name, but don't create it in dry-run mode
+ my_tmpdir="${my_template}-$$"
+ else
+
+ # If mktemp works, use that first and foremost
+ my_tmpdir=`mktemp -d "${my_template}-XXXXXXXX" 2>/dev/null`
+
+ if test ! -d "$my_tmpdir"; then
+ # Failing that, at least try and use $RANDOM to avoid a race
+ my_tmpdir="${my_template}-${RANDOM-0}$$"
+
+ save_mktempdir_umask=`umask`
+ umask 0077
+ $MKDIR "$my_tmpdir"
+ umask $save_mktempdir_umask
+ fi
+
+ # If we're not in dry-run mode, bomb out on failure
+ test -d "$my_tmpdir" || \
+ func_fatal_error "cannot create temporary directory \`$my_tmpdir'"
+ fi
+
+ $ECHO "X$my_tmpdir" | $Xsed
+}
+
+
+# func_quote_for_eval arg
+# Aesthetically quote ARG to be evaled later.
+# This function returns two values: FUNC_QUOTE_FOR_EVAL_RESULT
+# is double-quoted, suitable for a subsequent eval, whereas
+# FUNC_QUOTE_FOR_EVAL_UNQUOTED_RESULT has merely all characters
+# which are still active within double quotes backslashified.
+func_quote_for_eval ()
+{
+ case $1 in
+ *[\\\`\"\$]*)
+ func_quote_for_eval_unquoted_result=`$ECHO "X$1" | $Xsed -e "$sed_quote_subst"` ;;
+ *)
+ func_quote_for_eval_unquoted_result="$1" ;;
+ esac
+
+ case $func_quote_for_eval_unquoted_result in
+ # Double-quote args containing shell metacharacters to delay
+ # word splitting, command substitution and and variable
+ # expansion for a subsequent eval.
+ # Many Bourne shells cannot handle close brackets correctly
+ # in scan sets, so we specify it separately.
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ func_quote_for_eval_result="\"$func_quote_for_eval_unquoted_result\""
+ ;;
+ *)
+ func_quote_for_eval_result="$func_quote_for_eval_unquoted_result"
+ esac
+}
+
+
+# func_quote_for_expand arg
+# Aesthetically quote ARG to be evaled later; same as above,
+# but do not quote variable references.
+func_quote_for_expand ()
+{
+ case $1 in
+ *[\\\`\"]*)
+ my_arg=`$ECHO "X$1" | $Xsed \
+ -e "$double_quote_subst" -e "$sed_double_backslash"` ;;
+ *)
+ my_arg="$1" ;;
+ esac
+
+ case $my_arg in
+ # Double-quote args containing shell metacharacters to delay
+ # word splitting and command substitution for a subsequent eval.
+ # Many Bourne shells cannot handle close brackets correctly
+ # in scan sets, so we specify it separately.
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ my_arg="\"$my_arg\""
+ ;;
+ esac
+
+ func_quote_for_expand_result="$my_arg"
+}
+
+
+# func_show_eval cmd [fail_exp]
+# Unless opt_silent is true, then output CMD. Then, if opt_dryrun is
+# not true, evaluate CMD. If the evaluation of CMD fails, and FAIL_EXP
+# is given, then evaluate it.
+func_show_eval ()
+{
+ my_cmd="$1"
+ my_fail_exp="${2-:}"
+
+ ${opt_silent-false} || {
+ func_quote_for_expand "$my_cmd"
+ eval "func_echo $func_quote_for_expand_result"
+ }
+
+ if ${opt_dry_run-false}; then :; else
+ eval "$my_cmd"
+ my_status=$?
+ if test "$my_status" -eq 0; then :; else
+ eval "(exit $my_status); $my_fail_exp"
+ fi
+ fi
+}
+
+
+# func_show_eval_locale cmd [fail_exp]
+# Unless opt_silent is true, then output CMD. Then, if opt_dryrun is
+# not true, evaluate CMD. If the evaluation of CMD fails, and FAIL_EXP
+# is given, then evaluate it. Use the saved locale for evaluation.
+func_show_eval_locale ()
+{
+ my_cmd="$1"
+ my_fail_exp="${2-:}"
+
+ ${opt_silent-false} || {
+ func_quote_for_expand "$my_cmd"
+ eval "func_echo $func_quote_for_expand_result"
+ }
+
+ if ${opt_dry_run-false}; then :; else
+ eval "$lt_user_locale
+ $my_cmd"
+ my_status=$?
+ eval "$lt_safe_locale"
+ if test "$my_status" -eq 0; then :; else
+ eval "(exit $my_status); $my_fail_exp"
+ fi
+ fi
+}
+
+
+
+
+
+# func_version
+# Echo version message to standard output and exit.
+func_version ()
+{
+ $SED -n '/^# '$PROGRAM' (GNU /,/# warranty; / {
+ s/^# //
+ s/^# *$//
+ s/\((C)\)[ 0-9,-]*\( [1-9][0-9]*\)/\1\2/
+ p
+ }' < "$progpath"
+ exit $?
+}
+
+# func_usage
+# Echo short help message to standard output and exit.
+func_usage ()
+{
+ $SED -n '/^# Usage:/,/# -h/ {
+ s/^# //
+ s/^# *$//
+ s/\$progname/'$progname'/
+ p
+ }' < "$progpath"
+ $ECHO
+ $ECHO "run \`$progname --help | more' for full usage"
+ exit $?
+}
+
+# func_help
+# Echo long help message to standard output and exit.
+func_help ()
+{
+ $SED -n '/^# Usage:/,/# Report bugs to/ {
+ s/^# //
+ s/^# *$//
+ s*\$progname*'$progname'*
+ s*\$host*'"$host"'*
+ s*\$SHELL*'"$SHELL"'*
+ s*\$LTCC*'"$LTCC"'*
+ s*\$LTCFLAGS*'"$LTCFLAGS"'*
+ s*\$LD*'"$LD"'*
+ s/\$with_gnu_ld/'"$with_gnu_ld"'/
+ s/\$automake_version/'"`(automake --version) 2>/dev/null |$SED 1q`"'/
+ s/\$autoconf_version/'"`(autoconf --version) 2>/dev/null |$SED 1q`"'/
+ p
+ }' < "$progpath"
+ exit $?
+}
+
+# func_missing_arg argname
+# Echo program name prefixed message to standard error and set global
+# exit_cmd.
+func_missing_arg ()
+{
+ func_error "missing argument for $1"
+ exit_cmd=exit
+}
+
+exit_cmd=:
+
+
+
+
+
+# Check that we have a working $ECHO.
+if test "X$1" = X--no-reexec; then
+ # Discard the --no-reexec flag, and continue.
+ shift
+elif test "X$1" = X--fallback-echo; then
+ # Avoid inline document here, it may be left over
+ :
+elif test "X`{ $ECHO '\t'; } 2>/dev/null`" = 'X\t'; then
+ # Yippee, $ECHO works!
+ :
+else
+ # Restart under the correct shell, and then maybe $ECHO will work.
+ exec $SHELL "$progpath" --no-reexec ${1+"$@"}
+fi
+
+if test "X$1" = X--fallback-echo; then
+ # used as fallback echo
+ shift
+ cat <<EOF
+$*
+EOF
+ exit $EXIT_SUCCESS
+fi
+
+magic="%%%MAGIC variable%%%"
+magic_exe="%%%MAGIC EXE variable%%%"
+
+# Global variables.
+# $mode is unset
+nonopt=
+execute_dlfiles=
+preserve_args=
+lo2o="s/\\.lo\$/.${objext}/"
+o2lo="s/\\.${objext}\$/.lo/"
+extracted_archives=
+extracted_serial=0
+
+opt_dry_run=false
+opt_duplicate_deps=false
+opt_silent=false
+opt_debug=:
+
+# If this variable is set in any of the actions, the command in it
+# will be execed at the end. This prevents here-documents from being
+# left over by shells.
+exec_cmd=
+
+# func_fatal_configuration arg...
+# Echo program name prefixed message to standard error, followed by
+# a configuration failure hint, and exit.
+func_fatal_configuration ()
+{
+ func_error ${1+"$@"}
+ func_error "See the $PACKAGE documentation for more information."
+ func_fatal_error "Fatal configuration error."
+}
+
+
+# func_config
+# Display the configuration for all the tags in this script.
+func_config ()
+{
+ re_begincf='^# ### BEGIN LIBTOOL'
+ re_endcf='^# ### END LIBTOOL'
+
+ # Default configuration.
+ $SED "1,/$re_begincf CONFIG/d;/$re_endcf CONFIG/,\$d" < "$progpath"
+
+ # Now print the configurations for the tags.
+ for tagname in $taglist; do
+ $SED -n "/$re_begincf TAG CONFIG: $tagname\$/,/$re_endcf TAG CONFIG: $tagname\$/p" < "$progpath"
+ done
+
+ exit $?
+}
+
+# func_features
+# Display the features supported by this script.
+func_features ()
+{
+ $ECHO "host: $host"
+ if test "$build_libtool_libs" = yes; then
+ $ECHO "enable shared libraries"
+ else
+ $ECHO "disable shared libraries"
+ fi
+ if test "$build_old_libs" = yes; then
+ $ECHO "enable static libraries"
+ else
+ $ECHO "disable static libraries"
+ fi
+
+ exit $?
+}
+
+# func_enable_tag tagname
+# Verify that TAGNAME is valid, and either flag an error and exit, or
+# enable the TAGNAME tag. We also add TAGNAME to the global $taglist
+# variable here.
+func_enable_tag ()
+{
+ # Global variable:
+ tagname="$1"
+
+ re_begincf="^# ### BEGIN LIBTOOL TAG CONFIG: $tagname\$"
+ re_endcf="^# ### END LIBTOOL TAG CONFIG: $tagname\$"
+ sed_extractcf="/$re_begincf/,/$re_endcf/p"
+
+ # Validate tagname.
+ case $tagname in
+ *[!-_A-Za-z0-9,/]*)
+ func_fatal_error "invalid tag name: $tagname"
+ ;;
+ esac
+
+ # Don't test for the "default" C tag, as we know it's
+ # there but not specially marked.
+ case $tagname in
+ CC) ;;
+ *)
+ if $GREP "$re_begincf" "$progpath" >/dev/null 2>&1; then
+ taglist="$taglist $tagname"
+
+ # Evaluate the configuration. Be careful to quote the path
+ # and the sed script, to avoid splitting on whitespace, but
+ # also don't use non-portable quotes within backquotes within
+ # quotes we have to do it in 2 steps:
+ extractedcf=`$SED -n -e "$sed_extractcf" < "$progpath"`
+ eval "$extractedcf"
+ else
+ func_error "ignoring unknown tag $tagname"
+ fi
+ ;;
+ esac
+}
+
+# Parse options once, thoroughly. This comes as soon as possible in
+# the script to make things like `libtool --version' happen quickly.
+{
+
+ # Shorthand for --mode=foo, only valid as the first argument
+ case $1 in
+ clean|clea|cle|cl)
+ shift; set dummy --mode clean ${1+"$@"}; shift
+ ;;
+ compile|compil|compi|comp|com|co|c)
+ shift; set dummy --mode compile ${1+"$@"}; shift
+ ;;
+ execute|execut|execu|exec|exe|ex|e)
+ shift; set dummy --mode execute ${1+"$@"}; shift
+ ;;
+ finish|finis|fini|fin|fi|f)
+ shift; set dummy --mode finish ${1+"$@"}; shift
+ ;;
+ install|instal|insta|inst|ins|in|i)
+ shift; set dummy --mode install ${1+"$@"}; shift
+ ;;
+ link|lin|li|l)
+ shift; set dummy --mode link ${1+"$@"}; shift
+ ;;
+ uninstall|uninstal|uninsta|uninst|unins|unin|uni|un|u)
+ shift; set dummy --mode uninstall ${1+"$@"}; shift
+ ;;
+ esac
+
+ # Parse non-mode specific arguments:
+ while test "$#" -gt 0; do
+ opt="$1"
+ shift
+
+ case $opt in
+ --config) func_config ;;
+
+ --debug) preserve_args="$preserve_args $opt"
+ func_echo "enabling shell trace mode"
+ opt_debug='set -x'
+ $opt_debug
+ ;;
+
+ -dlopen) test "$#" -eq 0 && func_missing_arg "$opt" && break
+ execute_dlfiles="$execute_dlfiles $1"
+ shift
+ ;;
+
+ --dry-run | -n) opt_dry_run=: ;;
+ --features) func_features ;;
+ --finish) mode="finish" ;;
+
+ --mode) test "$#" -eq 0 && func_missing_arg "$opt" && break
+ case $1 in
+ # Valid mode arguments:
+ clean) ;;
+ compile) ;;
+ execute) ;;
+ finish) ;;
+ install) ;;
+ link) ;;
+ relink) ;;
+ uninstall) ;;
+
+ # Catch anything else as an error
+ *) func_error "invalid argument for $opt"
+ exit_cmd=exit
+ break
+ ;;
+ esac
+
+ mode="$1"
+ shift
+ ;;
+
+ --preserve-dup-deps)
+ opt_duplicate_deps=: ;;
+
+ --quiet|--silent) preserve_args="$preserve_args $opt"
+ opt_silent=:
+ ;;
+
+ --verbose| -v) preserve_args="$preserve_args $opt"
+ opt_silent=false
+ ;;
+
+ --tag) test "$#" -eq 0 && func_missing_arg "$opt" && break
+ preserve_args="$preserve_args $opt $1"
+ func_enable_tag "$1" # tagname is set here
+ shift
+ ;;
+
+ # Separate optargs to long options:
+ -dlopen=*|--mode=*|--tag=*)
+ func_opt_split "$opt"
+ set dummy "$func_opt_split_opt" "$func_opt_split_arg" ${1+"$@"}
+ shift
+ ;;
+
+ -\?|-h) func_usage ;;
+ --help) opt_help=: ;;
+ --version) func_version ;;
+
+ -*) func_fatal_help "unrecognized option \`$opt'" ;;
+
+ *) nonopt="$opt"
+ break
+ ;;
+ esac
+ done
+
+
+ case $host in
+ *cygwin* | *mingw* | *pw32* | *cegcc*)
+ # don't eliminate duplications in $postdeps and $predeps
+ opt_duplicate_compiler_generated_deps=:
+ ;;
+ *)
+ opt_duplicate_compiler_generated_deps=$opt_duplicate_deps
+ ;;
+ esac
+
+ # Having warned about all mis-specified options, bail out if
+ # anything was wrong.
+ $exit_cmd $EXIT_FAILURE
+}
+
+# func_check_version_match
+# Ensure that we are using m4 macros, and libtool script from the same
+# release of libtool.
+func_check_version_match ()
+{
+ if test "$package_revision" != "$macro_revision"; then
+ if test "$VERSION" != "$macro_version"; then
+ if test -z "$macro_version"; then
+ cat >&2 <<_LT_EOF
+$progname: Version mismatch error. This is $PACKAGE $VERSION, but the
+$progname: definition of this LT_INIT comes from an older release.
+$progname: You should recreate aclocal.m4 with macros from $PACKAGE $VERSION
+$progname: and run autoconf again.
+_LT_EOF
+ else
+ cat >&2 <<_LT_EOF
+$progname: Version mismatch error. This is $PACKAGE $VERSION, but the
+$progname: definition of this LT_INIT comes from $PACKAGE $macro_version.
+$progname: You should recreate aclocal.m4 with macros from $PACKAGE $VERSION
+$progname: and run autoconf again.
+_LT_EOF
+ fi
+ else
+ cat >&2 <<_LT_EOF
+$progname: Version mismatch error. This is $PACKAGE $VERSION, revision $package_revision,
+$progname: but the definition of this LT_INIT comes from revision $macro_revision.
+$progname: You should recreate aclocal.m4 with macros from revision $package_revision
+$progname: of $PACKAGE $VERSION and run autoconf again.
+_LT_EOF
+ fi
+
+ exit $EXIT_MISMATCH
+ fi
+}
+
+
+## ----------- ##
+## Main. ##
+## ----------- ##
+
+$opt_help || {
+ # Sanity checks first:
+ func_check_version_match
+
+ if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then
+ func_fatal_configuration "not configured to build any kind of library"
+ fi
+
+ test -z "$mode" && func_fatal_error "error: you must specify a MODE."
+
+
+ # Darwin sucks
+ eval std_shrext=\"$shrext_cmds\"
+
+
+ # Only execute mode is allowed to have -dlopen flags.
+ if test -n "$execute_dlfiles" && test "$mode" != execute; then
+ func_error "unrecognized option \`-dlopen'"
+ $ECHO "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # Change the help message to a mode-specific one.
+ generic_help="$help"
+ help="Try \`$progname --help --mode=$mode' for more information."
+}
+
+
+# func_lalib_p file
+# True iff FILE is a libtool `.la' library or `.lo' object file.
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_lalib_p ()
+{
+ test -f "$1" &&
+ $SED -e 4q "$1" 2>/dev/null \
+ | $GREP "^# Generated by .*$PACKAGE" > /dev/null 2>&1
+}
+
+# func_lalib_unsafe_p file
+# True iff FILE is a libtool `.la' library or `.lo' object file.
+# This function implements the same check as func_lalib_p without
+# resorting to external programs. To this end, it redirects stdin and
+# closes it afterwards, without saving the original file descriptor.
+# As a safety measure, use it only where a negative result would be
+# fatal anyway. Works if `file' does not exist.
+func_lalib_unsafe_p ()
+{
+ lalib_p=no
+ if test -f "$1" && test -r "$1" && exec 5<&0 <"$1"; then
+ for lalib_p_l in 1 2 3 4
+ do
+ read lalib_p_line
+ case "$lalib_p_line" in
+ \#\ Generated\ by\ *$PACKAGE* ) lalib_p=yes; break;;
+ esac
+ done
+ exec 0<&5 5<&-
+ fi
+ test "$lalib_p" = yes
+}
+
+# func_ltwrapper_script_p file
+# True iff FILE is a libtool wrapper script
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_script_p ()
+{
+ func_lalib_p "$1"
+}
+
+# func_ltwrapper_executable_p file
+# True iff FILE is a libtool wrapper executable
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_executable_p ()
+{
+ func_ltwrapper_exec_suffix=
+ case $1 in
+ *.exe) ;;
+ *) func_ltwrapper_exec_suffix=.exe ;;
+ esac
+ $GREP "$magic_exe" "$1$func_ltwrapper_exec_suffix" >/dev/null 2>&1
+}
+
+# func_ltwrapper_scriptname file
+# Assumes file is an ltwrapper_executable
+# uses $file to determine the appropriate filename for a
+# temporary ltwrapper_script.
+func_ltwrapper_scriptname ()
+{
+ func_ltwrapper_scriptname_result=""
+ if func_ltwrapper_executable_p "$1"; then
+ func_dirname_and_basename "$1" "" "."
+ func_stripname '' '.exe' "$func_basename_result"
+ func_ltwrapper_scriptname_result="$func_dirname_result/$objdir/${func_stripname_result}_ltshwrapper"
+ fi
+}
+
+# func_ltwrapper_p file
+# True iff FILE is a libtool wrapper script or wrapper executable
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_p ()
+{
+ func_ltwrapper_script_p "$1" || func_ltwrapper_executable_p "$1"
+}
+
+
+# func_execute_cmds commands fail_cmd
+# Execute tilde-delimited COMMANDS.
+# If FAIL_CMD is given, eval that upon failure.
+# FAIL_CMD may read-access the current command in variable CMD!
+func_execute_cmds ()
+{
+ $opt_debug
+ save_ifs=$IFS; IFS='~'
+ for cmd in $1; do
+ IFS=$save_ifs
+ eval cmd=\"$cmd\"
+ func_show_eval "$cmd" "${2-:}"
+ done
+ IFS=$save_ifs
+}
+
+
+# func_source file
+# Source FILE, adding directory component if necessary.
+# Note that it is not necessary on cygwin/mingw to append a dot to
+# FILE even if both FILE and FILE.exe exist: automatic-append-.exe
+# behavior happens only for exec(3), not for open(2)! Also, sourcing
+# `FILE.' does not work on cygwin managed mounts.
+func_source ()
+{
+ $opt_debug
+ case $1 in
+ */* | *\\*) . "$1" ;;
+ *) . "./$1" ;;
+ esac
+}
+
+
+# func_infer_tag arg
+# Infer tagged configuration to use if any are available and
+# if one wasn't chosen via the "--tag" command line option.
+# Only attempt this if the compiler in the base compile
+# command doesn't match the default compiler.
+# arg is usually of the form 'gcc ...'
+func_infer_tag ()
+{
+ $opt_debug
+ if test -n "$available_tags" && test -z "$tagname"; then
+ CC_quoted=
+ for arg in $CC; do
+ func_quote_for_eval "$arg"
+ CC_quoted="$CC_quoted $func_quote_for_eval_result"
+ done
+ case $@ in
+ # Blanks in the command may have been stripped by the calling shell,
+ # but not from the CC environment variable when configure was run.
+ " $CC "* | "$CC "* | " `$ECHO $CC` "* | "`$ECHO $CC` "* | " $CC_quoted"* | "$CC_quoted "* | " `$ECHO $CC_quoted` "* | "`$ECHO $CC_quoted` "*) ;;
+ # Blanks at the start of $base_compile will cause this to fail
+ # if we don't check for them as well.
+ *)
+ for z in $available_tags; do
+ if $GREP "^# ### BEGIN LIBTOOL TAG CONFIG: $z$" < "$progpath" > /dev/null; then
+ # Evaluate the configuration.
+ eval "`${SED} -n -e '/^# ### BEGIN LIBTOOL TAG CONFIG: '$z'$/,/^# ### END LIBTOOL TAG CONFIG: '$z'$/p' < $progpath`"
+ CC_quoted=
+ for arg in $CC; do
+ # Double-quote args containing other shell metacharacters.
+ func_quote_for_eval "$arg"
+ CC_quoted="$CC_quoted $func_quote_for_eval_result"
+ done
+ case "$@ " in
+ " $CC "* | "$CC "* | " `$ECHO $CC` "* | "`$ECHO $CC` "* | " $CC_quoted"* | "$CC_quoted "* | " `$ECHO $CC_quoted` "* | "`$ECHO $CC_quoted` "*)
+ # The compiler in the base compile command matches
+ # the one in the tagged configuration.
+ # Assume this is the tagged configuration we want.
+ tagname=$z
+ break
+ ;;
+ esac
+ fi
+ done
+ # If $tagname still isn't set, then no tagged configuration
+ # was found and let the user know that the "--tag" command
+ # line option must be used.
+ if test -z "$tagname"; then
+ func_echo "unable to infer tagged configuration"
+ func_fatal_error "specify a tag with \`--tag'"
+# else
+# func_verbose "using $tagname tagged configuration"
+ fi
+ ;;
+ esac
+ fi
+}
+
+
+
+# func_write_libtool_object output_name pic_name nonpic_name
+# Create a libtool object file (analogous to a ".la" file),
+# but don't create it if we're doing a dry run.
+func_write_libtool_object ()
+{
+ write_libobj=${1}
+ if test "$build_libtool_libs" = yes; then
+ write_lobj=\'${2}\'
+ else
+ write_lobj=none
+ fi
+
+ if test "$build_old_libs" = yes; then
+ write_oldobj=\'${3}\'
+ else
+ write_oldobj=none
+ fi
+
+ $opt_dry_run || {
+ cat >${write_libobj}T <<EOF
+# $write_libobj - a libtool object file
+# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION
+#
+# Please DO NOT delete this file!
+# It is necessary for linking the library.
+
+# Name of the PIC object.
+pic_object=$write_lobj
+
+# Name of the non-PIC object
+non_pic_object=$write_oldobj
+
+EOF
+ $MV "${write_libobj}T" "${write_libobj}"
+ }
+}
+
+# func_mode_compile arg...
+func_mode_compile ()
+{
+ $opt_debug
+ # Get the compilation command and the source file.
+ base_compile=
+ srcfile="$nonopt" # always keep a non-empty value in "srcfile"
+ suppress_opt=yes
+ suppress_output=
+ arg_mode=normal
+ libobj=
+ later=
+ pie_flag=
+
+ for arg
+ do
+ case $arg_mode in
+ arg )
+ # do not "continue". Instead, add this to base_compile
+ lastarg="$arg"
+ arg_mode=normal
+ ;;
+
+ target )
+ libobj="$arg"
+ arg_mode=normal
+ continue
+ ;;
+
+ normal )
+ # Accept any command-line options.
+ case $arg in
+ -o)
+ test -n "$libobj" && \
+ func_fatal_error "you cannot specify \`-o' more than once"
+ arg_mode=target
+ continue
+ ;;
+
+ -pie | -fpie | -fPIE)
+ pie_flag="$pie_flag $arg"
+ continue
+ ;;
+
+ -shared | -static | -prefer-pic | -prefer-non-pic)
+ later="$later $arg"
+ continue
+ ;;
+
+ -no-suppress)
+ suppress_opt=no
+ continue
+ ;;
+
+ -Xcompiler)
+ arg_mode=arg # the next one goes into the "base_compile" arg list
+ continue # The current "srcfile" will either be retained or
+ ;; # replaced later. I would guess that would be a bug.
+
+ -Wc,*)
+ func_stripname '-Wc,' '' "$arg"
+ args=$func_stripname_result
+ lastarg=
+ save_ifs="$IFS"; IFS=','
+ for arg in $args; do
+ IFS="$save_ifs"
+ func_quote_for_eval "$arg"
+ lastarg="$lastarg $func_quote_for_eval_result"
+ done
+ IFS="$save_ifs"
+ func_stripname ' ' '' "$lastarg"
+ lastarg=$func_stripname_result
+
+ # Add the arguments to base_compile.
+ base_compile="$base_compile $lastarg"
+ continue
+ ;;
+
+ *)
+ # Accept the current argument as the source file.
+ # The previous "srcfile" becomes the current argument.
+ #
+ lastarg="$srcfile"
+ srcfile="$arg"
+ ;;
+ esac # case $arg
+ ;;
+ esac # case $arg_mode
+
+ # Aesthetically quote the previous argument.
+ func_quote_for_eval "$lastarg"
+ base_compile="$base_compile $func_quote_for_eval_result"
+ done # for arg
+
+ case $arg_mode in
+ arg)
+ func_fatal_error "you must specify an argument for -Xcompile"
+ ;;
+ target)
+ func_fatal_error "you must specify a target with \`-o'"
+ ;;
+ *)
+ # Get the name of the library object.
+ test -z "$libobj" && {
+ func_basename "$srcfile"
+ libobj="$func_basename_result"
+ }
+ ;;
+ esac
+
+ # Recognize several different file suffixes.
+ # If the user specifies -o file.o, it is replaced with file.lo
+ case $libobj in
+ *.[cCFSifmso] | \
+ *.ada | *.adb | *.ads | *.asm | \
+ *.c++ | *.cc | *.ii | *.class | *.cpp | *.cxx | \
+ *.[fF][09]? | *.for | *.java | *.obj | *.sx)
+ func_xform "$libobj"
+ libobj=$func_xform_result
+ ;;
+ esac
+
+ case $libobj in
+ *.lo) func_lo2o "$libobj"; obj=$func_lo2o_result ;;
+ *)
+ func_fatal_error "cannot determine name of library object from \`$libobj'"
+ ;;
+ esac
+
+ func_infer_tag $base_compile
+
+ for arg in $later; do
+ case $arg in
+ -shared)
+ test "$build_libtool_libs" != yes && \
+ func_fatal_configuration "can not build a shared library"
+ build_old_libs=no
+ continue
+ ;;
+
+ -static)
+ build_libtool_libs=no
+ build_old_libs=yes
+ continue
+ ;;
+
+ -prefer-pic)
+ pic_mode=yes
+ continue
+ ;;
+
+ -prefer-non-pic)
+ pic_mode=no
+ continue
+ ;;
+ esac
+ done
+
+ func_quote_for_eval "$libobj"
+ test "X$libobj" != "X$func_quote_for_eval_result" \
+ && $ECHO "X$libobj" | $GREP '[]~#^*{};<>?"'"'"' &()|`$[]' \
+ && func_warning "libobj name \`$libobj' may not contain shell special characters."
+ func_dirname_and_basename "$obj" "/" ""
+ objname="$func_basename_result"
+ xdir="$func_dirname_result"
+ lobj=${xdir}$objdir/$objname
+
+ test -z "$base_compile" && \
+ func_fatal_help "you must specify a compilation command"
+
+ # Delete any leftover library objects.
+ if test "$build_old_libs" = yes; then
+ removelist="$obj $lobj $libobj ${libobj}T"
+ else
+ removelist="$lobj $libobj ${libobj}T"
+ fi
+
+ # On Cygwin there's no "real" PIC flag so we must build both object types
+ case $host_os in
+ cygwin* | mingw* | pw32* | os2* | cegcc*)
+ pic_mode=default
+ ;;
+ esac
+ if test "$pic_mode" = no && test "$deplibs_check_method" != pass_all; then
+ # non-PIC code in shared libraries is not supported
+ pic_mode=default
+ fi
+
+ # Calculate the filename of the output object if compiler does
+ # not support -o with -c
+ if test "$compiler_c_o" = no; then
+ output_obj=`$ECHO "X$srcfile" | $Xsed -e 's%^.*/%%' -e 's%\.[^.]*$%%'`.${objext}
+ lockfile="$output_obj.lock"
+ else
+ output_obj=
+ need_locks=no
+ lockfile=
+ fi
+
+ # Lock this critical section if it is needed
+ # We use this script file to make the link, it avoids creating a new file
+ if test "$need_locks" = yes; then
+ until $opt_dry_run || ln "$progpath" "$lockfile" 2>/dev/null; do
+ func_echo "Waiting for $lockfile to be removed"
+ sleep 2
+ done
+ elif test "$need_locks" = warn; then
+ if test -f "$lockfile"; then
+ $ECHO "\
+*** ERROR, $lockfile exists and contains:
+`cat $lockfile 2>/dev/null`
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together. If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+ $opt_dry_run || $RM $removelist
+ exit $EXIT_FAILURE
+ fi
+ removelist="$removelist $output_obj"
+ $ECHO "$srcfile" > "$lockfile"
+ fi
+
+ $opt_dry_run || $RM $removelist
+ removelist="$removelist $lockfile"
+ trap '$opt_dry_run || $RM $removelist; exit $EXIT_FAILURE' 1 2 15
+
+ if test -n "$fix_srcfile_path"; then
+ eval srcfile=\"$fix_srcfile_path\"
+ fi
+ func_quote_for_eval "$srcfile"
+ qsrcfile=$func_quote_for_eval_result
+
+ # Only build a PIC object if we are building libtool libraries.
+ if test "$build_libtool_libs" = yes; then
+ # Without this assignment, base_compile gets emptied.
+ fbsd_hideous_sh_bug=$base_compile
+
+ if test "$pic_mode" != no; then
+ command="$base_compile $qsrcfile $pic_flag"
+ else
+ # Don't build PIC code
+ command="$base_compile $qsrcfile"
+ fi
+
+ func_mkdir_p "$xdir$objdir"
+
+ if test -z "$output_obj"; then
+ # Place PIC objects in $objdir
+ command="$command -o $lobj"
+ fi
+
+ func_show_eval_locale "$command" \
+ 'test -n "$output_obj" && $RM $removelist; exit $EXIT_FAILURE'
+
+ if test "$need_locks" = warn &&
+ test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then
+ $ECHO "\
+*** ERROR, $lockfile contains:
+`cat $lockfile 2>/dev/null`
+
+but it should contain:
+$srcfile
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together. If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+ $opt_dry_run || $RM $removelist
+ exit $EXIT_FAILURE
+ fi
+
+ # Just move the object if needed, then go on to compile the next one
+ if test -n "$output_obj" && test "X$output_obj" != "X$lobj"; then
+ func_show_eval '$MV "$output_obj" "$lobj"' \
+ 'error=$?; $opt_dry_run || $RM $removelist; exit $error'
+ fi
+
+ # Allow error messages only from the first compilation.
+ if test "$suppress_opt" = yes; then
+ suppress_output=' >/dev/null 2>&1'
+ fi
+ fi
+
+ # Only build a position-dependent object if we build old libraries.
+ if test "$build_old_libs" = yes; then
+ if test "$pic_mode" != yes; then
+ # Don't build PIC code
+ command="$base_compile $qsrcfile$pie_flag"
+ else
+ command="$base_compile $qsrcfile $pic_flag"
+ fi
+ if test "$compiler_c_o" = yes; then
+ command="$command -o $obj"
+ fi
+
+ # Suppress compiler output if we already did a PIC compilation.
+ command="$command$suppress_output"
+ func_show_eval_locale "$command" \
+ '$opt_dry_run || $RM $removelist; exit $EXIT_FAILURE'
+
+ if test "$need_locks" = warn &&
+ test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then
+ $ECHO "\
+*** ERROR, $lockfile contains:
+`cat $lockfile 2>/dev/null`
+
+but it should contain:
+$srcfile
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together. If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+ $opt_dry_run || $RM $removelist
+ exit $EXIT_FAILURE
+ fi
+
+ # Just move the object if needed
+ if test -n "$output_obj" && test "X$output_obj" != "X$obj"; then
+ func_show_eval '$MV "$output_obj" "$obj"' \
+ 'error=$?; $opt_dry_run || $RM $removelist; exit $error'
+ fi
+ fi
+
+ $opt_dry_run || {
+ func_write_libtool_object "$libobj" "$objdir/$objname" "$objname"
+
+ # Unlock the critical section if it was locked
+ if test "$need_locks" != no; then
+ removelist=$lockfile
+ $RM "$lockfile"
+ fi
+ }
+
+ exit $EXIT_SUCCESS
+}
+
+$opt_help || {
+test "$mode" = compile && func_mode_compile ${1+"$@"}
+}
+
+func_mode_help ()
+{
+ # We need to display help for each of the modes.
+ case $mode in
+ "")
+ # Generic help is extracted from the usage comments
+ # at the start of this file.
+ func_help
+ ;;
+
+ clean)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=clean RM [RM-OPTION]... FILE...
+
+Remove files from the build directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, object or program, all the files associated
+with it are deleted. Otherwise, only FILE itself is deleted using RM."
+ ;;
+
+ compile)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE
+
+Compile a source file into a libtool library object.
+
+This mode accepts the following additional options:
+
+ -o OUTPUT-FILE set the output file name to OUTPUT-FILE
+ -no-suppress do not suppress compiler output for multiple passes
+ -prefer-pic try to building PIC objects only
+ -prefer-non-pic try to building non-PIC objects only
+ -shared do not build a \`.o' file suitable for static linking
+ -static only build a \`.o' file suitable for static linking
+
+COMPILE-COMMAND is a command to be used in creating a \`standard' object file
+from the given SOURCEFILE.
+
+The output file name is determined by removing the directory component from
+SOURCEFILE, then substituting the C source code suffix \`.c' with the
+library object suffix, \`.lo'."
+ ;;
+
+ execute)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=execute COMMAND [ARGS]...
+
+Automatically set library path, then run a program.
+
+This mode accepts the following additional options:
+
+ -dlopen FILE add the directory containing FILE to the library path
+
+This mode sets the library path environment variable according to \`-dlopen'
+flags.
+
+If any of the ARGS are libtool executable wrappers, then they are translated
+into their corresponding uninstalled binary, and any of their required library
+directories are added to the library path.
+
+Then, COMMAND is executed, with ARGS as arguments."
+ ;;
+
+ finish)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=finish [LIBDIR]...
+
+Complete the installation of libtool libraries.
+
+Each LIBDIR is a directory that contains libtool libraries.
+
+The commands that this mode executes may require superuser privileges. Use
+the \`--dry-run' option if you just want to see what would be executed."
+ ;;
+
+ install)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=install INSTALL-COMMAND...
+
+Install executables or libraries.
+
+INSTALL-COMMAND is the installation command. The first component should be
+either the \`install' or \`cp' program.
+
+The following components of INSTALL-COMMAND are treated specially:
+
+ -inst-prefix PREFIX-DIR Use PREFIX-DIR as a staging area for installation
+
+The rest of the components are interpreted as arguments to that command (only
+BSD-compatible install options are recognized)."
+ ;;
+
+ link)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=link LINK-COMMAND...
+
+Link object files or libraries together to form another library, or to
+create an executable program.
+
+LINK-COMMAND is a command using the C compiler that you would use to create
+a program from several object files.
+
+The following components of LINK-COMMAND are treated specially:
+
+ -all-static do not do any dynamic linking at all
+ -avoid-version do not add a version suffix if possible
+ -dlopen FILE \`-dlpreopen' FILE if it cannot be dlopened at runtime
+ -dlpreopen FILE link in FILE and add its symbols to lt_preloaded_symbols
+ -export-dynamic allow symbols from OUTPUT-FILE to be resolved with dlsym(3)
+ -export-symbols SYMFILE
+ try to export only the symbols listed in SYMFILE
+ -export-symbols-regex REGEX
+ try to export only the symbols matching REGEX
+ -LLIBDIR search LIBDIR for required installed libraries
+ -lNAME OUTPUT-FILE requires the installed library libNAME
+ -module build a library that can dlopened
+ -no-fast-install disable the fast-install mode
+ -no-install link a not-installable executable
+ -no-undefined declare that a library does not refer to external symbols
+ -o OUTPUT-FILE create OUTPUT-FILE from the specified objects
+ -objectlist FILE Use a list of object files found in FILE to specify objects
+ -precious-files-regex REGEX
+ don't remove output files matching REGEX
+ -release RELEASE specify package release information
+ -rpath LIBDIR the created library will eventually be installed in LIBDIR
+ -R[ ]LIBDIR add LIBDIR to the runtime path of programs and libraries
+ -shared only do dynamic linking of libtool libraries
+ -shrext SUFFIX override the standard shared library file extension
+ -static do not do any dynamic linking of uninstalled libtool libraries
+ -static-libtool-libs
+ do not do any dynamic linking of libtool libraries
+ -version-info CURRENT[:REVISION[:AGE]]
+ specify library version info [each variable defaults to 0]
+ -weak LIBNAME declare that the target provides the LIBNAME interface
+
+All other options (arguments beginning with \`-') are ignored.
+
+Every other argument is treated as a filename. Files ending in \`.la' are
+treated as uninstalled libtool libraries, other files are standard or library
+object files.
+
+If the OUTPUT-FILE ends in \`.la', then a libtool library is created,
+only library objects (\`.lo' files) may be specified, and \`-rpath' is
+required, except when creating a convenience library.
+
+If OUTPUT-FILE ends in \`.a' or \`.lib', then a standard library is created
+using \`ar' and \`ranlib', or on Windows using \`lib'.
+
+If OUTPUT-FILE ends in \`.lo' or \`.${objext}', then a reloadable object file
+is created, otherwise an executable program is created."
+ ;;
+
+ uninstall)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE...
+
+Remove libraries from an installation directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, all the files associated with it are deleted.
+Otherwise, only FILE itself is deleted using RM."
+ ;;
+
+ *)
+ func_fatal_help "invalid operation mode \`$mode'"
+ ;;
+ esac
+
+ $ECHO
+ $ECHO "Try \`$progname --help' for more information about other modes."
+
+ exit $?
+}
+
+ # Now that we've collected a possible --mode arg, show help if necessary
+ $opt_help && func_mode_help
+
+
+# func_mode_execute arg...
+func_mode_execute ()
+{
+ $opt_debug
+ # The first argument is the command name.
+ cmd="$nonopt"
+ test -z "$cmd" && \
+ func_fatal_help "you must specify a COMMAND"
+
+ # Handle -dlopen flags immediately.
+ for file in $execute_dlfiles; do
+ test -f "$file" \
+ || func_fatal_help "\`$file' is not a file"
+
+ dir=
+ case $file in
+ *.la)
+ # Check to see that this really is a libtool archive.
+ func_lalib_unsafe_p "$file" \
+ || func_fatal_help "\`$lib' is not a valid libtool archive"
+
+ # Read the libtool library.
+ dlname=
+ library_names=
+ func_source "$file"
+
+ # Skip this library if it cannot be dlopened.
+ if test -z "$dlname"; then
+ # Warn if it was a shared library.
+ test -n "$library_names" && \
+ func_warning "\`$file' was not linked with \`-export-dynamic'"
+ continue
+ fi
+
+ func_dirname "$file" "" "."
+ dir="$func_dirname_result"
+
+ if test -f "$dir/$objdir/$dlname"; then
+ dir="$dir/$objdir"
+ else
+ if test ! -f "$dir/$dlname"; then
+ func_fatal_error "cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'"
+ fi
+ fi
+ ;;
+
+ *.lo)
+ # Just add the directory containing the .lo file.
+ func_dirname "$file" "" "."
+ dir="$func_dirname_result"
+ ;;
+
+ *)
+ func_warning "\`-dlopen' is ignored for non-libtool libraries and objects"
+ continue
+ ;;
+ esac
+
+ # Get the absolute pathname.
+ absdir=`cd "$dir" && pwd`
+ test -n "$absdir" && dir="$absdir"
+
+ # Now add the directory to shlibpath_var.
+ if eval "test -z \"\$$shlibpath_var\""; then
+ eval "$shlibpath_var=\"\$dir\""
+ else
+ eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\""
+ fi
+ done
+
+ # This variable tells wrapper scripts just to set shlibpath_var
+ # rather than running their programs.
+ libtool_execute_magic="$magic"
+
+ # Check if any of the arguments is a wrapper script.
+ args=
+ for file
+ do
+ case $file in
+ -*) ;;
+ *)
+ # Do a test to see if this is really a libtool program.
+ if func_ltwrapper_script_p "$file"; then
+ func_source "$file"
+ # Transform arg to wrapped name.
+ file="$progdir/$program"
+ elif func_ltwrapper_executable_p "$file"; then
+ func_ltwrapper_scriptname "$file"
+ func_source "$func_ltwrapper_scriptname_result"
+ # Transform arg to wrapped name.
+ file="$progdir/$program"
+ fi
+ ;;
+ esac
+ # Quote arguments (to preserve shell metacharacters).
+ func_quote_for_eval "$file"
+ args="$args $func_quote_for_eval_result"
+ done
+
+ if test "X$opt_dry_run" = Xfalse; then
+ if test -n "$shlibpath_var"; then
+ # Export the shlibpath_var.
+ eval "export $shlibpath_var"
+ fi
+
+ # Restore saved environment variables
+ for lt_var in LANG LANGUAGE LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES
+ do
+ eval "if test \"\${save_$lt_var+set}\" = set; then
+ $lt_var=\$save_$lt_var; export $lt_var
+ else
+ $lt_unset $lt_var
+ fi"
+ done
+
+ # Now prepare to actually exec the command.
+ exec_cmd="\$cmd$args"
+ else
+ # Display what would be done.
+ if test -n "$shlibpath_var"; then
+ eval "\$ECHO \"\$shlibpath_var=\$$shlibpath_var\""
+ $ECHO "export $shlibpath_var"
+ fi
+ $ECHO "$cmd$args"
+ exit $EXIT_SUCCESS
+ fi
+}
+
+test "$mode" = execute && func_mode_execute ${1+"$@"}
+
+
+# func_mode_finish arg...
+func_mode_finish ()
+{
+ $opt_debug
+ libdirs="$nonopt"
+ admincmds=
+
+ if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then
+ for dir
+ do
+ libdirs="$libdirs $dir"
+ done
+
+ for libdir in $libdirs; do
+ if test -n "$finish_cmds"; then
+ # Do each command in the finish commands.
+ func_execute_cmds "$finish_cmds" 'admincmds="$admincmds
+'"$cmd"'"'
+ fi
+ if test -n "$finish_eval"; then
+ # Do the single finish_eval.
+ eval cmds=\"$finish_eval\"
+ $opt_dry_run || eval "$cmds" || admincmds="$admincmds
+ $cmds"
+ fi
+ done
+ fi
+
+ # Exit here if they wanted silent mode.
+ $opt_silent && exit $EXIT_SUCCESS
+
+ $ECHO "X----------------------------------------------------------------------" | $Xsed
+ $ECHO "Libraries have been installed in:"
+ for libdir in $libdirs; do
+ $ECHO " $libdir"
+ done
+ $ECHO
+ $ECHO "If you ever happen to want to link against installed libraries"
+ $ECHO "in a given directory, LIBDIR, you must either use libtool, and"
+ $ECHO "specify the full pathname of the library, or use the \`-LLIBDIR'"
+ $ECHO "flag during linking and do at least one of the following:"
+ if test -n "$shlibpath_var"; then
+ $ECHO " - add LIBDIR to the \`$shlibpath_var' environment variable"
+ $ECHO " during execution"
+ fi
+ if test -n "$runpath_var"; then
+ $ECHO " - add LIBDIR to the \`$runpath_var' environment variable"
+ $ECHO " during linking"
+ fi
+ if test -n "$hardcode_libdir_flag_spec"; then
+ libdir=LIBDIR
+ eval flag=\"$hardcode_libdir_flag_spec\"
+
+ $ECHO " - use the \`$flag' linker flag"
+ fi
+ if test -n "$admincmds"; then
+ $ECHO " - have your system administrator run these commands:$admincmds"
+ fi
+ if test -f /etc/ld.so.conf; then
+ $ECHO " - have your system administrator add LIBDIR to \`/etc/ld.so.conf'"
+ fi
+ $ECHO
+
+ $ECHO "See any operating system documentation about shared libraries for"
+ case $host in
+ solaris2.[6789]|solaris2.1[0-9])
+ $ECHO "more information, such as the ld(1), crle(1) and ld.so(8) manual"
+ $ECHO "pages."
+ ;;
+ *)
+ $ECHO "more information, such as the ld(1) and ld.so(8) manual pages."
+ ;;
+ esac
+ $ECHO "X----------------------------------------------------------------------" | $Xsed
+ exit $EXIT_SUCCESS
+}
+
+test "$mode" = finish && func_mode_finish ${1+"$@"}
+
+
+# func_mode_install arg...
+func_mode_install ()
+{
+ $opt_debug
+ # There may be an optional sh(1) argument at the beginning of
+ # install_prog (especially on Windows NT).
+ if test "$nonopt" = "$SHELL" || test "$nonopt" = /bin/sh ||
+ # Allow the use of GNU shtool's install command.
+ $ECHO "X$nonopt" | $GREP shtool >/dev/null; then
+ # Aesthetically quote it.
+ func_quote_for_eval "$nonopt"
+ install_prog="$func_quote_for_eval_result "
+ arg=$1
+ shift
+ else
+ install_prog=
+ arg=$nonopt
+ fi
+
+ # The real first argument should be the name of the installation program.
+ # Aesthetically quote it.
+ func_quote_for_eval "$arg"
+ install_prog="$install_prog$func_quote_for_eval_result"
+
+ # We need to accept at least all the BSD install flags.
+ dest=
+ files=
+ opts=
+ prev=
+ install_type=
+ isdir=no
+ stripme=
+ for arg
+ do
+ if test -n "$dest"; then
+ files="$files $dest"
+ dest=$arg
+ continue
+ fi
+
+ case $arg in
+ -d) isdir=yes ;;
+ -f)
+ case " $install_prog " in
+ *[\\\ /]cp\ *) ;;
+ *) prev=$arg ;;
+ esac
+ ;;
+ -g | -m | -o)
+ prev=$arg
+ ;;
+ -s)
+ stripme=" -s"
+ continue
+ ;;
+ -*)
+ ;;
+ *)
+ # If the previous option needed an argument, then skip it.
+ if test -n "$prev"; then
+ prev=
+ else
+ dest=$arg
+ continue
+ fi
+ ;;
+ esac
+
+ # Aesthetically quote the argument.
+ func_quote_for_eval "$arg"
+ install_prog="$install_prog $func_quote_for_eval_result"
+ done
+
+ test -z "$install_prog" && \
+ func_fatal_help "you must specify an install program"
+
+ test -n "$prev" && \
+ func_fatal_help "the \`$prev' option requires an argument"
+
+ if test -z "$files"; then
+ if test -z "$dest"; then
+ func_fatal_help "no file or destination specified"
+ else
+ func_fatal_help "you must specify a destination"
+ fi
+ fi
+
+ # Strip any trailing slash from the destination.
+ func_stripname '' '/' "$dest"
+ dest=$func_stripname_result
+
+ # Check to see that the destination is a directory.
+ test -d "$dest" && isdir=yes
+ if test "$isdir" = yes; then
+ destdir="$dest"
+ destname=
+ else
+ func_dirname_and_basename "$dest" "" "."
+ destdir="$func_dirname_result"
+ destname="$func_basename_result"
+
+ # Not a directory, so check to see that there is only one file specified.
+ set dummy $files; shift
+ test "$#" -gt 1 && \
+ func_fatal_help "\`$dest' is not a directory"
+ fi
+ case $destdir in
+ [\\/]* | [A-Za-z]:[\\/]*) ;;
+ *)
+ for file in $files; do
+ case $file in
+ *.lo) ;;
+ *)
+ func_fatal_help "\`$destdir' must be an absolute directory name"
+ ;;
+ esac
+ done
+ ;;
+ esac
+
+ # This variable tells wrapper scripts just to set variables rather
+ # than running their programs.
+ libtool_install_magic="$magic"
+
+ staticlibs=
+ future_libdirs=
+ current_libdirs=
+ for file in $files; do
+
+ # Do each installation.
+ case $file in
+ *.$libext)
+ # Do the static libraries later.
+ staticlibs="$staticlibs $file"
+ ;;
+
+ *.la)
+ # Check to see that this really is a libtool archive.
+ func_lalib_unsafe_p "$file" \
+ || func_fatal_help "\`$file' is not a valid libtool archive"
+
+ library_names=
+ old_library=
+ relink_command=
+ func_source "$file"
+
+ # Add the libdir to current_libdirs if it is the destination.
+ if test "X$destdir" = "X$libdir"; then
+ case "$current_libdirs " in
+ *" $libdir "*) ;;
+ *) current_libdirs="$current_libdirs $libdir" ;;
+ esac
+ else
+ # Note the libdir as a future libdir.
+ case "$future_libdirs " in
+ *" $libdir "*) ;;
+ *) future_libdirs="$future_libdirs $libdir" ;;
+ esac
+ fi
+
+ func_dirname "$file" "/" ""
+ dir="$func_dirname_result"
+ dir="$dir$objdir"
+
+ if test -n "$relink_command"; then
+ # Determine the prefix the user has applied to our future dir.
+ inst_prefix_dir=`$ECHO "X$destdir" | $Xsed -e "s%$libdir\$%%"`
+
+ # Don't allow the user to place us outside of our expected
+ # location b/c this prevents finding dependent libraries that
+ # are installed to the same prefix.
+ # At present, this check doesn't affect windows .dll's that
+ # are installed into $libdir/../bin (currently, that works fine)
+ # but it's something to keep an eye on.
+ test "$inst_prefix_dir" = "$destdir" && \
+ func_fatal_error "error: cannot install \`$file' to a directory not ending in $libdir"
+
+ if test -n "$inst_prefix_dir"; then
+ # Stick the inst_prefix_dir data into the link command.
+ relink_command=`$ECHO "X$relink_command" | $Xsed -e "s%@inst_prefix_dir@%-inst-prefix-dir $inst_prefix_dir%"`
+ else
+ relink_command=`$ECHO "X$relink_command" | $Xsed -e "s%@inst_prefix_dir@%%"`
+ fi
+
+ func_warning "relinking \`$file'"
+ func_show_eval "$relink_command" \
+ 'func_fatal_error "error: relink \`$file'\'' with the above command before installing it"'
+ fi
+
+ # See the names of the shared library.
+ set dummy $library_names; shift
+ if test -n "$1"; then
+ realname="$1"
+ shift
+
+ srcname="$realname"
+ test -n "$relink_command" && srcname="$realname"T
+
+ # Install the shared library and build the symlinks.
+ func_show_eval "$install_prog $dir/$srcname $destdir/$realname" \
+ 'exit $?'
+ tstripme="$stripme"
+ case $host_os in
+ cygwin* | mingw* | pw32* | cegcc*)
+ case $realname in
+ *.dll.a)
+ tstripme=""
+ ;;
+ esac
+ ;;
+ esac
+ if test -n "$tstripme" && test -n "$striplib"; then
+ func_show_eval "$striplib $destdir/$realname" 'exit $?'
+ fi
+
+ if test "$#" -gt 0; then
+ # Delete the old symlinks, and create new ones.
+ # Try `ln -sf' first, because the `ln' binary might depend on
+ # the symlink we replace! Solaris /bin/ln does not understand -f,
+ # so we also need to try rm && ln -s.
+ for linkname
+ do
+ test "$linkname" != "$realname" \
+ && func_show_eval "(cd $destdir && { $LN_S -f $realname $linkname || { $RM $linkname && $LN_S $realname $linkname; }; })"
+ done
+ fi
+
+ # Do each command in the postinstall commands.
+ lib="$destdir/$realname"
+ func_execute_cmds "$postinstall_cmds" 'exit $?'
+ fi
+
+ # Install the pseudo-library for information purposes.
+ func_basename "$file"
+ name="$func_basename_result"
+ instname="$dir/$name"i
+ func_show_eval "$install_prog $instname $destdir/$name" 'exit $?'
+
+ # Maybe install the static library, too.
+ test -n "$old_library" && staticlibs="$staticlibs $dir/$old_library"
+ ;;
+
+ *.lo)
+ # Install (i.e. copy) a libtool object.
+
+ # Figure out destination file name, if it wasn't already specified.
+ if test -n "$destname"; then
+ destfile="$destdir/$destname"
+ else
+ func_basename "$file"
+ destfile="$func_basename_result"
+ destfile="$destdir/$destfile"
+ fi
+
+ # Deduce the name of the destination old-style object file.
+ case $destfile in
+ *.lo)
+ func_lo2o "$destfile"
+ staticdest=$func_lo2o_result
+ ;;
+ *.$objext)
+ staticdest="$destfile"
+ destfile=
+ ;;
+ *)
+ func_fatal_help "cannot copy a libtool object to \`$destfile'"
+ ;;
+ esac
+
+ # Install the libtool object if requested.
+ test -n "$destfile" && \
+ func_show_eval "$install_prog $file $destfile" 'exit $?'
+
+ # Install the old object if enabled.
+ if test "$build_old_libs" = yes; then
+ # Deduce the name of the old-style object file.
+ func_lo2o "$file"
+ staticobj=$func_lo2o_result
+ func_show_eval "$install_prog \$staticobj \$staticdest" 'exit $?'
+ fi
+ exit $EXIT_SUCCESS
+ ;;
+
+ *)
+ # Figure out destination file name, if it wasn't already specified.
+ if test -n "$destname"; then
+ destfile="$destdir/$destname"
+ else
+ func_basename "$file"
+ destfile="$func_basename_result"
+ destfile="$destdir/$destfile"
+ fi
+
+ # If the file is missing, and there is a .exe on the end, strip it
+ # because it is most likely a libtool script we actually want to
+ # install
+ stripped_ext=""
+ case $file in
+ *.exe)
+ if test ! -f "$file"; then
+ func_stripname '' '.exe' "$file"
+ file=$func_stripname_result
+ stripped_ext=".exe"
+ fi
+ ;;
+ esac
+
+ # Do a test to see if this is really a libtool program.
+ case $host in
+ *cygwin* | *mingw*)
+ if func_ltwrapper_executable_p "$file"; then
+ func_ltwrapper_scriptname "$file"
+ wrapper=$func_ltwrapper_scriptname_result
+ else
+ func_stripname '' '.exe' "$file"
+ wrapper=$func_stripname_result
+ fi
+ ;;
+ *)
+ wrapper=$file
+ ;;
+ esac
+ if func_ltwrapper_script_p "$wrapper"; then
+ notinst_deplibs=
+ relink_command=
+
+ func_source "$wrapper"
+
+ # Check the variables that should have been set.
+ test -z "$generated_by_libtool_version" && \
+ func_fatal_error "invalid libtool wrapper script \`$wrapper'"
+
+ finalize=yes
+ for lib in $notinst_deplibs; do
+ # Check to see that each library is installed.
+ libdir=
+ if test -f "$lib"; then
+ func_source "$lib"
+ fi
+ libfile="$libdir/"`$ECHO "X$lib" | $Xsed -e 's%^.*/%%g'` ### testsuite: skip nested quoting test
+ if test -n "$libdir" && test ! -f "$libfile"; then
+ func_warning "\`$lib' has not been installed in \`$libdir'"
+ finalize=no
+ fi
+ done
+
+ relink_command=
+ func_source "$wrapper"
+
+ outputname=
+ if test "$fast_install" = no && test -n "$relink_command"; then
+ $opt_dry_run || {
+ if test "$finalize" = yes; then
+ tmpdir=`func_mktempdir`
+ func_basename "$file$stripped_ext"
+ file="$func_basename_result"
+ outputname="$tmpdir/$file"
+ # Replace the output file specification.
+ relink_command=`$ECHO "X$relink_command" | $Xsed -e 's%@OUTPUT@%'"$outputname"'%g'`
+
+ $opt_silent || {
+ func_quote_for_expand "$relink_command"
+ eval "func_echo $func_quote_for_expand_result"
+ }
+ if eval "$relink_command"; then :
+ else
+ func_error "error: relink \`$file' with the above command before installing it"
+ $opt_dry_run || ${RM}r "$tmpdir"
+ continue
+ fi
+ file="$outputname"
+ else
+ func_warning "cannot relink \`$file'"
+ fi
+ }
+ else
+ # Install the binary that we compiled earlier.
+ file=`$ECHO "X$file$stripped_ext" | $Xsed -e "s%\([^/]*\)$%$objdir/\1%"`
+ fi
+ fi
+
+ # remove .exe since cygwin /usr/bin/install will append another
+ # one anyway
+ case $install_prog,$host in
+ */usr/bin/install*,*cygwin*)
+ case $file:$destfile in
+ *.exe:*.exe)
+ # this is ok
+ ;;
+ *.exe:*)
+ destfile=$destfile.exe
+ ;;
+ *:*.exe)
+ func_stripname '' '.exe' "$destfile"
+ destfile=$func_stripname_result
+ ;;
+ esac
+ ;;
+ esac
+ func_show_eval "$install_prog\$stripme \$file \$destfile" 'exit $?'
+ $opt_dry_run || if test -n "$outputname"; then
+ ${RM}r "$tmpdir"
+ fi
+ ;;
+ esac
+ done
+
+ for file in $staticlibs; do
+ func_basename "$file"
+ name="$func_basename_result"
+
+ # Set up the ranlib parameters.
+ oldlib="$destdir/$name"
+
+ func_show_eval "$install_prog \$file \$oldlib" 'exit $?'
+
+ if test -n "$stripme" && test -n "$old_striplib"; then
+ func_show_eval "$old_striplib $oldlib" 'exit $?'
+ fi
+
+ # Do each command in the postinstall commands.
+ func_execute_cmds "$old_postinstall_cmds" 'exit $?'
+ done
+
+ test -n "$future_libdirs" && \
+ func_warning "remember to run \`$progname --finish$future_libdirs'"
+
+ if test -n "$current_libdirs"; then
+ # Maybe just do a dry run.
+ $opt_dry_run && current_libdirs=" -n$current_libdirs"
+ exec_cmd='$SHELL $progpath $preserve_args --finish$current_libdirs'
+ else
+ exit $EXIT_SUCCESS
+ fi
+}
+
+test "$mode" = install && func_mode_install ${1+"$@"}
+
+
+# func_generate_dlsyms outputname originator pic_p
+# Extract symbols from dlprefiles and create ${outputname}S.o with
+# a dlpreopen symbol table.
+func_generate_dlsyms ()
+{
+ $opt_debug
+ my_outputname="$1"
+ my_originator="$2"
+ my_pic_p="${3-no}"
+ my_prefix=`$ECHO "$my_originator" | sed 's%[^a-zA-Z0-9]%_%g'`
+ my_dlsyms=
+
+ if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+ if test -n "$NM" && test -n "$global_symbol_pipe"; then
+ my_dlsyms="${my_outputname}S.c"
+ else
+ func_error "not configured to extract global symbols from dlpreopened files"
+ fi
+ fi
+
+ if test -n "$my_dlsyms"; then
+ case $my_dlsyms in
+ "") ;;
+ *.c)
+ # Discover the nlist of each of the dlfiles.
+ nlist="$output_objdir/${my_outputname}.nm"
+
+ func_show_eval "$RM $nlist ${nlist}S ${nlist}T"
+
+ # Parse the name list into a source file.
+ func_verbose "creating $output_objdir/$my_dlsyms"
+
+ $opt_dry_run || $ECHO > "$output_objdir/$my_dlsyms" "\
+/* $my_dlsyms - symbol resolution table for \`$my_outputname' dlsym emulation. */
+/* Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION */
+
+#ifdef __cplusplus
+extern \"C\" {
+#endif
+
+/* External symbol declarations for the compiler. */\
+"
+
+ if test "$dlself" = yes; then
+ func_verbose "generating symbol list for \`$output'"
+
+ $opt_dry_run || echo ': @PROGRAM@ ' > "$nlist"
+
+ # Add our own program objects to the symbol list.
+ progfiles=`$ECHO "X$objs$old_deplibs" | $SP2NL | $Xsed -e "$lo2o" | $NL2SP`
+ for progfile in $progfiles; do
+ func_verbose "extracting global C symbols from \`$progfile'"
+ $opt_dry_run || eval "$NM $progfile | $global_symbol_pipe >> '$nlist'"
+ done
+
+ if test -n "$exclude_expsyms"; then
+ $opt_dry_run || {
+ eval '$EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T'
+ eval '$MV "$nlist"T "$nlist"'
+ }
+ fi
+
+ if test -n "$export_symbols_regex"; then
+ $opt_dry_run || {
+ eval '$EGREP -e "$export_symbols_regex" "$nlist" > "$nlist"T'
+ eval '$MV "$nlist"T "$nlist"'
+ }
+ fi
+
+ # Prepare the list of exported symbols
+ if test -z "$export_symbols"; then
+ export_symbols="$output_objdir/$outputname.exp"
+ $opt_dry_run || {
+ $RM $export_symbols
+ eval "${SED} -n -e '/^: @PROGRAM@ $/d' -e 's/^.* \(.*\)$/\1/p' "'< "$nlist" > "$export_symbols"'
+ case $host in
+ *cygwin* | *mingw* | *cegcc* )
+ eval "echo EXPORTS "'> "$output_objdir/$outputname.def"'
+ eval 'cat "$export_symbols" >> "$output_objdir/$outputname.def"'
+ ;;
+ esac
+ }
+ else
+ $opt_dry_run || {
+ eval "${SED} -e 's/\([].[*^$]\)/\\\\\1/g' -e 's/^/ /' -e 's/$/$/'"' < "$export_symbols" > "$output_objdir/$outputname.exp"'
+ eval '$GREP -f "$output_objdir/$outputname.exp" < "$nlist" > "$nlist"T'
+ eval '$MV "$nlist"T "$nlist"'
+ case $host in
+ *cygwin | *mingw* | *cegcc* )
+ eval "echo EXPORTS "'> "$output_objdir/$outputname.def"'
+ eval 'cat "$nlist" >> "$output_objdir/$outputname.def"'
+ ;;
+ esac
+ }
+ fi
+ fi
+
+ for dlprefile in $dlprefiles; do
+ func_verbose "extracting global C symbols from \`$dlprefile'"
+ func_basename "$dlprefile"
+ name="$func_basename_result"
+ $opt_dry_run || {
+ eval '$ECHO ": $name " >> "$nlist"'
+ eval "$NM $dlprefile 2>/dev/null | $global_symbol_pipe >> '$nlist'"
+ }
+ done
+
+ $opt_dry_run || {
+ # Make sure we have at least an empty file.
+ test -f "$nlist" || : > "$nlist"
+
+ if test -n "$exclude_expsyms"; then
+ $EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T
+ $MV "$nlist"T "$nlist"
+ fi
+
+ # Try sorting and uniquifying the output.
+ if $GREP -v "^: " < "$nlist" |
+ if sort -k 3 </dev/null >/dev/null 2>&1; then
+ sort -k 3
+ else
+ sort +2
+ fi |
+ uniq > "$nlist"S; then
+ :
+ else
+ $GREP -v "^: " < "$nlist" > "$nlist"S
+ fi
+
+ if test -f "$nlist"S; then
+ eval "$global_symbol_to_cdecl"' < "$nlist"S >> "$output_objdir/$my_dlsyms"'
+ else
+ $ECHO '/* NONE */' >> "$output_objdir/$my_dlsyms"
+ fi
+
+ $ECHO >> "$output_objdir/$my_dlsyms" "\
+
+/* The mapping between symbol names and symbols. */
+typedef struct {
+ const char *name;
+ void *address;
+} lt_dlsymlist;
+"
+ case $host in
+ *cygwin* | *mingw* | *cegcc* )
+ $ECHO >> "$output_objdir/$my_dlsyms" "\
+/* DATA imports from DLLs on WIN32 con't be const, because
+ runtime relocations are performed -- see ld's documentation
+ on pseudo-relocs. */"
+ lt_dlsym_const= ;;
+ *osf5*)
+ echo >> "$output_objdir/$my_dlsyms" "\
+/* This system does not cope well with relocations in const data */"
+ lt_dlsym_const= ;;
+ *)
+ lt_dlsym_const=const ;;
+ esac
+
+ $ECHO >> "$output_objdir/$my_dlsyms" "\
+extern $lt_dlsym_const lt_dlsymlist
+lt_${my_prefix}_LTX_preloaded_symbols[];
+$lt_dlsym_const lt_dlsymlist
+lt_${my_prefix}_LTX_preloaded_symbols[] =
+{\
+ { \"$my_originator\", (void *) 0 },"
+
+ case $need_lib_prefix in
+ no)
+ eval "$global_symbol_to_c_name_address" < "$nlist" >> "$output_objdir/$my_dlsyms"
+ ;;
+ *)
+ eval "$global_symbol_to_c_name_address_lib_prefix" < "$nlist" >> "$output_objdir/$my_dlsyms"
+ ;;
+ esac
+ $ECHO >> "$output_objdir/$my_dlsyms" "\
+ {0, (void *) 0}
+};
+
+/* This works around a problem in FreeBSD linker */
+#ifdef FREEBSD_WORKAROUND
+static const void *lt_preloaded_setup() {
+ return lt_${my_prefix}_LTX_preloaded_symbols;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif\
+"
+ } # !$opt_dry_run
+
+ pic_flag_for_symtable=
+ case "$compile_command " in
+ *" -static "*) ;;
+ *)
+ case $host in
+ # compiling the symbol table file with pic_flag works around
+ # a FreeBSD bug that causes programs to crash when -lm is
+ # linked before any other PIC object. But we must not use
+ # pic_flag when linking with -static. The problem exists in
+ # FreeBSD 2.2.6 and is fixed in FreeBSD 3.1.
+ *-*-freebsd2*|*-*-freebsd3.0*|*-*-freebsdelf3.0*)
+ pic_flag_for_symtable=" $pic_flag -DFREEBSD_WORKAROUND" ;;
+ *-*-hpux*)
+ pic_flag_for_symtable=" $pic_flag" ;;
+ *)
+ if test "X$my_pic_p" != Xno; then
+ pic_flag_for_symtable=" $pic_flag"
+ fi
+ ;;
+ esac
+ ;;
+ esac
+ symtab_cflags=
+ for arg in $LTCFLAGS; do
+ case $arg in
+ -pie | -fpie | -fPIE) ;;
+ *) symtab_cflags="$symtab_cflags $arg" ;;
+ esac
+ done
+
+ # Now compile the dynamic symbol file.
+ func_show_eval '(cd $output_objdir && $LTCC$symtab_cflags -c$no_builtin_flag$pic_flag_for_symtable "$my_dlsyms")' 'exit $?'
+
+ # Clean up the generated files.
+ func_show_eval '$RM "$output_objdir/$my_dlsyms" "$nlist" "${nlist}S" "${nlist}T"'
+
+ # Transform the symbol file into the correct name.
+ symfileobj="$output_objdir/${my_outputname}S.$objext"
+ case $host in
+ *cygwin* | *mingw* | *cegcc* )
+ if test -f "$output_objdir/$my_outputname.def"; then
+ compile_command=`$ECHO "X$compile_command" | $Xsed -e "s%@SYMFILE@%$output_objdir/$my_outputname.def $symfileobj%"`
+ finalize_command=`$ECHO "X$finalize_command" | $Xsed -e "s%@SYMFILE@%$output_objdir/$my_outputname.def $symfileobj%"`
+ else
+ compile_command=`$ECHO "X$compile_command" | $Xsed -e "s%@SYMFILE@%$symfileobj%"`
+ finalize_command=`$ECHO "X$finalize_command" | $Xsed -e "s%@SYMFILE@%$symfileobj%"`
+ fi
+ ;;
+ *)
+ compile_command=`$ECHO "X$compile_command" | $Xsed -e "s%@SYMFILE@%$symfileobj%"`
+ finalize_command=`$ECHO "X$finalize_command" | $Xsed -e "s%@SYMFILE@%$symfileobj%"`
+ ;;
+ esac
+ ;;
+ *)
+ func_fatal_error "unknown suffix for \`$my_dlsyms'"
+ ;;
+ esac
+ else
+ # We keep going just in case the user didn't refer to
+ # lt_preloaded_symbols. The linker will fail if global_symbol_pipe
+ # really was required.
+
+ # Nullify the symbol file.
+ compile_command=`$ECHO "X$compile_command" | $Xsed -e "s% @SYMFILE@%%"`
+ finalize_command=`$ECHO "X$finalize_command" | $Xsed -e "s% @SYMFILE@%%"`
+ fi
+}
+
+# func_win32_libid arg
+# return the library type of file 'arg'
+#
+# Need a lot of goo to handle *both* DLLs and import libs
+# Has to be a shell function in order to 'eat' the argument
+# that is supplied when $file_magic_command is called.
+func_win32_libid ()
+{
+ $opt_debug
+ win32_libid_type="unknown"
+ win32_fileres=`file -L $1 2>/dev/null`
+ case $win32_fileres in
+ *ar\ archive\ import\ library*) # definitely import
+ win32_libid_type="x86 archive import"
+ ;;
+ *ar\ archive*) # could be an import, or static
+ if eval $OBJDUMP -f $1 | $SED -e '10q' 2>/dev/null |
+ $EGREP 'file format pe-i386(.*architecture: i386)?' >/dev/null ; then
+ win32_nmres=`eval $NM -f posix -A $1 |
+ $SED -n -e '
+ 1,100{
+ / I /{
+ s,.*,import,
+ p
+ q
+ }
+ }'`
+ case $win32_nmres in
+ import*) win32_libid_type="x86 archive import";;
+ *) win32_libid_type="x86 archive static";;
+ esac
+ fi
+ ;;
+ *DLL*)
+ win32_libid_type="x86 DLL"
+ ;;
+ *executable*) # but shell scripts are "executable" too...
+ case $win32_fileres in
+ *MS\ Windows\ PE\ Intel*)
+ win32_libid_type="x86 DLL"
+ ;;
+ esac
+ ;;
+ esac
+ $ECHO "$win32_libid_type"
+}
+
+
+
+# func_extract_an_archive dir oldlib
+func_extract_an_archive ()
+{
+ $opt_debug
+ f_ex_an_ar_dir="$1"; shift
+ f_ex_an_ar_oldlib="$1"
+ func_show_eval "(cd \$f_ex_an_ar_dir && $AR x \"\$f_ex_an_ar_oldlib\")" 'exit $?'
+ if ($AR t "$f_ex_an_ar_oldlib" | sort | sort -uc >/dev/null 2>&1); then
+ :
+ else
+ func_fatal_error "object name conflicts in archive: $f_ex_an_ar_dir/$f_ex_an_ar_oldlib"
+ fi
+}
+
+
+# func_extract_archives gentop oldlib ...
+func_extract_archives ()
+{
+ $opt_debug
+ my_gentop="$1"; shift
+ my_oldlibs=${1+"$@"}
+ my_oldobjs=""
+ my_xlib=""
+ my_xabs=""
+ my_xdir=""
+
+ for my_xlib in $my_oldlibs; do
+ # Extract the objects.
+ case $my_xlib in
+ [\\/]* | [A-Za-z]:[\\/]*) my_xabs="$my_xlib" ;;
+ *) my_xabs=`pwd`"/$my_xlib" ;;
+ esac
+ func_basename "$my_xlib"
+ my_xlib="$func_basename_result"
+ my_xlib_u=$my_xlib
+ while :; do
+ case " $extracted_archives " in
+ *" $my_xlib_u "*)
+ func_arith $extracted_serial + 1
+ extracted_serial=$func_arith_result
+ my_xlib_u=lt$extracted_serial-$my_xlib ;;
+ *) break ;;
+ esac
+ done
+ extracted_archives="$extracted_archives $my_xlib_u"
+ my_xdir="$my_gentop/$my_xlib_u"
+
+ func_mkdir_p "$my_xdir"
+
+ case $host in
+ *-darwin*)
+ func_verbose "Extracting $my_xabs"
+ # Do not bother doing anything if just a dry run
+ $opt_dry_run || {
+ darwin_orig_dir=`pwd`
+ cd $my_xdir || exit $?
+ darwin_archive=$my_xabs
+ darwin_curdir=`pwd`
+ darwin_base_archive=`basename "$darwin_archive"`
+ darwin_arches=`$LIPO -info "$darwin_archive" 2>/dev/null | $GREP Architectures 2>/dev/null || true`
+ if test -n "$darwin_arches"; then
+ darwin_arches=`$ECHO "$darwin_arches" | $SED -e 's/.*are://'`
+ darwin_arch=
+ func_verbose "$darwin_base_archive has multiple architectures $darwin_arches"
+ for darwin_arch in $darwin_arches ; do
+ func_mkdir_p "unfat-$$/${darwin_base_archive}-${darwin_arch}"
+ $LIPO -thin $darwin_arch -output "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}" "${darwin_archive}"
+ cd "unfat-$$/${darwin_base_archive}-${darwin_arch}"
+ func_extract_an_archive "`pwd`" "${darwin_base_archive}"
+ cd "$darwin_curdir"
+ $RM "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}"
+ done # $darwin_arches
+ ## Okay now we've a bunch of thin objects, gotta fatten them up :)
+ darwin_filelist=`find unfat-$$ -type f -name \*.o -print -o -name \*.lo -print | $SED -e "$basename" | sort -u`
+ darwin_file=
+ darwin_files=
+ for darwin_file in $darwin_filelist; do
+ darwin_files=`find unfat-$$ -name $darwin_file -print | $NL2SP`
+ $LIPO -create -output "$darwin_file" $darwin_files
+ done # $darwin_filelist
+ $RM -rf unfat-$$
+ cd "$darwin_orig_dir"
+ else
+ cd $darwin_orig_dir
+ func_extract_an_archive "$my_xdir" "$my_xabs"
+ fi # $darwin_arches
+ } # !$opt_dry_run
+ ;;
+ *)
+ func_extract_an_archive "$my_xdir" "$my_xabs"
+ ;;
+ esac
+ my_oldobjs="$my_oldobjs "`find $my_xdir -name \*.$objext -print -o -name \*.lo -print | $NL2SP`
+ done
+
+ func_extract_archives_result="$my_oldobjs"
+}
+
+
+
+# func_emit_wrapper_part1 [arg=no]
+#
+# Emit the first part of a libtool wrapper script on stdout.
+# For more information, see the description associated with
+# func_emit_wrapper(), below.
+func_emit_wrapper_part1 ()
+{
+ func_emit_wrapper_part1_arg1=no
+ if test -n "$1" ; then
+ func_emit_wrapper_part1_arg1=$1
+ fi
+
+ $ECHO "\
+#! $SHELL
+
+# $output - temporary wrapper script for $objdir/$outputname
+# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION
+#
+# The $output program cannot be directly executed until all the libtool
+# libraries that it depends on are installed.
+#
+# This wrapper script should never be moved out of the build directory.
+# If it is, it will not operate correctly.
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='${SED} -e 1s/^X//'
+sed_quote_subst='$sed_quote_subst'
+
+# Be Bourne compatible
+if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then
+ emulate sh
+ NULLCMD=:
+ # Zsh 3.x and 4.x performs word splitting on \${1+\"\$@\"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '\${1+\"\$@\"}'='\"\$@\"'
+ setopt NO_GLOB_SUBST
+else
+ case \`(set -o) 2>/dev/null\` in *posix*) set -o posix;; esac
+fi
+BIN_SH=xpg4; export BIN_SH # for Tru64
+DUALCASE=1; export DUALCASE # for MKS sh
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+relink_command=\"$relink_command\"
+
+# This environment variable determines our operation mode.
+if test \"\$libtool_install_magic\" = \"$magic\"; then
+ # install mode needs the following variables:
+ generated_by_libtool_version='$macro_version'
+ notinst_deplibs='$notinst_deplibs'
+else
+ # When we are sourced in execute mode, \$file and \$ECHO are already set.
+ if test \"\$libtool_execute_magic\" != \"$magic\"; then
+ ECHO=\"$qecho\"
+ file=\"\$0\"
+ # Make sure echo works.
+ if test \"X\$1\" = X--no-reexec; then
+ # Discard the --no-reexec flag, and continue.
+ shift
+ elif test \"X\`{ \$ECHO '\t'; } 2>/dev/null\`\" = 'X\t'; then
+ # Yippee, \$ECHO works!
+ :
+ else
+ # Restart under the correct shell, and then maybe \$ECHO will work.
+ exec $SHELL \"\$0\" --no-reexec \${1+\"\$@\"}
+ fi
+ fi\
+"
+ $ECHO "\
+
+ # Find the directory that this script lives in.
+ thisdir=\`\$ECHO \"X\$file\" | \$Xsed -e 's%/[^/]*$%%'\`
+ test \"x\$thisdir\" = \"x\$file\" && thisdir=.
+
+ # Follow symbolic links until we get to the real thisdir.
+ file=\`ls -ld \"\$file\" | ${SED} -n 's/.*-> //p'\`
+ while test -n \"\$file\"; do
+ destdir=\`\$ECHO \"X\$file\" | \$Xsed -e 's%/[^/]*\$%%'\`
+
+ # If there was a directory component, then change thisdir.
+ if test \"x\$destdir\" != \"x\$file\"; then
+ case \"\$destdir\" in
+ [\\\\/]* | [A-Za-z]:[\\\\/]*) thisdir=\"\$destdir\" ;;
+ *) thisdir=\"\$thisdir/\$destdir\" ;;
+ esac
+ fi
+
+ file=\`\$ECHO \"X\$file\" | \$Xsed -e 's%^.*/%%'\`
+ file=\`ls -ld \"\$thisdir/\$file\" | ${SED} -n 's/.*-> //p'\`
+ done
+"
+}
+# end: func_emit_wrapper_part1
+
+# func_emit_wrapper_part2 [arg=no]
+#
+# Emit the second part of a libtool wrapper script on stdout.
+# For more information, see the description associated with
+# func_emit_wrapper(), below.
+func_emit_wrapper_part2 ()
+{
+ func_emit_wrapper_part2_arg1=no
+ if test -n "$1" ; then
+ func_emit_wrapper_part2_arg1=$1
+ fi
+
+ $ECHO "\
+
+ # Usually 'no', except on cygwin/mingw when embedded into
+ # the cwrapper.
+ WRAPPER_SCRIPT_BELONGS_IN_OBJDIR=$func_emit_wrapper_part2_arg1
+ if test \"\$WRAPPER_SCRIPT_BELONGS_IN_OBJDIR\" = \"yes\"; then
+ # special case for '.'
+ if test \"\$thisdir\" = \".\"; then
+ thisdir=\`pwd\`
+ fi
+ # remove .libs from thisdir
+ case \"\$thisdir\" in
+ *[\\\\/]$objdir ) thisdir=\`\$ECHO \"X\$thisdir\" | \$Xsed -e 's%[\\\\/][^\\\\/]*$%%'\` ;;
+ $objdir ) thisdir=. ;;
+ esac
+ fi
+
+ # Try to get the absolute directory name.
+ absdir=\`cd \"\$thisdir\" && pwd\`
+ test -n \"\$absdir\" && thisdir=\"\$absdir\"
+"
+
+ if test "$fast_install" = yes; then
+ $ECHO "\
+ program=lt-'$outputname'$exeext
+ progdir=\"\$thisdir/$objdir\"
+
+ if test ! -f \"\$progdir/\$program\" ||
+ { file=\`ls -1dt \"\$progdir/\$program\" \"\$progdir/../\$program\" 2>/dev/null | ${SED} 1q\`; \\
+ test \"X\$file\" != \"X\$progdir/\$program\"; }; then
+
+ file=\"\$\$-\$program\"
+
+ if test ! -d \"\$progdir\"; then
+ $MKDIR \"\$progdir\"
+ else
+ $RM \"\$progdir/\$file\"
+ fi"
+
+ $ECHO "\
+
+ # relink executable if necessary
+ if test -n \"\$relink_command\"; then
+ if relink_command_output=\`eval \$relink_command 2>&1\`; then :
+ else
+ $ECHO \"\$relink_command_output\" >&2
+ $RM \"\$progdir/\$file\"
+ exit 1
+ fi
+ fi
+
+ $MV \"\$progdir/\$file\" \"\$progdir/\$program\" 2>/dev/null ||
+ { $RM \"\$progdir/\$program\";
+ $MV \"\$progdir/\$file\" \"\$progdir/\$program\"; }
+ $RM \"\$progdir/\$file\"
+ fi"
+ else
+ $ECHO "\
+ program='$outputname'
+ progdir=\"\$thisdir/$objdir\"
+"
+ fi
+
+ $ECHO "\
+
+ if test -f \"\$progdir/\$program\"; then"
+
+ # Export our shlibpath_var if we have one.
+ if test "$shlibpath_overrides_runpath" = yes && test -n "$shlibpath_var" && test -n "$temp_rpath"; then
+ $ECHO "\
+ # Add our own library path to $shlibpath_var
+ $shlibpath_var=\"$temp_rpath\$$shlibpath_var\"
+
+ # Some systems cannot cope with colon-terminated $shlibpath_var
+ # The second colon is a workaround for a bug in BeOS R4 sed
+ $shlibpath_var=\`\$ECHO \"X\$$shlibpath_var\" | \$Xsed -e 's/::*\$//'\`
+
+ export $shlibpath_var
+"
+ fi
+
+ # fixup the dll searchpath if we need to.
+ if test -n "$dllsearchpath"; then
+ $ECHO "\
+ # Add the dll search path components to the executable PATH
+ PATH=$dllsearchpath:\$PATH
+"
+ fi
+
+ $ECHO "\
+ if test \"\$libtool_execute_magic\" != \"$magic\"; then
